/* Copyright 2012 Mozilla Foundation and Mozilla contributors * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ /** * This file implements the RIL worker thread. It communicates with * the main thread to provide a high-level API to the phone's RIL * stack, and with the RIL IPC thread to communicate with the RIL * device itself. These communication channels use message events as * known from Web Workers: * * - postMessage()/"message" events for main thread communication * * - postRILMessage()/"RILMessageEvent" events for RIL IPC thread * communication. * * The two main objects in this file represent individual parts of this * communication chain: * * - RILMessageEvent -> Buf -> RIL -> postMessage() -> nsIRadioInterfaceLayer * - nsIRadioInterfaceLayer -> postMessage() -> RIL -> Buf -> postRILMessage() * * Note: The code below is purposely lean on abstractions to be as lean in * terms of object allocations. As a result, it may look more like C than * JavaScript, and that's intended. */ "use strict"; importScripts("ril_consts.js", "systemlibs.js"); importScripts("resource://gre/modules/workers/require.js"); // set to true in ril_consts.js to see debug messages let DEBUG = DEBUG_WORKER; let CLIENT_ID = -1; let GLOBAL = this; if (!this.debug) { // Debugging stub that goes nowhere. this.debug = function debug(message) { dump("RIL Worker[" + CLIENT_ID + "]: " + message + "\n"); }; } const DEFAULT_EMERGENCY_NUMBERS = ["112", "911"]; // Timeout value for emergency callback mode. const EMERGENCY_CB_MODE_TIMEOUT_MS = 300000; // 5 mins = 300000 ms. const ICC_MAX_LINEAR_FIXED_RECORDS = 0xfe; // MMI match groups const MMI_MATCH_GROUP_FULL_MMI = 1; const MMI_MATCH_GROUP_MMI_PROCEDURE = 2; const MMI_MATCH_GROUP_SERVICE_CODE = 3; const MMI_MATCH_GROUP_SIA = 5; const MMI_MATCH_GROUP_SIB = 7; const MMI_MATCH_GROUP_SIC = 9; const MMI_MATCH_GROUP_PWD_CONFIRM = 11; const MMI_MATCH_GROUP_DIALING_NUMBER = 12; const MMI_MAX_LENGTH_SHORT_CODE = 2; const MMI_END_OF_USSD = "#"; let RILQUIRKS_CALLSTATE_EXTRA_UINT32 = libcutils.property_get("ro.moz.ril.callstate_extra_int", "false") === "true"; // This may change at runtime since in RIL v6 and later, we get the version // number via the UNSOLICITED_RIL_CONNECTED parcel. let RILQUIRKS_V5_LEGACY = libcutils.property_get("ro.moz.ril.v5_legacy", "true") === "true"; let RILQUIRKS_REQUEST_USE_DIAL_EMERGENCY_CALL = libcutils.property_get("ro.moz.ril.dial_emergency_call", "false") === "true"; let RILQUIRKS_MODEM_DEFAULTS_TO_EMERGENCY_MODE = libcutils.property_get("ro.moz.ril.emergency_by_default", "false") === "true"; let RILQUIRKS_SIM_APP_STATE_EXTRA_FIELDS = libcutils.property_get("ro.moz.ril.simstate_extra_field", "false") === "true"; // Needed for call-waiting on Peak device let RILQUIRKS_EXTRA_UINT32_2ND_CALL = libcutils.property_get("ro.moz.ril.extra_int_2nd_call", "false") == "true"; // On the emulator we support querying the number of lock retries let RILQUIRKS_HAVE_QUERY_ICC_LOCK_RETRY_COUNT = libcutils.property_get("ro.moz.ril.query_icc_count", "false") == "true"; // Marker object. let PENDING_NETWORK_TYPE = {}; let Buf = { __proto__: (function(){ return require("resource://gre/modules/workers/worker_buf.js").Buf; })(), mToken: 0, mTokenRequestMap: null, init: function init() { this._init(); // This gets incremented each time we send out a parcel. this.mToken = 1; // Maps tokens we send out with requests to the request type, so that // when we get a response parcel back, we know what request it was for. this.mTokenRequestMap = {}; }, /** * Process one parcel. */ processParcel: function processParcel() { let response_type = this.readUint32(); let request_type, options; if (response_type == RESPONSE_TYPE_SOLICITED) { let token = this.readUint32(); let error = this.readUint32(); options = this.mTokenRequestMap[token]; if (!options) { if (DEBUG) { debug("Suspicious uninvited request found: " + token + ". Ignored!"); } return; } delete this.mTokenRequestMap[token]; request_type = options.rilRequestType; options.rilRequestError = error; if (DEBUG) { debug("Solicited response for request type " + request_type + ", token " + token + ", error " + error); } } else if (response_type == RESPONSE_TYPE_UNSOLICITED) { request_type = this.readUint32(); if (DEBUG) debug("Unsolicited response for request type " + request_type); } else { if (DEBUG) debug("Unknown response type: " + response_type); return; } RIL.handleParcel(request_type, this.readAvailable, options); }, /** * Start a new outgoing parcel. * * @param type * Integer specifying the request type. * @param options [optional] * Object containing information about the request, e.g. the * original main thread message object that led to the RIL request. */ newParcel: function newParcel(type, options) { if (DEBUG) debug("New outgoing parcel of type " + type); // We're going to leave room for the parcel size at the beginning. this.outgoingIndex = this.PARCEL_SIZE_SIZE; this.writeUint32(type); this.writeUint32(this.mToken); if (!options) { options = {}; } options.rilRequestType = type; options.rilRequestError = null; this.mTokenRequestMap[this.mToken] = options; this.mToken++; return this.mToken; }, simpleRequest: function simpleRequest(type, options) { this.newParcel(type, options); this.sendParcel(); }, onSendParcel: function onSendParcel(parcel) { postRILMessage(CLIENT_ID, parcel); } }; /** * The RIL state machine. * * This object communicates with rild via parcels and with the main thread * via post messages. It maintains state about the radio, ICC, calls, etc. * and acts upon state changes accordingly. */ let RIL = { /** * Valid calls. */ currentCalls: {}, /** * Existing conference call and its participants. */ currentConference: {state: null, participants: {}}, /** * Existing data calls. */ currentDataCalls: {}, /** * Hash map for received multipart sms fragments. Messages are hashed with * its sender address and concatenation reference number. Three additional * attributes `segmentMaxSeq`, `receivedSegments`, `segments` are inserted. */ _receivedSmsSegmentsMap: {}, /** * Outgoing messages waiting for SMS-STATUS-REPORT. */ _pendingSentSmsMap: {}, /** * Index of the RIL_PREFERRED_NETWORK_TYPE_TO_GECKO. Its value should be * preserved over rild reset. */ preferredNetworkType: null, /** * Global Cell Broadcast switch. */ cellBroadcastDisabled: false, /** * Global CLIR mode settings. */ clirMode: CLIR_DEFAULT, /** * Parsed Cell Broadcast search lists. * cellBroadcastConfigs.MMI should be preserved over rild reset. */ cellBroadcastConfigs: null, mergedCellBroadcastConfig: null, _receivedSmsCbPagesMap: {}, initRILState: function initRILState() { /** * One of the RADIO_STATE_* constants. */ this.radioState = GECKO_RADIOSTATE_UNAVAILABLE; this._isInitialRadioState = true; /** * True if we are on CDMA network. */ this._isCdma = false; /** * True if we are in emergency callback mode. */ this._isInEmergencyCbMode = false; /** * Set when radio is ready but radio tech is unknown. That is, we are * waiting for REQUEST_VOICE_RADIO_TECH */ this._waitingRadioTech = false; /** * ICC status. Keeps a reference of the data response to the * getICCStatus request. */ this.iccStatus = null; /** * Card state */ this.cardState = GECKO_CARDSTATE_UNKNOWN; /** * Strings */ this.IMEI = null; this.IMEISV = null; this.ESN = null; this.MEID = null; this.SMSC = null; /** * ICC information that is not exposed to Gaia. */ this.iccInfoPrivate = {}; /** * ICC information, such as MSISDN, MCC, MNC, SPN...etc. */ this.iccInfo = {}; /** * CDMA specific information. ex. CDMA Network ID, CDMA System ID... etc. */ this.cdmaHome = null; /** * Application identification for apps in ICC. */ this.aid = null; /** * Application type for apps in ICC. */ this.appType = null; this.networkSelectionMode = null; this.voiceRegistrationState = {}; this.dataRegistrationState = {}; /** * List of strings identifying the network operator. */ this.operator = null; /** * String containing the baseband version. */ this.basebandVersion = null; // Clean up this.currentCalls: rild might have restarted. for each (let currentCall in this.currentCalls) { delete this.currentCalls[currentCall.callIndex]; this._handleDisconnectedCall(currentCall); } // Deactivate this.currentDataCalls: rild might have restarted. for each (let datacall in this.currentDataCalls) { this.deactivateDataCall(datacall); } // Don't clean up this._receivedSmsSegmentsMap or this._pendingSentSmsMap // because on rild restart: we may continue with the pending segments. /** * Whether or not the multiple requests in requestNetworkInfo() are currently * being processed */ this._processingNetworkInfo = false; /** * Multiple requestNetworkInfo() in a row before finishing the first * request, hence we need to fire requestNetworkInfo() again after * gathering all necessary stuffs. This is to make sure that ril_worker * gets precise network information. */ this._needRepollNetworkInfo = false; /** * Pending messages to be send in batch from requestNetworkInfo() */ this._pendingNetworkInfo = {rilMessageType: "networkinfochanged"}; /** * Mute or unmute the radio. */ this._muted = true; /** * USSD session flag. * Only one USSD session may exist at a time, and the session is assumed * to exist until: * a) There's a call to cancelUSSD() * b) The implementation sends a UNSOLICITED_ON_USSD with a type code * of "0" (USSD-Notify/no further action) or "2" (session terminated) */ this._ussdSession = null; /** * Regular expresion to parse MMI codes. */ this._mmiRegExp = null; /** * Cell Broadcast Search Lists. */ let cbmmi = this.cellBroadcastConfigs && this.cellBroadcastConfigs.MMI; this.cellBroadcastConfigs = { MMI: cbmmi || null }; this.mergedCellBroadcastConfig = null; }, get muted() { return this._muted; }, set muted(val) { val = Boolean(val); if (this._muted != val) { this.setMute(val); this._muted = val; } }, /** * Parse an integer from a string, falling back to a default value * if the the provided value is not a string or does not contain a valid * number. * * @param string * String to be parsed. * @param defaultValue [optional] * Default value to be used. * @param radix [optional] * A number that represents the numeral system to be used. Default 10. */ parseInt: function RIL_parseInt(string, defaultValue, radix) { let number = parseInt(string, radix || 10); if (!isNaN(number)) { return number; } if (defaultValue === undefined) { defaultValue = null; } return defaultValue; }, /** * Outgoing requests to the RIL. These can be triggered from the * main thread via messages that look like this: * * {rilMessageType: "methodName", * extra: "parameters", * go: "here"} * * So if one of the following methods takes arguments, it takes only one, * an object, which then contains all of the parameters as attributes. * The "@param" documentation is to be interpreted accordingly. */ /** * Retrieve the ICC's status. */ getICCStatus: function getICCStatus() { Buf.simpleRequest(REQUEST_GET_SIM_STATUS); }, /** * Helper function for unlocking ICC locks. */ iccUnlockCardLock: function iccUnlockCardLock(options) { switch (options.lockType) { case GECKO_CARDLOCK_PIN: this.enterICCPIN(options); break; case GECKO_CARDLOCK_PIN2: this.enterICCPIN2(options); break; case GECKO_CARDLOCK_PUK: this.enterICCPUK(options); break; case GECKO_CARDLOCK_PUK2: this.enterICCPUK2(options); break; case GECKO_CARDLOCK_NCK: case GECKO_CARDLOCK_CCK: // Fall through. case GECKO_CARDLOCK_SPCK: { let type = GECKO_PERSO_LOCK_TO_CARD_PERSO_LOCK[options.lockType]; this.enterDepersonalization(type, options.pin, options); break; } case GECKO_CARDLOCK_NCK_PUK: case GECKO_CARDLOCK_CCK_PUK: // Fall through. case GECKO_CARDLOCK_SPCK_PUK: { let type = GECKO_PERSO_LOCK_TO_CARD_PERSO_LOCK[options.lockType]; this.enterDepersonalization(type, options.puk, options); break; } default: options.errorMsg = "Unsupported Card Lock."; options.success = false; this.sendChromeMessage(options); } }, /** * Enter a PIN to unlock the ICC. * * @param pin * String containing the PIN. * @param [optional] aid * AID value. */ enterICCPIN: function enterICCPIN(options) { Buf.newParcel(REQUEST_ENTER_SIM_PIN, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 1 : 2); Buf.writeString(options.pin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Enter a PIN2 to unlock the ICC. * * @param pin * String containing the PIN2. * @param [optional] aid * AID value. */ enterICCPIN2: function enterICCPIN2(options) { Buf.newParcel(REQUEST_ENTER_SIM_PIN2, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 1 : 2); Buf.writeString(options.pin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Requests a network personalization be deactivated. * * @param type * Integer indicating the network personalization be deactivated. * @param password * String containing the password. */ enterDepersonalization: function enterDepersonalization(type, password, options) { Buf.newParcel(REQUEST_ENTER_NETWORK_DEPERSONALIZATION_CODE, options); Buf.writeUint32(type); Buf.writeString(password); Buf.sendParcel(); }, /** * Helper function for changing ICC locks. */ iccSetCardLock: function iccSetCardLock(options) { if (options.newPin !== undefined) { // Change PIN lock. switch (options.lockType) { case GECKO_CARDLOCK_PIN: this.changeICCPIN(options); break; case GECKO_CARDLOCK_PIN2: this.changeICCPIN2(options); break; default: options.errorMsg = "Unsupported Card Lock."; options.success = false; this.sendChromeMessage(options); } } else { // Enable/Disable lock. switch (options.lockType) { case GECKO_CARDLOCK_PIN: options.facility = ICC_CB_FACILITY_SIM; options.password = options.pin; break; case GECKO_CARDLOCK_FDN: options.facility = ICC_CB_FACILITY_FDN; options.password = options.pin2; break; default: options.errorMsg = "Unsupported Card Lock."; options.success = false; this.sendChromeMessage(options); return; } options.enabled = options.enabled; options.serviceClass = ICC_SERVICE_CLASS_VOICE | ICC_SERVICE_CLASS_DATA | ICC_SERVICE_CLASS_FAX; this.setICCFacilityLock(options); } }, /** * Change the current ICC PIN number. * * @param pin * String containing the old PIN value * @param newPin * String containing the new PIN value * @param [optional] aid * AID value. */ changeICCPIN: function changeICCPIN(options) { Buf.newParcel(REQUEST_CHANGE_SIM_PIN, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 2 : 3); Buf.writeString(options.pin); Buf.writeString(options.newPin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Change the current ICC PIN2 number. * * @param pin * String containing the old PIN2 value * @param newPin * String containing the new PIN2 value * @param [optional] aid * AID value. */ changeICCPIN2: function changeICCPIN2(options) { Buf.newParcel(REQUEST_CHANGE_SIM_PIN2, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 2 : 3); Buf.writeString(options.pin); Buf.writeString(options.newPin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Supplies ICC PUK and a new PIN to unlock the ICC. * * @param puk * String containing the PUK value. * @param newPin * String containing the new PIN value. * @param [optional] aid * AID value. */ enterICCPUK: function enterICCPUK(options) { Buf.newParcel(REQUEST_ENTER_SIM_PUK, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 2 : 3); Buf.writeString(options.puk); Buf.writeString(options.newPin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Supplies ICC PUK2 and a new PIN2 to unlock the ICC. * * @param puk * String containing the PUK2 value. * @param newPin * String containing the new PIN2 value. * @param [optional] aid * AID value. */ enterICCPUK2: function enterICCPUK2(options) { Buf.newParcel(REQUEST_ENTER_SIM_PUK2, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 2 : 3); Buf.writeString(options.puk); Buf.writeString(options.newPin); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Helper function for fetching the state of ICC locks. */ iccGetCardLockState: function iccGetCardLockState(options) { switch (options.lockType) { case GECKO_CARDLOCK_PIN: options.facility = ICC_CB_FACILITY_SIM; break; case GECKO_CARDLOCK_FDN: options.facility = ICC_CB_FACILITY_FDN; break; default: options.errorMsg = "Unsupported Card Lock."; options.success = false; this.sendChromeMessage(options); return; } options.password = ""; // For query no need to provide pin. options.serviceClass = ICC_SERVICE_CLASS_VOICE | ICC_SERVICE_CLASS_DATA | ICC_SERVICE_CLASS_FAX; this.queryICCFacilityLock(options); }, /** * Helper function for fetching the number of unlock retries of ICC locks. * * We only query the retry count when we're on the emulator. The phones do * not support the request id and their rild doesn't return an error. */ iccGetCardLockRetryCount: function iccGetCardLockRetryCount(options) { var selCode = { pin: ICC_SEL_CODE_SIM_PIN, puk: ICC_SEL_CODE_SIM_PUK, pin2: ICC_SEL_CODE_SIM_PIN2, puk2: ICC_SEL_CODE_SIM_PUK2, nck: ICC_SEL_CODE_PH_NET_PIN, cck: ICC_SEL_CODE_PH_CORP_PIN, spck: ICC_SEL_CODE_PH_SP_PIN }; if (typeof(selCode[options.lockType]) === 'undefined') { /* unknown lock type */ options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; options.success = false; this.sendChromeMessage(options); return; } if (RILQUIRKS_HAVE_QUERY_ICC_LOCK_RETRY_COUNT) { /* Only the emulator supports this request, ... */ options.selCode = selCode[options.lockType]; this.queryICCLockRetryCount(options); } else { /* ... while the phones do not. */ options.errorMsg = GECKO_ERROR_REQUEST_NOT_SUPPORTED; options.success = false; this.sendChromeMessage(options); } }, /** * Query ICC lock retry count. * * @param selCode * One of ICC_SEL_CODE_*. * @param serviceClass * One of ICC_SERVICE_CLASS_*. */ queryICCLockRetryCount: function queryICCLockRetryCount(options) { Buf.newParcel(REQUEST_GET_UNLOCK_RETRY_COUNT, options); Buf.writeUint32(1); Buf.writeString(options.selCode); Buf.sendParcel(); }, /** * Query ICC facility lock. * * @param facility * One of ICC_CB_FACILITY_*. * @param password * Password for the facility, or "" if not required. * @param serviceClass * One of ICC_SERVICE_CLASS_*. * @param [optional] aid * AID value. */ queryICCFacilityLock: function queryICCFacilityLock(options) { Buf.newParcel(REQUEST_QUERY_FACILITY_LOCK, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 3 : 4); Buf.writeString(options.facility); Buf.writeString(options.password); Buf.writeString(options.serviceClass.toString()); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Set ICC facility lock. * * @param facility * One of ICC_CB_FACILITY_*. * @param enabled * true to enable, false to disable. * @param password * Password for the facility, or "" if not required. * @param serviceClass * One of ICC_SERVICE_CLASS_*. * @param [optional] aid * AID value. */ setICCFacilityLock: function setICCFacilityLock(options) { Buf.newParcel(REQUEST_SET_FACILITY_LOCK, options); Buf.writeUint32(RILQUIRKS_V5_LEGACY ? 4 : 5); Buf.writeString(options.facility); Buf.writeString(options.enabled ? "1" : "0"); Buf.writeString(options.password); Buf.writeString(options.serviceClass.toString()); if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Request an ICC I/O operation. * * See TS 27.007 "restricted SIM" operation, "AT Command +CRSM". * The sequence is in the same order as how libril reads this parcel, * see the struct RIL_SIM_IO_v5 or RIL_SIM_IO_v6 defined in ril.h * * @param command * The I/O command, one of the ICC_COMMAND_* constants. * @param fileId * The file to operate on, one of the ICC_EF_* constants. * @param pathId * String type, check the 'pathid' parameter from TS 27.007 +CRSM. * @param p1, p2, p3 * Arbitrary integer parameters for the command. * @param [optional] dataWriter * The function for writing string parameter for the ICC_COMMAND_UPDATE_RECORD. * @param [optional] pin2 * String containing the PIN2. * @param [optional] aid * AID value. */ iccIO: function iccIO(options) { Buf.newParcel(REQUEST_SIM_IO, options); Buf.writeUint32(options.command); Buf.writeUint32(options.fileId); Buf.writeString(options.pathId); Buf.writeUint32(options.p1); Buf.writeUint32(options.p2); Buf.writeUint32(options.p3); // Write data. if (options.command == ICC_COMMAND_UPDATE_RECORD && options.dataWriter) { options.dataWriter(options.p3); } else { Buf.writeString(null); } // Write pin2. if (options.command == ICC_COMMAND_UPDATE_RECORD && options.pin2) { Buf.writeString(options.pin2); } else { Buf.writeString(null); } if (!RILQUIRKS_V5_LEGACY) { Buf.writeString(options.aid || this.aid); } Buf.sendParcel(); }, /** * Get IMSI. * * @param [optional] aid * AID value. */ getIMSI: function getIMSI(aid) { if (RILQUIRKS_V5_LEGACY) { Buf.simpleRequest(REQUEST_GET_IMSI); return; } Buf.newParcel(REQUEST_GET_IMSI); Buf.writeUint32(1); Buf.writeString(aid || this.aid); Buf.sendParcel(); }, /** * Read UICC Phonebook contacts. * * @param contactType * "adn" or "fdn". * @param requestId * Request id from RadioInterfaceLayer. */ readICCContacts: function readICCContacts(options) { if (!this.appType) { options.errorMsg = GECKO_ERROR_REQUEST_NOT_SUPPORTED; this.sendChromeMessage(options); return; } ICCContactHelper.readICCContacts( this.appType, options.contactType, function onsuccess(contacts) { // Reuse 'options' to get 'requestId' and 'contactType'. options.contacts = contacts; options.iccid = RIL.iccInfo.iccid; RIL.sendChromeMessage(options); }.bind(this), function onerror(errorMsg) { options.errorMsg = errorMsg; RIL.sendChromeMessage(options); }.bind(this)); }, /** * Update UICC Phonebook. * * @param contactType "adn" or "fdn". * @param contact The contact will be updated. * @param pin2 PIN2 is required for updating FDN. * @param requestId Request id from RadioInterfaceLayer. */ updateICCContact: function updateICCContact(options) { let onsuccess = function onsuccess() { // Reuse 'options' to get 'requestId' and 'contactType'. RIL.sendChromeMessage(options); }.bind(this); let onerror = function onerror(errorMsg) { options.errorMsg = errorMsg; RIL.sendChromeMessage(options); }.bind(this); if (!this.appType || !options.contact) { onerror(GECKO_ERROR_REQUEST_NOT_SUPPORTED); return; } let contact = options.contact; let iccid = RIL.iccInfo.iccid; if (contact.id.startsWith(iccid)) { contact.recordId = contact.id.substring(iccid.length); } if (DEBUG) { debug("Update ICC Contact " + JSON.stringify(contact)); } // If contact has 'recordId' property, updates corresponding record. // If not, inserts the contact into a free record. if (options.contact.recordId) { ICCContactHelper.updateICCContact( this.appType, options.contactType, options.contact, options.pin2, onsuccess, onerror); } else { ICCContactHelper.addICCContact( this.appType, options.contactType, options.contact, options.pin2, onsuccess, onerror); } }, /** * Request the phone's radio power to be switched on or off. * * @param on * Boolean indicating the desired power state. */ setRadioPower: function setRadioPower(options) { Buf.newParcel(REQUEST_RADIO_POWER, options); Buf.writeUint32(1); Buf.writeUint32(options.on ? 1 : 0); Buf.sendParcel(); }, /** * Query call waiting status via MMI. */ _handleQueryMMICallWaiting: function _handleQueryMMICallWaiting(options) { function callback(options) { options.length = Buf.readUint32(); options.enabled = (Buf.readUint32() === 1); let services = Buf.readUint32(); if (options.enabled) { options.statusMessage = MMI_SM_KS_SERVICE_ENABLED_FOR; let serviceClass = []; for (let serviceClassMask = 1; serviceClassMask <= ICC_SERVICE_CLASS_MAX; serviceClassMask <<= 1) { if ((serviceClassMask & services) !== 0) { serviceClass.push(MMI_KS_SERVICE_CLASS_MAPPING[serviceClassMask]); } } options.additionalInformation = serviceClass; } else { options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; } // Prevent DataCloneError when sending chrome messages. delete options.callback; this.sendChromeMessage(options); } options.callback = callback; this.queryCallWaiting(options); }, /** * Set call waiting status via MMI. */ _handleSetMMICallWaiting: function _handleSetMMICallWaiting(options) { function callback(options) { if (options.enabled) { options.statusMessage = MMI_SM_KS_SERVICE_ENABLED; } else { options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; } // Prevent DataCloneError when sending chrome messages. delete options.callback; this.sendChromeMessage(options); } options.callback = callback; this.setCallWaiting(options); }, /** * Query call waiting status. * */ queryCallWaiting: function queryCallWaiting(options) { Buf.newParcel(REQUEST_QUERY_CALL_WAITING, options); Buf.writeUint32(1); // As per 3GPP TS 24.083, section 1.6 UE doesn't need to send service // class parameter in call waiting interrogation to network Buf.writeUint32(ICC_SERVICE_CLASS_NONE); Buf.sendParcel(); }, /** * Set call waiting status. * * @param on * Boolean indicating the desired waiting status. */ setCallWaiting: function setCallWaiting(options) { Buf.newParcel(REQUEST_SET_CALL_WAITING, options); Buf.writeUint32(2); Buf.writeUint32(options.enabled ? 1 : 0); Buf.writeUint32(options.serviceClass !== undefined ? options.serviceClass : ICC_SERVICE_CLASS_VOICE); Buf.sendParcel(); }, /** * Queries current CLIP status. * * (MMI request for code "*#30#") * */ queryCLIP: function queryCLIP(options) { Buf.simpleRequest(REQUEST_QUERY_CLIP, options); }, /** * Queries current CLIR status. * */ getCLIR: function getCLIR(options) { Buf.simpleRequest(REQUEST_GET_CLIR, options); }, /** * Returns when to hide or show the caller id in the call. * * @param mmi * The MMI code. * @return One of the CLIR_* constants. */ _getCLIRMode: function _getCLIRMode(mmi) { if (!mmi || (mmi.serviceCode != MMI_SC_CLIR) || (mmi.procedure != MMI_PROCEDURE_ACTIVATION && mmi.procedure != MMI_PROCEDURE_DEACTIVATION)) { return CLIR_DEFAULT; } return mmi.procedure == MMI_PROCEDURE_ACTIVATION ? CLIR_INVOCATION : CLIR_SUPPRESSION; }, /** * Enables or disables the presentation of the calling line identity (CLI) to * the called party when originating a call. * * @param options.clirMode * Is one of the CLIR_* constants in * nsIDOMMozMobileConnection interface. */ setCLIR: function setCLIR(options) { if (options) { this.clirMode = options.clirMode; } Buf.newParcel(REQUEST_SET_CLIR, options); Buf.writeUint32(1); Buf.writeUint32(this.clirMode); Buf.sendParcel(); }, /** * Set screen state. * * @param on * Boolean indicating whether the screen should be on or off. */ setScreenState: function setScreenState(on) { Buf.newParcel(REQUEST_SCREEN_STATE); Buf.writeUint32(1); Buf.writeUint32(on ? 1 : 0); Buf.sendParcel(); }, getVoiceRegistrationState: function getVoiceRegistrationState() { Buf.simpleRequest(REQUEST_VOICE_REGISTRATION_STATE); }, getVoiceRadioTechnology: function getVoiceRadioTechnology() { Buf.simpleRequest(REQUEST_VOICE_RADIO_TECH); }, getDataRegistrationState: function getDataRegistrationState() { Buf.simpleRequest(REQUEST_DATA_REGISTRATION_STATE); }, getOperator: function getOperator() { Buf.simpleRequest(REQUEST_OPERATOR); }, /** * Set the preferred network type. * * @param options An object contains a valid index of * RIL_PREFERRED_NETWORK_TYPE_TO_GECKO as its `networkType` * attribute, or undefined to set current preferred network * type. */ setPreferredNetworkType: function setPreferredNetworkType(options) { if (options) { this.preferredNetworkType = options.networkType; } if (this.preferredNetworkType == null) { return; } Buf.newParcel(REQUEST_SET_PREFERRED_NETWORK_TYPE, options); Buf.writeUint32(1); Buf.writeUint32(this.preferredNetworkType); Buf.sendParcel(); }, /** * Get the preferred network type. */ getPreferredNetworkType: function getPreferredNetworkType() { Buf.simpleRequest(REQUEST_GET_PREFERRED_NETWORK_TYPE); }, /** * Request various states about the network. */ requestNetworkInfo: function requestNetworkInfo() { if (this._processingNetworkInfo) { if (DEBUG) debug("Network info requested, but we're already requesting network info."); this._needRepollNetworkInfo = true; return; } if (DEBUG) debug("Requesting network info"); this._processingNetworkInfo = true; this.getVoiceRegistrationState(); this.getDataRegistrationState(); //TODO only GSM this.getOperator(); this.getNetworkSelectionMode(); this.getSignalStrength(); }, /** * Get the available networks */ getAvailableNetworks: function getAvailableNetworks(options) { if (DEBUG) debug("Getting available networks"); Buf.newParcel(REQUEST_QUERY_AVAILABLE_NETWORKS, options); Buf.sendParcel(); }, /** * Request the radio's network selection mode */ getNetworkSelectionMode: function getNetworkSelectionMode() { if (DEBUG) debug("Getting network selection mode"); Buf.simpleRequest(REQUEST_QUERY_NETWORK_SELECTION_MODE); }, /** * Tell the radio to automatically choose a voice/data network */ selectNetworkAuto: function selectNetworkAuto(options) { if (DEBUG) debug("Setting automatic network selection"); Buf.simpleRequest(REQUEST_SET_NETWORK_SELECTION_AUTOMATIC, options); }, /** * Set the roaming preference mode */ setRoamingPreference: function setRoamingPreference(options) { let roamingMode = CDMA_ROAMING_PREFERENCE_TO_GECKO.indexOf(options.mode); if (roamingMode === -1) { options.errorMsg = GECKO_ERROR_INVALID_PARAMETER; this.sendChromeMessage(options); return; } Buf.newParcel(REQUEST_CDMA_SET_ROAMING_PREFERENCE, options); Buf.writeUint32(1); Buf.writeUint32(roamingMode); Buf.sendParcel(); }, /** * Get the roaming preference mode */ queryRoamingPreference: function getRoamingPreference(options) { Buf.simpleRequest(REQUEST_CDMA_QUERY_ROAMING_PREFERENCE, options); }, /** * Set the voice privacy mode */ setVoicePrivacyMode: function setVoicePrivacyMode(options) { Buf.newParcel(REQUEST_CDMA_SET_PREFERRED_VOICE_PRIVACY_MODE, options); Buf.writeUint32(1); Buf.writeUint32(options.enabled ? 1 : 0); Buf.sendParcel(); }, /** * Get the voice privacy mode */ queryVoicePrivacyMode: function getVoicePrivacyMode(options) { Buf.simpleRequest(REQUEST_CDMA_QUERY_PREFERRED_VOICE_PRIVACY_MODE, options); }, /** * Open Logical UICC channel (aid) for Secure Element access */ iccOpenChannel: function iccOpenChannel(options) { if (DEBUG) { debug("iccOpenChannel: " + JSON.stringify(options)); } Buf.newParcel(REQUEST_SIM_OPEN_CHANNEL, options); Buf.writeString(options.aid); Buf.sendParcel(); }, /** * Exchange APDU data on an open Logical UICC channel */ iccExchangeAPDU: function iccExchangeAPDU(options) { if (DEBUG) debug("iccExchangeAPDU: " + JSON.stringify(options)); let cla = options.apdu.cla; let command = options.apdu.command; let channel = options.channel; let path = options.apdu.path || ""; let data = options.apdu.data || ""; let data2 = options.apdu.data2 || ""; let p1 = options.apdu.p1; let p2 = options.apdu.p2; let p3 = options.apdu.p3; // Extra Buf.newParcel(REQUEST_SIM_ACCESS_CHANNEL, options); Buf.writeUint32(cla); Buf.writeUint32(command); Buf.writeUint32(channel); Buf.writeString(path); // path Buf.writeUint32(p1); Buf.writeUint32(p2); Buf.writeUint32(p3); Buf.writeString(data); // generic data field. Buf.writeString(data2); Buf.sendParcel(); }, /** * Close Logical UICC channel */ iccCloseChannel: function iccCloseChannel(options) { if (DEBUG) debug("iccCloseChannel: " + JSON.stringify(options)); Buf.newParcel(REQUEST_SIM_CLOSE_CHANNEL, options); Buf.writeUint32(1); Buf.writeUint32(options.channel); Buf.sendParcel(); }, /** * Tell the radio to choose a specific voice/data network */ selectNetwork: function selectNetwork(options) { if (DEBUG) { debug("Setting manual network selection: " + options.mcc + ", " + options.mnc); } let numeric = (options.mcc && options.mnc) ? options.mcc + options.mnc : null; Buf.newParcel(REQUEST_SET_NETWORK_SELECTION_MANUAL, options); Buf.writeString(numeric); Buf.sendParcel(); }, /** * Get current calls. */ getCurrentCalls: function getCurrentCalls() { Buf.simpleRequest(REQUEST_GET_CURRENT_CALLS); }, /** * Get the signal strength. */ getSignalStrength: function getSignalStrength() { Buf.simpleRequest(REQUEST_SIGNAL_STRENGTH); }, getIMEI: function getIMEI(options) { Buf.simpleRequest(REQUEST_GET_IMEI, options); }, getIMEISV: function getIMEISV() { Buf.simpleRequest(REQUEST_GET_IMEISV); }, getDeviceIdentity: function getDeviceIdentity() { Buf.simpleRequest(REQUEST_DEVICE_IDENTITY); }, getBasebandVersion: function getBasebandVersion() { Buf.simpleRequest(REQUEST_BASEBAND_VERSION); }, sendExitEmergencyCbModeRequest: function sendExitEmergencyCbModeRequest(options) { Buf.simpleRequest(REQUEST_EXIT_EMERGENCY_CALLBACK_MODE, options); }, getCdmaSubscription: function getCdmaSubscription() { Buf.simpleRequest(REQUEST_CDMA_SUBSCRIPTION); }, exitEmergencyCbMode: function exitEmergencyCbMode(options) { // The function could be called by an API from RadioInterfaceLayer or by // ril_worker itself. From ril_worker, we won't pass the parameter // 'options'. In this case, it is marked as internal. if (!options) { options = {internal: true}; } this._cancelEmergencyCbModeTimeout(); this.sendExitEmergencyCbModeRequest(options); }, /** * Cache the request for making an emergency call when radio is off. The * request shall include two types of callback functions. 'callback' is * called when radio is ready, and 'onerror' is called when turning radio * on fails. */ cachedDialRequest : null, /** * Dial the phone. * * @param number * String containing the number to dial. * @param clirMode * Integer for showing/hidding the caller Id to the called party. * @param uusInfo * Integer doing something XXX TODO */ dial: function dial(options) { let onerror = (function onerror(errorMsg) { this._sendCallError(-1, errorMsg); }).bind(this); if (this._isEmergencyNumber(options.number)) { this.dialEmergencyNumber(options, onerror); } else { if (!this._isCdma) { // TODO: Both dial() and sendMMI() functions should be unified at some // point in the future. In the mean time we handle temporary CLIR MMI // commands through the dial() function. Please see bug 889737. let mmi = this._parseMMI(options.number); if (mmi && this._isTemporaryModeCLIR(mmi)) { options.number = mmi.dialNumber; options.clirMode = this._getCLIRMode(mmi); } } this.dialNonEmergencyNumber(options, onerror); } }, dialNonEmergencyNumber: function dialNonEmergencyNumber(options, onerror) { if (this.radioState == GECKO_RADIOSTATE_OFF) { // Notify error in establishing the call without radio. onerror(GECKO_ERROR_RADIO_NOT_AVAILABLE); return; } if (this.voiceRegistrationState.emergencyCallsOnly || options.isDialEmergency) { onerror(RIL_CALL_FAILCAUSE_TO_GECKO_CALL_ERROR[CALL_FAIL_UNOBTAINABLE_NUMBER]); return; } // Exit emergency callback mode when user dial a non-emergency call. if (this._isInEmergencyCbMode) { this.exitEmergencyCbMode(); } options.request = REQUEST_DIAL; this.sendDialRequest(options); }, dialEmergencyNumber: function dialEmergencyNumber(options, onerror) { options.request = RILQUIRKS_REQUEST_USE_DIAL_EMERGENCY_CALL ? REQUEST_DIAL_EMERGENCY_CALL : REQUEST_DIAL; if (this.radioState == GECKO_RADIOSTATE_OFF) { if (DEBUG) debug("Automatically enable radio for an emergency call."); if (!this.cachedDialRequest) { this.cachedDialRequest = {}; } this.cachedDialRequest.onerror = onerror; this.cachedDialRequest.callback = this.sendDialRequest.bind(this, options); // Change radio setting value in settings DB to enable radio. this.sendChromeMessage({rilMessageType: "setRadioEnabled", on: true}); return; } this.sendDialRequest(options); }, sendDialRequest: function sendDialRequest(options) { Buf.newParcel(options.request); Buf.writeString(options.number); Buf.writeUint32(options.clirMode || 0); Buf.writeUint32(options.uusInfo || 0); // TODO Why do we need this extra 0? It was put it in to make this // match the format of the binary message. Buf.writeUint32(0); Buf.sendParcel(); }, /** * Hang up the phone. * * @param callIndex * Call index (1-based) as reported by REQUEST_GET_CURRENT_CALLS. */ hangUp: function hangUp(options) { let call = this.currentCalls[options.callIndex]; if (!call) { return; } switch (call.state) { case CALL_STATE_ACTIVE: case CALL_STATE_DIALING: case CALL_STATE_ALERTING: Buf.newParcel(REQUEST_HANGUP); Buf.writeUint32(1); Buf.writeUint32(options.callIndex); Buf.sendParcel(); break; case CALL_STATE_HOLDING: Buf.simpleRequest(REQUEST_HANGUP_WAITING_OR_BACKGROUND); break; } }, /** * Mute or unmute the radio. * * @param mute * Boolean to indicate whether to mute or unmute the radio. */ setMute: function setMute(mute) { Buf.newParcel(REQUEST_SET_MUTE); Buf.writeUint32(1); Buf.writeUint32(mute ? 1 : 0); Buf.sendParcel(); }, /** * Answer an incoming/waiting call. * * @param callIndex * Call index of the call to answer. */ answerCall: function answerCall(options) { // Check for races. Since we dispatched the incoming/waiting call // notification the incoming/waiting call may have changed. The main // thread thinks that it is answering the call with the given index, // so only answer if that is still incoming/waiting. let call = this.currentCalls[options.callIndex]; if (!call) { return; } switch (call.state) { case CALL_STATE_INCOMING: Buf.simpleRequest(REQUEST_ANSWER); break; case CALL_STATE_WAITING: // Answer the waiting (second) call, and hold the first call. Buf.simpleRequest(REQUEST_SWITCH_WAITING_OR_HOLDING_AND_ACTIVE); break; } }, /** * Reject an incoming/waiting call. * * @param callIndex * Call index of the call to reject. */ rejectCall: function rejectCall(options) { // Check for races. Since we dispatched the incoming/waiting call // notification the incoming/waiting call may have changed. The main // thread thinks that it is rejecting the call with the given index, // so only reject if that is still incoming/waiting. let call = this.currentCalls[options.callIndex]; if (!call) { return; } if (this._isCdma) { // AT+CHLD=0 means "release held or UDUB." Buf.simpleRequest(REQUEST_HANGUP_WAITING_OR_BACKGROUND); return; } switch (call.state) { case CALL_STATE_INCOMING: Buf.simpleRequest(REQUEST_UDUB); break; case CALL_STATE_WAITING: // Reject the waiting (second) call, and remain the first call. Buf.simpleRequest(REQUEST_HANGUP_WAITING_OR_BACKGROUND); break; } }, holdCall: function holdCall(options) { let call = this.currentCalls[options.callIndex]; if (call && call.state == CALL_STATE_ACTIVE) { if (this._isCdma) { Buf.newParcel(REQUEST_CDMA_FLASH); Buf.writeString(""); Buf.sendParcel(); } else { Buf.simpleRequest(REQUEST_SWITCH_HOLDING_AND_ACTIVE); } } }, resumeCall: function resumeCall(options) { let call = this.currentCalls[options.callIndex]; if (call && call.state == CALL_STATE_HOLDING) { Buf.simpleRequest(REQUEST_SWITCH_HOLDING_AND_ACTIVE); } }, // Flag indicating whether user has requested making a conference call. _hasConferenceRequest: false, conferenceCall: function conferenceCall(options) { this._hasConferenceRequest = true; Buf.simpleRequest(REQUEST_CONFERENCE, options); }, separateCall: function separateCall(options) { Buf.newParcel(REQUEST_SEPARATE_CONNECTION, options); Buf.writeUint32(1); Buf.writeUint32(options.callIndex); Buf.sendParcel(); }, holdConference: function holdConference() { Buf.simpleRequest(REQUEST_SWITCH_HOLDING_AND_ACTIVE); }, resumeConference: function resumeConference() { Buf.simpleRequest(REQUEST_SWITCH_HOLDING_AND_ACTIVE); }, /** * Send an SMS. * * The `options` parameter object should contain the following attributes: * * @param number * String containing the recipient number. * @param body * String containing the message text. * @param envelopeId * Numeric value identifying the sms request. */ sendSMS: function sendSMS(options) { options.langIndex = options.langIndex || PDU_NL_IDENTIFIER_DEFAULT; options.langShiftIndex = options.langShiftIndex || PDU_NL_IDENTIFIER_DEFAULT; if (!options.retryCount) { options.retryCount = 0; } if (!options.segmentSeq) { // Fist segment to send options.segmentSeq = 1; options.body = options.segments[0].body; options.encodedBodyLength = options.segments[0].encodedBodyLength; } if (this._isCdma) { Buf.newParcel(REQUEST_CDMA_SEND_SMS, options); CdmaPDUHelper.writeMessage(options); } else { Buf.newParcel(REQUEST_SEND_SMS, options); Buf.writeUint32(2); Buf.writeString(options.SMSC); GsmPDUHelper.writeMessage(options); } Buf.sendParcel(); }, /** * Acknowledge the receipt and handling of an SMS. * * @param success * Boolean indicating whether the message was successfuly handled. * @param cause * SMS_* constant indicating the reason for unsuccessful handling. */ acknowledgeGsmSms: function acknowledgeGsmSms(success, cause) { Buf.newParcel(REQUEST_SMS_ACKNOWLEDGE); Buf.writeUint32(2); Buf.writeUint32(success ? 1 : 0); Buf.writeUint32(cause); Buf.sendParcel(); }, /** * Acknowledge the receipt and handling of an SMS. * * @param success * Boolean indicating whether the message was successfuly handled. */ ackSMS: function ackSMS(options) { if (options.result == PDU_FCS_RESERVED) { return; } if (this._isCdma) { this.acknowledgeCdmaSms(options.result == PDU_FCS_OK, options.result); } else { this.acknowledgeGsmSms(options.result == PDU_FCS_OK, options.result); } }, /** * Acknowledge the receipt and handling of a CDMA SMS. * * @param success * Boolean indicating whether the message was successfuly handled. * @param cause * SMS_* constant indicating the reason for unsuccessful handling. */ acknowledgeCdmaSms: function acknowledgeCdmaSms(success, cause) { Buf.newParcel(REQUEST_CDMA_SMS_ACKNOWLEDGE); Buf.writeUint32(success ? 0 : 1); Buf.writeUint32(cause); Buf.sendParcel(); }, setCellBroadcastDisabled: function setCellBroadcastDisabled(options) { this.cellBroadcastDisabled = options.disabled; // If |this.mergedCellBroadcastConfig| is null, either we haven't finished // reading required SIM files, or no any channel is ever configured. In // the former case, we'll call |this.updateCellBroadcastConfig()| later // with correct configs; in the latter case, we don't bother resetting CB // to disabled again. if (this.mergedCellBroadcastConfig) { this.updateCellBroadcastConfig(); } }, setCellBroadcastSearchList: function setCellBroadcastSearchList(options) { try { let str = options.searchListStr; this.cellBroadcastConfigs.MMI = this._convertCellBroadcastSearchList(str); options.success = true; } catch (e) { if (DEBUG) { debug("Invalid Cell Broadcast search list: " + e); } options.success = false; } this.sendChromeMessage(options); if (!options.success) { return; } this._mergeAllCellBroadcastConfigs(); }, updateCellBroadcastConfig: function updateCellBroadcastConfig() { let activate = !this.cellBroadcastDisabled && (this.mergedCellBroadcastConfig != null) && (this.mergedCellBroadcastConfig.length > 0); if (activate) { this.setSmsBroadcastConfig(this.mergedCellBroadcastConfig); } else { // It's unnecessary to set config first if we're deactivating. this.setSmsBroadcastActivation(false); } }, setGsmSmsBroadcastConfig: function setGsmSmsBroadcastConfig(config) { Buf.newParcel(REQUEST_GSM_SET_BROADCAST_SMS_CONFIG); let numConfigs = config ? config.length / 2 : 0; Buf.writeUint32(numConfigs); for (let i = 0; i < config.length;) { Buf.writeUint32(config[i++]); Buf.writeUint32(config[i++]); Buf.writeUint32(0x00); Buf.writeUint32(0xFF); Buf.writeUint32(1); } Buf.sendParcel(); }, /** * Send CDMA SMS broadcast config. * * @see 3GPP2 C.R1001 Sec. 9.2 and 9.3 */ setCdmaSmsBroadcastConfig: function setCdmaSmsBroadcastConfig(config) { // |config| is an array of half-closed range: [[from, to), [from, to), ...]. // It will be further decomposed, ex: [1, 4) => 1, 2, 3. Buf.newParcel(REQUEST_CDMA_SET_BROADCAST_SMS_CONFIG); let numConfigs = 0; for (let i = 0; i < config.length; i += 2) { numConfigs += (config[i+1] - config[i]); } Buf.writeUint32(numConfigs); for (let i = 0; i < config.length;) { let begin = config[i++]; let end = config[i++]; for (let j = begin; j < end; ++j) { Buf.writeUint32(j); Buf.writeUint32(0); // Language Indicator: Unknown or unspecified. Buf.writeUint32(1); } } Buf.sendParcel(); }, setSmsBroadcastConfig: function setSmsBroadcastConfig(config) { if (this._isCdma) { this.setCdmaSmsBroadcastConfig(config); } else { this.setGsmSmsBroadcastConfig(config); } }, setSmsBroadcastActivation: function setSmsBroadcastActivation(activate) { let parcelType = this._isCdma ? REQUEST_CDMA_SMS_BROADCAST_ACTIVATION : REQUEST_GSM_SMS_BROADCAST_ACTIVATION; Buf.newParcel(parcelType); Buf.writeUint32(1); // See hardware/ril/include/telephony/ril.h, 0 - Activate, 1 - Turn off. Buf.writeUint32(activate ? 0 : 1); Buf.sendParcel(); }, /** * Start a DTMF Tone. * * @param dtmfChar * DTMF signal to send, 0-9, *, + */ startTone: function startTone(options) { Buf.newParcel(REQUEST_DTMF_START); Buf.writeString(options.dtmfChar); Buf.sendParcel(); }, stopTone: function stopTone() { Buf.simpleRequest(REQUEST_DTMF_STOP); }, /** * Send a DTMF tone. * * @param dtmfChar * DTMF signal to send, 0-9, *, + */ sendTone: function sendTone(options) { Buf.newParcel(REQUEST_DTMF); Buf.writeString(options.dtmfChar); Buf.sendParcel(); }, /** * Get the Short Message Service Center address. */ getSMSCAddress: function getSMSCAddress() { Buf.simpleRequest(REQUEST_GET_SMSC_ADDRESS); }, /** * Set the Short Message Service Center address. * * @param SMSC * Short Message Service Center address in PDU format. */ setSMSCAddress: function setSMSCAddress(options) { Buf.newParcel(REQUEST_SET_SMSC_ADDRESS); Buf.writeString(options.SMSC); Buf.sendParcel(); }, /** * Setup a data call. * * @param radioTech * Integer to indicate radio technology. * DATACALL_RADIOTECHNOLOGY_CDMA => CDMA. * DATACALL_RADIOTECHNOLOGY_GSM => GSM. * @param apn * String containing the name of the APN to connect to. * @param user * String containing the username for the APN. * @param passwd * String containing the password for the APN. * @param chappap * Integer containing CHAP/PAP auth type. * DATACALL_AUTH_NONE => PAP and CHAP is never performed. * DATACALL_AUTH_PAP => PAP may be performed. * DATACALL_AUTH_CHAP => CHAP may be performed. * DATACALL_AUTH_PAP_OR_CHAP => PAP / CHAP may be performed. * @param pdptype * String containing PDP type to request. ("IP", "IPV6", ...) */ setupDataCall: function setupDataCall(options) { // From ./hardware/ril/include/telephony/ril.h: // ((const char **)data)[0] Radio technology to use: 0-CDMA, 1-GSM/UMTS, 2... // for values above 2 this is RIL_RadioTechnology + 2. // // From frameworks/base/telephony/java/com/android/internal/telephony/DataConnection.java: // if the mRilVersion < 6, radio technology must be GSM/UMTS or CDMA. // Otherwise, it must be + 2 // // See also bug 901232 and 867873 let radioTech; if (RILQUIRKS_V5_LEGACY) { radioTech = this._isCdma ? DATACALL_RADIOTECHNOLOGY_CDMA : DATACALL_RADIOTECHNOLOGY_GSM; } else { radioTech = options.radioTech + 2; } let token = Buf.newParcel(REQUEST_SETUP_DATA_CALL, options); Buf.writeUint32(7); Buf.writeString(radioTech.toString()); Buf.writeString(DATACALL_PROFILE_DEFAULT.toString()); Buf.writeString(options.apn); Buf.writeString(options.user); Buf.writeString(options.passwd); Buf.writeString(options.chappap.toString()); Buf.writeString(options.pdptype); Buf.sendParcel(); return token; }, /** * Deactivate a data call. * * @param cid * String containing CID. * @param reason * One of DATACALL_DEACTIVATE_* constants. */ deactivateDataCall: function deactivateDataCall(options) { let datacall = this.currentDataCalls[options.cid]; if (!datacall) { return; } Buf.newParcel(REQUEST_DEACTIVATE_DATA_CALL, options); Buf.writeUint32(2); Buf.writeString(options.cid); Buf.writeString(options.reason || DATACALL_DEACTIVATE_NO_REASON); Buf.sendParcel(); datacall.state = GECKO_NETWORK_STATE_DISCONNECTING; this.sendChromeMessage(datacall); }, /** * Get a list of data calls. */ getDataCallList: function getDataCallList() { Buf.simpleRequest(REQUEST_DATA_CALL_LIST); }, /** * Get failure casue code for the most recently failed PDP context. */ getFailCauseCode: function getFailCauseCode(options) { Buf.simpleRequest(REQUEST_LAST_CALL_FAIL_CAUSE, options); }, /** * Helper to parse MMI/USSD string. TS.22.030 Figure 3.5.3.2. */ _parseMMI: function _parseMMI(mmiString) { if (!mmiString || !mmiString.length) { return null; } let matches = this._matchMMIRegexp(mmiString); if (matches) { // After successfully executing the regular expresion over the MMI string, // the following match groups should contain: // 1 = full MMI string that might be used as a USSD request. // 2 = MMI procedure. // 3 = Service code. // 5 = SIA. // 7 = SIB. // 9 = SIC. // 11 = Password registration. // 12 = Dialing number. return { fullMMI: matches[MMI_MATCH_GROUP_FULL_MMI], procedure: matches[MMI_MATCH_GROUP_MMI_PROCEDURE], serviceCode: matches[MMI_MATCH_GROUP_SERVICE_CODE], sia: matches[MMI_MATCH_GROUP_SIA], sib: matches[MMI_MATCH_GROUP_SIB], sic: matches[MMI_MATCH_GROUP_SIC], pwd: matches[MMI_MATCH_GROUP_PWD_CONFIRM], dialNumber: matches[MMI_MATCH_GROUP_DIALING_NUMBER] }; } if (this._isPoundString(mmiString) || this._isMMIShortString(mmiString)) { return { fullMMI: mmiString }; } return null; }, /** * Helper to parse MMI string via regular expression. TS.22.030 Figure * 3.5.3.2. */ _matchMMIRegexp: function _matchMMIRegexp(mmiString) { // Regexp to parse and process the MMI code. if (this._mmiRegExp == null) { // The first group of the regexp takes the whole MMI string. // The second group takes the MMI procedure that can be: // - Activation (*SC*SI#). // - Deactivation (#SC*SI#). // - Interrogation (*#SC*SI#). // - Registration (**SC*SI#). // - Erasure (##SC*SI#). // where SC = Service Code (2 or 3 digits) and SI = Supplementary Info // (variable length). let pattern = "((\\*[*#]?|##?)"; // Third group of the regexp looks for the MMI Service code, which is a // 2 or 3 digits that uniquely specifies the Supplementary Service // associated with the MMI code. pattern += "(\\d{2,3})"; // Groups from 4 to 9 looks for the MMI Supplementary Information SIA, // SIB and SIC. SIA may comprise e.g. a PIN code or Directory Number, // SIB may be used to specify the tele or bearer service and SIC to // specify the value of the "No Reply Condition Timer". Where a particular // service request does not require any SI, "*SI" is not entered. The use // of SIA, SIB and SIC is optional and shall be entered in any of the // following formats: // - *SIA*SIB*SIC# // - *SIA*SIB# // - *SIA**SIC# // - *SIA# // - **SIB*SIC# // - ***SISC# pattern += "(\\*([^*#]*)(\\*([^*#]*)(\\*([^*#]*)"; // The eleventh group takes the password for the case of a password // registration procedure. pattern += "(\\*([^*#]*))?)?)?)?#)"; // The last group takes the dial string after the #. pattern += "([^#]*)"; this._mmiRegExp = new RegExp(pattern); } // Regex only applys for those well-defined MMI strings (refer to TS.22.030 // Annex B), otherwise, null should be the expected return value. return this._mmiRegExp.exec(mmiString); }, /** * Helper to parse # string. TS.22.030 Figure 3.5.3.2. */ _isPoundString: function _isPoundString(mmiString) { return (mmiString.charAt(mmiString.length - 1) === MMI_END_OF_USSD); }, /** * Helper to parse short string. TS.22.030 Figure 3.5.3.2. */ _isMMIShortString: function _isMMIShortString(mmiString) { if (mmiString.length > 2) { return false; } if (this._isEmergencyNumber(mmiString)) { return false; } // In a call case. if (Object.getOwnPropertyNames(this.currentCalls).length > 0) { return true; } if ((mmiString.length != 2) || (mmiString.charAt(0) !== '1')) { return true; } return false; }, sendMMI: function sendMMI(options) { if (DEBUG) { debug("SendMMI " + JSON.stringify(options)); } let mmiString = options.mmi; let mmi = this._parseMMI(mmiString); let _sendMMIError = (function _sendMMIError(errorMsg, mmiServiceCode) { options.success = false; options.errorMsg = errorMsg; if (mmiServiceCode) { options.mmiServiceCode = mmiServiceCode; } this.sendChromeMessage(options); }).bind(this); function _isValidPINPUKRequest(mmiServiceCode) { // The only allowed MMI procedure for ICC PIN, PIN2, PUK and PUK2 handling // is "Registration" (**). if (!mmi.procedure || mmi.procedure != MMI_PROCEDURE_REGISTRATION ) { _sendMMIError(MMI_ERROR_KS_INVALID_ACTION, mmiServiceCode); return false; } if (!mmi.sia || !mmi.sia.length || !mmi.sib || !mmi.sib.length || !mmi.sic || !mmi.sic.length) { _sendMMIError(MMI_ERROR_KS_ERROR, mmiServiceCode); return false; } if (mmi.sib != mmi.sic) { _sendMMIError(MMI_ERROR_KS_MISMATCH_PIN, mmiServiceCode); return false; } if (mmi.sia.length < 4 || mmi.sia.length > 8 || mmi.sib.length < 4 || mmi.sib.length > 8 || mmi.sic.length < 4 || mmi.sic.length > 8) { _sendMMIError(MMI_ERROR_KS_INVALID_PIN, mmiServiceCode); return false; } return true; } function _isRadioAvailable(mmiServiceCode) { if (RIL.radioState !== GECKO_RADIOSTATE_READY) { _sendMMIError(GECKO_ERROR_RADIO_NOT_AVAILABLE, mmiServiceCode); return false; } return true; } // If we couldn't parse the MMI code, we'll send it as an USSD request. if (mmi === null) { if (this._ussdSession) { if (!_isRadioAvailable(MMI_KS_SC_USSD)) { return; } options.ussd = mmiString; this.sendUSSD(options); return; } _sendMMIError(MMI_ERROR_KS_ERROR); return; } if (DEBUG) { debug("MMI " + JSON.stringify(mmi)); } // We check if the MMI service code is supported and in that case we // trigger the appropriate RIL request if possible. let sc = mmi.serviceCode; switch (sc) { // Call forwarding case MMI_SC_CFU: case MMI_SC_CF_BUSY: case MMI_SC_CF_NO_REPLY: case MMI_SC_CF_NOT_REACHABLE: case MMI_SC_CF_ALL: case MMI_SC_CF_ALL_CONDITIONAL: if (!_isRadioAvailable(MMI_KS_SC_CALL_FORWARDING)) { return; } // Call forwarding requires at least an action, given by the MMI // procedure, and a reason, given by the MMI service code, but there // is no way that we get this far without a valid procedure or service // code. options.mmiServiceCode = MMI_KS_SC_CALL_FORWARDING; options.action = MMI_PROC_TO_CF_ACTION[mmi.procedure]; options.reason = MMI_SC_TO_CF_REASON[sc]; options.number = mmi.sia; options.serviceClass = this._siToServiceClass(mmi.sib); if (options.action == CALL_FORWARD_ACTION_QUERY_STATUS) { this.queryCallForwardStatus(options); return; } options.isSetCallForward = true; options.timeSeconds = mmi.sic; this.setCallForward(options); return; // Change the current ICC PIN number. case MMI_SC_PIN: // As defined in TS.122.030 6.6.2 to change the ICC PIN we should expect // an MMI code of the form **04*OLD_PIN*NEW_PIN*NEW_PIN#, where old PIN // should be entered as the SIA parameter and the new PIN as SIB and // SIC. if (!_isRadioAvailable(MMI_KS_SC_PIN) || !_isValidPINPUKRequest(MMI_KS_SC_PIN)) { return; } options.mmiServiceCode = MMI_KS_SC_PIN; options.pin = mmi.sia; options.newPin = mmi.sib; this.changeICCPIN(options); return; // Change the current ICC PIN2 number. case MMI_SC_PIN2: // As defined in TS.122.030 6.6.2 to change the ICC PIN2 we should // enter and MMI code of the form **042*OLD_PIN2*NEW_PIN2*NEW_PIN2#, // where the old PIN2 should be entered as the SIA parameter and the // new PIN2 as SIB and SIC. if (!_isRadioAvailable(MMI_KS_SC_PIN2) || !_isValidPINPUKRequest(MMI_KS_SC_PIN2)) { return; } options.mmiServiceCode = MMI_KS_SC_PIN2; options.pin = mmi.sia; options.newPin = mmi.sib; this.changeICCPIN2(options); return; // Unblock ICC PIN. case MMI_SC_PUK: // As defined in TS.122.030 6.6.3 to unblock the ICC PIN we should // enter an MMI code of the form **05*PUK*NEW_PIN*NEW_PIN#, where PUK // should be entered as the SIA parameter and the new PIN as SIB and // SIC. if (!_isRadioAvailable(MMI_KS_SC_PUK) || !_isValidPINPUKRequest(MMI_KS_SC_PUK)) { return; } options.mmiServiceCode = MMI_KS_SC_PUK; options.puk = mmi.sia; options.newPin = mmi.sib; this.enterICCPUK(options); return; // Unblock ICC PIN2. case MMI_SC_PUK2: // As defined in TS.122.030 6.6.3 to unblock the ICC PIN2 we should // enter an MMI code of the form **052*PUK2*NEW_PIN2*NEW_PIN2#, where // PUK2 should be entered as the SIA parameter and the new PIN2 as SIB // and SIC. if (!_isRadioAvailable(MMI_KS_SC_PUK2) || !_isValidPINPUKRequest(MMI_KS_SC_PUK2)) { return; } options.mmiServiceCode = MMI_KS_SC_PUK2; options.puk = mmi.sia; options.newPin = mmi.sib; this.enterICCPUK2(options); return; // IMEI case MMI_SC_IMEI: // A device's IMEI can't change, so we only need to request it once. if (this.IMEI == null) { this.getIMEI(options); return; } // If we already had the device's IMEI, we just send it to chrome. options.mmiServiceCode = MMI_KS_SC_IMEI; options.success = true; options.statusMessage = this.IMEI; this.sendChromeMessage(options); return; // CLIP case MMI_SC_CLIP: options.mmiServiceCode = MMI_KS_SC_CLIP; options.procedure = mmi.procedure; if (options.procedure === MMI_PROCEDURE_INTERROGATION) { this.queryCLIP(options); } else { _sendMMIError(MMI_ERROR_KS_NOT_SUPPORTED, MMI_KS_SC_CLIP); } return; // CLIR (non-temporary ones) // TODO: Both dial() and sendMMI() functions should be unified at some // point in the future. In the mean time we handle temporary CLIR MMI // commands through the dial() function. Please see bug 889737. case MMI_SC_CLIR: options.mmiServiceCode = MMI_KS_SC_CLIR; options.procedure = mmi.procedure; switch (options.procedure) { case MMI_PROCEDURE_INTERROGATION: this.getCLIR(options); return; case MMI_PROCEDURE_ACTIVATION: options.clirMode = CLIR_INVOCATION; break; case MMI_PROCEDURE_DEACTIVATION: options.clirMode = CLIR_SUPPRESSION; break; default: _sendMMIError(MMI_ERROR_KS_NOT_SUPPORTED, MMI_KS_SC_CLIR); return; } options.isSetCLIR = true; this.setCLIR(options); return; // Call barring case MMI_SC_BAOC: case MMI_SC_BAOIC: case MMI_SC_BAOICxH: case MMI_SC_BAIC: case MMI_SC_BAICr: case MMI_SC_BA_ALL: case MMI_SC_BA_MO: case MMI_SC_BA_MT: options.mmiServiceCode = MMI_KS_SC_CALL_BARRING; options.password = mmi.sia || ""; options.serviceClass = this._siToServiceClass(mmi.sib); options.facility = MMI_SC_TO_CB_FACILITY[sc]; options.procedure = mmi.procedure; if (mmi.procedure === MMI_PROCEDURE_INTERROGATION) { this.queryICCFacilityLock(options); return; } if (mmi.procedure === MMI_PROCEDURE_ACTIVATION) { options.enabled = 1; } else if (mmi.procedure === MMI_PROCEDURE_DEACTIVATION) { options.enabled = 0; } else { _sendMMIError(MMI_ERROR_KS_NOT_SUPPORTED, MMI_KS_SC_CALL_BARRING); return; } this.setICCFacilityLock(options); return; // Call waiting case MMI_SC_CALL_WAITING: if (!_isRadioAvailable(MMI_KS_SC_CALL_WAITING)) { return; } options.mmiServiceCode = MMI_KS_SC_CALL_WAITING; if (mmi.procedure === MMI_PROCEDURE_INTERROGATION) { this._handleQueryMMICallWaiting(options); return; } if (mmi.procedure === MMI_PROCEDURE_ACTIVATION) { options.enabled = true; } else if (mmi.procedure === MMI_PROCEDURE_DEACTIVATION) { options.enabled = false; } else { _sendMMIError(MMI_ERROR_KS_NOT_SUPPORTED, MMI_KS_SC_CALL_WAITING); return; } options.serviceClass = this._siToServiceClass(mmi.sia); this._handleSetMMICallWaiting(options); return; } // If the MMI code is not a known code and is a recognized USSD request, // it shall still be sent as a USSD request. if (mmi.fullMMI) { if (!_isRadioAvailable(MMI_KS_SC_USSD)) { return; } options.ussd = mmi.fullMMI; options.mmiServiceCode = MMI_KS_SC_USSD; this.sendUSSD(options); return; } // At this point, the MMI string is considered as not valid MMI code and // not valid USSD code. _sendMMIError(MMI_ERROR_KS_ERROR); }, /** * Send USSD. * * @param ussd * String containing the USSD code. * */ sendUSSD: function sendUSSD(options) { Buf.newParcel(REQUEST_SEND_USSD, options); Buf.writeString(options.ussd); Buf.sendParcel(); }, /** * Cancel pending USSD. */ cancelUSSD: function cancelUSSD(options) { options.mmiServiceCode = MMI_KS_SC_USSD; Buf.simpleRequest(REQUEST_CANCEL_USSD, options); }, /** * Queries current call forward rules. * * @param reason * One of nsIDOMMozMobileCFInfo.CALL_FORWARD_REASON_* constants. * @param serviceClass * One of ICC_SERVICE_CLASS_* constants. * @param number * Phone number of forwarding address. */ queryCallForwardStatus: function queryCallForwardStatus(options) { Buf.newParcel(REQUEST_QUERY_CALL_FORWARD_STATUS, options); Buf.writeUint32(CALL_FORWARD_ACTION_QUERY_STATUS); Buf.writeUint32(options.reason); Buf.writeUint32(options.serviceClass || ICC_SERVICE_CLASS_NONE); Buf.writeUint32(this._toaFromString(options.number)); Buf.writeString(options.number); Buf.writeUint32(0); Buf.sendParcel(); }, /** * Configures call forward rule. * * @param action * One of nsIDOMMozMobileCFInfo.CALL_FORWARD_ACTION_* constants. * @param reason * One of nsIDOMMozMobileCFInfo.CALL_FORWARD_REASON_* constants. * @param serviceClass * One of ICC_SERVICE_CLASS_* constants. * @param number * Phone number of forwarding address. * @param timeSeconds * Time in seconds to wait beforec all is forwarded. */ setCallForward: function setCallForward(options) { Buf.newParcel(REQUEST_SET_CALL_FORWARD, options); Buf.writeUint32(options.action); Buf.writeUint32(options.reason); Buf.writeUint32(options.serviceClass); Buf.writeUint32(this._toaFromString(options.number)); Buf.writeString(options.number); Buf.writeUint32(options.timeSeconds); Buf.sendParcel(); }, /** * Queries current call barring rules. * * @param program * One of nsIDOMMozMobileConnection.CALL_BARRING_PROGRAM_* constants. * @param serviceClass * One of ICC_SERVICE_CLASS_* constants. */ queryCallBarringStatus: function queryCallBarringStatus(options) { options.facility = CALL_BARRING_PROGRAM_TO_FACILITY[options.program]; options.password = ""; // For query no need to provide it. this.queryICCFacilityLock(options); }, /** * Configures call barring rule. * * @param program * One of nsIDOMMozMobileConnection.CALL_BARRING_PROGRAM_* constants. * @param enabled * Enable or disable the call barring. * @param password * Barring password. * @param serviceClass * One of ICC_SERVICE_CLASS_* constants. */ setCallBarring: function setCallBarring(options) { options.facility = CALL_BARRING_PROGRAM_TO_FACILITY[options.program]; this.setICCFacilityLock(options); }, /** * Change call barring facility password. * * @param pin * Old password. * @param newPin * New password. */ changeCallBarringPassword: function changeCallBarringPassword(options) { Buf.newParcel(REQUEST_CHANGE_BARRING_PASSWORD, options); Buf.writeUint32(3); // Set facility to ICC_CB_FACILITY_BA_ALL by following TS.22.030 clause // 6.5.4 and Table B.1. Buf.writeString(ICC_CB_FACILITY_BA_ALL); Buf.writeString(options.pin); Buf.writeString(options.newPin); Buf.sendParcel(); }, /** * Handle STK CALL_SET_UP request. * * @param hasConfirmed * Does use have confirmed the call requested from ICC? */ stkHandleCallSetup: function stkHandleCallSetup(options) { Buf.newParcel(REQUEST_STK_HANDLE_CALL_SETUP_REQUESTED_FROM_SIM); Buf.writeUint32(1); Buf.writeUint32(options.hasConfirmed ? 1 : 0); Buf.sendParcel(); }, /** * Send STK Profile Download. * * @param profile Profile supported by ME. */ sendStkTerminalProfile: function sendStkTerminalProfile(profile) { Buf.newParcel(REQUEST_STK_SET_PROFILE); Buf.writeUint32(profile.length * 2); for (let i = 0; i < profile.length; i++) { GsmPDUHelper.writeHexOctet(profile[i]); } Buf.writeUint32(0); Buf.sendParcel(); }, /** * Send STK terminal response. * * @param command * @param deviceIdentities * @param resultCode * @param [optional] itemIdentifier * @param [optional] input * @param [optional] isYesNo * @param [optional] hasConfirmed * @param [optional] localInfo * @param [optional] timer */ sendStkTerminalResponse: function sendStkTerminalResponse(response) { if (response.hasConfirmed !== undefined) { this.stkHandleCallSetup(response); return; } let command = response.command; Buf.newParcel(REQUEST_STK_SEND_TERMINAL_RESPONSE); // 1st mark for Parcel size Buf.startCalOutgoingSize(function(size) { // Parcel size is in string length, which costs 2 uint8 per char. Buf.writeUint32(size / 2); }); // Command Details GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_COMMAND_DETAILS | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(3); if (response.command) { GsmPDUHelper.writeHexOctet(command.commandNumber); GsmPDUHelper.writeHexOctet(command.typeOfCommand); GsmPDUHelper.writeHexOctet(command.commandQualifier); } else { GsmPDUHelper.writeHexOctet(0x00); GsmPDUHelper.writeHexOctet(0x00); GsmPDUHelper.writeHexOctet(0x00); } // Device Identifier // According to TS102.223/TS31.111 section 6.8 Structure of // TERMINAL RESPONSE, "For all SIMPLE-TLV objects with Min=N, // the ME should set the CR(comprehension required) flag to // comprehension not required.(CR=0)" // Since DEVICE_IDENTITIES and DURATION TLVs have Min=N, // the CR flag is not set. GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_DEVICE_ID); GsmPDUHelper.writeHexOctet(2); GsmPDUHelper.writeHexOctet(STK_DEVICE_ID_ME); GsmPDUHelper.writeHexOctet(STK_DEVICE_ID_SIM); // Result GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_RESULT | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(response.resultCode); // Item Identifier if (response.itemIdentifier != null) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_ITEM_ID | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(response.itemIdentifier); } // No need to process Text data if user requests help information. if (response.resultCode != STK_RESULT_HELP_INFO_REQUIRED) { let text; if (response.isYesNo !== undefined) { // GET_INKEY // When the ME issues a successful TERMINAL RESPONSE for a GET INKEY // ("Yes/No") command with command qualifier set to "Yes/No", it shall // supply the value '01' when the answer is "positive" and the value // '00' when the answer is "negative" in the Text string data object. text = response.isYesNo ? 0x01 : 0x00; } else { text = response.input; } if (text) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_TEXT_STRING | COMPREHENSIONTLV_FLAG_CR); // 2nd mark for text length Buf.startCalOutgoingSize(function(size) { // Text length is in number of hexOctets, which costs 4 uint8 per hexOctet. GsmPDUHelper.writeHexOctet(size / 4); }); let coding = command.options.isUCS2 ? STK_TEXT_CODING_UCS2 : (command.options.isPacked ? STK_TEXT_CODING_GSM_7BIT_PACKED : STK_TEXT_CODING_GSM_8BIT); GsmPDUHelper.writeHexOctet(coding); // Write Text String. switch (coding) { case STK_TEXT_CODING_UCS2: GsmPDUHelper.writeUCS2String(text); break; case STK_TEXT_CODING_GSM_7BIT_PACKED: GsmPDUHelper.writeStringAsSeptets(text, 0, 0, 0); break; case STK_TEXT_CODING_GSM_8BIT: for (let i = 0; i < text.length; i++) { GsmPDUHelper.writeHexOctet(text.charCodeAt(i)); } break; } // Calculate and write text length to 2nd mark Buf.stopCalOutgoingSize(); } } // Local Information if (response.localInfo) { let localInfo = response.localInfo; // Location Infomation if (localInfo.locationInfo) { ComprehensionTlvHelper.writeLocationInfoTlv(localInfo.locationInfo); } // IMEI if (localInfo.imei != null) { let imei = localInfo.imei; if(imei.length == 15) { imei = imei + "0"; } GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_IMEI); GsmPDUHelper.writeHexOctet(8); for (let i = 0; i < imei.length / 2; i++) { GsmPDUHelper.writeHexOctet(parseInt(imei.substr(i * 2, 2), 16)); } } // Date and Time Zone if (localInfo.date != null) { ComprehensionTlvHelper.writeDateTimeZoneTlv(localInfo.date); } // Language if (localInfo.language) { ComprehensionTlvHelper.writeLanguageTlv(localInfo.language); } } // Timer if (response.timer) { let timer = response.timer; if (timer.timerId) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_TIMER_IDENTIFIER); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(timer.timerId); } if (timer.timerValue) { ComprehensionTlvHelper.writeTimerValueTlv(timer.timerValue, false); } } // Calculate and write Parcel size to 1st mark Buf.stopCalOutgoingSize(); Buf.writeUint32(0); Buf.sendParcel(); }, /** * Send STK Envelope(Menu Selection) command. * * @param itemIdentifier * @param helpRequested */ sendStkMenuSelection: function sendStkMenuSelection(command) { command.tag = BER_MENU_SELECTION_TAG; command.deviceId = { sourceId :STK_DEVICE_ID_KEYPAD, destinationId: STK_DEVICE_ID_SIM }; this.sendICCEnvelopeCommand(command); }, /** * Send STK Envelope(Timer Expiration) command. * * @param timer */ sendStkTimerExpiration: function sendStkTimerExpiration(command) { command.tag = BER_TIMER_EXPIRATION_TAG; command.deviceId = { sourceId: STK_DEVICE_ID_ME, destinationId: STK_DEVICE_ID_SIM }; command.timerId = command.timer.timerId; command.timerValue = command.timer.timerValue; this.sendICCEnvelopeCommand(command); }, /** * Send STK Envelope(Event Download) command. * @param event */ sendStkEventDownload: function sendStkEventDownload(command) { command.tag = BER_EVENT_DOWNLOAD_TAG; command.eventList = command.event.eventType; switch (command.eventList) { case STK_EVENT_TYPE_LOCATION_STATUS: command.deviceId = { sourceId :STK_DEVICE_ID_ME, destinationId: STK_DEVICE_ID_SIM }; command.locationStatus = command.event.locationStatus; // Location info should only be provided when locationStatus is normal. if (command.locationStatus == STK_SERVICE_STATE_NORMAL) { command.locationInfo = command.event.locationInfo; } break; case STK_EVENT_TYPE_MT_CALL: command.deviceId = { sourceId: STK_DEVICE_ID_NETWORK, destinationId: STK_DEVICE_ID_SIM }; command.transactionId = 0; command.address = command.event.number; break; case STK_EVENT_TYPE_CALL_DISCONNECTED: command.cause = command.event.error; // Fall through. case STK_EVENT_TYPE_CALL_CONNECTED: command.deviceId = { sourceId: (command.event.isIssuedByRemote ? STK_DEVICE_ID_NETWORK : STK_DEVICE_ID_ME), destinationId: STK_DEVICE_ID_SIM }; command.transactionId = 0; break; case STK_EVENT_TYPE_USER_ACTIVITY: command.deviceId = { sourceId: STK_DEVICE_ID_ME, destinationId: STK_DEVICE_ID_SIM }; break; case STK_EVENT_TYPE_IDLE_SCREEN_AVAILABLE: command.deviceId = { sourceId: STK_DEVICE_ID_DISPLAY, destinationId: STK_DEVICE_ID_SIM }; break; case STK_EVENT_TYPE_LANGUAGE_SELECTION: command.deviceId = { sourceId: STK_DEVICE_ID_ME, destinationId: STK_DEVICE_ID_SIM }; command.language = command.event.language; break; } this.sendICCEnvelopeCommand(command); }, /** * Send REQUEST_STK_SEND_ENVELOPE_COMMAND to ICC. * * @param tag * @patam deviceId * @param [optioanl] itemIdentifier * @param [optional] helpRequested * @param [optional] eventList * @param [optional] locationStatus * @param [optional] locationInfo * @param [optional] address * @param [optional] transactionId * @param [optional] cause * @param [optional] timerId * @param [optional] timerValue */ sendICCEnvelopeCommand: function sendICCEnvelopeCommand(options) { if (DEBUG) { debug("Stk Envelope " + JSON.stringify(options)); } Buf.newParcel(REQUEST_STK_SEND_ENVELOPE_COMMAND); // 1st mark for Parcel size Buf.startCalOutgoingSize(function(size) { // Parcel size is in string length, which costs 2 uint8 per char. Buf.writeUint32(size / 2); }); // Write a BER-TLV GsmPDUHelper.writeHexOctet(options.tag); // 2nd mark for BER length Buf.startCalOutgoingSize(function(size) { // BER length is in number of hexOctets, which costs 4 uint8 per hexOctet. GsmPDUHelper.writeHexOctet(size / 4); }); // Device Identifies GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_DEVICE_ID | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(2); GsmPDUHelper.writeHexOctet(options.deviceId.sourceId); GsmPDUHelper.writeHexOctet(options.deviceId.destinationId); // Item Identifier if (options.itemIdentifier != null) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_ITEM_ID | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(options.itemIdentifier); } // Help Request if (options.helpRequested) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_HELP_REQUEST | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(0); // Help Request doesn't have value } // Event List if (options.eventList != null) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_EVENT_LIST | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(options.eventList); } // Location Status if (options.locationStatus != null) { let len = options.locationStatus.length; GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_LOCATION_STATUS | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(options.locationStatus); } // Location Info if (options.locationInfo) { ComprehensionTlvHelper.writeLocationInfoTlv(options.locationInfo); } // Transaction Id if (options.transactionId != null) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_TRANSACTION_ID | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(options.transactionId); } // Address if (options.address) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_ADDRESS | COMPREHENSIONTLV_FLAG_CR); ComprehensionTlvHelper.writeLength( Math.ceil(options.address.length/2) + 1 // address BCD + TON ); GsmPDUHelper.writeDiallingNumber(options.address); } // Cause of disconnection. if (options.cause != null) { ComprehensionTlvHelper.writeCauseTlv(options.cause); } // Timer Identifier if (options.timerId != null) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_TIMER_IDENTIFIER | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(1); GsmPDUHelper.writeHexOctet(options.timerId); } // Timer Value if (options.timerValue != null) { ComprehensionTlvHelper.writeTimerValueTlv(options.timerValue, true); } // Language if (options.language) { ComprehensionTlvHelper.writeLanguageTlv(options.language); } // Calculate and write BER length to 2nd mark Buf.stopCalOutgoingSize(); // Calculate and write Parcel size to 1st mark Buf.stopCalOutgoingSize(); Buf.writeUint32(0); Buf.sendParcel(); }, /** * Check a given number against the list of emergency numbers provided by the RIL. * * @param number * The number to look up. */ _isEmergencyNumber: function _isEmergencyNumber(number) { // Check read-write ecclist property first. let numbers = libcutils.property_get("ril.ecclist"); if (!numbers) { // Then read-only ecclist property since others RIL only uses this. numbers = libcutils.property_get("ro.ril.ecclist"); } if (numbers) { numbers = numbers.split(","); } else { // No ecclist system property, so use our own list. numbers = DEFAULT_EMERGENCY_NUMBERS; } return numbers.indexOf(number) != -1; }, /** * Checks whether to temporarily suppress caller id for the call. * * @param mmi * MMI full object. */ _isTemporaryModeCLIR: function _isTemporaryModeCLIR(mmi) { return (mmi && mmi.serviceCode == MMI_SC_CLIR && mmi.dialNumber && (mmi.procedure == MMI_PROCEDURE_ACTIVATION || mmi.procedure == MMI_PROCEDURE_DEACTIVATION)); }, /** * Report STK Service is running. */ reportStkServiceIsRunning: function reportStkServiceIsRunning() { Buf.simpleRequest(REQUEST_REPORT_STK_SERVICE_IS_RUNNING); }, /** * Process ICC status. */ _processICCStatus: function _processICCStatus(iccStatus) { this.iccStatus = iccStatus; let newCardState; if ((!iccStatus) || (iccStatus.cardState == CARD_STATE_ABSENT)) { switch (this.radioState) { case GECKO_RADIOSTATE_UNAVAILABLE: newCardState = GECKO_CARDSTATE_UNKNOWN; break; case GECKO_RADIOSTATE_OFF: newCardState = GECKO_CARDSTATE_NOT_READY; break; case GECKO_RADIOSTATE_READY: if (DEBUG) { debug("ICC absent"); } newCardState = GECKO_CARDSTATE_ABSENT; break; } if (newCardState == this.cardState) { return; } this.iccInfo = {iccType: null}; ICCUtilsHelper.handleICCInfoChange(); this.cardState = newCardState; this.sendChromeMessage({rilMessageType: "cardstatechange", cardState: this.cardState}); return; } let index = this._isCdma ? iccStatus.cdmaSubscriptionAppIndex : iccStatus.gsmUmtsSubscriptionAppIndex; let app = iccStatus.apps[index]; if (iccStatus.cardState == CARD_STATE_ERROR || !app) { if (this.cardState == GECKO_CARDSTATE_UNKNOWN) { this.operator = null; return; } this.operator = null; this.cardState = GECKO_CARDSTATE_UNKNOWN; this.sendChromeMessage({rilMessageType: "cardstatechange", cardState: this.cardState}); return; } // fetchICCRecords will need to read aid, so read aid here. this.aid = app.aid; this.appType = app.app_type; switch (app.app_state) { case CARD_APPSTATE_PIN: newCardState = GECKO_CARDSTATE_PIN_REQUIRED; break; case CARD_APPSTATE_PUK: newCardState = GECKO_CARDSTATE_PUK_REQUIRED; break; case CARD_APPSTATE_SUBSCRIPTION_PERSO: newCardState = PERSONSUBSTATE[app.perso_substate]; break; case CARD_APPSTATE_READY: newCardState = GECKO_CARDSTATE_READY; break; case CARD_APPSTATE_UNKNOWN: case CARD_APPSTATE_DETECTED: // Fall through. default: newCardState = GECKO_CARDSTATE_UNKNOWN; } if (this.cardState == newCardState) { return; } // This was moved down from CARD_APPSTATE_READY this.requestNetworkInfo(); if (newCardState == GECKO_CARDSTATE_READY) { this.iccInfo.iccType = GECKO_CARD_TYPE[this.appType]; // For type SIM, we need to check EF_phase first. // Other types of ICC we can send Terminal_Profile immediately. if (this.appType == CARD_APPTYPE_SIM) { ICCRecordHelper.readICCPhase(); ICCRecordHelper.fetchICCRecords(); } else if (this.appType == CARD_APPTYPE_USIM) { this.sendStkTerminalProfile(STK_SUPPORTED_TERMINAL_PROFILE); ICCRecordHelper.fetchICCRecords(); } else if (this.appType == CARD_APPTYPE_RUIM) { this.sendStkTerminalProfile(STK_SUPPORTED_TERMINAL_PROFILE); RuimRecordHelper.fetchRuimRecords(); } this.reportStkServiceIsRunning(); } this.cardState = newCardState; this.sendChromeMessage({rilMessageType: "cardstatechange", cardState: this.cardState}); }, /** * Helper for processing responses of functions such as enterICC* and changeICC*. */ _processEnterAndChangeICCResponses: function _processEnterAndChangeICCResponses(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } options.retryCount = length ? Buf.readUint32List()[0] : -1; if (options.rilMessageType != "sendMMI") { this.sendChromeMessage(options); return; } let mmiServiceCode = options.mmiServiceCode; if (options.success) { switch (mmiServiceCode) { case MMI_KS_SC_PIN: options.statusMessage = MMI_SM_KS_PIN_CHANGED; break; case MMI_KS_SC_PIN2: options.statusMessage = MMI_SM_KS_PIN2_CHANGED; break; case MMI_KS_SC_PUK: options.statusMessage = MMI_SM_KS_PIN_UNBLOCKED; break; case MMI_KS_SC_PUK2: options.statusMessage = MMI_SM_KS_PIN2_UNBLOCKED; break; } } else { if (options.retryCount <= 0) { if (mmiServiceCode === MMI_KS_SC_PUK) { options.errorMsg = MMI_ERROR_KS_SIM_BLOCKED; } else if (mmiServiceCode === MMI_KS_SC_PIN) { options.errorMsg = MMI_ERROR_KS_NEEDS_PUK; } } else { if (mmiServiceCode === MMI_KS_SC_PIN || mmiServiceCode === MMI_KS_SC_PIN2) { options.errorMsg = MMI_ERROR_KS_BAD_PIN; } else if (mmiServiceCode === MMI_KS_SC_PUK || mmiServiceCode === MMI_KS_SC_PUK2) { options.errorMsg = MMI_ERROR_KS_BAD_PUK; } if (options.retryCount !== undefined) { options.additionalInformation = options.retryCount; } } } this.sendChromeMessage(options); }, // We combine all of the NETWORK_INFO_MESSAGE_TYPES into one "networkinfochange" // message to the RadioInterfaceLayer, so we can avoid sending multiple // VoiceInfoChanged events for both operator / voice_data_registration // // State management here is a little tricky. We need to know both: // 1. Whether or not a response was received for each of the // NETWORK_INFO_MESSAGE_TYPES // 2. The outbound message that corresponds with that response -- but this // only happens when internal state changes (i.e. it isn't guaranteed) // // To collect this state, each message response function first calls // _receivedNetworkInfo, to mark the response as received. When the // final response is received, a call to _sendPendingNetworkInfo is placed // on the next tick of the worker thread. // // Since the original call to _receivedNetworkInfo happens at the top // of the response handler, this gives the final handler a chance to // queue up it's "changed" message by calling _sendNetworkInfoMessage if/when // the internal state has actually changed. _sendNetworkInfoMessage: function _sendNetworkInfoMessage(type, message) { if (!this._processingNetworkInfo) { // We only combine these messages in the case of the combined request // in requestNetworkInfo() this.sendChromeMessage(message); return; } if (DEBUG) debug("Queuing " + type + " network info message: " + JSON.stringify(message)); this._pendingNetworkInfo[type] = message; }, _receivedNetworkInfo: function _receivedNetworkInfo(type) { if (DEBUG) debug("Received " + type + " network info."); if (!this._processingNetworkInfo) { return; } let pending = this._pendingNetworkInfo; // We still need to track states for events that aren't fired. if (!(type in pending)) { pending[type] = PENDING_NETWORK_TYPE; } // Pending network info is ready to be sent when no more messages // are waiting for responses, but the combined payload hasn't been sent. for (let i = 0; i < NETWORK_INFO_MESSAGE_TYPES.length; i++) { let msgType = NETWORK_INFO_MESSAGE_TYPES[i]; if (!(msgType in pending)) { if (DEBUG) debug("Still missing some more network info, not notifying main thread."); return; } } // Do a pass to clean up the processed messages that didn't create // a response message, so we don't have unused keys in the outbound // networkinfochanged message. for (let key in pending) { if (pending[key] == PENDING_NETWORK_TYPE) { delete pending[key]; } } if (DEBUG) debug("All pending network info has been received: " + JSON.stringify(pending)); // Send the message on the next tick of the worker's loop, so we give the // last message a chance to call _sendNetworkInfoMessage first. setTimeout(this._sendPendingNetworkInfo, 0); }, _sendPendingNetworkInfo: function _sendPendingNetworkInfo() { RIL.sendChromeMessage(RIL._pendingNetworkInfo); RIL._processingNetworkInfo = false; for (let i = 0; i < NETWORK_INFO_MESSAGE_TYPES.length; i++) { delete RIL._pendingNetworkInfo[NETWORK_INFO_MESSAGE_TYPES[i]]; } if (RIL._needRepollNetworkInfo) { RIL._needRepollNetworkInfo = false; RIL.requestNetworkInfo(); } }, /** * Normalize the signal strength in dBm to the signal level from 0 to 100. * * @param signal * The signal strength in dBm to normalize. * @param min * The signal strength in dBm maps to level 0. * @param max * The signal strength in dBm maps to level 100. * * @return level * The signal level from 0 to 100. */ _processSignalLevel: function _processSignalLevel(signal, min, max) { if (signal <= min) { return 0; } if (signal >= max) { return 100; } return Math.floor((signal - min) * 100 / (max - min)); }, _processSignalStrength: function _processSignalStrength(signal) { let info = { voice: { signalStrength: null, relSignalStrength: null }, data: { signalStrength: null, relSignalStrength: null } }; if (this._isCdma) { // CDMA RSSI. // Valid values are positive integers. This value is the actual RSSI value // multiplied by -1. Example: If the actual RSSI is -75, then this // response value will be 75. if (signal.cdmaDBM && signal.cdmaDBM > 0) { let signalStrength = -1 * signal.cdmaDBM; info.voice.signalStrength = signalStrength; // -105 and -70 are referred to AOSP's implementation. These values are // not constants and can be customized based on different requirement. let signalLevel = this._processSignalLevel(signalStrength, -105, -70); info.voice.relSignalStrength = signalLevel; } // EVDO RSSI. // Valid values are positive integers. This value is the actual RSSI value // multiplied by -1. Example: If the actual RSSI is -75, then this // response value will be 75. if (signal.evdoDBM && signal.evdoDBM > 0) { let signalStrength = -1 * signal.evdoDBM; info.data.signalStrength = signalStrength; // -105 and -70 are referred to AOSP's implementation. These values are // not constants and can be customized based on different requirement. let signalLevel = this._processSignalLevel(signalStrength, -105, -70); info.data.relSignalStrength = signalLevel; } } else { // GSM signal strength. // Valid values are 0-31 as defined in TS 27.007 8.5. // 0 : -113 dBm or less // 1 : -111 dBm // 2...30: -109...-53 dBm // 31 : -51 dBm if (signal.gsmSignalStrength && signal.gsmSignalStrength >= 0 && signal.gsmSignalStrength <= 31) { let signalStrength = -113 + 2 * signal.gsmSignalStrength; info.voice.signalStrength = info.data.signalStrength = signalStrength; // -115 and -85 are referred to AOSP's implementation. These values are // not constants and can be customized based on different requirement. let signalLevel = this._processSignalLevel(signalStrength, -110, -85); info.voice.relSignalStrength = info.data.relSignalStrength = signalLevel; } } info.rilMessageType = "signalstrengthchange"; this._sendNetworkInfoMessage(NETWORK_INFO_SIGNAL, info); if (this.cachedDialRequest && info.voice.signalStrength) { // Radio is ready for making the cached emergency call. this.cachedDialRequest.callback(); this.cachedDialRequest = null; } }, /** * Process the network registration flags. * * @return true if the state changed, false otherwise. */ _processCREG: function _processCREG(curState, newState) { let changed = false; let regState = RIL.parseInt(newState[0], NETWORK_CREG_STATE_UNKNOWN); if (curState.regState === undefined || curState.regState !== regState) { changed = true; curState.regState = regState; curState.state = NETWORK_CREG_TO_GECKO_MOBILE_CONNECTION_STATE[regState]; curState.connected = regState == NETWORK_CREG_STATE_REGISTERED_HOME || regState == NETWORK_CREG_STATE_REGISTERED_ROAMING; curState.roaming = regState == NETWORK_CREG_STATE_REGISTERED_ROAMING; curState.emergencyCallsOnly = (regState >= NETWORK_CREG_STATE_NOT_SEARCHING_EMERGENCY_CALLS) && (regState <= NETWORK_CREG_STATE_UNKNOWN_EMERGENCY_CALLS); if (RILQUIRKS_MODEM_DEFAULTS_TO_EMERGENCY_MODE) { curState.emergencyCallsOnly = !curState.connected; } } if (!curState.cell) { curState.cell = {}; } // From TS 23.003, 0000 and 0xfffe are indicated that no valid LAI exists // in MS. So we still need to report the '0000' as well. let lac = RIL.parseInt(newState[1], -1, 16); if (curState.cell.gsmLocationAreaCode === undefined || curState.cell.gsmLocationAreaCode !== lac) { curState.cell.gsmLocationAreaCode = lac; changed = true; } let cid = RIL.parseInt(newState[2], -1, 16); if (curState.cell.gsmCellId === undefined || curState.cell.gsmCellId !== cid) { curState.cell.gsmCellId = cid; changed = true; } let radioTech = (newState[3] === undefined ? NETWORK_CREG_TECH_UNKNOWN : RIL.parseInt(newState[3], NETWORK_CREG_TECH_UNKNOWN)); if (curState.radioTech === undefined || curState.radioTech !== radioTech) { changed = true; curState.radioTech = radioTech; curState.type = GECKO_RADIO_TECH[radioTech] || null; } return changed; }, _processVoiceRegistrationState: function _processVoiceRegistrationState(state) { let rs = this.voiceRegistrationState; let stateChanged = this._processCREG(rs, state); if (stateChanged && rs.connected) { RIL.getSMSCAddress(); } let cell = rs.cell; if (this._isCdma) { // Some variables below are not used. Comment them instead of removing to // keep the information about state[x]. let cdmaBaseStationId = RIL.parseInt(state[4], -1); let cdmaBaseStationLatitude = RIL.parseInt(state[5], -2147483648); let cdmaBaseStationLongitude = RIL.parseInt(state[6], -2147483648); // let cssIndicator = RIL.parseInt(state[7]); let cdmaSystemId = RIL.parseInt(state[8], -1); let cdmaNetworkId = RIL.parseInt(state[9], -1); // let roamingIndicator = RIL.parseInt(state[10]); // let systemIsInPRL = RIL.parseInt(state[11]); // let defaultRoamingIndicator = RIL.parseInt(state[12]); // let reasonForDenial = RIL.parseInt(state[13]); if (cell.cdmaBaseStationId !== cdmaBaseStationId || cell.cdmaBaseStationLatitude !== cdmaBaseStationLatitude || cell.cdmaBaseStationLongitude !== cdmaBaseStationLongitude || cell.cdmaSystemId !== cdmaSystemId || cell.cdmaNetworkId !== cdmaNetworkId) { stateChanged = true; cell.cdmaBaseStationId = cdmaBaseStationId; cell.cdmaBaseStationLatitude = cdmaBaseStationLatitude; cell.cdmaBaseStationLongitude = cdmaBaseStationLongitude; cell.cdmaSystemId = cdmaSystemId; cell.cdmaNetworkId = cdmaNetworkId; } } if (stateChanged) { rs.rilMessageType = "voiceregistrationstatechange"; this._sendNetworkInfoMessage(NETWORK_INFO_VOICE_REGISTRATION_STATE, rs); } }, _processDataRegistrationState: function _processDataRegistrationState(state) { let rs = this.dataRegistrationState; let stateChanged = this._processCREG(rs, state); if (stateChanged) { rs.rilMessageType = "dataregistrationstatechange"; this._sendNetworkInfoMessage(NETWORK_INFO_DATA_REGISTRATION_STATE, rs); } }, _processOperator: function _processOperator(operatorData) { if (operatorData.length < 3) { if (DEBUG) { debug("Expected at least 3 strings for operator."); } } if (!this.operator) { this.operator = { rilMessageType: "operatorchange", longName: null, shortName: null }; } let [longName, shortName, networkTuple] = operatorData; let thisTuple = (this.operator.mcc || "") + (this.operator.mnc || ""); if (this.operator.longName !== longName || this.operator.shortName !== shortName || thisTuple !== networkTuple) { this.operator.mcc = null; this.operator.mnc = null; if (networkTuple) { try { this._processNetworkTuple(networkTuple, this.operator); } catch (e) { if (DEBUG) debug("Error processing operator tuple: " + e); } } else { // According to ril.h, the operator fields will be NULL when the operator // is not currently registered. We can avoid trying to parse the numeric // tuple in that case. if (DEBUG) { debug("Operator is currently unregistered"); } } let networkName; // We won't get network name using PNN and OPL if voice registration isn't ready if (this.voiceRegistrationState.cell && this.voiceRegistrationState.cell.gsmLocationAreaCode != -1) { networkName = ICCUtilsHelper.getNetworkNameFromICC( this.operator.mcc, this.operator.mnc, this.voiceRegistrationState.cell.gsmLocationAreaCode); } if (networkName) { if (DEBUG) { debug("Operator names will be overriden: " + "longName = " + networkName.fullName + ", " + "shortName = " + networkName.shortName); } this.operator.longName = networkName.fullName; this.operator.shortName = networkName.shortName; } else { this.operator.longName = longName; this.operator.shortName = shortName; } if (ICCUtilsHelper.updateDisplayCondition()) { ICCUtilsHelper.handleICCInfoChange(); } this._sendNetworkInfoMessage(NETWORK_INFO_OPERATOR, this.operator); } }, /** * Helpers for processing call state and handle the active call. */ _processCalls: function _processCalls(newCalls) { let conferenceChanged = false; let clearConferenceRequest = false; // Go through the calls we currently have on file and see if any of them // changed state. Remove them from the newCalls map as we deal with them // so that only new calls remain in the map after we're done. for each (let currentCall in this.currentCalls) { let newCall; if (newCalls) { newCall = newCalls[currentCall.callIndex]; delete newCalls[currentCall.callIndex]; } if (!newCall) { // Call is no longer reported by the radio. Remove from our map and // send disconnected state change. if (this.currentConference.participants[currentCall.callIndex]) { conferenceChanged = true; currentCall.isConference = false; delete this.currentConference.participants[currentCall.callIndex]; delete this.currentCalls[currentCall.callIndex]; // We don't query the fail cause here as it triggers another asynchrouns // request that leads to a problem of updating all conferece participants // in one task. this._handleDisconnectedCall(currentCall); } else { delete this.currentCalls[currentCall.callIndex]; this.getFailCauseCode(currentCall); } continue; } // Call is still valid. if (newCall.state == currentCall.state && newCall.isMpty == currentCall.isMpty) { continue; } // State has changed. if (newCall.state == CALL_STATE_INCOMING && currentCall.state == CALL_STATE_WAITING) { // Update the call internally but we don't notify chrome since these two // states are viewed as the same one there. currentCall.state = newCall.state; continue; } if (!currentCall.started && newCall.state == CALL_STATE_ACTIVE) { currentCall.started = new Date().getTime(); } if (currentCall.isMpty == newCall.isMpty && newCall.state != currentCall.state) { currentCall.state = newCall.state; if (currentCall.isConference) { conferenceChanged = true; } this._handleChangedCallState(currentCall); continue; } // '.isMpty' becomes false when the conference call is put on hold. // We need to introduce additional 'isConference' to correctly record the // real conference status // Update a possible conference participant when .isMpty changes. if (!currentCall.isMpty && newCall.isMpty) { if (this._hasConferenceRequest) { conferenceChanged = true; clearConferenceRequest = true; currentCall.state = newCall.state; currentCall.isMpty = newCall.isMpty; currentCall.isConference = true; this.currentConference.participants[currentCall.callIndex] = currentCall; this._handleChangedCallState(currentCall); } else if (currentCall.isConference) { // The case happens when resuming a held conference call. conferenceChanged = true; currentCall.state = newCall.state; currentCall.isMpty = newCall.isMpty; this.currentConference.participants[currentCall.callIndex] = currentCall; this._handleChangedCallState(currentCall); } else { // Weird. This sometimes happens when we switch two calls, but it is // not a conference call. currentCall.state = newCall.state; this._handleChangedCallState(currentCall); } } else if (currentCall.isMpty && !newCall.isMpty) { if (!this.currentConference.participants[newCall.callIndex]) { continue; } // '.isMpty' of a conference participant is set to false by rild when // the conference call is put on hold. We don't actually know if the call // still attends the conference until updating all calls finishes. We // cache it for further determination. if (newCall.state != CALL_STATE_HOLDING) { delete this.currentConference.participants[newCall.callIndex]; currentCall.state = newCall.state; currentCall.isMpty = newCall.isMpty; currentCall.isConference = false; conferenceChanged = true; this._handleChangedCallState(currentCall); continue; } if (!this.currentConference.cache) { this.currentConference.cache = {}; } this.currentConference.cache[currentCall.callIndex] = newCall; currentCall.state = newCall.state; currentCall.isMpty = newCall.isMpty; conferenceChanged = true; } } // Go through any remaining calls that are new to us. for each (let newCall in newCalls) { if (newCall.isVoice) { // Format international numbers appropriately. if (newCall.number && newCall.toa == TOA_INTERNATIONAL && newCall.number[0] != "+") { newCall.number = "+" + newCall.number; } if (newCall.state == CALL_STATE_INCOMING) { newCall.isOutgoing = false; } else if (newCall.state == CALL_STATE_DIALING) { newCall.isOutgoing = true; } // Set flag for outgoing emergency call. if (newCall.isOutgoing && this._isEmergencyNumber(newCall.number)) { newCall.isEmergency = true; } else { newCall.isEmergency = false; } // Add to our map. if (newCall.isMpty) { conferenceChanged = true; newCall.isConference = true; this.currentConference.participants[newCall.callIndex] = newCall; } else { newCall.isConference = false; } this._handleChangedCallState(newCall); this.currentCalls[newCall.callIndex] = newCall; } } if (clearConferenceRequest) { this._hasConferenceRequest = false; } if (conferenceChanged) { this._ensureConference(); } // Update our mute status. If there is anything in our currentCalls map then // we know it's a voice call and we should leave audio on. this.muted = (Object.getOwnPropertyNames(this.currentCalls).length === 0); }, _ensureConference: function _ensureConference() { let oldState = this.currentConference.state; let remaining = Object.keys(this.currentConference.participants); if (remaining.length == 1) { // Remove that if only does one remain in a conference call. let call = this.currentCalls[remaining[0]]; call.isConference = false; this._handleChangedCallState(call); delete this.currentConference.participants[call.callIndex]; } else if (remaining.length > 1) { for each (let call in this.currentConference.cache) { call.isConference = true; this.currentConference.participants[call.callIndex] = call; this.currentCalls[call.callIndex] = call; this._handleChangedCallState(call); } } delete this.currentConference.cache; // Update the conference call's state. let state = null; for each (let call in this.currentConference.participants) { if (state && state != call.state) { // Each participant should have the same state, otherwise something // wrong happens. state = null; break; } state = call.state; } if (oldState != state) { this.currentConference.state = state; let message = {rilMessageType: "conferenceCallStateChanged", state: state}; this.sendChromeMessage(message); } }, _handleChangedCallState: function _handleChangedCallState(changedCall) { let message = {rilMessageType: "callStateChange", call: changedCall}; this.sendChromeMessage(message); }, _handleDisconnectedCall: function _handleDisconnectedCall(disconnectedCall) { let message = {rilMessageType: "callDisconnected", call: disconnectedCall}; this.sendChromeMessage(message); }, _sendCallError: function _sendCallError(callIndex, errorMsg) { this.sendChromeMessage({rilMessageType: "callError", callIndex: callIndex, errorMsg: errorMsg}); }, _sendDataCallError: function _sendDataCallError(message, errorCode) { // Should not include token for unsolicited response. delete message.rilMessageToken; message.rilMessageType = "datacallerror"; if (errorCode == ERROR_GENERIC_FAILURE) { message.errorMsg = RIL_ERROR_TO_GECKO_ERROR[errorCode]; } else { message.errorMsg = RIL_DATACALL_FAILCAUSE_TO_GECKO_DATACALL_ERROR[errorCode]; } this.sendChromeMessage(message); }, _processDataCallList: function _processDataCallList(datacalls, newDataCallOptions) { // Check for possible PDP errors: We check earlier because the datacall // can be removed if is the same as the current one. for each (let newDataCall in datacalls) { if (newDataCall.status != DATACALL_FAIL_NONE) { if (newDataCallOptions) { newDataCall.apn = newDataCallOptions.apn; } this._sendDataCallError(newDataCall, newDataCall.status); } } for each (let currentDataCall in this.currentDataCalls) { let updatedDataCall; if (datacalls) { updatedDataCall = datacalls[currentDataCall.cid]; delete datacalls[currentDataCall.cid]; } if (!updatedDataCall) { // If datacalls list is coming from REQUEST_SETUP_DATA_CALL response, // we do not change state for any currentDataCalls not in datacalls list. if (!newDataCallOptions) { currentDataCall.state = GECKO_NETWORK_STATE_DISCONNECTED; currentDataCall.rilMessageType = "datacallstatechange"; this.sendChromeMessage(currentDataCall); } continue; } if (updatedDataCall && !updatedDataCall.ifname) { delete this.currentDataCalls[currentDataCall.cid]; currentDataCall.state = GECKO_NETWORK_STATE_UNKNOWN; currentDataCall.rilMessageType = "datacallstatechange"; this.sendChromeMessage(currentDataCall); continue; } this._setDataCallGeckoState(updatedDataCall); if (updatedDataCall.state != currentDataCall.state) { currentDataCall.status = updatedDataCall.status; currentDataCall.active = updatedDataCall.active; currentDataCall.state = updatedDataCall.state; currentDataCall.rilMessageType = "datacallstatechange"; this.sendChromeMessage(currentDataCall); } } for each (let newDataCall in datacalls) { if (!newDataCall.ifname) { continue; } this.currentDataCalls[newDataCall.cid] = newDataCall; this._setDataCallGeckoState(newDataCall); if (newDataCallOptions) { newDataCall.radioTech = newDataCallOptions.radioTech; newDataCall.apn = newDataCallOptions.apn; newDataCall.user = newDataCallOptions.user; newDataCall.passwd = newDataCallOptions.passwd; newDataCall.chappap = newDataCallOptions.chappap; newDataCall.pdptype = newDataCallOptions.pdptype; newDataCallOptions = null; } else if (DEBUG) { debug("Unexpected new data call: " + JSON.stringify(newDataCall)); } newDataCall.rilMessageType = "datacallstatechange"; this.sendChromeMessage(newDataCall); } }, _setDataCallGeckoState: function _setDataCallGeckoState(datacall) { switch (datacall.active) { case DATACALL_INACTIVE: datacall.state = GECKO_NETWORK_STATE_DISCONNECTED; break; case DATACALL_ACTIVE_DOWN: case DATACALL_ACTIVE_UP: datacall.state = GECKO_NETWORK_STATE_CONNECTED; break; } }, _processSuppSvcNotification: function _processSuppSvcNotification(info) { debug("handle supp svc notification: " + JSON.stringify(info)); let notification = null; let callIndex = -1; if (info.notificationType === 0) { // MO intermediate result code. Refer to code1 defined in 3GPP 27.007 // 7.17. } else if (info.notificationType === 1) { // MT unsolicited result code. Refer to code2 defined in 3GPP 27.007 7.17. switch (info.code) { case SUPP_SVC_NOTIFICATION_CODE2_PUT_ON_HOLD: case SUPP_SVC_NOTIFICATION_CODE2_RETRIEVED: notification = GECKO_SUPP_SVC_NOTIFICATION_FROM_CODE2[info.code]; break; default: // Notification type not supported. return; } // Get the target call object for this notification. let currentCallIndexes = Object.keys(this.currentCalls); if (currentCallIndexes.length === 1) { // Only one call exists. This should be the target. callIndex = currentCallIndexes[0]; } else { // Find the call in |currentCalls| by the given number. if (info.number) { for each (let currentCall in this.currentCalls) { if (currentCall.number == info.number) { callIndex = currentCall.callIndex; break; } } } } } let message = {rilMessageType: "suppSvcNotification", notification: notification, callIndex: callIndex}; this.sendChromeMessage(message); }, _cancelEmergencyCbModeTimeout: function _cancelEmergencyCbModeTimeout() { if (this._exitEmergencyCbModeTimeoutID) { clearTimeout(this._exitEmergencyCbModeTimeoutID); this._exitEmergencyCbModeTimeoutID = null; } }, _handleChangedEmergencyCbMode: function _handleChangedEmergencyCbMode(active) { this._isInEmergencyCbMode = active; // Clear the existed timeout event. this._cancelEmergencyCbModeTimeout(); // Start a new timeout event when entering the mode. if (active) { this._exitEmergencyCbModeTimeoutID = setTimeout( this.exitEmergencyCbMode.bind(this), EMERGENCY_CB_MODE_TIMEOUT_MS); } let message = {rilMessageType: "emergencyCbModeChange", active: active, timeoutMs: EMERGENCY_CB_MODE_TIMEOUT_MS}; this.sendChromeMessage(message); }, _processNetworks: function _processNetworks() { let strings = Buf.readStringList(); let networks = []; for (let i = 0; i < strings.length; i += 4) { let network = { longName: strings[i], shortName: strings[i + 1], mcc: null, mnc: null, state: null }; let networkTuple = strings[i + 2]; try { this._processNetworkTuple(networkTuple, network); } catch (e) { if (DEBUG) debug("Error processing operator tuple: " + e); } let state = strings[i + 3]; if (state === NETWORK_STATE_UNKNOWN) { // TODO: looks like this might conflict in style with // GECKO_NETWORK_STYLE_UNKNOWN / nsINetworkManager state = GECKO_QAN_STATE_UNKNOWN; } network.state = state; networks.push(network); } return networks; }, /** * The "numeric" portion of the operator info is a tuple * containing MCC (country code) and MNC (network code). * AFAICT, MCC should always be 3 digits, making the remaining * portion the MNC. */ _processNetworkTuple: function _processNetworkTuple(networkTuple, network) { let tupleLen = networkTuple.length; if (tupleLen == 5 || tupleLen == 6) { network.mcc = networkTuple.substr(0, 3); network.mnc = networkTuple.substr(3); } else { network.mcc = null; network.mnc = null; throw new Error("Invalid network tuple (should be 5 or 6 digits): " + networkTuple); } }, /** * Process radio technology change. */ _processRadioTech: function _processRadioTech(radioTech) { let isCdma = true; this.radioTech = radioTech; switch(radioTech) { case NETWORK_CREG_TECH_GPRS: case NETWORK_CREG_TECH_EDGE: case NETWORK_CREG_TECH_UMTS: case NETWORK_CREG_TECH_HSDPA: case NETWORK_CREG_TECH_HSUPA: case NETWORK_CREG_TECH_HSPA: case NETWORK_CREG_TECH_LTE: case NETWORK_CREG_TECH_HSPAP: case NETWORK_CREG_TECH_GSM: isCdma = false; } if (DEBUG) { debug("Radio tech is set to: " + GECKO_RADIO_TECH[radioTech] + ", it is a " + (isCdma?"cdma":"gsm") + " technology"); } // We should request SIM information when // 1. Radio state has been changed, so we are waiting for radioTech or // 2. isCdma is different from this._isCdma. if (this._waitingRadioTech || isCdma != this._isCdma) { this._isCdma = isCdma; this._waitingRadioTech = false; if (this._isCdma) { this.getDeviceIdentity(); } else { this.getIMEI(); this.getIMEISV(); } this.getICCStatus(); } }, /** * Helper for returning the TOA for the given dial string. */ _toaFromString: function _toaFromString(number) { let toa = TOA_UNKNOWN; if (number && number.length > 0 && number[0] == '+') { toa = TOA_INTERNATIONAL; } return toa; }, /** * Helper for translating basic service group to call forwarding service class * parameter. */ _siToServiceClass: function _siToServiceClass(si) { if (!si) { return ICC_SERVICE_CLASS_NONE; } let serviceCode = parseInt(si, 10); switch (serviceCode) { case 10: return ICC_SERVICE_CLASS_SMS + ICC_SERVICE_CLASS_FAX + ICC_SERVICE_CLASS_VOICE; case 11: return ICC_SERVICE_CLASS_VOICE; case 12: return ICC_SERVICE_CLASS_SMS + ICC_SERVICE_CLASS_FAX; case 13: return ICC_SERVICE_CLASS_FAX; case 16: return ICC_SERVICE_CLASS_SMS; case 19: return ICC_SERVICE_CLASS_FAX + ICC_SERVICE_CLASS_VOICE; case 21: return ICC_SERVICE_CLASS_PAD + ICC_SERVICE_CLASS_DATA_ASYNC; case 22: return ICC_SERVICE_CLASS_PACKET + ICC_SERVICE_CLASS_DATA_SYNC; case 25: return ICC_SERVICE_CLASS_DATA_ASYNC; case 26: return ICC_SERVICE_CLASS_DATA_SYNC + SERVICE_CLASS_VOICE; case 99: return ICC_SERVICE_CLASS_PACKET; default: return ICC_SERVICE_CLASS_NONE; } }, /** * @param message A decoded SMS-DELIVER message. * * @see 3GPP TS 31.111 section 7.1.1 */ dataDownloadViaSMSPP: function dataDownloadViaSMSPP(message) { let options = { pid: message.pid, dcs: message.dcs, encoding: message.encoding, }; Buf.newParcel(REQUEST_STK_SEND_ENVELOPE_WITH_STATUS, options); Buf.seekIncoming(-1 * (Buf.getCurrentParcelSize() - Buf.getReadAvailable() - 2 * Buf.UINT32_SIZE)); // Skip response_type & request_type. let messageStringLength = Buf.readUint32(); // In semi-octets let smscLength = GsmPDUHelper.readHexOctet(); // In octets, inclusive of TOA let tpduLength = (messageStringLength / 2) - (smscLength + 1); // In octets // Device identities: 4 bytes // Address: 0 or (2 + smscLength) // SMS TPDU: (2 or 3) + tpduLength let berLen = 4 + (smscLength ? (2 + smscLength) : 0) + (tpduLength <= 127 ? 2 : 3) + tpduLength; // In octets let parcelLength = (berLen <= 127 ? 2 : 3) + berLen; // In octets Buf.writeUint32(parcelLength * 2); // In semi-octets // Write a BER-TLV GsmPDUHelper.writeHexOctet(BER_SMS_PP_DOWNLOAD_TAG); if (berLen > 127) { GsmPDUHelper.writeHexOctet(0x81); } GsmPDUHelper.writeHexOctet(berLen); // Device Identifies-TLV GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_DEVICE_ID | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(0x02); GsmPDUHelper.writeHexOctet(STK_DEVICE_ID_NETWORK); GsmPDUHelper.writeHexOctet(STK_DEVICE_ID_SIM); // Address-TLV if (smscLength) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_ADDRESS); GsmPDUHelper.writeHexOctet(smscLength); Buf.copyIncomingToOutgoing(Buf.PDU_HEX_OCTET_SIZE * smscLength); } // SMS TPDU-TLV GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_SMS_TPDU | COMPREHENSIONTLV_FLAG_CR); if (tpduLength > 127) { GsmPDUHelper.writeHexOctet(0x81); } GsmPDUHelper.writeHexOctet(tpduLength); Buf.copyIncomingToOutgoing(Buf.PDU_HEX_OCTET_SIZE * tpduLength); // Write 2 string delimitors for the total string length must be even. Buf.writeStringDelimiter(0); Buf.sendParcel(); }, /** * @param success A boolean value indicating the result of previous * SMS-DELIVER message handling. * @param responsePduLen ICC IO response PDU length in octets. * @param options An object that contains four attributes: `pid`, `dcs`, * `encoding` and `responsePduLen`. * * @see 3GPP TS 23.040 section 9.2.2.1a */ acknowledgeIncomingGsmSmsWithPDU: function acknowledgeIncomingGsmSmsWithPDU(success, responsePduLen, options) { Buf.newParcel(REQUEST_ACKNOWLEDGE_INCOMING_GSM_SMS_WITH_PDU); // Two strings. Buf.writeUint32(2); // String 1: Success Buf.writeString(success ? "1" : "0"); // String 2: RP-ACK/RP-ERROR PDU Buf.writeUint32(2 * (responsePduLen + (success ? 5 : 6))); // In semi-octet // 1. TP-MTI & TP-UDHI GsmPDUHelper.writeHexOctet(PDU_MTI_SMS_DELIVER); if (!success) { // 2. TP-FCS GsmPDUHelper.writeHexOctet(PDU_FCS_USIM_DATA_DOWNLOAD_ERROR); } // 3. TP-PI GsmPDUHelper.writeHexOctet(PDU_PI_USER_DATA_LENGTH | PDU_PI_DATA_CODING_SCHEME | PDU_PI_PROTOCOL_IDENTIFIER); // 4. TP-PID GsmPDUHelper.writeHexOctet(options.pid); // 5. TP-DCS GsmPDUHelper.writeHexOctet(options.dcs); // 6. TP-UDL if (options.encoding == PDU_DCS_MSG_CODING_7BITS_ALPHABET) { GsmPDUHelper.writeHexOctet(Math.floor(responsePduLen * 8 / 7)); } else { GsmPDUHelper.writeHexOctet(responsePduLen); } // TP-UD Buf.copyIncomingToOutgoing(Buf.PDU_HEX_OCTET_SIZE * responsePduLen); // Write 2 string delimitors for the total string length must be even. Buf.writeStringDelimiter(0); Buf.sendParcel(); }, /** * @param message A decoded SMS-DELIVER message. */ writeSmsToSIM: function writeSmsToSIM(message) { Buf.newParcel(REQUEST_WRITE_SMS_TO_SIM); // Write EFsms Status Buf.writeUint32(EFSMS_STATUS_FREE); Buf.seekIncoming(-1 * (Buf.getCurrentParcelSize() - Buf.getReadAvailable() - 2 * Buf.UINT32_SIZE)); // Skip response_type & request_type. let messageStringLength = Buf.readUint32(); // In semi-octets let smscLength = GsmPDUHelper.readHexOctet(); // In octets, inclusive of TOA let pduLength = (messageStringLength / 2) - (smscLength + 1); // In octets // 1. Write PDU first. if (smscLength > 0) { Buf.seekIncoming(smscLength * Buf.PDU_HEX_OCTET_SIZE); } // Write EFsms PDU string length Buf.writeUint32(2 * pduLength); // In semi-octets if (pduLength) { Buf.copyIncomingToOutgoing(Buf.PDU_HEX_OCTET_SIZE * pduLength); } // Write 2 string delimitors for the total string length must be even. Buf.writeStringDelimiter(0); // 2. Write SMSC // Write EFsms SMSC string length Buf.writeUint32(2 * (smscLength + 1)); // Plus smscLength itself, in semi-octets // Write smscLength GsmPDUHelper.writeHexOctet(smscLength); // Write TOA & SMSC Address if (smscLength) { Buf.seekIncoming(-1 * (Buf.getCurrentParcelSize() - Buf.getReadAvailable() - 2 * Buf.UINT32_SIZE // Skip response_type, request_type. - 2 * Buf.PDU_HEX_OCTET_SIZE)); // Skip messageStringLength & smscLength. Buf.copyIncomingToOutgoing(Buf.PDU_HEX_OCTET_SIZE * smscLength); } // Write 2 string delimitors for the total string length must be even. Buf.writeStringDelimiter(0); Buf.sendParcel(); }, /** * Helper for processing multipart SMS. * * @param message * Received sms message. * * @return A failure cause defined in 3GPP 23.040 clause 9.2.3.22. */ _processSmsMultipart: function _processSmsMultipart(message) { if (message.header && message.header.segmentMaxSeq && (message.header.segmentMaxSeq > 1)) { message = this._processReceivedSmsSegment(message); } else { if (message.encoding == PDU_DCS_MSG_CODING_8BITS_ALPHABET) { message.fullData = message.data; delete message.data; } else { message.fullBody = message.body; delete message.body; } } if (message) { message.result = PDU_FCS_OK; if (message.messageClass == GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_2]) { // `MS shall ensure that the message has been to the SMS data field in // the (U)SIM before sending an ACK to the SC.` ~ 3GPP 23.038 clause 4 message.result = PDU_FCS_RESERVED; } message.rilMessageType = "sms-received"; this.sendChromeMessage(message); // We will acknowledge receipt of the SMS after we try to store it // in the database. return MOZ_FCS_WAIT_FOR_EXPLICIT_ACK; } return PDU_FCS_OK; }, /** * Helper for processing SMS-STATUS-REPORT PDUs. * * @param length * Length of SMS string in the incoming parcel. * * @return A failure cause defined in 3GPP 23.040 clause 9.2.3.22. */ _processSmsStatusReport: function _processSmsStatusReport(length) { let [message, result] = GsmPDUHelper.processReceivedSms(length); if (!message) { if (DEBUG) debug("invalid SMS-STATUS-REPORT"); return PDU_FCS_UNSPECIFIED; } let options = this._pendingSentSmsMap[message.messageRef]; if (!options) { if (DEBUG) debug("no pending SMS-SUBMIT message"); return PDU_FCS_OK; } let status = message.status; // 3GPP TS 23.040 9.2.3.15 `The MS shall interpret any reserved values as // "Service Rejected"(01100011) but shall store them exactly as received.` if ((status >= 0x80) || ((status >= PDU_ST_0_RESERVED_BEGIN) && (status < PDU_ST_0_SC_SPECIFIC_BEGIN)) || ((status >= PDU_ST_1_RESERVED_BEGIN) && (status < PDU_ST_1_SC_SPECIFIC_BEGIN)) || ((status >= PDU_ST_2_RESERVED_BEGIN) && (status < PDU_ST_2_SC_SPECIFIC_BEGIN)) || ((status >= PDU_ST_3_RESERVED_BEGIN) && (status < PDU_ST_3_SC_SPECIFIC_BEGIN)) ) { status = PDU_ST_3_SERVICE_REJECTED; } // Pending. Waiting for next status report. if ((status >>> 5) == 0x01) { if (DEBUG) debug("SMS-STATUS-REPORT: delivery still pending"); return PDU_FCS_OK; } delete this._pendingSentSmsMap[message.messageRef]; let deliveryStatus = ((status >>> 5) === 0x00) ? GECKO_SMS_DELIVERY_STATUS_SUCCESS : GECKO_SMS_DELIVERY_STATUS_ERROR; this.sendChromeMessage({ rilMessageType: options.rilMessageType, rilMessageToken: options.rilMessageToken, deliveryStatus: deliveryStatus }); return PDU_FCS_OK; }, /** * Helper for processing received multipart SMS. * * @return null for handled segments, and an object containing full message * body/data once all segments are received. */ _processReceivedSmsSegment: function _processReceivedSmsSegment(original) { let hash = original.sender + ":" + original.header.segmentRef; let seq = original.header.segmentSeq; let options = this._receivedSmsSegmentsMap[hash]; if (!options) { options = original; this._receivedSmsSegmentsMap[hash] = options; options.segmentMaxSeq = original.header.segmentMaxSeq; options.receivedSegments = 0; options.segments = []; } else if (options.segments[seq]) { // Duplicated segment? if (DEBUG) { debug("Got duplicated segment no." + seq + " of a multipart SMS: " + JSON.stringify(original)); } return null; } if (options.encoding == PDU_DCS_MSG_CODING_8BITS_ALPHABET) { options.segments[seq] = original.data; delete original.data; } else { options.segments[seq] = original.body; delete original.body; } options.receivedSegments++; if (options.receivedSegments < options.segmentMaxSeq) { if (DEBUG) { debug("Got segment no." + seq + " of a multipart SMS: " + JSON.stringify(options)); } return null; } // Remove from map delete this._receivedSmsSegmentsMap[hash]; // Rebuild full body if (options.encoding == PDU_DCS_MSG_CODING_8BITS_ALPHABET) { // Uint8Array doesn't have `concat`, so we have to merge all segements // by hand. let fullDataLen = 0; for (let i = 1; i <= options.segmentMaxSeq; i++) { fullDataLen += options.segments[i].length; } options.fullData = new Uint8Array(fullDataLen); for (let d= 0, i = 1; i <= options.segmentMaxSeq; i++) { let data = options.segments[i]; for (let j = 0; j < data.length; j++) { options.fullData[d++] = data[j]; } } } else { options.fullBody = options.segments.join(""); } if (DEBUG) { debug("Got full multipart SMS: " + JSON.stringify(options)); } return options; }, /** * Helper for processing sent multipart SMS. */ _processSentSmsSegment: function _processSentSmsSegment(options) { // Setup attributes for sending next segment let next = options.segmentSeq; options.body = options.segments[next].body; options.encodedBodyLength = options.segments[next].encodedBodyLength; options.segmentSeq = next + 1; this.sendSMS(options); }, /** * Helper for processing result of send SMS. * * @param length * Length of SMS string in the incoming parcel. * @param options * Sms information. */ _processSmsSendResult: function _processSmsSendResult(length, options) { if (options.rilRequestError) { if (DEBUG) debug("_processSmsSendResult: rilRequestError = " + options.rilRequestError); switch (options.rilRequestError) { case ERROR_SMS_SEND_FAIL_RETRY: if (options.retryCount < SMS_RETRY_MAX) { options.retryCount++; // TODO: bug 736702 TP-MR, retry interval, retry timeout this.sendSMS(options); break; } // Fallback to default error handling if it meets max retry count. // Fall through. default: this.sendChromeMessage({ rilMessageType: options.rilMessageType, rilMessageToken: options.rilMessageToken, errorMsg: options.rilRequestError, }); break; } return; } options.messageRef = Buf.readUint32(); options.ackPDU = Buf.readString(); options.errorCode = Buf.readUint32(); if ((options.segmentMaxSeq > 1) && (options.segmentSeq < options.segmentMaxSeq)) { // Not last segment this._processSentSmsSegment(options); } else { // Last segment sent with success. if (options.requestStatusReport) { if (DEBUG) debug("waiting SMS-STATUS-REPORT for messageRef " + options.messageRef); this._pendingSentSmsMap[options.messageRef] = options; } this.sendChromeMessage({ rilMessageType: options.rilMessageType, rilMessageToken: options.rilMessageToken, }); } }, _processReceivedSmsCbPage: function _processReceivedSmsCbPage(original) { if (original.numPages <= 1) { if (original.body) { original.fullBody = original.body; delete original.body; } else if (original.data) { original.fullData = original.data; delete original.data; } return original; } // Hash = :::: let hash = original.serial + ":" + this.iccInfo.mcc + ":" + this.iccInfo.mnc + ":"; switch (original.geographicalScope) { case CB_GSM_GEOGRAPHICAL_SCOPE_CELL_WIDE_IMMEDIATE: case CB_GSM_GEOGRAPHICAL_SCOPE_CELL_WIDE: hash += this.voiceRegistrationState.cell.gsmLocationAreaCode + ":" + this.voiceRegistrationState.cell.gsmCellId; break; case CB_GSM_GEOGRAPHICAL_SCOPE_LOCATION_AREA_WIDE: hash += this.voiceRegistrationState.cell.gsmLocationAreaCode + ":"; break; default: hash += ":"; break; } let index = original.pageIndex; let options = this._receivedSmsCbPagesMap[hash]; if (!options) { options = original; this._receivedSmsCbPagesMap[hash] = options; options.receivedPages = 0; options.pages = []; } else if (options.pages[index]) { // Duplicated page? if (DEBUG) { debug("Got duplicated page no." + index + " of a multipage SMSCB: " + JSON.stringify(original)); } return null; } if (options.encoding == PDU_DCS_MSG_CODING_8BITS_ALPHABET) { options.pages[index] = original.data; delete original.data; } else { options.pages[index] = original.body; delete original.body; } options.receivedPages++; if (options.receivedPages < options.numPages) { if (DEBUG) { debug("Got page no." + index + " of a multipage SMSCB: " + JSON.stringify(options)); } return null; } // Remove from map delete this._receivedSmsCbPagesMap[hash]; // Rebuild full body if (options.encoding == PDU_DCS_MSG_CODING_8BITS_ALPHABET) { // Uint8Array doesn't have `concat`, so we have to merge all pages by hand. let fullDataLen = 0; for (let i = 1; i <= options.numPages; i++) { fullDataLen += options.pages[i].length; } options.fullData = new Uint8Array(fullDataLen); for (let d= 0, i = 1; i <= options.numPages; i++) { let data = options.pages[i]; for (let j = 0; j < data.length; j++) { options.fullData[d++] = data[j]; } } } else { options.fullBody = options.pages.join(""); } if (DEBUG) { debug("Got full multipage SMSCB: " + JSON.stringify(options)); } return options; }, _mergeCellBroadcastConfigs: function _mergeCellBroadcastConfigs(list, from, to) { if (!list) { return [from, to]; } for (let i = 0, f1, t1; i < list.length;) { f1 = list[i++]; t1 = list[i++]; if (to == f1) { // ...[from]...[to|f1]...(t1) list[i - 2] = from; return list; } if (to < f1) { // ...[from]...(to)...[f1] or ...[from]...(to)[f1] if (i > 2) { // Not the first range pair, merge three arrays. return list.slice(0, i - 2).concat([from, to]).concat(list.slice(i - 2)); } else { return [from, to].concat(list); } } if (from > t1) { // ...[f1]...(t1)[from] or ...[f1]...(t1)...[from] continue; } // Have overlap or merge-able adjacency with [f1]...(t1). Replace it // with [min(from, f1)]...(max(to, t1)). let changed = false; if (from < f1) { // [from]...[f1]...(t1) or [from][f1]...(t1) // Save minimum from value. list[i - 2] = from; changed = true; } if (to <= t1) { // [from]...[to](t1) or [from]...(to|t1) // Can't have further merge-able adjacency. Return. return list; } // Try merging possible next adjacent range. let j = i; for (let f2, t2; j < list.length;) { f2 = list[j++]; t2 = list[j++]; if (to > t2) { // [from]...[f2]...[t2]...(to) or [from]...[f2]...[t2](to) // Merge next adjacent range again. continue; } if (to < t2) { if (to < f2) { // [from]...(to)[f2] or [from]...(to)...[f2] // Roll back and give up. j -= 2; } else if (to < t2) { // [from]...[to|f2]...(t2), or [from]...[f2]...[to](t2) // Merge to [from]...(t2) and give up. to = t2; } } break; } // Save maximum to value. list[i - 1] = to; if (j != i) { // Remove merged adjacent ranges. let ret = list.slice(0, i); if (j < list.length) { ret = ret.concat(list.slice(j)); } return ret; } return list; } // Append to the end. list.push(from); list.push(to); return list; }, _isCellBroadcastConfigReady: function() { if (!("MMI" in this.cellBroadcastConfigs)) { return false; } // CBMI should be ready in GSM. if (!this._isCdma && (!("CBMI" in this.cellBroadcastConfigs) || !("CBMID" in this.cellBroadcastConfigs) || !("CBMIR" in this.cellBroadcastConfigs))) { return false; } return true; }, /** * Merge all members of cellBroadcastConfigs into mergedCellBroadcastConfig. */ _mergeAllCellBroadcastConfigs: function _mergeAllCellBroadcastConfigs() { if (!this._isCellBroadcastConfigReady()) { if (DEBUG) { debug("cell broadcast configs not ready, waiting ..."); } return; } // Prepare cell broadcast config. CBMI* are only used in GSM. let usedCellBroadcastConfigs = {MMI: this.cellBroadcastConfigs.MMI}; if (!this._isCdma) { usedCellBroadcastConfigs.CBMI = this.cellBroadcastConfigs.CBMI; usedCellBroadcastConfigs.CBMID = this.cellBroadcastConfigs.CBMID; usedCellBroadcastConfigs.CBMIR = this.cellBroadcastConfigs.CBMIR; } if (DEBUG) { debug("Cell Broadcast search lists: " + JSON.stringify(usedCellBroadcastConfigs)); } let list = null; for each (let ll in usedCellBroadcastConfigs) { if (ll == null) { continue; } for (let i = 0; i < ll.length; i += 2) { list = this._mergeCellBroadcastConfigs(list, ll[i], ll[i + 1]); } } if (DEBUG) { debug("Cell Broadcast search lists(merged): " + JSON.stringify(list)); } this.mergedCellBroadcastConfig = list; this.updateCellBroadcastConfig(); }, /** * Check whether search list from settings is settable by MMI, that is, * whether the range is bounded in any entries of CB_NON_MMI_SETTABLE_RANGES. */ _checkCellBroadcastMMISettable: function _checkCellBroadcastMMISettable(from, to) { if ((to <= from) || (from >= 65536) || (from < 0)) { return false; } if (!this._isCdma) { // GSM not settable ranges. for (let i = 0, f, t; i < CB_NON_MMI_SETTABLE_RANGES.length;) { f = CB_NON_MMI_SETTABLE_RANGES[i++]; t = CB_NON_MMI_SETTABLE_RANGES[i++]; if ((from < t) && (to > f)) { // Have overlap. return false; } } } return true; }, /** * Convert Cell Broadcast settings string into search list. */ _convertCellBroadcastSearchList: function _convertCellBroadcastSearchList(searchListStr) { let parts = searchListStr && searchListStr.split(","); if (!parts) { return null; } let list = null; let result, from, to; for (let range of parts) { // Match "12" or "12-34". The result will be ["12", "12", null] or // ["12-34", "12", "34"]. result = range.match(/^(\d+)(?:-(\d+))?$/); if (!result) { throw "Invalid format"; } from = parseInt(result[1], 10); to = (result[2]) ? parseInt(result[2], 10) + 1 : from + 1; if (!this._checkCellBroadcastMMISettable(from, to)) { throw "Invalid range"; } if (list == null) { list = []; } list.push(from); list.push(to); } return list; }, /** * Handle incoming messages from the main UI thread. * * @param message * Object containing the message. Messages are supposed */ handleChromeMessage: function handleChromeMessage(message) { if (DEBUG) debug("Received chrome message " + JSON.stringify(message)); let method = this[message.rilMessageType]; if (typeof method != "function") { if (DEBUG) { debug("Don't know what to do with message " + JSON.stringify(message)); } return; } method.call(this, message); }, /** * Get a list of current voice calls. */ enumerateCalls: function enumerateCalls(options) { if (DEBUG) debug("Sending all current calls"); let calls = []; for each (let call in this.currentCalls) { calls.push(call); } options.calls = calls; this.sendChromeMessage(options); }, /** * Get a list of current data calls. */ enumerateDataCalls: function enumerateDataCalls() { let datacall_list = []; for each (let datacall in this.currentDataCalls) { datacall_list.push(datacall); } this.sendChromeMessage({rilMessageType: "datacalllist", datacalls: datacall_list}); }, /** * Process STK Proactive Command. */ processStkProactiveCommand: function processStkProactiveCommand() { let length = Buf.readUint32(); let berTlv = BerTlvHelper.decode(length / 2); Buf.readStringDelimiter(length); let ctlvs = berTlv.value; let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_COMMAND_DETAILS, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Can't find COMMAND_DETAILS ComprehensionTlv"); } let cmdDetails = ctlv.value; if (DEBUG) { debug("commandNumber = " + cmdDetails.commandNumber + " typeOfCommand = " + cmdDetails.typeOfCommand.toString(16) + " commandQualifier = " + cmdDetails.commandQualifier); } // STK_CMD_MORE_TIME need not to propagate event to chrome. if (cmdDetails.typeOfCommand == STK_CMD_MORE_TIME) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_OK}); return; } cmdDetails.rilMessageType = "stkcommand"; cmdDetails.options = StkCommandParamsFactory.createParam(cmdDetails, ctlvs); RIL.sendChromeMessage(cmdDetails); }, /** * Send messages to the main thread. */ sendChromeMessage: function sendChromeMessage(message) { postMessage(message); }, /** * Handle incoming requests from the RIL. We find the method that * corresponds to the request type. Incidentally, the request type * _is_ the method name, so that's easy. */ handleParcel: function handleParcel(request_type, length, options) { let method = this[request_type]; if (typeof method == "function") { if (DEBUG) debug("Handling parcel as " + method.name); method.call(this, length, options); } }, setInitialOptions: function setInitialOptions(options) { DEBUG = DEBUG_WORKER || options.debug; CLIENT_ID = options.clientId; this.cellBroadcastDisabled = options.cellBroadcastDisabled; this.clirMode = options.clirMode; } }; RIL.initRILState(); RIL[REQUEST_GET_SIM_STATUS] = function REQUEST_GET_SIM_STATUS(length, options) { if (options.rilRequestError) { return; } let iccStatus = {}; iccStatus.cardState = Buf.readUint32(); // CARD_STATE_* iccStatus.universalPINState = Buf.readUint32(); // CARD_PINSTATE_* iccStatus.gsmUmtsSubscriptionAppIndex = Buf.readUint32(); iccStatus.cdmaSubscriptionAppIndex = Buf.readUint32(); if (!RILQUIRKS_V5_LEGACY) { iccStatus.imsSubscriptionAppIndex = Buf.readUint32(); } let apps_length = Buf.readUint32(); if (apps_length > CARD_MAX_APPS) { apps_length = CARD_MAX_APPS; } iccStatus.apps = []; for (let i = 0 ; i < apps_length ; i++) { iccStatus.apps.push({ app_type: Buf.readUint32(), // CARD_APPTYPE_* app_state: Buf.readUint32(), // CARD_APPSTATE_* perso_substate: Buf.readUint32(), // CARD_PERSOSUBSTATE_* aid: Buf.readString(), app_label: Buf.readString(), pin1_replaced: Buf.readUint32(), pin1: Buf.readUint32(), pin2: Buf.readUint32() }); if (RILQUIRKS_SIM_APP_STATE_EXTRA_FIELDS) { Buf.readUint32(); Buf.readUint32(); Buf.readUint32(); Buf.readUint32(); } } if (DEBUG) debug("iccStatus: " + JSON.stringify(iccStatus)); this._processICCStatus(iccStatus); }; RIL[REQUEST_ENTER_SIM_PIN] = function REQUEST_ENTER_SIM_PIN(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_ENTER_SIM_PUK] = function REQUEST_ENTER_SIM_PUK(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_ENTER_SIM_PIN2] = function REQUEST_ENTER_SIM_PIN2(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_ENTER_SIM_PUK2] = function REQUEST_ENTER_SIM_PUK(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_CHANGE_SIM_PIN] = function REQUEST_CHANGE_SIM_PIN(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_CHANGE_SIM_PIN2] = function REQUEST_CHANGE_SIM_PIN2(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_ENTER_NETWORK_DEPERSONALIZATION_CODE] = function REQUEST_ENTER_NETWORK_DEPERSONALIZATION_CODE(length, options) { this._processEnterAndChangeICCResponses(length, options); }; RIL[REQUEST_GET_CURRENT_CALLS] = function REQUEST_GET_CURRENT_CALLS(length, options) { if (options.rilRequestError) { return; } let calls_length = 0; // The RIL won't even send us the length integer if there are no active calls. // So only read this integer if the parcel actually has it. if (length) { calls_length = Buf.readUint32(); } if (!calls_length) { this._processCalls(null); return; } let calls = {}; for (let i = 0; i < calls_length; i++) { let call = {}; // Extra uint32 field to get correct callIndex and rest of call data for // call waiting feature. if (RILQUIRKS_EXTRA_UINT32_2ND_CALL && i > 0) { Buf.readUint32(); } call.state = Buf.readUint32(); // CALL_STATE_* call.callIndex = Buf.readUint32(); // GSM index (1-based) call.toa = Buf.readUint32(); call.isMpty = Boolean(Buf.readUint32()); call.isMT = Boolean(Buf.readUint32()); call.als = Buf.readUint32(); call.isVoice = Boolean(Buf.readUint32()); call.isVoicePrivacy = Boolean(Buf.readUint32()); if (RILQUIRKS_CALLSTATE_EXTRA_UINT32) { Buf.readUint32(); } call.number = Buf.readString(); //TODO munge with TOA call.numberPresentation = Buf.readUint32(); // CALL_PRESENTATION_* call.name = Buf.readString(); call.namePresentation = Buf.readUint32(); call.uusInfo = null; let uusInfoPresent = Buf.readUint32(); if (uusInfoPresent == 1) { call.uusInfo = { type: Buf.readUint32(), dcs: Buf.readUint32(), userData: null //XXX TODO byte array?!? }; } calls[call.callIndex] = call; } this._processCalls(calls); }; RIL[REQUEST_DIAL] = function REQUEST_DIAL(length, options) { if (options.rilRequestError) { // The connection is not established yet. options.callIndex = -1; this.getFailCauseCode(options); return; } }; RIL[REQUEST_GET_IMSI] = function REQUEST_GET_IMSI(length, options) { if (options.rilRequestError) { return; } this.iccInfoPrivate.imsi = Buf.readString(); if (DEBUG) { debug("IMSI: " + this.iccInfoPrivate.imsi); } options.rilMessageType = "iccimsi"; options.imsi = this.iccInfoPrivate.imsi; this.sendChromeMessage(options); if (this._isCdma) { let mccMnc = ICCUtilsHelper.parseMccMncFromImsi(this.iccInfoPrivate.imsi); if (mccMnc) { this.iccInfo.mcc = mccMnc.mcc; this.iccInfo.mnc = mccMnc.mnc; ICCUtilsHelper.handleICCInfoChange(); } } }; RIL[REQUEST_HANGUP] = function REQUEST_HANGUP(length, options) { if (options.rilRequestError) { return; } this.getCurrentCalls(); }; RIL[REQUEST_HANGUP_WAITING_OR_BACKGROUND] = function REQUEST_HANGUP_WAITING_OR_BACKGROUND(length, options) { if (options.rilRequestError) { return; } this.getCurrentCalls(); }; RIL[REQUEST_HANGUP_FOREGROUND_RESUME_BACKGROUND] = function REQUEST_HANGUP_FOREGROUND_RESUME_BACKGROUND(length, options) { if (options.rilRequestError) { return; } this.getCurrentCalls(); }; RIL[REQUEST_SWITCH_WAITING_OR_HOLDING_AND_ACTIVE] = function REQUEST_SWITCH_WAITING_OR_HOLDING_AND_ACTIVE(length, options) { if (options.rilRequestError) { return; } this.getCurrentCalls(); }; RIL[REQUEST_SWITCH_HOLDING_AND_ACTIVE] = function REQUEST_SWITCH_HOLDING_AND_ACTIVE(length, options) { if (options.rilRequestError) { return; } // XXX Normally we should get a UNSOLICITED_RESPONSE_CALL_STATE_CHANGED parcel // notifying us of call state changes, but sometimes we don't (have no idea why). // this.getCurrentCalls() helps update the call state actively. this.getCurrentCalls(); }; RIL[REQUEST_CONFERENCE] = function REQUEST_CONFERENCE(length, options) { if (options.rilRequestError) { this._hasConferenceRequest = false; return; } }; RIL[REQUEST_UDUB] = null; RIL[REQUEST_LAST_CALL_FAIL_CAUSE] = function REQUEST_LAST_CALL_FAIL_CAUSE(length, options) { let num = 0; if (length) { num = Buf.readUint32(); } if (!num) { // No response of REQUEST_LAST_CALL_FAIL_CAUSE. Change the call state into // 'disconnected' directly. this._handleDisconnectedCall(options); return; } let failCause = Buf.readUint32(); switch (failCause) { case CALL_FAIL_NORMAL: this._handleDisconnectedCall(options); break; default: this._sendCallError(options.callIndex, RIL_CALL_FAILCAUSE_TO_GECKO_CALL_ERROR[failCause]); break; } }; RIL[REQUEST_SIGNAL_STRENGTH] = function REQUEST_SIGNAL_STRENGTH(length, options) { this._receivedNetworkInfo(NETWORK_INFO_SIGNAL); if (options.rilRequestError) { return; } let signal = { gsmSignalStrength: Buf.readUint32(), gsmBitErrorRate: Buf.readUint32(), cdmaDBM: Buf.readUint32(), cdmaECIO: Buf.readUint32(), evdoDBM: Buf.readUint32(), evdoECIO: Buf.readUint32(), evdoSNR: Buf.readUint32() }; if (!RILQUIRKS_V5_LEGACY) { signal.lteSignalStrength = Buf.readUint32(); signal.lteRSRP = Buf.readUint32(); signal.lteRSRQ = Buf.readUint32(); signal.lteRSSNR = Buf.readUint32(); signal.lteCQI = Buf.readUint32(); } if (DEBUG) debug("signal strength: " + JSON.stringify(signal)); this._processSignalStrength(signal); }; RIL[REQUEST_VOICE_REGISTRATION_STATE] = function REQUEST_VOICE_REGISTRATION_STATE(length, options) { this._receivedNetworkInfo(NETWORK_INFO_VOICE_REGISTRATION_STATE); if (options.rilRequestError) { return; } let state = Buf.readStringList(); if (DEBUG) debug("voice registration state: " + state); this._processVoiceRegistrationState(state); if (this.cachedDialRequest && (this.voiceRegistrationState.emergencyCallsOnly || this.voiceRegistrationState.connected) && this.voiceRegistrationState.radioTech != NETWORK_CREG_TECH_UNKNOWN) { // Radio is ready for making the cached emergency call. this.cachedDialRequest.callback(); this.cachedDialRequest = null; } }; RIL[REQUEST_DATA_REGISTRATION_STATE] = function REQUEST_DATA_REGISTRATION_STATE(length, options) { this._receivedNetworkInfo(NETWORK_INFO_DATA_REGISTRATION_STATE); if (options.rilRequestError) { return; } let state = Buf.readStringList(); this._processDataRegistrationState(state); }; RIL[REQUEST_OPERATOR] = function REQUEST_OPERATOR(length, options) { this._receivedNetworkInfo(NETWORK_INFO_OPERATOR); if (options.rilRequestError) { return; } let operatorData = Buf.readStringList(); if (DEBUG) debug("Operator: " + operatorData); this._processOperator(operatorData); }; RIL[REQUEST_RADIO_POWER] = function REQUEST_RADIO_POWER(length, options) { if (options.rilRequestError) { if (this.cachedDialRequest && options.on) { // Turning on radio fails. Notify the error of making an emergency call. this.cachedDialRequest.onerror(GECKO_ERROR_RADIO_NOT_AVAILABLE); this.cachedDialRequest = null; } return; } if (this._isInitialRadioState) { this._isInitialRadioState = false; } }; RIL[REQUEST_DTMF] = null; RIL[REQUEST_SEND_SMS] = function REQUEST_SEND_SMS(length, options) { this._processSmsSendResult(length, options); }; RIL[REQUEST_SEND_SMS_EXPECT_MORE] = null; RIL.readSetupDataCall_v5 = function readSetupDataCall_v5(options) { if (!options) { options = {}; } let [cid, ifname, ipaddr, dns, gw] = Buf.readStringList(); options.cid = cid; options.ifname = ifname; options.ipaddr = ipaddr; options.dns = dns; options.gw = gw; options.active = DATACALL_ACTIVE_UNKNOWN; options.state = GECKO_NETWORK_STATE_CONNECTING; return options; }; RIL[REQUEST_SETUP_DATA_CALL] = function REQUEST_SETUP_DATA_CALL(length, options) { if (options.rilRequestError) { // On Data Call generic errors, we shall notify caller this._sendDataCallError(options, options.rilRequestError); return; } if (RILQUIRKS_V5_LEGACY) { // Populate the `options` object with the data call information. That way // we retain the APN and other info about how the data call was set up. this.readSetupDataCall_v5(options); this.currentDataCalls[options.cid] = options; options.rilMessageType = "datacallstatechange"; this.sendChromeMessage(options); // Let's get the list of data calls to ensure we know whether it's active // or not. this.getDataCallList(); return; } // Pass `options` along. That way we retain the APN and other info about // how the data call was set up. this[REQUEST_DATA_CALL_LIST](length, options); }; RIL[REQUEST_SIM_IO] = function REQUEST_SIM_IO(length, options) { if (!length) { ICCIOHelper.processICCIOError(options); return; } // Don't need to read rilRequestError since we can know error status from // sw1 and sw2. options.sw1 = Buf.readUint32(); options.sw2 = Buf.readUint32(); if (options.sw1 != ICC_STATUS_NORMAL_ENDING) { ICCIOHelper.processICCIOError(options); return; } ICCIOHelper.processICCIO(options); }; RIL[REQUEST_SEND_USSD] = function REQUEST_SEND_USSD(length, options) { if (DEBUG) { debug("REQUEST_SEND_USSD " + JSON.stringify(options)); } options.success = (this._ussdSession = options.rilRequestError === 0); options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); }; RIL[REQUEST_CANCEL_USSD] = function REQUEST_CANCEL_USSD(length, options) { if (DEBUG) { debug("REQUEST_CANCEL_USSD" + JSON.stringify(options)); } options.success = (options.rilRequestError === 0); this._ussdSession = !options.success; options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); }; RIL[REQUEST_GET_CLIR] = function REQUEST_GET_CLIR(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } let bufLength = Buf.readUint32(); if (!bufLength || bufLength < 2) { options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; this.sendChromeMessage(options); return; } options.n = Buf.readUint32(); // Will be TS 27.007 +CLIR parameter 'n'. options.m = Buf.readUint32(); // Will be TS 27.007 +CLIR parameter 'm'. if (options.rilMessageType === "sendMMI") { // TS 27.007 +CLIR parameter 'm'. switch (options.m) { // CLIR not provisioned. case 0: options.statusMessage = MMI_SM_KS_SERVICE_NOT_PROVISIONED; break; // CLIR provisioned in permanent mode. case 1: options.statusMessage = MMI_SM_KS_CLIR_PERMANENT; break; // Unknown (e.g. no network, etc.). case 2: options.success = false; options.errorMsg = MMI_ERROR_KS_ERROR; break; // CLIR temporary mode presentation restricted. case 3: // TS 27.007 +CLIR parameter 'n'. switch (options.n) { // Default. case 0: // CLIR invocation. case 1: options.statusMessage = MMI_SM_KS_CLIR_DEFAULT_ON_NEXT_CALL_ON; break; // CLIR suppression. case 2: options.statusMessage = MMI_SM_KS_CLIR_DEFAULT_ON_NEXT_CALL_OFF; break; default: options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; break; } break; // CLIR temporary mode presentation allowed. case 4: // TS 27.007 +CLIR parameter 'n'. switch (options.n) { // Default. case 0: // CLIR suppression. case 2: options.statusMessage = MMI_SM_KS_CLIR_DEFAULT_OFF_NEXT_CALL_OFF; break; // CLIR invocation. case 1: options.statusMessage = MMI_SM_KS_CLIR_DEFAULT_OFF_NEXT_CALL_ON; break; default: options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; break; } break; default: options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; break; } } this.sendChromeMessage(options); }; RIL[REQUEST_SET_CLIR] = function REQUEST_SET_CLIR(length, options) { if (options.rilMessageType == null) { // The request was made by ril_worker itself automatically. Don't report. return; } options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } else if (options.rilMessageType === "sendMMI") { switch (options.procedure) { case MMI_PROCEDURE_ACTIVATION: options.statusMessage = MMI_SM_KS_SERVICE_ENABLED; break; case MMI_PROCEDURE_DEACTIVATION: options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; break; } } this.sendChromeMessage(options); }; RIL[REQUEST_QUERY_CALL_FORWARD_STATUS] = function REQUEST_QUERY_CALL_FORWARD_STATUS(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } let rulesLength = 0; if (length) { rulesLength = Buf.readUint32(); } if (!rulesLength) { options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; this.sendChromeMessage(options); return; } let rules = new Array(rulesLength); for (let i = 0; i < rulesLength; i++) { let rule = {}; rule.active = Buf.readUint32() == 1; // CALL_FORWARD_STATUS_* rule.reason = Buf.readUint32(); // CALL_FORWARD_REASON_* rule.serviceClass = Buf.readUint32(); rule.toa = Buf.readUint32(); rule.number = Buf.readString(); rule.timeSeconds = Buf.readUint32(); rules[i] = rule; } options.rules = rules; if (options.rilMessageType === "sendMMI") { options.statusMessage = MMI_SM_KS_SERVICE_INTERROGATED; // MMI query call forwarding options request returns a set of rules that // will be exposed in the form of an array of nsIDOMMozMobileCFInfo // instances. options.additionalInformation = rules; } this.sendChromeMessage(options); }; RIL[REQUEST_SET_CALL_FORWARD] = function REQUEST_SET_CALL_FORWARD(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } else if (options.rilMessageType === "sendMMI") { switch (options.action) { case CALL_FORWARD_ACTION_ENABLE: options.statusMessage = MMI_SM_KS_SERVICE_ENABLED; break; case CALL_FORWARD_ACTION_DISABLE: options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; break; case CALL_FORWARD_ACTION_REGISTRATION: options.statusMessage = MMI_SM_KS_SERVICE_REGISTERED; break; case CALL_FORWARD_ACTION_ERASURE: options.statusMessage = MMI_SM_KS_SERVICE_ERASED; break; } } this.sendChromeMessage(options); }; RIL[REQUEST_QUERY_CALL_WAITING] = function REQUEST_QUERY_CALL_WAITING(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } if (options.callback) { options.callback.call(this, options); return; } options.length = Buf.readUint32(); options.enabled = ((Buf.readUint32() == 1) && ((Buf.readUint32() & ICC_SERVICE_CLASS_VOICE) == 0x01)); this.sendChromeMessage(options); }; RIL[REQUEST_SET_CALL_WAITING] = function REQUEST_SET_CALL_WAITING(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } if (options.callback) { options.callback.call(this, options); return; } this.sendChromeMessage(options); }; RIL[REQUEST_SMS_ACKNOWLEDGE] = null; RIL[REQUEST_GET_IMEI] = function REQUEST_GET_IMEI(length, options) { this.IMEI = Buf.readString(); let rilMessageType = options.rilMessageType; // So far we only send the IMEI back to chrome if it was requested via MMI. if (rilMessageType !== "sendMMI") { return; } options.success = (options.rilRequestError === 0); options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; if ((!options.success || this.IMEI == null) && !options.errorMsg) { options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; } options.statusMessage = this.IMEI; this.sendChromeMessage(options); }; RIL[REQUEST_GET_IMEISV] = function REQUEST_GET_IMEISV(length, options) { if (options.rilRequestError) { return; } this.IMEISV = Buf.readString(); }; RIL[REQUEST_ANSWER] = null; RIL[REQUEST_DEACTIVATE_DATA_CALL] = function REQUEST_DEACTIVATE_DATA_CALL(length, options) { if (options.rilRequestError) { return; } let datacall = this.currentDataCalls[options.cid]; delete this.currentDataCalls[options.cid]; datacall.state = GECKO_NETWORK_STATE_UNKNOWN; datacall.rilMessageType = "datacallstatechange"; this.sendChromeMessage(datacall); }; RIL[REQUEST_QUERY_FACILITY_LOCK] = function REQUEST_QUERY_FACILITY_LOCK(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } let services; if (length) { // Buf.readUint32List()[0] for Call Barring is a bit vector of services. services = Buf.readUint32List()[0]; } else { options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; this.sendChromeMessage(options); return; } options.enabled = services === 0 ? false : true; if (options.success && (options.rilMessageType === "sendMMI")) { if (!options.enabled) { options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; } else { options.statusMessage = MMI_SM_KS_SERVICE_ENABLED_FOR; let serviceClass = []; for (let serviceClassMask = 1; serviceClassMask <= ICC_SERVICE_CLASS_MAX; serviceClassMask <<= 1) { if ((serviceClassMask & services) !== 0) { serviceClass.push(MMI_KS_SERVICE_CLASS_MAPPING[serviceClassMask]); } } options.additionalInformation = serviceClass; } } this.sendChromeMessage(options); }; RIL[REQUEST_SET_FACILITY_LOCK] = function REQUEST_SET_FACILITY_LOCK(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } options.retryCount = length ? Buf.readUint32List()[0] : -1; if (options.success && (options.rilMessageType === "sendMMI")) { switch (options.procedure) { case MMI_PROCEDURE_ACTIVATION: options.statusMessage = MMI_SM_KS_SERVICE_ENABLED; break; case MMI_PROCEDURE_DEACTIVATION: options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; break; } } this.sendChromeMessage(options); }; RIL[REQUEST_CHANGE_BARRING_PASSWORD] = function REQUEST_CHANGE_BARRING_PASSWORD(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } this.sendChromeMessage(options); }; RIL[REQUEST_SIM_OPEN_CHANNEL] = function REQUEST_SIM_OPEN_CHANNEL(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } options.channel = Buf.readUint32(); if (DEBUG) debug("Setting channel number in options: " + options.channel); this.sendChromeMessage(options); }; RIL[REQUEST_SIM_CLOSE_CHANNEL] = function REQUEST_SIM_CLOSE_CHANNEL(length, options) { if (options.rilRequestError) { options.error = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } // No return value this.sendChromeMessage(options); }; RIL[REQUEST_SIM_ACCESS_CHANNEL] = function REQUEST_SIM_ACCESS_CHANNEL(length, options) { if (options.rilRequestError) { options.error = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); } options.sw1 = Buf.readUint32(); options.sw2 = Buf.readUint32(); options.simResponse = Buf.readString(); if (DEBUG) { debug("Setting return values for RIL[REQUEST_SIM_ACCESS_CHANNEL]: [" + options.sw1 + "," + options.sw2 + ", " + options.simResponse + "]"); } this.sendChromeMessage(options); }; RIL[REQUEST_QUERY_NETWORK_SELECTION_MODE] = function REQUEST_QUERY_NETWORK_SELECTION_MODE(length, options) { this._receivedNetworkInfo(NETWORK_INFO_NETWORK_SELECTION_MODE); if (options.rilRequestError) { return; } let mode = Buf.readUint32List(); let selectionMode; switch (mode[0]) { case NETWORK_SELECTION_MODE_AUTOMATIC: selectionMode = GECKO_NETWORK_SELECTION_AUTOMATIC; break; case NETWORK_SELECTION_MODE_MANUAL: selectionMode = GECKO_NETWORK_SELECTION_MANUAL; break; default: selectionMode = GECKO_NETWORK_SELECTION_UNKNOWN; break; } if (this.networkSelectionMode != selectionMode) { this.networkSelectionMode = options.mode = selectionMode; options.rilMessageType = "networkselectionmodechange"; this._sendNetworkInfoMessage(NETWORK_INFO_NETWORK_SELECTION_MODE, options); } }; RIL[REQUEST_SET_NETWORK_SELECTION_AUTOMATIC] = function REQUEST_SET_NETWORK_SELECTION_AUTOMATIC(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } this.sendChromeMessage(options); }; RIL[REQUEST_SET_NETWORK_SELECTION_MANUAL] = function REQUEST_SET_NETWORK_SELECTION_MANUAL(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } this.sendChromeMessage(options); }; RIL[REQUEST_QUERY_AVAILABLE_NETWORKS] = function REQUEST_QUERY_AVAILABLE_NETWORKS(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } else { options.networks = this._processNetworks(); } this.sendChromeMessage(options); }; RIL[REQUEST_DTMF_START] = null; RIL[REQUEST_DTMF_STOP] = null; RIL[REQUEST_BASEBAND_VERSION] = function REQUEST_BASEBAND_VERSION(length, options) { if (options.rilRequestError) { return; } this.basebandVersion = Buf.readString(); if (DEBUG) debug("Baseband version: " + this.basebandVersion); }; RIL[REQUEST_SEPARATE_CONNECTION] = null; RIL[REQUEST_SET_MUTE] = null; RIL[REQUEST_GET_MUTE] = null; RIL[REQUEST_QUERY_CLIP] = function REQUEST_QUERY_CLIP(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } let bufLength = Buf.readUint32(); if (!bufLength) { options.success = false; options.errorMsg = GECKO_ERROR_GENERIC_FAILURE; this.sendChromeMessage(options); return; } // options.provisioned informs about the called party receives the calling // party's address information: // 0 for CLIP not provisioned // 1 for CLIP provisioned // 2 for unknown options.provisioned = Buf.readUint32(); if (options.rilMessageType === "sendMMI") { switch (options.provisioned) { case 0: options.statusMessage = MMI_SM_KS_SERVICE_DISABLED; break; case 1: options.statusMessage = MMI_SM_KS_SERVICE_ENABLED; break; default: options.success = false; options.errorMsg = MMI_ERROR_KS_ERROR; break; } } this.sendChromeMessage(options); }; RIL[REQUEST_LAST_DATA_CALL_FAIL_CAUSE] = null; RIL.readDataCall_v5 = function readDataCall_v5(options) { if (!options) { options = {}; } options.cid = Buf.readUint32().toString(); options.active = Buf.readUint32(); // DATACALL_ACTIVE_* options.type = Buf.readString(); options.apn = Buf.readString(); options.address = Buf.readString(); return options; }; RIL.readDataCall_v6 = function readDataCall_v6(options) { if (!options) { options = {}; } options.status = Buf.readUint32(); // DATACALL_FAIL_* options.suggestedRetryTime = Buf.readUint32(); options.cid = Buf.readUint32().toString(); options.active = Buf.readUint32(); // DATACALL_ACTIVE_* options.type = Buf.readString(); options.ifname = Buf.readString(); options.ipaddr = Buf.readString(); options.dns = Buf.readString(); options.gw = Buf.readString(); if (options.dns) { options.dns = options.dns.split(" "); } //TODO for now we only support one address and gateway if (options.ipaddr) { options.ipaddr = options.ipaddr.split(" ")[0]; } if (options.gw) { options.gw = options.gw.split(" ")[0]; } options.ip = null; options.netmask = null; options.broadcast = null; if (options.ipaddr) { options.ip = options.ipaddr.split("/")[0]; let ip_value = netHelpers.stringToIP(options.ip); let prefix_len = options.ipaddr.split("/")[1]; let mask_value = netHelpers.makeMask(prefix_len); options.netmask = netHelpers.ipToString(mask_value); options.broadcast = netHelpers.ipToString((ip_value & mask_value) + ~mask_value); } return options; }; RIL[REQUEST_DATA_CALL_LIST] = function REQUEST_DATA_CALL_LIST(length, options) { if (options.rilRequestError) { return; } if (!length) { this._processDataCallList(null); return; } let version = 0; if (!RILQUIRKS_V5_LEGACY) { version = Buf.readUint32(); } let num = Buf.readUint32(); let datacalls = {}; for (let i = 0; i < num; i++) { let datacall; if (version < 6) { datacall = this.readDataCall_v5(); } else { datacall = this.readDataCall_v6(); } datacalls[datacall.cid] = datacall; } let newDataCallOptions = null; if (options.rilRequestType == REQUEST_SETUP_DATA_CALL) { newDataCallOptions = options; } this._processDataCallList(datacalls, newDataCallOptions); }; RIL[REQUEST_RESET_RADIO] = null; RIL[REQUEST_OEM_HOOK_RAW] = null; RIL[REQUEST_OEM_HOOK_STRINGS] = null; RIL[REQUEST_SCREEN_STATE] = null; RIL[REQUEST_SET_SUPP_SVC_NOTIFICATION] = null; RIL[REQUEST_WRITE_SMS_TO_SIM] = function REQUEST_WRITE_SMS_TO_SIM(length, options) { if (options.rilRequestError) { // `The MS shall return a "protocol error, unspecified" error message if // the short message cannot be stored in the (U)SIM, and there is other // message storage available at the MS` ~ 3GPP TS 23.038 section 4. Here // we assume we always have indexed db as another storage. this.acknowledgeGsmSms(false, PDU_FCS_PROTOCOL_ERROR); } else { this.acknowledgeGsmSms(true, PDU_FCS_OK); } }; RIL[REQUEST_DELETE_SMS_ON_SIM] = null; RIL[REQUEST_SET_BAND_MODE] = null; RIL[REQUEST_QUERY_AVAILABLE_BAND_MODE] = null; RIL[REQUEST_STK_GET_PROFILE] = null; RIL[REQUEST_STK_SET_PROFILE] = null; RIL[REQUEST_STK_SEND_ENVELOPE_COMMAND] = null; RIL[REQUEST_STK_SEND_TERMINAL_RESPONSE] = null; RIL[REQUEST_STK_HANDLE_CALL_SETUP_REQUESTED_FROM_SIM] = null; RIL[REQUEST_EXPLICIT_CALL_TRANSFER] = null; RIL[REQUEST_SET_PREFERRED_NETWORK_TYPE] = function REQUEST_SET_PREFERRED_NETWORK_TYPE(length, options) { if (options.networkType == null) { // The request was made by ril_worker itself automatically. Don't report. return; } options.success = (options.rilRequestError == ERROR_SUCCESS); this.sendChromeMessage(options); }; RIL[REQUEST_GET_PREFERRED_NETWORK_TYPE] = function REQUEST_GET_PREFERRED_NETWORK_TYPE(length, options) { let networkType; if (!options.rilRequestError) { networkType = RIL_PREFERRED_NETWORK_TYPE_TO_GECKO.indexOf(GECKO_PREFERRED_NETWORK_TYPE_DEFAULT); let responseLen = Buf.readUint32(); // Number of INT32 responsed. if (responseLen) { this.preferredNetworkType = networkType = Buf.readUint32(); } } this.sendChromeMessage({ rilMessageType: "getPreferredNetworkType", networkType: networkType, success: options.rilRequestError == ERROR_SUCCESS }); }; RIL[REQUEST_GET_NEIGHBORING_CELL_IDS] = null; RIL[REQUEST_SET_LOCATION_UPDATES] = null; RIL[REQUEST_CDMA_SET_SUBSCRIPTION_SOURCE] = null; RIL[REQUEST_CDMA_SET_ROAMING_PREFERENCE] = function REQUEST_CDMA_SET_ROAMING_PREFERENCE(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } this.sendChromeMessage(options); }; RIL[REQUEST_CDMA_QUERY_ROAMING_PREFERENCE] = function REQUEST_CDMA_QUERY_ROAMING_PREFERENCE(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } else { let mode = Buf.readUint32List(); options.mode = CDMA_ROAMING_PREFERENCE_TO_GECKO[mode[0]]; } this.sendChromeMessage(options); }; RIL[REQUEST_SET_TTY_MODE] = null; RIL[REQUEST_QUERY_TTY_MODE] = null; RIL[REQUEST_CDMA_SET_PREFERRED_VOICE_PRIVACY_MODE] = function REQUEST_CDMA_SET_PREFERRED_VOICE_PRIVACY_MODE(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } this.sendChromeMessage(options); }; RIL[REQUEST_CDMA_QUERY_PREFERRED_VOICE_PRIVACY_MODE] = function REQUEST_CDMA_QUERY_PREFERRED_VOICE_PRIVACY_MODE(length, options) { if (options.rilRequestError) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; this.sendChromeMessage(options); return; } let enabled = Buf.readUint32List(); options.enabled = enabled[0] ? true : false; this.sendChromeMessage(options); }; RIL[REQUEST_CDMA_FLASH] = null; RIL[REQUEST_CDMA_BURST_DTMF] = null; RIL[REQUEST_CDMA_VALIDATE_AND_WRITE_AKEY] = null; RIL[REQUEST_CDMA_SEND_SMS] = function REQUEST_CDMA_SEND_SMS(length, options) { this._processSmsSendResult(length, options); }; RIL[REQUEST_CDMA_SMS_ACKNOWLEDGE] = null; RIL[REQUEST_GSM_GET_BROADCAST_SMS_CONFIG] = null; RIL[REQUEST_GSM_SET_BROADCAST_SMS_CONFIG] = function REQUEST_GSM_SET_BROADCAST_SMS_CONFIG(length, options) { if (options.rilRequestError == ERROR_SUCCESS) { this.setSmsBroadcastActivation(true); } }; RIL[REQUEST_GSM_SMS_BROADCAST_ACTIVATION] = null; RIL[REQUEST_CDMA_GET_BROADCAST_SMS_CONFIG] = null; RIL[REQUEST_CDMA_SET_BROADCAST_SMS_CONFIG] = null; RIL[REQUEST_CDMA_SMS_BROADCAST_ACTIVATION] = null; RIL[REQUEST_CDMA_SUBSCRIPTION] = function REQUEST_CDMA_SUBSCRIPTION(length, options) { if (options.rilRequestError) { return; } let result = Buf.readStringList(); this.iccInfo.mdn = result[0]; // The result[1] is Home SID. (Already be handled in readCDMAHome()) // The result[2] is Home NID. (Already be handled in readCDMAHome()) this.iccInfo.min = result[3]; // The result[4] is PRL version. ICCUtilsHelper.handleICCInfoChange(); }; RIL[REQUEST_CDMA_WRITE_SMS_TO_RUIM] = null; RIL[REQUEST_CDMA_DELETE_SMS_ON_RUIM] = null; RIL[REQUEST_DEVICE_IDENTITY] = function REQUEST_DEVICE_IDENTITY(length, options) { if (options.rilRequestError) { return; } let result = Buf.readStringList(); // The result[0] is for IMEI. (Already be handled in REQUEST_GET_IMEI) // The result[1] is for IMEISV. (Already be handled in REQUEST_GET_IMEISV) // They are both ignored. this.ESN = result[2]; this.MEID = result[3]; }; RIL[REQUEST_EXIT_EMERGENCY_CALLBACK_MODE] = function REQUEST_EXIT_EMERGENCY_CALLBACK_MODE(length, options) { if (options.internal) { return; } options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } this.sendChromeMessage(options); }; RIL[REQUEST_GET_SMSC_ADDRESS] = function REQUEST_GET_SMSC_ADDRESS(length, options) { if (options.rilRequestError) { return; } this.SMSC = Buf.readString(); }; RIL[REQUEST_SET_SMSC_ADDRESS] = null; RIL[REQUEST_REPORT_SMS_MEMORY_STATUS] = null; RIL[REQUEST_REPORT_STK_SERVICE_IS_RUNNING] = null; RIL[REQUEST_ACKNOWLEDGE_INCOMING_GSM_SMS_WITH_PDU] = null; RIL[REQUEST_STK_SEND_ENVELOPE_WITH_STATUS] = function REQUEST_STK_SEND_ENVELOPE_WITH_STATUS(length, options) { if (options.rilRequestError) { this.acknowledgeGsmSms(false, PDU_FCS_UNSPECIFIED); return; } let sw1 = Buf.readUint32(); let sw2 = Buf.readUint32(); if ((sw1 == ICC_STATUS_SAT_BUSY) && (sw2 === 0x00)) { this.acknowledgeGsmSms(false, PDU_FCS_USAT_BUSY); return; } let success = ((sw1 == ICC_STATUS_NORMAL_ENDING) && (sw2 === 0x00)) || (sw1 == ICC_STATUS_NORMAL_ENDING_WITH_EXTRA); let messageStringLength = Buf.readUint32(); // In semi-octets let responsePduLen = messageStringLength / 2; // In octets if (!responsePduLen) { this.acknowledgeGsmSms(success, success ? PDU_FCS_OK : PDU_FCS_USIM_DATA_DOWNLOAD_ERROR); return; } this.acknowledgeIncomingGsmSmsWithPDU(success, responsePduLen, options); }; RIL[REQUEST_VOICE_RADIO_TECH] = function REQUEST_VOICE_RADIO_TECH(length, options) { if (options.rilRequestError) { if (DEBUG) { debug("Error when getting voice radio tech: " + options.rilRequestError); } return; } let radioTech = Buf.readUint32List(); this._processRadioTech(radioTech[0]); }; RIL[REQUEST_GET_UNLOCK_RETRY_COUNT] = function REQUEST_GET_UNLOCK_RETRY_COUNT(length, options) { options.success = (options.rilRequestError === 0); if (!options.success) { options.errorMsg = RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError]; } options.retryCount = length ? Buf.readUint32List()[0] : -1; this.sendChromeMessage(options); }; RIL[UNSOLICITED_RESPONSE_RADIO_STATE_CHANGED] = function UNSOLICITED_RESPONSE_RADIO_STATE_CHANGED() { let radioState = Buf.readUint32(); // Ensure radio state at boot time. if (this._isInitialRadioState) { // Even radioState is RADIO_STATE_OFF, we still have to maually turn radio off, // otherwise REQUEST_GET_SIM_STATUS will still report CARD_STATE_PRESENT. this.setRadioPower({on: false}); } let newState; if (radioState == RADIO_STATE_UNAVAILABLE) { newState = GECKO_RADIOSTATE_UNAVAILABLE; } else if (radioState == RADIO_STATE_OFF) { newState = GECKO_RADIOSTATE_OFF; } else { newState = GECKO_RADIOSTATE_READY; } if (DEBUG) { debug("Radio state changed from '" + this.radioState + "' to '" + newState + "'"); } if (this.radioState == newState) { return; } switch (radioState) { case RADIO_STATE_SIM_READY: case RADIO_STATE_SIM_NOT_READY: case RADIO_STATE_SIM_LOCKED_OR_ABSENT: this._isCdma = false; this._waitingRadioTech = false; break; case RADIO_STATE_RUIM_READY: case RADIO_STATE_RUIM_NOT_READY: case RADIO_STATE_RUIM_LOCKED_OR_ABSENT: case RADIO_STATE_NV_READY: case RADIO_STATE_NV_NOT_READY: this._isCdma = true; this._waitingRadioTech = false; break; case RADIO_STATE_ON: // RIL v7 // This value is defined in RIL v7, we will retrieve radio tech by another // request. We leave _isCdma untouched, and it will be set once we get the // radio technology. this._waitingRadioTech = true; this.getVoiceRadioTechnology(); break; } if ((this.radioState == GECKO_RADIOSTATE_UNAVAILABLE || this.radioState == GECKO_RADIOSTATE_OFF) && newState == GECKO_RADIOSTATE_READY) { // The radio became available, let's get its info. if (!this._waitingRadioTech) { if (this._isCdma) { this.getDeviceIdentity(); } else { this.getIMEI(); this.getIMEISV(); } } this.getBasebandVersion(); this.updateCellBroadcastConfig(); this.setPreferredNetworkType(); this.setCLIR(); } this.radioState = newState; this.sendChromeMessage({ rilMessageType: "radiostatechange", radioState: newState }); // If the radio is up and on, so let's query the card state. // On older RILs only if the card is actually ready, though. // If _waitingRadioTech is set, we don't need to get icc status now. if (radioState == RADIO_STATE_UNAVAILABLE || radioState == RADIO_STATE_OFF || this._waitingRadioTech) { return; } this.getICCStatus(); }; RIL[UNSOLICITED_RESPONSE_CALL_STATE_CHANGED] = function UNSOLICITED_RESPONSE_CALL_STATE_CHANGED() { this.getCurrentCalls(); }; RIL[UNSOLICITED_RESPONSE_VOICE_NETWORK_STATE_CHANGED] = function UNSOLICITED_RESPONSE_VOICE_NETWORK_STATE_CHANGED() { if (DEBUG) debug("Network state changed, re-requesting phone state and ICC status"); this.getICCStatus(); this.requestNetworkInfo(); }; RIL[UNSOLICITED_RESPONSE_NEW_SMS] = function UNSOLICITED_RESPONSE_NEW_SMS(length) { let [message, result] = GsmPDUHelper.processReceivedSms(length); if (message) { result = this._processSmsMultipart(message); } if (result == PDU_FCS_RESERVED || result == MOZ_FCS_WAIT_FOR_EXPLICIT_ACK) { return; } // Not reserved FCS values, send ACK now. this.acknowledgeGsmSms(result == PDU_FCS_OK, result); }; RIL[UNSOLICITED_RESPONSE_NEW_SMS_STATUS_REPORT] = function UNSOLICITED_RESPONSE_NEW_SMS_STATUS_REPORT(length) { let result = this._processSmsStatusReport(length); this.acknowledgeGsmSms(result == PDU_FCS_OK, result); }; RIL[UNSOLICITED_RESPONSE_NEW_SMS_ON_SIM] = function UNSOLICITED_RESPONSE_NEW_SMS_ON_SIM(length) { // let info = Buf.readUint32List(); //TODO }; RIL[UNSOLICITED_ON_USSD] = function UNSOLICITED_ON_USSD() { let [typeCode, message] = Buf.readStringList(); if (DEBUG) { debug("On USSD. Type Code: " + typeCode + " Message: " + message); } this._ussdSession = (typeCode != "0" && typeCode != "2"); this.sendChromeMessage({rilMessageType: "USSDReceived", message: message, sessionEnded: !this._ussdSession}); }; RIL[UNSOLICITED_NITZ_TIME_RECEIVED] = function UNSOLICITED_NITZ_TIME_RECEIVED() { let dateString = Buf.readString(); // The data contained in the NITZ message is // in the form "yy/mm/dd,hh:mm:ss(+/-)tz,dt" // for example: 12/02/16,03:36:08-20,00,310410 // Always print the NITZ info so we can collection what different providers // send down the pipe (see bug XXX). // TODO once data is collected, add in |if (DEBUG)| debug("DateTimeZone string " + dateString); let now = Date.now(); let year = parseInt(dateString.substr(0, 2), 10); let month = parseInt(dateString.substr(3, 2), 10); let day = parseInt(dateString.substr(6, 2), 10); let hours = parseInt(dateString.substr(9, 2), 10); let minutes = parseInt(dateString.substr(12, 2), 10); let seconds = parseInt(dateString.substr(15, 2), 10); // Note that |tz| is in 15-min units. let tz = parseInt(dateString.substr(17, 3), 10); // Note that |dst| is in 1-hour units and is already applied in |tz|. let dst = parseInt(dateString.substr(21, 2), 10); let timeInMS = Date.UTC(year + PDU_TIMESTAMP_YEAR_OFFSET, month - 1, day, hours, minutes, seconds); if (isNaN(timeInMS)) { if (DEBUG) debug("NITZ failed to convert date"); return; } this.sendChromeMessage({rilMessageType: "nitzTime", networkTimeInMS: timeInMS, networkTimeZoneInMinutes: -(tz * 15), networkDSTInMinutes: -(dst * 60), receiveTimeInMS: now}); }; RIL[UNSOLICITED_SIGNAL_STRENGTH] = function UNSOLICITED_SIGNAL_STRENGTH(length) { this[REQUEST_SIGNAL_STRENGTH](length, {rilRequestError: ERROR_SUCCESS}); }; RIL[UNSOLICITED_DATA_CALL_LIST_CHANGED] = function UNSOLICITED_DATA_CALL_LIST_CHANGED(length) { if (RILQUIRKS_V5_LEGACY) { this.getDataCallList(); return; } this[REQUEST_DATA_CALL_LIST](length, {rilRequestError: ERROR_SUCCESS}); }; RIL[UNSOLICITED_SUPP_SVC_NOTIFICATION] = function UNSOLICITED_SUPP_SVC_NOTIFICATION(length) { let info = {}; info.notificationType = Buf.readUint32(); info.code = Buf.readUint32(); info.index = Buf.readUint32(); info.type = Buf.readUint32(); info.number = Buf.readString(); this._processSuppSvcNotification(info); }; RIL[UNSOLICITED_STK_SESSION_END] = function UNSOLICITED_STK_SESSION_END() { this.sendChromeMessage({rilMessageType: "stksessionend"}); }; RIL[UNSOLICITED_STK_PROACTIVE_COMMAND] = function UNSOLICITED_STK_PROACTIVE_COMMAND() { this.processStkProactiveCommand(); }; RIL[UNSOLICITED_STK_EVENT_NOTIFY] = function UNSOLICITED_STK_EVENT_NOTIFY() { this.processStkProactiveCommand(); }; RIL[UNSOLICITED_STK_CALL_SETUP] = null; RIL[UNSOLICITED_SIM_SMS_STORAGE_FULL] = null; RIL[UNSOLICITED_SIM_REFRESH] = null; RIL[UNSOLICITED_CALL_RING] = function UNSOLICITED_CALL_RING() { let info = {rilMessageType: "callRing"}; let isCDMA = false; //XXX TODO hard-code this for now if (isCDMA) { info.isPresent = Buf.readUint32(); info.signalType = Buf.readUint32(); info.alertPitch = Buf.readUint32(); info.signal = Buf.readUint32(); } // At this point we don't know much other than the fact there's an incoming // call, but that's enough to bring up the Phone app already. We'll know // details once we get a call state changed notification and can then // dispatch DOM events etc. this.sendChromeMessage(info); }; RIL[UNSOLICITED_RESPONSE_SIM_STATUS_CHANGED] = function UNSOLICITED_RESPONSE_SIM_STATUS_CHANGED() { this.getICCStatus(); }; RIL[UNSOLICITED_RESPONSE_CDMA_NEW_SMS] = function UNSOLICITED_RESPONSE_CDMA_NEW_SMS(length) { let [message, result] = CdmaPDUHelper.processReceivedSms(length); if (message) { result = this._processSmsMultipart(message); } if (result == PDU_FCS_RESERVED || result == MOZ_FCS_WAIT_FOR_EXPLICIT_ACK) { return; } // Not reserved FCS values, send ACK now. this.acknowledgeCdmaSms(result == PDU_FCS_OK, result); }; RIL[UNSOLICITED_RESPONSE_NEW_BROADCAST_SMS] = function UNSOLICITED_RESPONSE_NEW_BROADCAST_SMS(length) { let message; try { message = GsmPDUHelper.readCbMessage(Buf.readUint32()); } catch (e) { if (DEBUG) { debug("Failed to parse Cell Broadcast message: " + JSON.stringify(e)); } return; } message = this._processReceivedSmsCbPage(message); if (!message) { return; } message.rilMessageType = "cellbroadcast-received"; this.sendChromeMessage(message); }; RIL[UNSOLICITED_CDMA_RUIM_SMS_STORAGE_FULL] = null; RIL[UNSOLICITED_RESTRICTED_STATE_CHANGED] = null; RIL[UNSOLICITED_ENTER_EMERGENCY_CALLBACK_MODE] = function UNSOLICITED_ENTER_EMERGENCY_CALLBACK_MODE() { this._handleChangedEmergencyCbMode(true); }; RIL[UNSOLICITED_CDMA_CALL_WAITING] = function UNSOLICITED_CDMA_CALL_WAITING(length) { let call = {}; call.number = Buf.readString(); call.numberPresentation = Buf.readUint32(); call.name = Buf.readString(); call.namePresentation = Buf.readUint32(); call.isPresent = Buf.readUint32(); call.signalType = Buf.readUint32(); call.alertPitch = Buf.readUint32(); call.signal = Buf.readUint32(); this.sendChromeMessage({rilMessageType: "cdmaCallWaiting", number: call.number}); }; RIL[UNSOLICITED_CDMA_OTA_PROVISION_STATUS] = function UNSOLICITED_CDMA_OTA_PROVISION_STATUS() { let status = Buf.readUint32List()[0]; this.sendChromeMessage({rilMessageType: "otastatuschange", status: status}); }; RIL[UNSOLICITED_CDMA_INFO_REC] = function UNSOLICITED_CDMA_INFO_REC(length) { let record = CdmaPDUHelper.decodeInformationRecord(); record.rilMessageType = "cdma-info-rec-received"; this.sendChromeMessage(record); }; RIL[UNSOLICITED_OEM_HOOK_RAW] = null; RIL[UNSOLICITED_RINGBACK_TONE] = null; RIL[UNSOLICITED_RESEND_INCALL_MUTE] = null; RIL[UNSOLICITED_EXIT_EMERGENCY_CALLBACK_MODE] = function UNSOLICITED_EXIT_EMERGENCY_CALLBACK_MODE() { this._handleChangedEmergencyCbMode(false); }; RIL[UNSOLICITED_RIL_CONNECTED] = function UNSOLICITED_RIL_CONNECTED(length) { // Prevent response id collision between UNSOLICITED_RIL_CONNECTED and // UNSOLICITED_VOICE_RADIO_TECH_CHANGED for Akami on gingerbread branch. if (!length) { return; } let version = Buf.readUint32List()[0]; RILQUIRKS_V5_LEGACY = (version < 5); if (DEBUG) { debug("Detected RIL version " + version); debug("RILQUIRKS_V5_LEGACY is " + RILQUIRKS_V5_LEGACY); } this.initRILState(); // Always ensure that we are not in emergency callback mode when init. this.exitEmergencyCbMode(); }; /** * This object exposes the functionality to parse and serialize PDU strings * * A PDU is a string containing a series of hexadecimally encoded octets * or nibble-swapped binary-coded decimals (BCDs). It contains not only the * message text but information about the sender, the SMS service center, * timestamp, etc. */ let GsmPDUHelper = { /** * Read one character (2 bytes) from a RIL string and decode as hex. * * @return the nibble as a number. */ readHexNibble: function readHexNibble() { let nibble = Buf.readUint16(); if (nibble >= 48 && nibble <= 57) { nibble -= 48; // ASCII '0'..'9' } else if (nibble >= 65 && nibble <= 70) { nibble -= 55; // ASCII 'A'..'F' } else if (nibble >= 97 && nibble <= 102) { nibble -= 87; // ASCII 'a'..'f' } else { throw "Found invalid nibble during PDU parsing: " + String.fromCharCode(nibble); } return nibble; }, /** * Encode a nibble as one hex character in a RIL string (2 bytes). * * @param nibble * The nibble to encode (represented as a number) */ writeHexNibble: function writeHexNibble(nibble) { nibble &= 0x0f; if (nibble < 10) { nibble += 48; // ASCII '0' } else { nibble += 55; // ASCII 'A' } Buf.writeUint16(nibble); }, /** * Read a hex-encoded octet (two nibbles). * * @return the octet as a number. */ readHexOctet: function readHexOctet() { return (this.readHexNibble() << 4) | this.readHexNibble(); }, /** * Write an octet as two hex-encoded nibbles. * * @param octet * The octet (represented as a number) to encode. */ writeHexOctet: function writeHexOctet(octet) { this.writeHexNibble(octet >> 4); this.writeHexNibble(octet); }, /** * Read an array of hex-encoded octets. */ readHexOctetArray: function readHexOctetArray(length) { let array = new Uint8Array(length); for (let i = 0; i < length; i++) { array[i] = this.readHexOctet(); } return array; }, /** * Convert an octet (number) to a BCD number. * * Any nibbles that are not in the BCD range count as 0. * * @param octet * The octet (a number, as returned by getOctet()) * * @return the corresponding BCD number. */ octetToBCD: function octetToBCD(octet) { return ((octet & 0xf0) <= 0x90) * ((octet >> 4) & 0x0f) + ((octet & 0x0f) <= 0x09) * (octet & 0x0f) * 10; }, /** * Convert a BCD number to an octet (number) * * Only take two digits with absolute value. * * @param bcd * * @return the corresponding octet. */ BCDToOctet: function BCDToOctet(bcd) { bcd = Math.abs(bcd); return ((bcd % 10) << 4) + (Math.floor(bcd / 10) % 10); }, /** * Convert a semi-octet (number) to a GSM BCD char. */ bcdChars: "0123456789*#,;", semiOctetToBcdChar: function semiOctetToBcdChar(semiOctet) { if (semiOctet >= 14) { throw new RangeError(); } return this.bcdChars.charAt(semiOctet); }, /** * Read a *swapped nibble* binary coded decimal (BCD) * * @param pairs * Number of nibble *pairs* to read. * * @return the decimal as a number. */ readSwappedNibbleBcdNum: function readSwappedNibbleBcdNum(pairs) { let number = 0; for (let i = 0; i < pairs; i++) { let octet = this.readHexOctet(); // Ignore 'ff' octets as they're often used as filler. if (octet == 0xff) { continue; } // If the first nibble is an "F" , only the second nibble is to be taken // into account. if ((octet & 0xf0) == 0xf0) { number *= 10; number += octet & 0x0f; continue; } number *= 100; number += this.octetToBCD(octet); } return number; }, /** * Read a *swapped nibble* binary coded string (BCD) * * @param pairs * Number of nibble *pairs* to read. * * @return The BCD string. */ readSwappedNibbleBcdString: function readSwappedNibbleBcdString(pairs) { let str = ""; for (let i = 0; i < pairs; i++) { let nibbleH = this.readHexNibble(); let nibbleL = this.readHexNibble(); if (nibbleL == 0x0F) { break; } str += this.semiOctetToBcdChar(nibbleL); if (nibbleH != 0x0F) { str += this.semiOctetToBcdChar(nibbleH); } } return str; }, /** * Write numerical data as swapped nibble BCD. * * @param data * Data to write (as a string or a number) */ writeSwappedNibbleBCD: function writeSwappedNibbleBCD(data) { data = data.toString(); if (data.length % 2) { data += "F"; } for (let i = 0; i < data.length; i += 2) { Buf.writeUint16(data.charCodeAt(i + 1)); Buf.writeUint16(data.charCodeAt(i)); } }, /** * Write numerical data as swapped nibble BCD. * If the number of digit of data is even, add '0' at the beginning. * * @param data * Data to write (as a string or a number) */ writeSwappedNibbleBCDNum: function writeSwappedNibbleBCDNum(data) { data = data.toString(); if (data.length % 2) { data = "0" + data; } for (let i = 0; i < data.length; i += 2) { Buf.writeUint16(data.charCodeAt(i + 1)); Buf.writeUint16(data.charCodeAt(i)); } }, /** * Read user data, convert to septets, look up relevant characters in a * 7-bit alphabet, and construct string. * * @param length * Number of septets to read (*not* octets) * @param paddingBits * Number of padding bits in the first byte of user data. * @param langIndex * Table index used for normal 7-bit encoded character lookup. * @param langShiftIndex * Table index used for escaped 7-bit encoded character lookup. * * @return a string. */ readSeptetsToString: function readSeptetsToString(length, paddingBits, langIndex, langShiftIndex) { let ret = ""; let byteLength = Math.ceil((length * 7 + paddingBits) / 8); /** * |<- last byte in header ->| * |<- incompleteBits ->|<- last header septet->| * +===7===|===6===|===5===|===4===|===3===|===2===|===1===|===0===| * * |<- 1st byte in user data ->| * |<- data septet 1 ->|<-paddingBits->| * +===7===|===6===|===5===|===4===|===3===|===2===|===1===|===0===| * * |<- 2nd byte in user data ->| * |<- data spetet 2 ->|<-ds1->| * +===7===|===6===|===5===|===4===|===3===|===2===|===1===|===0===| */ let data = 0; let dataBits = 0; if (paddingBits) { data = this.readHexOctet() >> paddingBits; dataBits = 8 - paddingBits; --byteLength; } let escapeFound = false; const langTable = PDU_NL_LOCKING_SHIFT_TABLES[langIndex]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[langShiftIndex]; do { // Read as much as fits in 32bit word let bytesToRead = Math.min(byteLength, dataBits ? 3 : 4); for (let i = 0; i < bytesToRead; i++) { data |= this.readHexOctet() << dataBits; dataBits += 8; --byteLength; } // Consume available full septets for (; dataBits >= 7; dataBits -= 7) { let septet = data & 0x7F; data >>>= 7; if (escapeFound) { escapeFound = false; if (septet == PDU_NL_EXTENDED_ESCAPE) { // According to 3GPP TS 23.038, section 6.2.1.1, NOTE 1, "On // receipt of this code, a receiving entity shall display a space // until another extensiion table is defined." ret += " "; } else if (septet == PDU_NL_RESERVED_CONTROL) { // According to 3GPP TS 23.038 B.2, "This code represents a control // character and therefore must not be used for language specific // characters." ret += " "; } else { ret += langShiftTable[septet]; } } else if (septet == PDU_NL_EXTENDED_ESCAPE) { escapeFound = true; // is not an effective character --length; } else { ret += langTable[septet]; } } } while (byteLength); if (ret.length != length) { /** * If num of effective characters does not equal to the length of read * string, cut the tail off. This happens when the last octet of user * data has following layout: * * |<- penultimate octet in user data ->| * |<- data septet N ->|<- dsN-1 ->| * +===7===|===6===|===5===|===4===|===3===|===2===|===1===|===0===| * * |<- last octet in user data ->| * |<- fill bits ->|<-dsN->| * +===7===|===6===|===5===|===4===|===3===|===2===|===1===|===0===| * * The fill bits in the last octet may happen to form a full septet and * be appended at the end of result string. */ ret = ret.slice(0, length); } return ret; }, writeStringAsSeptets: function writeStringAsSeptets(message, paddingBits, langIndex, langShiftIndex) { const langTable = PDU_NL_LOCKING_SHIFT_TABLES[langIndex]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[langShiftIndex]; let dataBits = paddingBits; let data = 0; for (let i = 0; i < message.length; i++) { let c = message.charAt(i); let septet = langTable.indexOf(c); if (septet == PDU_NL_EXTENDED_ESCAPE) { continue; } if (septet >= 0) { data |= septet << dataBits; dataBits += 7; } else { septet = langShiftTable.indexOf(c); if (septet == -1) { throw new Error("'" + c + "' is not in 7 bit alphabet " + langIndex + ":" + langShiftIndex + "!"); } if (septet == PDU_NL_RESERVED_CONTROL) { continue; } data |= PDU_NL_EXTENDED_ESCAPE << dataBits; dataBits += 7; data |= septet << dataBits; dataBits += 7; } for (; dataBits >= 8; dataBits -= 8) { this.writeHexOctet(data & 0xFF); data >>>= 8; } } if (dataBits !== 0) { this.writeHexOctet(data & 0xFF); } }, /** * Read GSM 8-bit unpacked octets, * which are SMS default 7-bit alphabets with bit 8 set to 0. * * @param numOctets * Number of octets to be read. */ read8BitUnpackedToString: function read8BitUnpackedToString(numOctets) { let ret = ""; let escapeFound = false; let i; const langTable = PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; for(i = 0; i < numOctets; i++) { let octet = this.readHexOctet(); if (octet == 0xff) { i++; break; } if (escapeFound) { escapeFound = false; if (octet == PDU_NL_EXTENDED_ESCAPE) { // According to 3GPP TS 23.038, section 6.2.1.1, NOTE 1, "On // receipt of this code, a receiving entity shall display a space // until another extensiion table is defined." ret += " "; } else if (octet == PDU_NL_RESERVED_CONTROL) { // According to 3GPP TS 23.038 B.2, "This code represents a control // character and therefore must not be used for language specific // characters." ret += " "; } else { ret += langShiftTable[octet]; } } else if (octet == PDU_NL_EXTENDED_ESCAPE) { escapeFound = true; } else { ret += langTable[octet]; } } Buf.seekIncoming((numOctets - i) * Buf.PDU_HEX_OCTET_SIZE); return ret; }, /** * Write GSM 8-bit unpacked octets. * * @param numOctets Number of total octets to be writen, including trailing * 0xff. * @param str String to be written. Could be null. */ writeStringTo8BitUnpacked: function writeStringTo8BitUnpacked(numOctets, str) { const langTable = PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; // If the character is GSM extended alphabet, two octets will be written. // So we need to keep track of number of octets to be written. let i, j; let len = str ? str.length : 0; for (i = 0, j = 0; i < len && j < numOctets; i++) { let c = str.charAt(i); let octet = langTable.indexOf(c); if (octet == -1) { // Make sure we still have enough space to write two octets. if (j + 2 > numOctets) { break; } octet = langShiftTable.indexOf(c); if (octet == -1) { // Fallback to ASCII space. octet = langTable.indexOf(' '); } this.writeHexOctet(PDU_NL_EXTENDED_ESCAPE); j++; } this.writeHexOctet(octet); j++; } // trailing 0xff while (j++ < numOctets) { this.writeHexOctet(0xff); } }, /** * Read user data and decode as a UCS2 string. * * @param numOctets * Number of octets to be read as UCS2 string. * * @return a string. */ readUCS2String: function readUCS2String(numOctets) { let str = ""; let length = numOctets / 2; for (let i = 0; i < length; ++i) { let code = (this.readHexOctet() << 8) | this.readHexOctet(); str += String.fromCharCode(code); } if (DEBUG) debug("Read UCS2 string: " + str); return str; }, /** * Write user data as a UCS2 string. * * @param message * Message string to encode as UCS2 in hex-encoded octets. */ writeUCS2String: function writeUCS2String(message) { for (let i = 0; i < message.length; ++i) { let code = message.charCodeAt(i); this.writeHexOctet((code >> 8) & 0xFF); this.writeHexOctet(code & 0xFF); } }, /** * Read UCS2 String on UICC. * * @see TS 101.221, Annex A. * @param scheme * Coding scheme for UCS2 on UICC. One of 0x80, 0x81 or 0x82. * @param numOctets * Number of octets to be read as UCS2 string. */ readICCUCS2String: function readICCUCS2String(scheme, numOctets) { let str = ""; switch (scheme) { /** * +------+---------+---------+---------+---------+------+------+ * | 0x80 | Ch1_msb | Ch1_lsb | Ch2_msb | Ch2_lsb | 0xff | 0xff | * +------+---------+---------+---------+---------+------+------+ */ case 0x80: let isOdd = numOctets % 2; let i; for (i = 0; i < numOctets - isOdd; i += 2) { let code = (this.readHexOctet() << 8) | this.readHexOctet(); if (code == 0xffff) { i += 2; break; } str += String.fromCharCode(code); } // Skip trailing 0xff Buf.seekIncoming((numOctets - i) * Buf.PDU_HEX_OCTET_SIZE); break; case 0x81: // Fall through case 0x82: /** * +------+-----+--------+-----+-----+-----+--------+------+ * | 0x81 | len | offset | Ch1 | Ch2 | ... | Ch_len | 0xff | * +------+-----+--------+-----+-----+-----+--------+------+ * * len : The length of characters. * offset : 0hhh hhhh h000 0000 * Ch_n: bit 8 = 0 * GSM default alphabets * bit 8 = 1 * UCS2 character whose char code is (Ch_n & 0x7f) + offset * * +------+-----+------------+------------+-----+-----+-----+--------+ * | 0x82 | len | offset_msb | offset_lsb | Ch1 | Ch2 | ... | Ch_len | * +------+-----+------------+------------+-----+-----+-----+--------+ * * len : The length of characters. * offset_msb, offset_lsn: offset * Ch_n: bit 8 = 0 * GSM default alphabets * bit 8 = 1 * UCS2 character whose char code is (Ch_n & 0x7f) + offset */ let len = this.readHexOctet(); let offset, headerLen; if (scheme == 0x81) { offset = this.readHexOctet() << 7; headerLen = 2; } else { offset = (this.readHexOctet() << 8) | this.readHexOctet(); headerLen = 3; } for (let i = 0; i < len; i++) { let ch = this.readHexOctet(); if (ch & 0x80) { // UCS2 str += String.fromCharCode((ch & 0x7f) + offset); } else { // GSM 8bit let count = 0, gotUCS2 = 0; while ((i + count + 1 < len)) { count++; if (this.readHexOctet() & 0x80) { gotUCS2 = 1; break; } } // Unread. // +1 for the GSM alphabet indexed at i, Buf.seekIncoming(-1 * (count + 1) * Buf.PDU_HEX_OCTET_SIZE); str += this.read8BitUnpackedToString(count + 1 - gotUCS2); i += count - gotUCS2; } } // Skipping trailing 0xff Buf.seekIncoming((numOctets - len - headerLen) * Buf.PDU_HEX_OCTET_SIZE); break; } return str; }, /** * Read 1 + UDHL octets and construct user data header. * * @param msg * message object for output. * * @see 3GPP TS 23.040 9.2.3.24 */ readUserDataHeader: function readUserDataHeader(msg) { /** * A header object with properties contained in received message. * The properties set include: * * length: totoal length of the header, default 0. * langIndex: used locking shift table index, default * PDU_NL_IDENTIFIER_DEFAULT. * langShiftIndex: used locking shift table index, default * PDU_NL_IDENTIFIER_DEFAULT. * */ let header = { length: 0, langIndex: PDU_NL_IDENTIFIER_DEFAULT, langShiftIndex: PDU_NL_IDENTIFIER_DEFAULT }; header.length = this.readHexOctet(); if (DEBUG) debug("Read UDH length: " + header.length); let dataAvailable = header.length; while (dataAvailable >= 2) { let id = this.readHexOctet(); let length = this.readHexOctet(); if (DEBUG) debug("Read UDH id: " + id + ", length: " + length); dataAvailable -= 2; switch (id) { case PDU_IEI_CONCATENATED_SHORT_MESSAGES_8BIT: { let ref = this.readHexOctet(); let max = this.readHexOctet(); let seq = this.readHexOctet(); dataAvailable -= 3; if (max && seq && (seq <= max)) { header.segmentRef = ref; header.segmentMaxSeq = max; header.segmentSeq = seq; } break; } case PDU_IEI_APPLICATION_PORT_ADDRESSING_SCHEME_8BIT: { let dstp = this.readHexOctet(); let orip = this.readHexOctet(); dataAvailable -= 2; if ((dstp < PDU_APA_RESERVED_8BIT_PORTS) || (orip < PDU_APA_RESERVED_8BIT_PORTS)) { // 3GPP TS 23.040 clause 9.2.3.24.3: "A receiving entity shall // ignore any information element where the value of the // Information-Element-Data is Reserved or not supported" break; } header.destinationPort = dstp; header.originatorPort = orip; break; } case PDU_IEI_APPLICATION_PORT_ADDRESSING_SCHEME_16BIT: { let dstp = (this.readHexOctet() << 8) | this.readHexOctet(); let orip = (this.readHexOctet() << 8) | this.readHexOctet(); dataAvailable -= 4; // 3GPP TS 23.040 clause 9.2.3.24.4: "A receiving entity shall // ignore any information element where the value of the // Information-Element-Data is Reserved or not supported" if ((dstp < PDU_APA_VALID_16BIT_PORTS) && (orip < PDU_APA_VALID_16BIT_PORTS)) { header.destinationPort = dstp; header.originatorPort = orip; } break; } case PDU_IEI_CONCATENATED_SHORT_MESSAGES_16BIT: { let ref = (this.readHexOctet() << 8) | this.readHexOctet(); let max = this.readHexOctet(); let seq = this.readHexOctet(); dataAvailable -= 4; if (max && seq && (seq <= max)) { header.segmentRef = ref; header.segmentMaxSeq = max; header.segmentSeq = seq; } break; } case PDU_IEI_NATIONAL_LANGUAGE_SINGLE_SHIFT: let langShiftIndex = this.readHexOctet(); --dataAvailable; if (langShiftIndex < PDU_NL_SINGLE_SHIFT_TABLES.length) { header.langShiftIndex = langShiftIndex; } break; case PDU_IEI_NATIONAL_LANGUAGE_LOCKING_SHIFT: let langIndex = this.readHexOctet(); --dataAvailable; if (langIndex < PDU_NL_LOCKING_SHIFT_TABLES.length) { header.langIndex = langIndex; } break; case PDU_IEI_SPECIAL_SMS_MESSAGE_INDICATION: let msgInd = this.readHexOctet() & 0xFF; let msgCount = this.readHexOctet(); dataAvailable -= 2; /* * TS 23.040 V6.8.1 Sec 9.2.3.24.2 * bits 1 0 : basic message indication type * bits 4 3 2 : extended message indication type * bits 6 5 : Profile id * bit 7 : storage type */ let storeType = msgInd & PDU_MWI_STORE_TYPE_BIT; let mwi = msg.mwi; if (!mwi) { mwi = msg.mwi = {}; } if (storeType == PDU_MWI_STORE_TYPE_STORE) { // Store message because TP_UDH indicates so, note this may override // the setting in DCS, but that is expected mwi.discard = false; } else if (mwi.discard === undefined) { // storeType == PDU_MWI_STORE_TYPE_DISCARD // only override mwi.discard here if it hasn't already been set mwi.discard = true; } mwi.msgCount = msgCount & 0xFF; mwi.active = mwi.msgCount > 0; if (DEBUG) debug("MWI in TP_UDH received: " + JSON.stringify(mwi)); break; default: if (DEBUG) { debug("readUserDataHeader: unsupported IEI(" + id + "), " + length + " bytes."); } // Read out unsupported data if (length) { let octets; if (DEBUG) octets = new Uint8Array(length); for (let i = 0; i < length; i++) { let octet = this.readHexOctet(); if (DEBUG) octets[i] = octet; } dataAvailable -= length; if (DEBUG) debug("readUserDataHeader: " + Array.slice(octets)); } break; } } if (dataAvailable !== 0) { throw new Error("Illegal user data header found!"); } msg.header = header; }, /** * Write out user data header. * * @param options * Options containing information for user data header write-out. The * `userDataHeaderLength` property must be correctly pre-calculated. */ writeUserDataHeader: function writeUserDataHeader(options) { this.writeHexOctet(options.userDataHeaderLength); if (options.segmentMaxSeq > 1) { if (options.segmentRef16Bit) { this.writeHexOctet(PDU_IEI_CONCATENATED_SHORT_MESSAGES_16BIT); this.writeHexOctet(4); this.writeHexOctet((options.segmentRef >> 8) & 0xFF); } else { this.writeHexOctet(PDU_IEI_CONCATENATED_SHORT_MESSAGES_8BIT); this.writeHexOctet(3); } this.writeHexOctet(options.segmentRef & 0xFF); this.writeHexOctet(options.segmentMaxSeq & 0xFF); this.writeHexOctet(options.segmentSeq & 0xFF); } if (options.dcs == PDU_DCS_MSG_CODING_7BITS_ALPHABET) { if (options.langIndex != PDU_NL_IDENTIFIER_DEFAULT) { this.writeHexOctet(PDU_IEI_NATIONAL_LANGUAGE_LOCKING_SHIFT); this.writeHexOctet(1); this.writeHexOctet(options.langIndex); } if (options.langShiftIndex != PDU_NL_IDENTIFIER_DEFAULT) { this.writeHexOctet(PDU_IEI_NATIONAL_LANGUAGE_SINGLE_SHIFT); this.writeHexOctet(1); this.writeHexOctet(options.langShiftIndex); } } }, /** * Read SM-TL Address. * * @param len * Length of useful semi-octets within the Address-Value field. For * example, the lenth of "12345" should be 5, and 4 for "1234". * * @see 3GPP TS 23.040 9.1.2.5 */ readAddress: function readAddress(len) { // Address Length if (!len || (len < 0)) { if (DEBUG) debug("PDU error: invalid sender address length: " + len); return null; } if (len % 2 == 1) { len += 1; } if (DEBUG) debug("PDU: Going to read address: " + len); // Type-of-Address let toa = this.readHexOctet(); let addr = ""; if ((toa & 0xF0) == PDU_TOA_ALPHANUMERIC) { addr = this.readSeptetsToString(Math.floor(len * 4 / 7), 0, PDU_NL_IDENTIFIER_DEFAULT , PDU_NL_IDENTIFIER_DEFAULT ); return addr; } addr = this.readSwappedNibbleBcdString(len / 2); if (addr.length <= 0) { if (DEBUG) debug("PDU error: no number provided"); return null; } if ((toa & 0xF0) == (PDU_TOA_INTERNATIONAL)) { addr = '+' + addr; } return addr; }, /** * Read Alpha Id and Dialling number from TS TS 151.011 clause 10.5.1 * * @param recordSize The size of linear fixed record. */ readAlphaIdDiallingNumber: function readAlphaIdDiallingNumber(recordSize) { let length = Buf.readUint32(); let alphaLen = recordSize - ADN_FOOTER_SIZE_BYTES; let alphaId = this.readAlphaIdentifier(alphaLen); let number = this.readNumberWithLength(); // Skip 2 unused octets, CCP and EXT1. Buf.seekIncoming(2 * Buf.PDU_HEX_OCTET_SIZE); Buf.readStringDelimiter(length); let contact = null; if (alphaId || number) { contact = {alphaId: alphaId, number: number}; } return contact; }, /** * Write Alpha Identifier and Dialling number from TS 151.011 clause 10.5.1 * * @param recordSize The size of linear fixed record. * @param alphaId Alpha Identifier to be written. * @param number Dialling Number to be written. */ writeAlphaIdDiallingNumber: function writeAlphaIdDiallingNumber(recordSize, alphaId, number) { // Write String length let strLen = recordSize * 2; Buf.writeUint32(strLen); let alphaLen = recordSize - ADN_FOOTER_SIZE_BYTES; this.writeAlphaIdentifier(alphaLen, alphaId); this.writeNumberWithLength(number); // Write unused octets 0xff, CCP and EXT1. this.writeHexOctet(0xff); this.writeHexOctet(0xff); Buf.writeStringDelimiter(strLen); }, /** * Read Alpha Identifier. * * @see TS 131.102 * * @param numOctets * Number of octets to be read. * * It uses either * 1. SMS default 7-bit alphabet with bit 8 set to 0. * 2. UCS2 string. * * Unused bytes should be set to 0xff. */ readAlphaIdentifier: function readAlphaIdentifier(numOctets) { if (numOctets === 0) { return ""; } let temp; // Read the 1st octet to determine the encoding. if ((temp = GsmPDUHelper.readHexOctet()) == 0x80 || temp == 0x81 || temp == 0x82) { numOctets--; return this.readICCUCS2String(temp, numOctets); } else { Buf.seekIncoming(-1 * Buf.PDU_HEX_OCTET_SIZE); return this.read8BitUnpackedToString(numOctets); } }, /** * Write Alpha Identifier. * * @param numOctets * Total number of octets to be written. This includes the length of * alphaId and the length of trailing unused octets(0xff). * @param alphaId * Alpha Identifier to be written. * * Unused octets will be written as 0xff. */ writeAlphaIdentifier: function writeAlphaIdentifier(numOctets, alphaId) { if (numOctets === 0) { return; } // If alphaId is empty or it's of GSM 8 bit. if (!alphaId || ICCUtilsHelper.isGsm8BitAlphabet(alphaId)) { this.writeStringTo8BitUnpacked(numOctets, alphaId); } else { // Currently only support UCS2 coding scheme 0x80. this.writeHexOctet(0x80); numOctets--; // Now the alphaId is UCS2 string, each character will take 2 octets. if (alphaId.length * 2 > numOctets) { alphaId = alphaId.substring(0, Math.floor(numOctets / 2)); } this.writeUCS2String(alphaId); for (let i = alphaId.length * 2; i < numOctets; i++) { this.writeHexOctet(0xff); } } }, /** * Read Dialling number. * * @see TS 131.102 * * @param len * The Length of BCD number. * * From TS 131.102, in EF_ADN, EF_FDN, the field 'Length of BCD number' * means the total bytes should be allocated to store the TON/NPI and * the dialing number. * For example, if the dialing number is 1234567890, * and the TON/NPI is 0x81, * The field 'Length of BCD number' should be 06, which is * 1 byte to store the TON/NPI, 0x81 * 5 bytes to store the BCD number 2143658709. * * Here the definition of the length is different from SMS spec, * TS 23.040 9.1.2.5, which the length means * "number of useful semi-octets within the Address-Value field". */ readDiallingNumber: function readDiallingNumber(len) { if (DEBUG) debug("PDU: Going to read Dialling number: " + len); if (len === 0) { return ""; } // TOA = TON + NPI let toa = this.readHexOctet(); let number = this.readSwappedNibbleBcdString(len - 1); if (number.length <= 0) { if (DEBUG) debug("No number provided"); return ""; } if ((toa >> 4) == (PDU_TOA_INTERNATIONAL >> 4)) { number = '+' + number; } return number; }, /** * Write Dialling Number. * * @param number The Dialling number */ writeDiallingNumber: function writeDiallingNumber(number) { let toa = PDU_TOA_ISDN; // 81 if (number[0] == '+') { toa = PDU_TOA_INTERNATIONAL | PDU_TOA_ISDN; // 91 number = number.substring(1); } this.writeHexOctet(toa); this.writeSwappedNibbleBCD(number); }, readNumberWithLength: function readNumberWithLength() { let number; let numLen = this.readHexOctet(); if (numLen != 0xff) { if (numLen > ADN_MAX_BCD_NUMBER_BYTES) { throw new Error("invalid length of BCD number/SSC contents - " + numLen); } number = this.readDiallingNumber(numLen); Buf.seekIncoming((ADN_MAX_BCD_NUMBER_BYTES - numLen) * Buf.PDU_HEX_OCTET_SIZE); } else { Buf.seekIncoming(ADN_MAX_BCD_NUMBER_BYTES * Buf.PDU_HEX_OCTET_SIZE); } return number; }, writeNumberWithLength: function writeNumberWithLength(number) { if (number) { let numStart = number[0] == "+" ? 1 : 0; let numDigits = number.length - numStart; if (numDigits > ADN_MAX_NUMBER_DIGITS) { number = number.substring(0, ADN_MAX_NUMBER_DIGITS + numStart); numDigits = number.length - numStart; } // +1 for TON/NPI let numLen = Math.ceil(numDigits / 2) + 1; this.writeHexOctet(numLen); this.writeDiallingNumber(number); // Write trailing 0xff of Dialling Number. for (let i = 0; i < ADN_MAX_BCD_NUMBER_BYTES - numLen; i++) { this.writeHexOctet(0xff); } } else { // +1 for numLen for (let i = 0; i < ADN_MAX_BCD_NUMBER_BYTES + 1; i++) { this.writeHexOctet(0xff); } } }, /** * Read TP-Protocol-Indicator(TP-PID). * * @param msg * message object for output. * * @see 3GPP TS 23.040 9.2.3.9 */ readProtocolIndicator: function readProtocolIndicator(msg) { // `The MS shall interpret reserved, obsolete, or unsupported values as the // value 00000000 but shall store them exactly as received.` msg.pid = this.readHexOctet(); msg.epid = msg.pid; switch (msg.epid & 0xC0) { case 0x40: // Bit 7..0 = 01xxxxxx switch (msg.epid) { case PDU_PID_SHORT_MESSAGE_TYPE_0: case PDU_PID_ANSI_136_R_DATA: case PDU_PID_USIM_DATA_DOWNLOAD: return; case PDU_PID_RETURN_CALL_MESSAGE: // Level 1 of message waiting indication: // Only a return call message is provided let mwi = msg.mwi = {}; // TODO: When should we de-activate the level 1 indicator? mwi.active = true; mwi.discard = false; mwi.msgCount = GECKO_VOICEMAIL_MESSAGE_COUNT_UNKNOWN; if (DEBUG) debug("TP-PID got return call message: " + msg.sender); return; } break; } msg.epid = PDU_PID_DEFAULT; }, /** * Read TP-Data-Coding-Scheme(TP-DCS) * * @param msg * message object for output. * * @see 3GPP TS 23.040 9.2.3.10, 3GPP TS 23.038 4. */ readDataCodingScheme: function readDataCodingScheme(msg) { let dcs = this.readHexOctet(); if (DEBUG) debug("PDU: read SMS dcs: " + dcs); // No message class by default. let messageClass = PDU_DCS_MSG_CLASS_NORMAL; // 7 bit is the default fallback encoding. let encoding = PDU_DCS_MSG_CODING_7BITS_ALPHABET; switch (dcs & PDU_DCS_CODING_GROUP_BITS) { case 0x40: // bits 7..4 = 01xx case 0x50: case 0x60: case 0x70: // Bit 5..0 are coded exactly the same as Group 00xx case 0x00: // bits 7..4 = 00xx case 0x10: case 0x20: case 0x30: if (dcs & 0x10) { messageClass = dcs & PDU_DCS_MSG_CLASS_BITS; } switch (dcs & 0x0C) { case 0x4: encoding = PDU_DCS_MSG_CODING_8BITS_ALPHABET; break; case 0x8: encoding = PDU_DCS_MSG_CODING_16BITS_ALPHABET; break; } break; case 0xE0: // bits 7..4 = 1110 encoding = PDU_DCS_MSG_CODING_16BITS_ALPHABET; // Bit 3..0 are coded exactly the same as Message Waiting Indication // Group 1101. // Fall through. case 0xC0: // bits 7..4 = 1100 case 0xD0: // bits 7..4 = 1101 // Indiciates voicemail indicator set or clear let active = (dcs & PDU_DCS_MWI_ACTIVE_BITS) == PDU_DCS_MWI_ACTIVE_VALUE; // If TP-UDH is present, these values will be overwritten switch (dcs & PDU_DCS_MWI_TYPE_BITS) { case PDU_DCS_MWI_TYPE_VOICEMAIL: let mwi = msg.mwi; if (!mwi) { mwi = msg.mwi = {}; } mwi.active = active; mwi.discard = (dcs & PDU_DCS_CODING_GROUP_BITS) == 0xC0; mwi.msgCount = active ? GECKO_VOICEMAIL_MESSAGE_COUNT_UNKNOWN : 0; if (DEBUG) { debug("MWI in DCS received for voicemail: " + JSON.stringify(mwi)); } break; case PDU_DCS_MWI_TYPE_FAX: if (DEBUG) debug("MWI in DCS received for fax"); break; case PDU_DCS_MWI_TYPE_EMAIL: if (DEBUG) debug("MWI in DCS received for email"); break; default: if (DEBUG) debug("MWI in DCS received for \"other\""); break; } break; case 0xF0: // bits 7..4 = 1111 if (dcs & 0x04) { encoding = PDU_DCS_MSG_CODING_8BITS_ALPHABET; } messageClass = dcs & PDU_DCS_MSG_CLASS_BITS; break; default: // Falling back to default encoding. break; } msg.dcs = dcs; msg.encoding = encoding; msg.messageClass = GECKO_SMS_MESSAGE_CLASSES[messageClass]; if (DEBUG) debug("PDU: message encoding is " + encoding + " bit."); }, /** * Read GSM TP-Service-Centre-Time-Stamp(TP-SCTS). * * @see 3GPP TS 23.040 9.2.3.11 */ readTimestamp: function readTimestamp() { let year = this.readSwappedNibbleBcdNum(1) + PDU_TIMESTAMP_YEAR_OFFSET; let month = this.readSwappedNibbleBcdNum(1) - 1; let day = this.readSwappedNibbleBcdNum(1); let hour = this.readSwappedNibbleBcdNum(1); let minute = this.readSwappedNibbleBcdNum(1); let second = this.readSwappedNibbleBcdNum(1); let timestamp = Date.UTC(year, month, day, hour, minute, second); // If the most significant bit of the least significant nibble is 1, // the timezone offset is negative (fourth bit from the right => 0x08): // localtime = UTC + tzOffset // therefore // UTC = localtime - tzOffset let tzOctet = this.readHexOctet(); let tzOffset = this.octetToBCD(tzOctet & ~0x08) * 15 * 60 * 1000; tzOffset = (tzOctet & 0x08) ? -tzOffset : tzOffset; timestamp -= tzOffset; return timestamp; }, /** * Write GSM TP-Service-Centre-Time-Stamp(TP-SCTS). * * @see 3GPP TS 23.040 9.2.3.11 */ writeTimestamp: function writeTimestamp(date) { this.writeSwappedNibbleBCDNum(date.getFullYear() - PDU_TIMESTAMP_YEAR_OFFSET); // The value returned by getMonth() is an integer between 0 and 11. // 0 is corresponds to January, 1 to February, and so on. this.writeSwappedNibbleBCDNum(date.getMonth() + 1); this.writeSwappedNibbleBCDNum(date.getDate()); this.writeSwappedNibbleBCDNum(date.getHours()); this.writeSwappedNibbleBCDNum(date.getMinutes()); this.writeSwappedNibbleBCDNum(date.getSeconds()); // the value returned by getTimezoneOffset() is the difference, // in minutes, between UTC and local time. // For example, if your time zone is UTC+10 (Australian Eastern Standard Time), // -600 will be returned. // In TS 23.040 9.2.3.11, the Time Zone field of TP-SCTS indicates // the different between the local time and GMT. // And expressed in quarters of an hours. (so need to divid by 15) let zone = date.getTimezoneOffset() / 15; let octet = this.BCDToOctet(zone); // the bit3 of the Time Zone field represents the algebraic sign. // (0: positive, 1: negative). // For example, if the time zone is -0800 GMT, // 480 will be returned by getTimezoneOffset(). // In this case, need to mark sign bit as 1. => 0x08 if (zone > 0) { octet = octet | 0x08; } this.writeHexOctet(octet); }, /** * User data can be 7 bit (default alphabet) data, 8 bit data, or 16 bit * (UCS2) data. * * @param msg * message object for output. * @param length * length of user data to read in octets. */ readUserData: function readUserData(msg, length) { if (DEBUG) { debug("Reading " + length + " bytes of user data."); } let paddingBits = 0; if (msg.udhi) { this.readUserDataHeader(msg); if (msg.encoding == PDU_DCS_MSG_CODING_7BITS_ALPHABET) { let headerBits = (msg.header.length + 1) * 8; let headerSeptets = Math.ceil(headerBits / 7); length -= headerSeptets; paddingBits = headerSeptets * 7 - headerBits; } else { length -= (msg.header.length + 1); } } if (DEBUG) debug("After header, " + length + " septets left of user data"); msg.body = null; msg.data = null; switch (msg.encoding) { case PDU_DCS_MSG_CODING_7BITS_ALPHABET: // 7 bit encoding allows 140 octets, which means 160 characters // ((140x8) / 7 = 160 chars) if (length > PDU_MAX_USER_DATA_7BIT) { if (DEBUG) debug("PDU error: user data is too long: " + length); break; } let langIndex = msg.udhi ? msg.header.langIndex : PDU_NL_IDENTIFIER_DEFAULT; let langShiftIndex = msg.udhi ? msg.header.langShiftIndex : PDU_NL_IDENTIFIER_DEFAULT; msg.body = this.readSeptetsToString(length, paddingBits, langIndex, langShiftIndex); break; case PDU_DCS_MSG_CODING_8BITS_ALPHABET: msg.data = this.readHexOctetArray(length); break; case PDU_DCS_MSG_CODING_16BITS_ALPHABET: msg.body = this.readUCS2String(length); break; } }, /** * Read extra parameters if TP-PI is set. * * @param msg * message object for output. */ readExtraParams: function readExtraParams(msg) { // Because each PDU octet is converted to two UCS2 char2, we should always // get even messageStringLength in this#_processReceivedSms(). So, we'll // always need two delimitors at the end. if (Buf.getReadAvailable() <= 4) { return; } // TP-Parameter-Indicator let pi; do { // `The most significant bit in octet 1 and any other TP-PI octets which // may be added later is reserved as an extension bit which when set to a // 1 shall indicate that another TP-PI octet follows immediately // afterwards.` ~ 3GPP TS 23.040 9.2.3.27 pi = this.readHexOctet(); } while (pi & PDU_PI_EXTENSION); // `If the TP-UDL bit is set to "1" but the TP-DCS bit is set to "0" then // the receiving entity shall for TP-DCS assume a value of 0x00, i.e. the // 7bit default alphabet.` ~ 3GPP 23.040 9.2.3.27 msg.dcs = 0; msg.encoding = PDU_DCS_MSG_CODING_7BITS_ALPHABET; // TP-Protocol-Identifier if (pi & PDU_PI_PROTOCOL_IDENTIFIER) { this.readProtocolIndicator(msg); } // TP-Data-Coding-Scheme if (pi & PDU_PI_DATA_CODING_SCHEME) { this.readDataCodingScheme(msg); } // TP-User-Data-Length if (pi & PDU_PI_USER_DATA_LENGTH) { let userDataLength = this.readHexOctet(); this.readUserData(msg, userDataLength); } }, /** * Read and decode a PDU-encoded message from the stream. * * TODO: add some basic sanity checks like: * - do we have the minimum number of chars available */ readMessage: function readMessage() { // An empty message object. This gets filled below and then returned. let msg = { // D:DELIVER, DR:DELIVER-REPORT, S:SUBMIT, SR:SUBMIT-REPORT, // ST:STATUS-REPORT, C:COMMAND // M:Mandatory, O:Optional, X:Unavailable // D DR S SR ST C SMSC: null, // M M M M M M mti: null, // M M M M M M udhi: null, // M M O M M M sender: null, // M X X X X X recipient: null, // X X M X M M pid: null, // M O M O O M epid: null, // M O M O O M dcs: null, // M O M O O X mwi: null, // O O O O O O replace: false, // O O O O O O header: null, // M M O M M M body: null, // M O M O O O data: null, // M O M O O O timestamp: null, // M X X X X X status: null, // X X X X M X scts: null, // X X X M M X dt: null, // X X X X M X }; // SMSC info let smscLength = this.readHexOctet(); if (smscLength > 0) { let smscTypeOfAddress = this.readHexOctet(); // Subtract the type-of-address octet we just read from the length. msg.SMSC = this.readSwappedNibbleBcdString(smscLength - 1); if ((smscTypeOfAddress >> 4) == (PDU_TOA_INTERNATIONAL >> 4)) { msg.SMSC = '+' + msg.SMSC; } } // First octet of this SMS-DELIVER or SMS-SUBMIT message let firstOctet = this.readHexOctet(); // Message Type Indicator msg.mti = firstOctet & 0x03; // User data header indicator msg.udhi = firstOctet & PDU_UDHI; switch (msg.mti) { case PDU_MTI_SMS_RESERVED: // `If an MS receives a TPDU with a "Reserved" value in the TP-MTI it // shall process the message as if it were an "SMS-DELIVER" but store // the message exactly as received.` ~ 3GPP TS 23.040 9.2.3.1 case PDU_MTI_SMS_DELIVER: return this.readDeliverMessage(msg); case PDU_MTI_SMS_STATUS_REPORT: return this.readStatusReportMessage(msg); default: return null; } }, /** * Helper for processing received SMS parcel data. * * @param length * Length of SMS string in the incoming parcel. * * @return Message parsed or null for invalid message. */ processReceivedSms: function processReceivedSms(length) { if (!length) { if (DEBUG) debug("Received empty SMS!"); return [null, PDU_FCS_UNSPECIFIED]; } // An SMS is a string, but we won't read it as such, so let's read the // string length and then defer to PDU parsing helper. let messageStringLength = Buf.readUint32(); if (DEBUG) debug("Got new SMS, length " + messageStringLength); let message = this.readMessage(); if (DEBUG) debug("Got new SMS: " + JSON.stringify(message)); // Read string delimiters. See Buf.readString(). Buf.readStringDelimiter(length); // Determine result if (!message) { return [null, PDU_FCS_UNSPECIFIED]; } if (message.epid == PDU_PID_SHORT_MESSAGE_TYPE_0) { // `A short message type 0 indicates that the ME must acknowledge receipt // of the short message but shall discard its contents.` ~ 3GPP TS 23.040 // 9.2.3.9 return [null, PDU_FCS_OK]; } if (message.messageClass == GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_2]) { switch (message.epid) { case PDU_PID_ANSI_136_R_DATA: case PDU_PID_USIM_DATA_DOWNLOAD: if (ICCUtilsHelper.isICCServiceAvailable("DATA_DOWNLOAD_SMS_PP")) { // `If the service "data download via SMS Point-to-Point" is // allocated and activated in the (U)SIM Service Table, ... then the // ME shall pass the message transparently to the UICC using the // ENVELOPE (SMS-PP DOWNLOAD).` ~ 3GPP TS 31.111 7.1.1.1 RIL.dataDownloadViaSMSPP(message); // `the ME shall not display the message, or alert the user of a // short message waiting.` ~ 3GPP TS 31.111 7.1.1.1 return [null, PDU_FCS_RESERVED]; } // If the service "data download via SMS-PP" is not available in the // (U)SIM Service Table, ..., then the ME shall store the message in // EFsms in accordance with TS 31.102` ~ 3GPP TS 31.111 7.1.1.1 // Fall through. default: RIL.writeSmsToSIM(message); break; } } // TODO: Bug 739143: B2G SMS: Support SMS Storage Full event if ((message.messageClass != GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_0]) && !true) { // `When a mobile terminated message is class 0..., the MS shall display // the message immediately and send a ACK to the SC ..., irrespective of // whether there is memory available in the (U)SIM or ME.` ~ 3GPP 23.038 // clause 4. if (message.messageClass == GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_2]) { // `If all the short message storage at the MS is already in use, the // MS shall return "memory capacity exceeded".` ~ 3GPP 23.038 clause 4. return [null, PDU_FCS_MEMORY_CAPACITY_EXCEEDED]; } return [null, PDU_FCS_UNSPECIFIED]; } return [message, PDU_FCS_OK]; }, /** * Read and decode a SMS-DELIVER PDU. * * @param msg * message object for output. */ readDeliverMessage: function readDeliverMessage(msg) { // - Sender Address info - let senderAddressLength = this.readHexOctet(); msg.sender = this.readAddress(senderAddressLength); // - TP-Protocolo-Identifier - this.readProtocolIndicator(msg); // - TP-Data-Coding-Scheme - this.readDataCodingScheme(msg); // - TP-Service-Center-Time-Stamp - msg.timestamp = this.readTimestamp(); // - TP-User-Data-Length - let userDataLength = this.readHexOctet(); // - TP-User-Data - if (userDataLength > 0) { this.readUserData(msg, userDataLength); } return msg; }, /** * Read and decode a SMS-STATUS-REPORT PDU. * * @param msg * message object for output. */ readStatusReportMessage: function readStatusReportMessage(msg) { // TP-Message-Reference msg.messageRef = this.readHexOctet(); // TP-Recipient-Address let recipientAddressLength = this.readHexOctet(); msg.recipient = this.readAddress(recipientAddressLength); // TP-Service-Centre-Time-Stamp msg.scts = this.readTimestamp(); // TP-Discharge-Time msg.dt = this.readTimestamp(); // TP-Status msg.status = this.readHexOctet(); this.readExtraParams(msg); return msg; }, /** * Serialize a SMS-SUBMIT PDU message and write it to the output stream. * * This method expects that a data coding scheme has been chosen already * and that the length of the user data payload in that encoding is known, * too. Both go hand in hand together anyway. * * @param address * String containing the address (number) of the SMS receiver * @param userData * String containing the message to be sent as user data * @param dcs * Data coding scheme. One of the PDU_DCS_MSG_CODING_*BITS_ALPHABET * constants. * @param userDataHeaderLength * Length of embedded user data header, in bytes. The whole header * size will be userDataHeaderLength + 1; 0 for no header. * @param encodedBodyLength * Length of the user data when encoded with the given DCS. For UCS2, * in bytes; for 7-bit, in septets. * @param langIndex * Table index used for normal 7-bit encoded character lookup. * @param langShiftIndex * Table index used for escaped 7-bit encoded character lookup. * @param requestStatusReport * Request status report. */ writeMessage: function writeMessage(options) { if (DEBUG) { debug("writeMessage: " + JSON.stringify(options)); } let address = options.number; let body = options.body; let dcs = options.dcs; let userDataHeaderLength = options.userDataHeaderLength; let encodedBodyLength = options.encodedBodyLength; let langIndex = options.langIndex; let langShiftIndex = options.langShiftIndex; // SMS-SUBMIT Format: // // PDU Type - 1 octet // Message Reference - 1 octet // DA - Destination Address - 2 to 12 octets // PID - Protocol Identifier - 1 octet // DCS - Data Coding Scheme - 1 octet // VP - Validity Period - 0, 1 or 7 octets // UDL - User Data Length - 1 octet // UD - User Data - 140 octets let addressFormat = PDU_TOA_ISDN; // 81 if (address[0] == '+') { addressFormat = PDU_TOA_INTERNATIONAL | PDU_TOA_ISDN; // 91 address = address.substring(1); } //TODO validity is unsupported for now let validity = 0; let headerOctets = (userDataHeaderLength ? userDataHeaderLength + 1 : 0); let paddingBits; let userDataLengthInSeptets; let userDataLengthInOctets; if (dcs == PDU_DCS_MSG_CODING_7BITS_ALPHABET) { let headerSeptets = Math.ceil(headerOctets * 8 / 7); userDataLengthInSeptets = headerSeptets + encodedBodyLength; userDataLengthInOctets = Math.ceil(userDataLengthInSeptets * 7 / 8); paddingBits = headerSeptets * 7 - headerOctets * 8; } else { userDataLengthInOctets = headerOctets + encodedBodyLength; paddingBits = 0; } let pduOctetLength = 4 + // PDU Type, Message Ref, address length + format Math.ceil(address.length / 2) + 3 + // PID, DCS, UDL userDataLengthInOctets; if (validity) { //TODO: add more to pduOctetLength } // Start the string. Since octets are represented in hex, we will need // twice as many characters as octets. Buf.writeUint32(pduOctetLength * 2); // - PDU-TYPE- // +--------+----------+---------+---------+--------+---------+ // | RP (1) | UDHI (1) | SRR (1) | VPF (2) | RD (1) | MTI (2) | // +--------+----------+---------+---------+--------+---------+ // RP: 0 Reply path parameter is not set // 1 Reply path parameter is set // UDHI: 0 The UD Field contains only the short message // 1 The beginning of the UD field contains a header in addition // of the short message // SRR: 0 A status report is not requested // 1 A status report is requested // VPF: bit4 bit3 // 0 0 VP field is not present // 0 1 Reserved // 1 0 VP field present an integer represented (relative) // 1 1 VP field present a semi-octet represented (absolute) // RD: Instruct the SMSC to accept(0) or reject(1) an SMS-SUBMIT // for a short message still held in the SMSC which has the same // MR and DA as a previously submitted short message from the // same OA // MTI: bit1 bit0 Message Type // 0 0 SMS-DELIVER (SMSC ==> MS) // 0 1 SMS-SUBMIT (MS ==> SMSC) // PDU type. MTI is set to SMS-SUBMIT let firstOctet = PDU_MTI_SMS_SUBMIT; // Status-Report-Request if (options.requestStatusReport) { firstOctet |= PDU_SRI_SRR; } // Validity period if (validity) { //TODO: not supported yet, OR with one of PDU_VPF_* } // User data header indicator if (headerOctets) { firstOctet |= PDU_UDHI; } this.writeHexOctet(firstOctet); // Message reference 00 this.writeHexOctet(0x00); // - Destination Address - this.writeHexOctet(address.length); this.writeHexOctet(addressFormat); this.writeSwappedNibbleBCD(address); // - Protocol Identifier - this.writeHexOctet(0x00); // - Data coding scheme - // For now it assumes bits 7..4 = 1111 except for the 16 bits use case this.writeHexOctet(dcs); // - Validity Period - if (validity) { this.writeHexOctet(validity); } // - User Data - if (dcs == PDU_DCS_MSG_CODING_7BITS_ALPHABET) { this.writeHexOctet(userDataLengthInSeptets); } else { this.writeHexOctet(userDataLengthInOctets); } if (headerOctets) { this.writeUserDataHeader(options); } switch (dcs) { case PDU_DCS_MSG_CODING_7BITS_ALPHABET: this.writeStringAsSeptets(body, paddingBits, langIndex, langShiftIndex); break; case PDU_DCS_MSG_CODING_8BITS_ALPHABET: // Unsupported. break; case PDU_DCS_MSG_CODING_16BITS_ALPHABET: this.writeUCS2String(body); break; } // End of the string. The string length is always even by definition, so // we write two \0 delimiters. Buf.writeUint16(0); Buf.writeUint16(0); }, /** * Read GSM CBS message serial number. * * @param msg * message object for output. * * @see 3GPP TS 23.041 section 9.4.1.2.1 */ readCbSerialNumber: function readCbSerialNumber(msg) { msg.serial = Buf.readUint8() << 8 | Buf.readUint8(); msg.geographicalScope = (msg.serial >>> 14) & 0x03; msg.messageCode = (msg.serial >>> 4) & 0x03FF; msg.updateNumber = msg.serial & 0x0F; }, /** * Read GSM CBS message message identifier. * * @param msg * message object for output. * * @see 3GPP TS 23.041 section 9.4.1.2.2 */ readCbMessageIdentifier: function readCbMessageIdentifier(msg) { msg.messageId = Buf.readUint8() << 8 | Buf.readUint8(); if ((msg.format != CB_FORMAT_ETWS) && (msg.messageId >= CB_GSM_MESSAGEID_ETWS_BEGIN) && (msg.messageId <= CB_GSM_MESSAGEID_ETWS_END)) { // `In the case of transmitting CBS message for ETWS, a part of // Message Code can be used to command mobile terminals to activate // emergency user alert and message popup in order to alert the users.` msg.etws = { emergencyUserAlert: msg.messageCode & 0x0200 ? true : false, popup: msg.messageCode & 0x0100 ? true : false }; let warningType = msg.messageId - CB_GSM_MESSAGEID_ETWS_BEGIN; if (warningType < CB_ETWS_WARNING_TYPE_NAMES.length) { msg.etws.warningType = warningType; } } }, /** * Read CBS Data Coding Scheme. * * @param msg * message object for output. * * @see 3GPP TS 23.038 section 5. */ readCbDataCodingScheme: function readCbDataCodingScheme(msg) { let dcs = Buf.readUint8(); if (DEBUG) debug("PDU: read CBS dcs: " + dcs); let language = null, hasLanguageIndicator = false; // `Any reserved codings shall be assumed to be the GSM 7bit default // alphabet.` let encoding = PDU_DCS_MSG_CODING_7BITS_ALPHABET; let messageClass = PDU_DCS_MSG_CLASS_NORMAL; switch (dcs & PDU_DCS_CODING_GROUP_BITS) { case 0x00: // 0000 language = CB_DCS_LANG_GROUP_1[dcs & 0x0F]; break; case 0x10: // 0001 switch (dcs & 0x0F) { case 0x00: hasLanguageIndicator = true; break; case 0x01: encoding = PDU_DCS_MSG_CODING_16BITS_ALPHABET; hasLanguageIndicator = true; break; } break; case 0x20: // 0010 language = CB_DCS_LANG_GROUP_2[dcs & 0x0F]; break; case 0x40: // 01xx case 0x50: //case 0x60: Text Compression, not supported //case 0x70: Text Compression, not supported case 0x90: // 1001 encoding = (dcs & 0x0C); if (encoding == 0x0C) { encoding = PDU_DCS_MSG_CODING_7BITS_ALPHABET; } messageClass = (dcs & PDU_DCS_MSG_CLASS_BITS); break; case 0xF0: encoding = (dcs & 0x04) ? PDU_DCS_MSG_CODING_8BITS_ALPHABET : PDU_DCS_MSG_CODING_7BITS_ALPHABET; switch(dcs & PDU_DCS_MSG_CLASS_BITS) { case 0x01: messageClass = PDU_DCS_MSG_CLASS_USER_1; break; case 0x02: messageClass = PDU_DCS_MSG_CLASS_USER_2; break; case 0x03: messageClass = PDU_DCS_MSG_CLASS_3; break; } break; case 0x30: // 0011 (Reserved) case 0x80: // 1000 (Reserved) case 0xA0: // 1010..1100 (Reserved) case 0xB0: case 0xC0: break; default: throw new Error("Unsupported CBS data coding scheme: " + dcs); } msg.dcs = dcs; msg.encoding = encoding; msg.language = language; msg.messageClass = GECKO_SMS_MESSAGE_CLASSES[messageClass]; msg.hasLanguageIndicator = hasLanguageIndicator; }, /** * Read GSM CBS message page parameter. * * @param msg * message object for output. * * @see 3GPP TS 23.041 section 9.4.1.2.4 */ readCbPageParameter: function readCbPageParameter(msg) { let octet = Buf.readUint8(); msg.pageIndex = (octet >>> 4) & 0x0F; msg.numPages = octet & 0x0F; if (!msg.pageIndex || !msg.numPages) { // `If a mobile receives the code 0000 in either the first field or the // second field then it shall treat the CBS message exactly the same as a // CBS message with page parameter 0001 0001 (i.e. a single page message).` msg.pageIndex = msg.numPages = 1; } }, /** * Read ETWS Primary Notification message warning type. * * @param msg * message object for output. * * @see 3GPP TS 23.041 section 9.3.24 */ readCbWarningType: function readCbWarningType(msg) { let word = Buf.readUint8() << 8 | Buf.readUint8(); msg.etws = { warningType: (word >>> 9) & 0x7F, popup: word & 0x80 ? true : false, emergencyUserAlert: word & 0x100 ? true : false }; }, /** * Read CBS-Message-Information-Page * * @param msg * message object for output. * @param length * length of cell broadcast data to read in octets. * * @see 3GPP TS 23.041 section 9.3.19 */ readGsmCbData: function readGsmCbData(msg, length) { let bufAdapter = { readHexOctet: function readHexOctet() { return Buf.readUint8(); } }; msg.body = null; msg.data = null; switch (msg.encoding) { case PDU_DCS_MSG_CODING_7BITS_ALPHABET: msg.body = this.readSeptetsToString.call(bufAdapter, (length * 8 / 7), 0, PDU_NL_IDENTIFIER_DEFAULT, PDU_NL_IDENTIFIER_DEFAULT); if (msg.hasLanguageIndicator) { msg.language = msg.body.substring(0, 2); msg.body = msg.body.substring(3); } break; case PDU_DCS_MSG_CODING_8BITS_ALPHABET: msg.data = Buf.readUint8Array(length); break; case PDU_DCS_MSG_CODING_16BITS_ALPHABET: if (msg.hasLanguageIndicator) { msg.language = this.readSeptetsToString.call(bufAdapter, 2, 0, PDU_NL_IDENTIFIER_DEFAULT, PDU_NL_IDENTIFIER_DEFAULT); length -= 2; } msg.body = this.readUCS2String.call(bufAdapter, length); break; } }, /** * Read Cell GSM/ETWS/UMTS Broadcast Message. * * @param pduLength * total length of the incoming PDU in octets. */ readCbMessage: function readCbMessage(pduLength) { // Validity GSM ETWS UMTS let msg = { // Internally used in ril_worker: serial: null, // O O O updateNumber: null, // O O O format: null, // O O O dcs: 0x0F, // O X O encoding: PDU_DCS_MSG_CODING_7BITS_ALPHABET, // O X O hasLanguageIndicator: false, // O X O data: null, // O X O body: null, // O X O pageIndex: 1, // O X X numPages: 1, // O X X // DOM attributes: geographicalScope: null, // O O O messageCode: null, // O O O messageId: null, // O O O language: null, // O X O fullBody: null, // O X O fullData: null, // O X O messageClass: GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_NORMAL], // O x O etws: null // ? O ? /*{ warningType: null, // X O X popup: false, // X O X emergencyUserAlert: false, // X O X }*/ }; if (pduLength <= CB_MESSAGE_SIZE_ETWS) { msg.format = CB_FORMAT_ETWS; return this.readEtwsCbMessage(msg); } if (pduLength <= CB_MESSAGE_SIZE_GSM) { msg.format = CB_FORMAT_GSM; return this.readGsmCbMessage(msg, pduLength); } return null; }, /** * Read GSM Cell Broadcast Message. * * @param msg * message object for output. * @param pduLength * total length of the incomint PDU in octets. * * @see 3GPP TS 23.041 clause 9.4.1.2 */ readGsmCbMessage: function readGsmCbMessage(msg, pduLength) { this.readCbSerialNumber(msg); this.readCbMessageIdentifier(msg); this.readCbDataCodingScheme(msg); this.readCbPageParameter(msg); // GSM CB message header takes 6 octets. this.readGsmCbData(msg, pduLength - 6); return msg; }, /** * Read ETWS Primary Notification Message. * * @param msg * message object for output. * * @see 3GPP TS 23.041 clause 9.4.1.3 */ readEtwsCbMessage: function readEtwsCbMessage(msg) { this.readCbSerialNumber(msg); this.readCbMessageIdentifier(msg); this.readCbWarningType(msg); // Octet 7..56 is Warning Security Information. However, according to // section 9.4.1.3.6, `The UE shall ignore this parameter.` So we just skip // processing it here. return msg; }, /** * Read network name. * * @param len Length of the information element. * @return * { * networkName: network name. * shouldIncludeCi: Should Country's initials included in text string. * } * @see TS 24.008 clause 10.5.3.5a. */ readNetworkName: function readNetworkName(len) { // According to TS 24.008 Sec. 10.5.3.5a, the first octet is: // bit 8: must be 1. // bit 5-7: Text encoding. // 000 - GSM default alphabet. // 001 - UCS2 (16 bit). // else - reserved. // bit 4: MS should add the letters for Country's Initials and a space // to the text string if this bit is true. // bit 1-3: number of spare bits in last octet. let codingInfo = GsmPDUHelper.readHexOctet(); if (!(codingInfo & 0x80)) { return null; } let textEncoding = (codingInfo & 0x70) >> 4; let shouldIncludeCountryInitials = !!(codingInfo & 0x08); let spareBits = codingInfo & 0x07; let resultString; switch (textEncoding) { case 0: // GSM Default alphabet. resultString = GsmPDUHelper.readSeptetsToString( ((len - 1) * 8 - spareBits) / 7, 0, PDU_NL_IDENTIFIER_DEFAULT, PDU_NL_IDENTIFIER_DEFAULT); break; case 1: // UCS2 encoded. resultString = this.readUCS2String(len - 1); break; default: // Not an available text coding. return null; } // TODO - Bug 820286: According to shouldIncludeCountryInitials, add // country initials to the resulting string. return resultString; } }; /** * Provide buffer with bitwise read/write function so make encoding/decoding easier. */ let BitBufferHelper = { readCache: 0, readCacheSize: 0, readBuffer: [], readIndex: 0, writeCache: 0, writeCacheSize: 0, writeBuffer: [], // Max length is 32 because we use integer as read/write cache. // All read/write functions are implemented based on bitwise operation. readBits: function readBits(length) { if (length <= 0 || length > 32) { return null; } if (length > this.readCacheSize) { let bytesToRead = Math.ceil((length - this.readCacheSize) / 8); for(let i = 0; i < bytesToRead; i++) { this.readCache = (this.readCache << 8) | (this.readBuffer[this.readIndex++] & 0xFF); this.readCacheSize += 8; } } let bitOffset = (this.readCacheSize - length), resultMask = (1 << length) - 1, result = 0; result = (this.readCache >> bitOffset) & resultMask; this.readCacheSize -= length; return result; }, writeBits: function writeBits(value, length) { if (length <= 0 || length > 32) { return; } let totalLength = length + this.writeCacheSize; // 8-byte cache not full if (totalLength < 8) { let valueMask = (1 << length) - 1; this.writeCache = (this.writeCache << length) | (value & valueMask); this.writeCacheSize += length; return; } // Deal with unaligned part if (this.writeCacheSize) { let mergeLength = 8 - this.writeCacheSize, valueMask = (1 << mergeLength) - 1; this.writeCache = (this.writeCache << mergeLength) | ((value >> (length - mergeLength)) & valueMask); this.writeBuffer.push(this.writeCache & 0xFF); length -= mergeLength; } // Aligned part, just copy while (length >= 8) { length -= 8; this.writeBuffer.push((value >> length) & 0xFF); } // Rest part is saved into cache this.writeCacheSize = length; this.writeCache = value & ((1 << length) - 1); return; }, // Drop what still in read cache and goto next 8-byte alignment. // There might be a better naming. nextOctetAlign: function nextOctetAlign() { this.readCache = 0; this.readCacheSize = 0; }, // Flush current write cache to Buf with padding 0s. // There might be a better naming. flushWithPadding: function flushWithPadding() { if (this.writeCacheSize) { this.writeBuffer.push(this.writeCache << (8 - this.writeCacheSize)); } this.writeCache = 0; this.writeCacheSize = 0; }, startWrite: function startWrite(dataBuffer) { this.writeBuffer = dataBuffer; this.writeCache = 0; this.writeCacheSize = 0; }, startRead: function startRead(dataBuffer) { this.readBuffer = dataBuffer; this.readCache = 0; this.readCacheSize = 0; this.readIndex = 0; }, getWriteBufferSize: function getWriteBufferSize() { return this.writeBuffer.length; }, overwriteWriteBuffer: function overwriteWriteBuffer(position, data) { let writeLength = data.length; if (writeLength + position >= this.writeBuffer.length) { writeLength = this.writeBuffer.length - position; } for (let i = 0; i < writeLength; i++) { this.writeBuffer[i + position] = data[i]; } } }; /** * Helper for CDMA PDU * * Currently, some function are shared with GsmPDUHelper, they should be * moved from GsmPDUHelper to a common object shared among GsmPDUHelper and * CdmaPDUHelper. */ let CdmaPDUHelper = { // 1..........C // Only "1234567890*#" is defined in C.S0005-D v2.0 dtmfChars: ".1234567890*#...", /** * Entry point for SMS encoding, the options object is made compatible * with existing writeMessage() of GsmPDUHelper, but less key is used. * * Current used key in options: * @param number * String containing the address (number) of the SMS receiver * @param body * String containing the message to be sent, segmented part * @param dcs * Data coding scheme. One of the PDU_DCS_MSG_CODING_*BITS_ALPHABET * constants. * @param encodedBodyLength * Length of the user data when encoded with the given DCS. For UCS2, * in bytes; for 7-bit, in septets. * @param requestStatusReport * Request status report. * @param segmentRef * Reference number of concatenated SMS message * @param segmentMaxSeq * Total number of concatenated SMS message * @param segmentSeq * Sequence number of concatenated SMS message */ writeMessage: function cdma_writeMessage(options) { if (DEBUG) { debug("cdma_writeMessage: " + JSON.stringify(options)); } // Get encoding options.encoding = this.gsmDcsToCdmaEncoding(options.dcs); // Common Header if (options.segmentMaxSeq > 1) { this.writeInt(PDU_CDMA_MSG_TELESERIVCIE_ID_WEMT); } else { this.writeInt(PDU_CDMA_MSG_TELESERIVCIE_ID_SMS); } this.writeInt(0); this.writeInt(PDU_CDMA_MSG_CATEGORY_UNSPEC); // Just fill out address info in byte, rild will encap them for us let addrInfo = this.encodeAddr(options.number); this.writeByte(addrInfo.digitMode); this.writeByte(addrInfo.numberMode); this.writeByte(addrInfo.numberType); this.writeByte(addrInfo.numberPlan); this.writeByte(addrInfo.address.length); for (let i = 0; i < addrInfo.address.length; i++) { this.writeByte(addrInfo.address[i]); } // Subaddress, not supported this.writeByte(0); // Subaddress : Type this.writeByte(0); // Subaddress : Odd this.writeByte(0); // Subaddress : length // User Data let encodeResult = this.encodeUserData(options); this.writeByte(encodeResult.length); for (let i = 0; i < encodeResult.length; i++) { this.writeByte(encodeResult[i]); } encodeResult = null; }, /** * Data writters */ writeInt: function writeInt(value) { Buf.writeUint32(value); }, writeByte: function writeByte(value) { Buf.writeUint32(value & 0xFF); }, /** * Transform GSM DCS to CDMA encoding. */ gsmDcsToCdmaEncoding: function gsmDcsToCdmaEncoding(encoding) { switch (encoding) { case PDU_DCS_MSG_CODING_7BITS_ALPHABET: return PDU_CDMA_MSG_CODING_7BITS_ASCII; case PDU_DCS_MSG_CODING_8BITS_ALPHABET: return PDU_CDMA_MSG_CODING_OCTET; case PDU_DCS_MSG_CODING_16BITS_ALPHABET: return PDU_CDMA_MSG_CODING_UNICODE; } throw new Error("gsmDcsToCdmaEncoding(): Invalid GSM SMS DCS value: " + encoding); }, /** * Encode address into CDMA address format, as a byte array. * * @see 3GGP2 C.S0015-B 2.0, 3.4.3.3 Address Parameters * * @param address * String of address to be encoded */ encodeAddr: function cdma_encodeAddr(address) { let result = {}; result.numberType = PDU_CDMA_MSG_ADDR_NUMBER_TYPE_UNKNOWN; result.numberPlan = PDU_CDMA_MSG_ADDR_NUMBER_TYPE_UNKNOWN; if (address[0] === '+') { address = address.substring(1); } // Try encode with DTMF first result.digitMode = PDU_CDMA_MSG_ADDR_DIGIT_MODE_DTMF; result.numberMode = PDU_CDMA_MSG_ADDR_NUMBER_MODE_ANSI; result.address = []; for (let i = 0; i < address.length; i++) { let addrDigit = this.dtmfChars.indexOf(address.charAt(i)); if (addrDigit < 0) { result.digitMode = PDU_CDMA_MSG_ADDR_DIGIT_MODE_ASCII; result.numberMode = PDU_CDMA_MSG_ADDR_NUMBER_MODE_ASCII; result.address = []; break; } result.address.push(addrDigit); } // Address can't be encoded with DTMF, then use 7-bit ASCII if (result.digitMode !== PDU_CDMA_MSG_ADDR_DIGIT_MODE_DTMF) { if (address.indexOf("@") !== -1) { result.numberType = PDU_CDMA_MSG_ADDR_NUMBER_TYPE_NATIONAL; } for (let i = 0; i < address.length; i++) { result.address.push(address.charCodeAt(i) & 0x7F); } } return result; }, /** * Encode SMS contents in options into CDMA userData field. * Corresponding and required subparameters will be added automatically. * * @see 3GGP2 C.S0015-B 2.0, 3.4.3.7 Bearer Data * 4.5 Bearer Data Parameters * * Current used key in options: * @param body * String containing the message to be sent, segmented part * @param encoding * Encoding method of CDMA, can be transformed from GSM DCS by function * cdmaPduHelp.gsmDcsToCdmaEncoding() * @param encodedBodyLength * Length of the user data when encoded with the given DCS. For UCS2, * in bytes; for 7-bit, in septets. * @param requestStatusReport * Request status report. * @param segmentRef * Reference number of concatenated SMS message * @param segmentMaxSeq * Total number of concatenated SMS message * @param segmentSeq * Sequence number of concatenated SMS message */ encodeUserData: function cdma_encodeUserData(options) { let userDataBuffer = []; BitBufferHelper.startWrite(userDataBuffer); // Message Identifier this.encodeUserDataMsgId(options); // User Data this.encodeUserDataMsg(options); return userDataBuffer; }, /** * User data subparameter encoder : Message Identifier * * @see 3GGP2 C.S0015-B 2.0, 4.5.1 Message Identifier */ encodeUserDataMsgId: function cdma_encodeUserDataMsgId(options) { BitBufferHelper.writeBits(PDU_CDMA_MSG_USERDATA_MSG_ID, 8); BitBufferHelper.writeBits(3, 8); BitBufferHelper.writeBits(PDU_CDMA_MSG_TYPE_SUBMIT, 4); BitBufferHelper.writeBits(1, 16); // TODO: How to get message ID? if (options.segmentMaxSeq > 1) { BitBufferHelper.writeBits(1, 1); } else { BitBufferHelper.writeBits(0, 1); } BitBufferHelper.flushWithPadding(); }, /** * User data subparameter encoder : User Data * * @see 3GGP2 C.S0015-B 2.0, 4.5.2 User Data */ encodeUserDataMsg: function cdma_encodeUserDataMsg(options) { BitBufferHelper.writeBits(PDU_CDMA_MSG_USERDATA_BODY, 8); // Reserve space for length BitBufferHelper.writeBits(0, 8); let lengthPosition = BitBufferHelper.getWriteBufferSize(); BitBufferHelper.writeBits(options.encoding, 5); // Add user data header for message segement let msgBody = options.body, msgBodySize = (options.encoding === PDU_CDMA_MSG_CODING_7BITS_ASCII ? options.encodedBodyLength : msgBody.length); if (options.segmentMaxSeq > 1) { if (options.encoding === PDU_CDMA_MSG_CODING_7BITS_ASCII) { BitBufferHelper.writeBits(msgBodySize + 7, 8); // Required length for user data header, in septet(7-bit) BitBufferHelper.writeBits(5, 8); // total header length 5 bytes BitBufferHelper.writeBits(PDU_IEI_CONCATENATED_SHORT_MESSAGES_8BIT, 8); // header id 0 BitBufferHelper.writeBits(3, 8); // length of element for id 0 is 3 BitBufferHelper.writeBits(options.segmentRef & 0xFF, 8); // Segement reference BitBufferHelper.writeBits(options.segmentMaxSeq & 0xFF, 8); // Max segment BitBufferHelper.writeBits(options.segmentSeq & 0xFF, 8); // Current segment BitBufferHelper.writeBits(0, 1); // Padding to make header data septet(7-bit) aligned } else { if (options.encoding === PDU_CDMA_MSG_CODING_UNICODE) { BitBufferHelper.writeBits(msgBodySize + 3, 8); // Required length for user data header, in 16-bit } else { BitBufferHelper.writeBits(msgBodySize + 6, 8); // Required length for user data header, in octet(8-bit) } BitBufferHelper.writeBits(5, 8); // total header length 5 bytes BitBufferHelper.writeBits(PDU_IEI_CONCATENATED_SHORT_MESSAGES_8BIT, 8); // header id 0 BitBufferHelper.writeBits(3, 8); // length of element for id 0 is 3 BitBufferHelper.writeBits(options.segmentRef & 0xFF, 8); // Segement reference BitBufferHelper.writeBits(options.segmentMaxSeq & 0xFF, 8); // Max segment BitBufferHelper.writeBits(options.segmentSeq & 0xFF, 8); // Current segment } } else { BitBufferHelper.writeBits(msgBodySize, 8); } // Encode message based on encoding method const langTable = PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; for (let i = 0; i < msgBody.length; i++) { switch (options.encoding) { case PDU_CDMA_MSG_CODING_OCTET: { let msgDigit = msgBody.charCodeAt(i); BitBufferHelper.writeBits(msgDigit, 8); break; } case PDU_CDMA_MSG_CODING_7BITS_ASCII: { let msgDigit = msgBody.charCodeAt(i), msgDigitChar = msgBody.charAt(i); if (msgDigit >= 32) { BitBufferHelper.writeBits(msgDigit, 7); } else { msgDigit = langTable.indexOf(msgDigitChar); if (msgDigit === PDU_NL_EXTENDED_ESCAPE) { break; } if (msgDigit >= 0) { BitBufferHelper.writeBits(msgDigit, 7); } else { msgDigit = langShiftTable.indexOf(msgDigitChar); if (msgDigit == -1) { throw new Error("'" + msgDigitChar + "' is not in 7 bit alphabet " + langIndex + ":" + langShiftIndex + "!"); } if (msgDigit === PDU_NL_RESERVED_CONTROL) { break; } BitBufferHelper.writeBits(PDU_NL_EXTENDED_ESCAPE, 7); BitBufferHelper.writeBits(msgDigit, 7); } } break; } case PDU_CDMA_MSG_CODING_UNICODE: { let msgDigit = msgBody.charCodeAt(i); BitBufferHelper.writeBits(msgDigit, 16); break; } } } BitBufferHelper.flushWithPadding(); // Fill length let currentPosition = BitBufferHelper.getWriteBufferSize(); BitBufferHelper.overwriteWriteBuffer(lengthPosition - 1, [currentPosition - lengthPosition]); }, /** * Entry point for SMS decoding, the returned object is made compatible * with existing readMessage() of GsmPDUHelper */ readMessage: function cdma_readMessage() { let message = {}; // Teleservice Identifier message.teleservice = this.readInt(); // Message Type let isServicePresent = this.readByte(); if (isServicePresent) { message.messageType = PDU_CDMA_MSG_TYPE_BROADCAST; } else { if (message.teleservice) { message.messageType = PDU_CDMA_MSG_TYPE_P2P; } else { message.messageType = PDU_CDMA_MSG_TYPE_ACK; } } // Service Category message.service = this.readInt(); // Originated Address let addrInfo = {}; addrInfo.digitMode = (this.readInt() & 0x01); addrInfo.numberMode = (this.readInt() & 0x01); addrInfo.numberType = (this.readInt() & 0x01); addrInfo.numberPlan = (this.readInt() & 0x01); addrInfo.addrLength = this.readByte(); addrInfo.address = []; for (let i = 0; i < addrInfo.addrLength; i++) { addrInfo.address.push(this.readByte()); } message.sender = this.decodeAddr(addrInfo); // Originated Subaddress addrInfo.Type = (this.readInt() & 0x07); addrInfo.Odd = (this.readByte() & 0x01); addrInfo.addrLength = this.readByte(); for (let i = 0; i < addrInfo.addrLength; i++) { let addrDigit = this.readByte(); message.sender += String.fromCharCode(addrDigit); } // User Data this.decodeUserData(message); // Transform message to GSM msg let msg = { SMSC: "", mti: 0, udhi: 0, sender: message.sender, recipient: null, pid: PDU_PID_DEFAULT, epid: PDU_PID_DEFAULT, dcs: 0, mwi: null, //message[PDU_CDMA_MSG_USERDATA_BODY].header ? message[PDU_CDMA_MSG_USERDATA_BODY].header.mwi : null, replace: false, header: message[PDU_CDMA_MSG_USERDATA_BODY].header, body: message[PDU_CDMA_MSG_USERDATA_BODY].body, data: null, timestamp: message[PDU_CDMA_MSG_USERDATA_TIMESTAMP], status: null, scts: null, dt: null, encoding: message[PDU_CDMA_MSG_USERDATA_BODY].encoding, messageClass: GECKO_SMS_MESSAGE_CLASSES[PDU_DCS_MSG_CLASS_NORMAL] }; return msg; }, /** * Helper for processing received SMS parcel data. * * @param length * Length of SMS string in the incoming parcel. * * @return Message parsed or null for invalid message. */ processReceivedSms: function cdma_processReceivedSms(length) { if (!length) { if (DEBUG) debug("Received empty SMS!"); return [null, PDU_FCS_UNSPECIFIED]; } let message = this.readMessage(); if (DEBUG) debug("Got new SMS: " + JSON.stringify(message)); // Determine result if (!message) { return [null, PDU_FCS_UNSPECIFIED]; } return [message, PDU_FCS_OK]; }, /** * Data readers */ readInt: function readInt() { return Buf.readUint32(); }, readByte: function readByte() { return (Buf.readUint32() & 0xFF); }, /** * Decode CDMA address data into address string * * @see 3GGP2 C.S0015-B 2.0, 3.4.3.3 Address Parameters * * Required key in addrInfo * @param addrLength * Length of address * @param digitMode * Address encoding method * @param address * Array of encoded address data */ decodeAddr: function cdma_decodeAddr(addrInfo) { let result = ""; for (let i = 0; i < addrInfo.addrLength; i++) { if (addrInfo.digitMode === PDU_CDMA_MSG_ADDR_DIGIT_MODE_DTMF) { result += this.dtmfChars.charAt(addrInfo.address[i]); } else { result += String.fromCharCode(addrInfo.address[i]); } } return result; }, /** * Read userData in parcel buffer and decode into message object. * Each subparameter will be stored in corresponding key. * * @see 3GGP2 C.S0015-B 2.0, 3.4.3.7 Bearer Data * 4.5 Bearer Data Parameters */ decodeUserData: function cdma_decodeUserData(message) { let userDataLength = this.readInt(); while (userDataLength > 0) { let id = this.readByte(), length = this.readByte(), userDataBuffer = []; for (let i = 0; i < length; i++) { userDataBuffer.push(this.readByte()); } BitBufferHelper.startRead(userDataBuffer); switch (id) { case PDU_CDMA_MSG_USERDATA_MSG_ID: message[id] = this.decodeUserDataMsgId(); break; case PDU_CDMA_MSG_USERDATA_BODY: message[id] = this.decodeUserDataMsg(message[PDU_CDMA_MSG_USERDATA_MSG_ID].userHeader); break; case PDU_CDMA_MSG_USERDATA_TIMESTAMP: message[id] = this.decodeUserDataTimestamp(); break; case PDU_CDMA_REPLY_OPTION: message[id] = this.decodeUserDataReplyAction(); break; case PDU_CDMA_MSG_USERDATA_CALLBACK_NUMBER: message[id] = this.decodeUserDataCallbackNumber(); break; } userDataLength -= (length + 2); userDataBuffer = []; } }, /** * User data subparameter decoder: Message Identifier * * @see 3GGP2 C.S0015-B 2.0, 4.5.1 Message Identifier */ decodeUserDataMsgId: function cdma_decodeUserDataMsgId() { let result = {}; result.msgType = BitBufferHelper.readBits(4); result.msgId = BitBufferHelper.readBits(16); result.userHeader = BitBufferHelper.readBits(1); return result; }, /** * Decode user data header, we only care about segment information * on CDMA. * * This function is mostly copied from gsmPduHelper.readUserDataHeader() but * change the read function, because CDMA user header decoding is't byte-wise * aligned. */ decodeUserDataHeader: function cdma_decodeUserDataHeader(encoding) { let header = {}, headerSize = BitBufferHelper.readBits(8), userDataHeaderSize = headerSize + 1, headerPaddingBits = 0; // Calculate header size if (encoding === PDU_DCS_MSG_CODING_7BITS_ALPHABET) { // Length is in 7-bit header.length = Math.ceil(userDataHeaderSize * 8 / 7); // Calulate padding length headerPaddingBits = (header.length * 7) - (userDataHeaderSize * 8); } else if (encoding === PDU_DCS_MSG_CODING_8BITS_ALPHABET) { header.length = userDataHeaderSize; } else { header.length = userDataHeaderSize / 2; } while (headerSize) { let identifier = BitBufferHelper.readBits(8), length = BitBufferHelper.readBits(8); headerSize -= (2 + length); switch (identifier) { case PDU_IEI_CONCATENATED_SHORT_MESSAGES_8BIT: { let ref = BitBufferHelper.readBits(8), max = BitBufferHelper.readBits(8), seq = BitBufferHelper.readBits(8); if (max && seq && (seq <= max)) { header.segmentRef = ref; header.segmentMaxSeq = max; header.segmentSeq = seq; } break; } case PDU_IEI_APPLICATION_PORT_ADDRESSING_SCHEME_8BIT: { let dstp = BitBufferHelper.readBits(8), orip = BitBufferHelper.readBits(8); if ((dstp < PDU_APA_RESERVED_8BIT_PORTS) || (orip < PDU_APA_RESERVED_8BIT_PORTS)) { // 3GPP TS 23.040 clause 9.2.3.24.3: "A receiving entity shall // ignore any information element where the value of the // Information-Element-Data is Reserved or not supported" break; } header.destinationPort = dstp; header.originatorPort = orip; break; } case PDU_IEI_APPLICATION_PORT_ADDRESSING_SCHEME_16BIT: { let dstp = (BitBufferHelper.readBits(8) << 8) | BitBufferHelper.readBits(8), orip = (BitBufferHelper.readBits(8) << 8) | BitBufferHelper.readBits(8); // 3GPP TS 23.040 clause 9.2.3.24.4: "A receiving entity shall // ignore any information element where the value of the // Information-Element-Data is Reserved or not supported" if ((dstp < PDU_APA_VALID_16BIT_PORTS) && (orip < PDU_APA_VALID_16BIT_PORTS)) { header.destinationPort = dstp; header.originatorPort = orip; } break; } case PDU_IEI_CONCATENATED_SHORT_MESSAGES_16BIT: { let ref = (BitBufferHelper.readBits(8) << 8) | BitBufferHelper.readBits(8), max = BitBufferHelper.readBits(8), seq = BitBufferHelper.readBits(8); if (max && seq && (seq <= max)) { header.segmentRef = ref; header.segmentMaxSeq = max; header.segmentSeq = seq; } break; } case PDU_IEI_NATIONAL_LANGUAGE_SINGLE_SHIFT: { let langShiftIndex = BitBufferHelper.readBits(8); if (langShiftIndex < PDU_NL_SINGLE_SHIFT_TABLES.length) { header.langShiftIndex = langShiftIndex; } break; } case PDU_IEI_NATIONAL_LANGUAGE_LOCKING_SHIFT: { let langIndex = BitBufferHelper.readBits(8); if (langIndex < PDU_NL_LOCKING_SHIFT_TABLES.length) { header.langIndex = langIndex; } break; } case PDU_IEI_SPECIAL_SMS_MESSAGE_INDICATION: { let msgInd = BitBufferHelper.readBits(8) & 0xFF, msgCount = BitBufferHelper.readBits(8); /* * TS 23.040 V6.8.1 Sec 9.2.3.24.2 * bits 1 0 : basic message indication type * bits 4 3 2 : extended message indication type * bits 6 5 : Profile id * bit 7 : storage type */ let storeType = msgInd & PDU_MWI_STORE_TYPE_BIT; header.mwi = {}; mwi = header.mwi; if (storeType == PDU_MWI_STORE_TYPE_STORE) { // Store message because TP_UDH indicates so, note this may override // the setting in DCS, but that is expected mwi.discard = false; } else if (mwi.discard === undefined) { // storeType == PDU_MWI_STORE_TYPE_DISCARD // only override mwi.discard here if it hasn't already been set mwi.discard = true; } mwi.msgCount = msgCount & 0xFF; mwi.active = mwi.msgCount > 0; if (DEBUG) debug("MWI in TP_UDH received: " + JSON.stringify(mwi)); break; } default: // Drop unsupported id for (let i = 0; i < length; i++) { BitBufferHelper.readBits(8); } } } // Consume padding bits if (headerPaddingBits) { BitBufferHelper.readBits(headerPaddingBits); } return header; }, getCdmaMsgEncoding: function getCdmaMsgEncoding(encoding) { // Determine encoding method switch (encoding) { case PDU_CDMA_MSG_CODING_7BITS_ASCII: case PDU_CDMA_MSG_CODING_IA5: case PDU_CDMA_MSG_CODING_7BITS_GSM: return PDU_DCS_MSG_CODING_7BITS_ALPHABET; case PDU_CDMA_MSG_CODING_OCTET: case PDU_CDMA_MSG_CODING_IS_91: case PDU_CDMA_MSG_CODING_LATIN_HEBREW: case PDU_CDMA_MSG_CODING_LATIN: return PDU_DCS_MSG_CODING_8BITS_ALPHABET; case PDU_CDMA_MSG_CODING_UNICODE: case PDU_CDMA_MSG_CODING_SHIFT_JIS: case PDU_CDMA_MSG_CODING_KOREAN: return PDU_DCS_MSG_CODING_16BITS_ALPHABET; } return null; }, decodeCdmaPDUMsg: function decodeCdmaPDUMsg(encoding, msgType, msgBodySize) { const langTable = PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; let result = ""; let msgDigit; switch (encoding) { case PDU_CDMA_MSG_CODING_OCTET: // TODO : Require Test while(msgBodySize > 0) { msgDigit = String.fromCharCode(BitBufferHelper.readBits(8)); result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_IS_91: // TODO : Require Test // Referenced from android code switch (msgType) { case PDU_CDMA_MSG_CODING_IS_91_TYPE_SMS: case PDU_CDMA_MSG_CODING_IS_91_TYPE_SMS_FULL: case PDU_CDMA_MSG_CODING_IS_91_TYPE_VOICEMAIL_STATUS: while(msgBodySize > 0) { msgDigit = String.fromCharCode(BitBufferHelper.readBits(6) + 0x20); result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_IS_91_TYPE_CLI: let addrInfo = {}; addrInfo.digitMode = PDU_CDMA_MSG_ADDR_DIGIT_MODE_DTMF; addrInfo.numberMode = PDU_CDMA_MSG_ADDR_NUMBER_MODE_ANSI; addrInfo.numberType = PDU_CDMA_MSG_ADDR_NUMBER_TYPE_UNKNOWN; addrInfo.numberPlan = PDU_CDMA_MSG_ADDR_NUMBER_PLAN_UNKNOWN; addrInfo.addrLength = msgBodySize; addrInfo.address = []; for (let i = 0; i < addrInfo.addrLength; i++) { addrInfo.address.push(BitBufferHelper.readBits(4)); } result = this.decodeAddr(addrInfo); break; } // Fall through. case PDU_CDMA_MSG_CODING_7BITS_ASCII: case PDU_CDMA_MSG_CODING_IA5: // TODO : Require Test while(msgBodySize > 0) { msgDigit = BitBufferHelper.readBits(7); if (msgDigit >= 32) { msgDigit = String.fromCharCode(msgDigit); } else { if (msgDigit !== PDU_NL_EXTENDED_ESCAPE) { msgDigit = langTable[msgDigit]; } else { msgDigit = BitBufferHelper.readBits(7); msgBodySize--; msgDigit = langShiftTable[msgDigit]; } } result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_UNICODE: while(msgBodySize > 0) { msgDigit = String.fromCharCode(BitBufferHelper.readBits(16)); result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_7BITS_GSM: // TODO : Require Test while(msgBodySize > 0) { msgDigit = BitBufferHelper.readBits(7); if (msgDigit !== PDU_NL_EXTENDED_ESCAPE) { msgDigit = langTable[msgDigit]; } else { msgDigit = BitBufferHelper.readBits(7); msgBodySize--; msgDigit = langShiftTable[msgDigit]; } result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_LATIN: // TODO : Require Test // Reference : http://en.wikipedia.org/wiki/ISO/IEC_8859-1 while(msgBodySize > 0) { msgDigit = String.fromCharCode(BitBufferHelper.readBits(8)); result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_LATIN_HEBREW: // TODO : Require Test // Reference : http://en.wikipedia.org/wiki/ISO/IEC_8859-8 while(msgBodySize > 0) { msgDigit = BitBufferHelper.readBits(8); if (msgDigit === 0xDF) { msgDigit = String.fromCharCode(0x2017); } else if (msgDigit === 0xFD) { msgDigit = String.fromCharCode(0x200E); } else if (msgDigit === 0xFE) { msgDigit = String.fromCharCode(0x200F); } else if (msgDigit >= 0xE0 && msgDigit <= 0xFA) { msgDigit = String.fromCharCode(0x4F0 + msgDigit); } else { msgDigit = String.fromCharCode(msgDigit); } result += msgDigit; msgBodySize--; } break; case PDU_CDMA_MSG_CODING_SHIFT_JIS: // Reference : http://msdn.microsoft.com/en-US/goglobal/cc305152.aspx // http://demo.icu-project.org/icu-bin/convexp?conv=Shift_JIS // Fall through. case PDU_CDMA_MSG_CODING_KOREAN: case PDU_CDMA_MSG_CODING_GSM_DCS: // Fall through. default: break; } return result; }, /** * User data subparameter decoder : User Data * * @see 3GGP2 C.S0015-B 2.0, 4.5.2 User Data */ decodeUserDataMsg: function cdma_decodeUserDataMsg(hasUserHeader) { let result = {}, encoding = BitBufferHelper.readBits(5), msgType; if(encoding === PDU_CDMA_MSG_CODING_IS_91) { msgType = BitBufferHelper.readBits(8); } result.encoding = this.getCdmaMsgEncoding(encoding); let msgBodySize = BitBufferHelper.readBits(8); // For segmented SMS, a user header is included before sms content if (hasUserHeader) { result.header = this.decodeUserDataHeader(result.encoding); // header size is included in body size, they are decoded msgBodySize -= result.header.length; } // Decode sms content result.body = this.decodeCdmaPDUMsg(encoding, msgType, msgBodySize); return result; }, decodeBcd: function cdma_decodeBcd(value) { return ((value >> 4) & 0xF) * 10 + (value & 0x0F); }, /** * User data subparameter decoder : Time Stamp * * @see 3GGP2 C.S0015-B 2.0, 4.5.4 Message Center Time Stamp */ decodeUserDataTimestamp: function cdma_decodeUserDataTimestamp() { let year = this.decodeBcd(BitBufferHelper.readBits(8)), month = this.decodeBcd(BitBufferHelper.readBits(8)) - 1, date = this.decodeBcd(BitBufferHelper.readBits(8)), hour = this.decodeBcd(BitBufferHelper.readBits(8)), min = this.decodeBcd(BitBufferHelper.readBits(8)), sec = this.decodeBcd(BitBufferHelper.readBits(8)); if (year >= 96 && year <= 99) { year += 1900; } else { year += 2000; } let result = (new Date(year, month, date, hour, min, sec, 0)).valueOf(); return result; }, /** * User data subparameter decoder : Reply Option * * @see 3GGP2 C.S0015-B 2.0, 4.5.11 Reply Option */ decodeUserDataReplyAction: function cdma_decodeUserDataReplyAction() { let replyAction = BitBufferHelper.readBits(4), result = { userAck: (replyAction & 0x8) ? true : false, deliverAck: (replyAction & 0x4) ? true : false, readAck: (replyAction & 0x2) ? true : false, report: (replyAction & 0x1) ? true : false }; return result; }, /** * User data subparameter decoder : Call-Back Number * * @see 3GGP2 C.S0015-B 2.0, 4.5.15 Call-Back Number */ decodeUserDataCallbackNumber: function cdma_decodeUserDataCallbackNumber() { let digitMode = BitBufferHelper.readBits(1); if (digitMode) { let numberType = BitBufferHelper.readBits(3), numberPlan = BitBufferHelper.readBits(4); } let numberFields = BitBufferHelper.readBits(8), result = ""; for (let i = 0; i < numberFields; i++) { if (digitMode === PDU_CDMA_MSG_ADDR_DIGIT_MODE_DTMF) { let addrDigit = BitBufferHelper.readBits(4); result += this.dtmfChars.charAt(addrDigit); } else { let addrDigit = BitBufferHelper.readBits(8); result += String.fromCharCode(addrDigit); } } return result; }, /** * Decode information record parcel. */ decodeInformationRecord: function cdma_decodeInformationRecord() { let record = {}; let numOfRecords = Buf.readUint32(); let type; for (let i = 0; i < numOfRecords; i++) { type = Buf.readUint32(); switch (type) { /* * Every type is encaped by ril, except extended display */ case PDU_CDMA_INFO_REC_TYPE_DISPLAY: record.display = Buf.readString(); break; case PDU_CDMA_INFO_REC_TYPE_CALLED_PARTY_NUMBER: record.calledNumber = {}; record.calledNumber.number = Buf.readString(); record.calledNumber.type = Buf.readUint32(); record.calledNumber.plan = Buf.readUint32(); record.calledNumber.pi = Buf.readUint32(); record.calledNumber.si = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_CALLING_PARTY_NUMBER: record.callingNumber = {}; record.callingNumber.number = Buf.readString(); record.callingNumber.type = Buf.readUint32(); record.callingNumber.plan = Buf.readUint32(); record.callingNumber.pi = Buf.readUint32(); record.callingNumber.si = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_CONNECTED_NUMBER: record.connectedNumber = {}; record.connectedNumber.number = Buf.readString(); record.connectedNumber.type = Buf.readUint32(); record.connectedNumber.plan = Buf.readUint32(); record.connectedNumber.pi = Buf.readUint32(); record.connectedNumber.si = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_SIGNAL: record.signal = {}; record.signal.present = Buf.readUint32(); record.signal.type = Buf.readUint32(); record.signal.alertPitch = Buf.readUint32(); record.signal.signal = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_REDIRECTING_NUMBER: record.redirect = {}; record.redirect.number = Buf.readString(); record.redirect.type = Buf.readUint32(); record.redirect.plan = Buf.readUint32(); record.redirect.pi = Buf.readUint32(); record.redirect.si = Buf.readUint32(); record.redirect.reason = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_LINE_CONTROL: record.lineControl = {}; record.lineControl.polarityIncluded = Buf.readUint32(); record.lineControl.toggle = Buf.readUint32(); record.lineControl.recerse = Buf.readUint32(); record.lineControl.powerDenial = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_EXTENDED_DISPLAY: let length = Buf.readUint32(); /* * Extended display is still in format defined in * C.S0005-F v1.0, 3.7.5.16 */ record.extendedDisplay = {}; let headerByte = Buf.readUint32(); length--; // Based on spec, headerByte must be 0x80 now record.extendedDisplay.indicator = (headerByte >> 7); record.extendedDisplay.type = (headerByte & 0x7F); record.extendedDisplay.records = []; while (length > 0) { let display = {}; display.tag = Buf.readUint32(); length--; if (display.tag !== INFO_REC_EXTENDED_DISPLAY_BLANK && display.tag !== INFO_REC_EXTENDED_DISPLAY_SKIP) { display.content = Buf.readString(); length -= (display.content.length + 1); } record.extendedDisplay.records.push(display); } break; case PDU_CDMA_INFO_REC_TYPE_T53_CLIR: record.cause = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_T53_AUDIO_CONTROL: record.audioControl = {}; record.audioControl.upLink = Buf.readUint32(); record.audioControl.downLink = Buf.readUint32(); break; case PDU_CDMA_INFO_REC_TYPE_T53_RELEASE: // Fall through default: throw new Error("UNSOLICITED_CDMA_INFO_REC(), Unsupported information record type " + record.type + "\n"); } } return record; } }; let StkCommandParamsFactory = { createParam: function createParam(cmdDetails, ctlvs) { let method = StkCommandParamsFactory[cmdDetails.typeOfCommand]; if (typeof method != "function") { if (DEBUG) { debug("Unknown proactive command " + cmdDetails.typeOfCommand.toString(16)); } return null; } return method.call(this, cmdDetails, ctlvs); }, /** * Construct a param for Refresh. * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processRefresh: function processRefresh(cmdDetails, ctlvs) { let refreshType = cmdDetails.commandQualifier; switch (refreshType) { case STK_REFRESH_FILE_CHANGE: case STK_REFRESH_NAA_INIT_AND_FILE_CHANGE: let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_FILE_LIST, ctlvs); if (ctlv) { let list = ctlv.value.fileList; if (DEBUG) { debug("Refresh, list = " + list); } ICCRecordHelper.fetchICCRecords(); } break; } return null; }, /** * Construct a param for Poll Interval. * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processPollInterval: function processPollInterval(cmdDetails, ctlvs) { let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_DURATION, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Poll Interval: Required value missing : Duration"); } return ctlv.value; }, /** * Construct a param for Poll Off. * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processPollOff: function processPollOff(cmdDetails, ctlvs) { return null; }, /** * Construct a param for Set Up Event list. * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processSetUpEventList: function processSetUpEventList(cmdDetails, ctlvs) { let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_EVENT_LIST, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Event List: Required value missing : Event List"); } return ctlv.value || {eventList: null}; }, /** * Construct a param for Select Item. * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processSelectItem: function processSelectItem(cmdDetails, ctlvs) { let menu = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_ALPHA_ID, ctlvs); if (ctlv) { menu.title = ctlv.value.identifier; } menu.items = []; for (let i = 0; i < ctlvs.length; i++) { let ctlv = ctlvs[i]; if (ctlv.tag == COMPREHENSIONTLV_TAG_ITEM) { menu.items.push(ctlv.value); } } if (menu.items.length === 0) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Menu: Required value missing : items"); } ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_ITEM_ID, ctlvs); if (ctlv) { menu.defaultItem = ctlv.value.identifier - 1; } // The 1st bit and 2nd bit determines the presentation type. menu.presentationType = cmdDetails.commandQualifier & 0x03; // Help information available. if (cmdDetails.commandQualifier & 0x80) { menu.isHelpAvailable = true; } return menu; }, processDisplayText: function processDisplayText(cmdDetails, ctlvs) { let textMsg = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_TEXT_STRING, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Display Text: Required value missing : Text String"); } textMsg.text = ctlv.value.textString; ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_IMMEDIATE_RESPONSE, ctlvs); if (ctlv) { textMsg.responseNeeded = true; } ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_DURATION, ctlvs); if (ctlv) { textMsg.duration = ctlv.value; } // High priority. if (cmdDetails.commandQualifier & 0x01) { textMsg.isHighPriority = true; } // User clear. if (cmdDetails.commandQualifier & 0x80) { textMsg.userClear = true; } return textMsg; }, processSetUpIdleModeText: function processSetUpIdleModeText(cmdDetails, ctlvs) { let textMsg = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_TEXT_STRING, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Set Up Idle Text: Required value missing : Text String"); } textMsg.text = ctlv.value.textString; return textMsg; }, processGetInkey: function processGetInkey(cmdDetails, ctlvs) { let input = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_TEXT_STRING, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Get InKey: Required value missing : Text String"); } input.text = ctlv.value.textString; // duration ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_DURATION, ctlvs); if (ctlv) { input.duration = ctlv.value; } input.minLength = 1; input.maxLength = 1; // isAlphabet if (cmdDetails.commandQualifier & 0x01) { input.isAlphabet = true; } // UCS2 if (cmdDetails.commandQualifier & 0x02) { input.isUCS2 = true; } // Character sets defined in bit 1 and bit 2 are disable and // the YES/NO reponse is required. if (cmdDetails.commandQualifier & 0x04) { input.isYesNoRequested = true; } // Help information available. if (cmdDetails.commandQualifier & 0x80) { input.isHelpAvailable = true; } return input; }, processGetInput: function processGetInput(cmdDetails, ctlvs) { let input = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_TEXT_STRING, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Get Input: Required value missing : Text String"); } input.text = ctlv.value.textString; ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_RESPONSE_LENGTH, ctlvs); if (ctlv) { input.minLength = ctlv.value.minLength; input.maxLength = ctlv.value.maxLength; } ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_DEFAULT_TEXT, ctlvs); if (ctlv) { input.defaultText = ctlv.value.textString; } // Alphabet only if (cmdDetails.commandQualifier & 0x01) { input.isAlphabet = true; } // UCS2 if (cmdDetails.commandQualifier & 0x02) { input.isUCS2 = true; } // User input shall not be revealed if (cmdDetails.commandQualifier & 0x04) { input.hideInput = true; } // User input in SMS packed format if (cmdDetails.commandQualifier & 0x08) { input.isPacked = true; } // Help information available. if (cmdDetails.commandQualifier & 0x80) { input.isHelpAvailable = true; } return input; }, processEventNotify: function processEventNotify(cmdDetails, ctlvs) { let textMsg = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_ALPHA_ID, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Event Notfiy: Required value missing : Alpha ID"); } textMsg.text = ctlv.value.identifier; return textMsg; }, processSetupCall: function processSetupCall(cmdDetails, ctlvs) { let call = {}; for (let i = 0; i < ctlvs.length; i++) { let ctlv = ctlvs[i]; if (ctlv.tag == COMPREHENSIONTLV_TAG_ALPHA_ID) { if (!call.confirmMessage) { call.confirmMessage = ctlv.value.identifier; } else { call.callMessage = ctlv.value.identifier; break; } } } let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_ADDRESS, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Set Up Call: Required value missing : Adress"); } call.address = ctlv.value.number; // see 3GPP TS 31.111 section 6.4.13 ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_DURATION, ctlvs); if (ctlv) { call.duration = ctlv.value; } return call; }, processLaunchBrowser: function processLaunchBrowser(cmdDetails, ctlvs) { let browser = {}; let ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_URL, ctlvs); if (!ctlv) { RIL.sendStkTerminalResponse({ command: cmdDetails, resultCode: STK_RESULT_REQUIRED_VALUES_MISSING}); throw new Error("Stk Launch Browser: Required value missing : URL"); } browser.url = ctlv.value.url; ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_ALPHA_ID, ctlvs); if (ctlv) { browser.confirmMessage = ctlv.value.identifier; } browser.mode = cmdDetails.commandQualifier & 0x03; return browser; }, processPlayTone: function processPlayTone(cmdDetails, ctlvs) { let playTone = {}; let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_ALPHA_ID, ctlvs); if (ctlv) { playTone.text = ctlv.value.identifier; } ctlv = StkProactiveCmdHelper.searchForTag(COMPREHENSIONTLV_TAG_TONE, ctlvs); if (ctlv) { playTone.tone = ctlv.value.tone; } ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_DURATION, ctlvs); if (ctlv) { playTone.duration = ctlv.value; } // vibrate is only defined in TS 102.223 playTone.isVibrate = (cmdDetails.commandQualifier & 0x01) !== 0x00; return playTone; }, /** * Construct a param for Provide Local Information * * @param cmdDetails * The value object of CommandDetails TLV. * @param ctlvs * The all TLVs in this proactive command. */ processProvideLocalInfo: function processProvideLocalInfo(cmdDetails, ctlvs) { let provideLocalInfo = { localInfoType: cmdDetails.commandQualifier }; return provideLocalInfo; }, processTimerManagement: function processTimerManagement(cmdDetails, ctlvs) { let timer = { timerAction: cmdDetails.commandQualifier }; let ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_TIMER_IDENTIFIER, ctlvs); if (ctlv) { timer.timerId = ctlv.value.timerId; } ctlv = StkProactiveCmdHelper.searchForTag( COMPREHENSIONTLV_TAG_TIMER_VALUE, ctlvs); if (ctlv) { timer.timerValue = ctlv.value.timerValue; } return timer; } }; StkCommandParamsFactory[STK_CMD_REFRESH] = function STK_CMD_REFRESH(cmdDetails, ctlvs) { return this.processRefresh(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_POLL_INTERVAL] = function STK_CMD_POLL_INTERVAL(cmdDetails, ctlvs) { return this.processPollInterval(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_POLL_OFF] = function STK_CMD_POLL_OFF(cmdDetails, ctlvs) { return this.processPollOff(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_PROVIDE_LOCAL_INFO] = function STK_CMD_PROVIDE_LOCAL_INFO(cmdDetails, ctlvs) { return this.processProvideLocalInfo(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SET_UP_EVENT_LIST] = function STK_CMD_SET_UP_EVENT_LIST(cmdDetails, ctlvs) { return this.processSetUpEventList(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SET_UP_MENU] = function STK_CMD_SET_UP_MENU(cmdDetails, ctlvs) { return this.processSelectItem(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SELECT_ITEM] = function STK_CMD_SELECT_ITEM(cmdDetails, ctlvs) { return this.processSelectItem(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_DISPLAY_TEXT] = function STK_CMD_DISPLAY_TEXT(cmdDetails, ctlvs) { return this.processDisplayText(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SET_UP_IDLE_MODE_TEXT] = function STK_CMD_SET_UP_IDLE_MODE_TEXT(cmdDetails, ctlvs) { return this.processSetUpIdleModeText(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_GET_INKEY] = function STK_CMD_GET_INKEY(cmdDetails, ctlvs) { return this.processGetInkey(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_GET_INPUT] = function STK_CMD_GET_INPUT(cmdDetails, ctlvs) { return this.processGetInput(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SEND_SS] = function STK_CMD_SEND_SS(cmdDetails, ctlvs) { return this.processEventNotify(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SEND_USSD] = function STK_CMD_SEND_USSD(cmdDetails, ctlvs) { return this.processEventNotify(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SEND_SMS] = function STK_CMD_SEND_SMS(cmdDetails, ctlvs) { return this.processEventNotify(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SEND_DTMF] = function STK_CMD_SEND_DTMF(cmdDetails, ctlvs) { return this.processEventNotify(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_SET_UP_CALL] = function STK_CMD_SET_UP_CALL(cmdDetails, ctlvs) { return this.processSetupCall(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_LAUNCH_BROWSER] = function STK_CMD_LAUNCH_BROWSER(cmdDetails, ctlvs) { return this.processLaunchBrowser(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_PLAY_TONE] = function STK_CMD_PLAY_TONE(cmdDetails, ctlvs) { return this.processPlayTone(cmdDetails, ctlvs); }; StkCommandParamsFactory[STK_CMD_TIMER_MANAGEMENT] = function STK_CMD_TIMER_MANAGEMENT(cmdDetails, ctlvs) { return this.processTimerManagement(cmdDetails, ctlvs); }; let StkProactiveCmdHelper = { retrieve: function retrieve(tag, length) { let method = StkProactiveCmdHelper[tag]; if (typeof method != "function") { if (DEBUG) { debug("Unknown comprehension tag " + tag.toString(16)); } Buf.seekIncoming(length * Buf.PDU_HEX_OCTET_SIZE); return null; } return method.call(this, length); }, /** * Command Details. * * | Byte | Description | Length | * | 1 | Command details Tag | 1 | * | 2 | Length = 03 | 1 | * | 3 | Command number | 1 | * | 4 | Type of Command | 1 | * | 5 | Command Qualifier | 1 | */ retrieveCommandDetails: function retrieveCommandDetails(length) { let cmdDetails = { commandNumber: GsmPDUHelper.readHexOctet(), typeOfCommand: GsmPDUHelper.readHexOctet(), commandQualifier: GsmPDUHelper.readHexOctet() }; return cmdDetails; }, /** * Device Identities. * * | Byte | Description | Length | * | 1 | Device Identity Tag | 1 | * | 2 | Length = 02 | 1 | * | 3 | Source device Identity | 1 | * | 4 | Destination device Id | 1 | */ retrieveDeviceId: function retrieveDeviceId(length) { let deviceId = { sourceId: GsmPDUHelper.readHexOctet(), destinationId: GsmPDUHelper.readHexOctet() }; return deviceId; }, /** * Alpha Identifier. * * | Byte | Description | Length | * | 1 | Alpha Identifier Tag | 1 | * | 2 ~ (Y-1)+2 | Length (X) | Y | * | (Y-1)+3 ~ | Alpha identfier | X | * | (Y-1)+X+2 | | | */ retrieveAlphaId: function retrieveAlphaId(length) { let alphaId = { identifier: GsmPDUHelper.readAlphaIdentifier(length) }; return alphaId; }, /** * Duration. * * | Byte | Description | Length | * | 1 | Response Length Tag | 1 | * | 2 | Lenth = 02 | 1 | * | 3 | Time unit | 1 | * | 4 | Time interval | 1 | */ retrieveDuration: function retrieveDuration(length) { let duration = { timeUnit: GsmPDUHelper.readHexOctet(), timeInterval: GsmPDUHelper.readHexOctet(), }; return duration; }, /** * Address. * * | Byte | Description | Length | * | 1 | Alpha Identifier Tag | 1 | * | 2 ~ (Y-1)+2 | Length (X) | Y | * | (Y-1)+3 | TON and NPI | 1 | * | (Y-1)+4 ~ | Dialling number | X | * | (Y-1)+X+2 | | | */ retrieveAddress: function retrieveAddress(length) { let address = { number : GsmPDUHelper.readDiallingNumber(length) }; return address; }, /** * Text String. * * | Byte | Description | Length | * | 1 | Text String Tag | 1 | * | 2 ~ (Y-1)+2 | Length (X) | Y | * | (Y-1)+3 | Data coding scheme | 1 | * | (Y-1)+4~ | Text String | X | * | (Y-1)+X+2 | | | */ retrieveTextString: function retrieveTextString(length) { if (!length) { // null string. return {textString: null}; } let text = { codingScheme: GsmPDUHelper.readHexOctet() }; length--; // -1 for the codingScheme. switch (text.codingScheme & 0x0f) { case STK_TEXT_CODING_GSM_7BIT_PACKED: text.textString = GsmPDUHelper.readSeptetsToString(length * 8 / 7, 0, 0, 0); break; case STK_TEXT_CODING_GSM_8BIT: text.textString = GsmPDUHelper.read8BitUnpackedToString(length); break; case STK_TEXT_CODING_UCS2: text.textString = GsmPDUHelper.readUCS2String(length); break; } return text; }, /** * Tone. * * | Byte | Description | Length | * | 1 | Tone Tag | 1 | * | 2 | Lenth = 01 | 1 | * | 3 | Tone | 1 | */ retrieveTone: function retrieveTone(length) { let tone = { tone: GsmPDUHelper.readHexOctet(), }; return tone; }, /** * Item. * * | Byte | Description | Length | * | 1 | Item Tag | 1 | * | 2 ~ (Y-1)+2 | Length (X) | Y | * | (Y-1)+3 | Identifier of item | 1 | * | (Y-1)+4 ~ | Text string of item | X | * | (Y-1)+X+2 | | | */ retrieveItem: function retrieveItem(length) { // TS 102.223 ,clause 6.6.7 SET-UP MENU // If the "Item data object for item 1" is a null data object // (i.e. length = '00' and no value part), this is an indication to the ME // to remove the existing menu from the menu system in the ME. if (!length) { return null; } let item = { identifier: GsmPDUHelper.readHexOctet(), text: GsmPDUHelper.readAlphaIdentifier(length - 1) }; return item; }, /** * Item Identifier. * * | Byte | Description | Length | * | 1 | Item Identifier Tag | 1 | * | 2 | Lenth = 01 | 1 | * | 3 | Identifier of Item chosen | 1 | */ retrieveItemId: function retrieveItemId(length) { let itemId = { identifier: GsmPDUHelper.readHexOctet() }; return itemId; }, /** * Response Length. * * | Byte | Description | Length | * | 1 | Response Length Tag | 1 | * | 2 | Lenth = 02 | 1 | * | 3 | Minimum length of response | 1 | * | 4 | Maximum length of response | 1 | */ retrieveResponseLength: function retrieveResponseLength(length) { let rspLength = { minLength : GsmPDUHelper.readHexOctet(), maxLength : GsmPDUHelper.readHexOctet() }; return rspLength; }, /** * File List. * * | Byte | Description | Length | * | 1 | File List Tag | 1 | * | 2 ~ (Y-1)+2 | Length (X) | Y | * | (Y-1)+3 | Number of files | 1 | * | (Y-1)+4 ~ | Files | X | * | (Y-1)+X+2 | | | */ retrieveFileList: function retrieveFileList(length) { let num = GsmPDUHelper.readHexOctet(); let fileList = ""; length--; // -1 for the num octet. for (let i = 0; i < 2 * length; i++) { // Didn't use readHexOctet here, // otherwise 0x00 will be "0", not "00" fileList += String.fromCharCode(Buf.readUint16()); } return { fileList: fileList }; }, /** * Default Text. * * Same as Text String. */ retrieveDefaultText: function retrieveDefaultText(length) { return this.retrieveTextString(length); }, /** * Event List. */ retrieveEventList: function retrieveEventList(length) { if (!length) { // null means an indication to ME to remove the existing list of events // in ME. return null; } let eventList = []; for (let i = 0; i < length; i++) { eventList.push(GsmPDUHelper.readHexOctet()); } return { eventList: eventList }; }, /** * Timer Identifier. * * | Byte | Description | Length | * | 1 | Timer Identifier Tag | 1 | * | 2 | Length = 01 | 1 | * | 3 | Timer Identifier | 1 | */ retrieveTimerId: function retrieveTimerId(length) { let id = { timerId: GsmPDUHelper.readHexOctet() }; return id; }, /** * Timer Value. * * | Byte | Description | Length | * | 1 | Timer Value Tag | 1 | * | 2 | Length = 03 | 1 | * | 3 | Hour | 1 | * | 4 | Minute | 1 | * | 5 | Second | 1 | */ retrieveTimerValue: function retrieveTimerValue(length) { let value = { timerValue: (GsmPDUHelper.readSwappedNibbleBcdNum(1) * 60 * 60) + (GsmPDUHelper.readSwappedNibbleBcdNum(1) * 60) + (GsmPDUHelper.readSwappedNibbleBcdNum(1)) }; return value; }, /** * Immediate Response. * * | Byte | Description | Length | * | 1 | Immediate Response Tag | 1 | * | 2 | Length = 00 | 1 | */ retrieveImmediaResponse: function retrieveImmediaResponse(length) { return {}; }, /** * URL * * | Byte | Description | Length | * | 1 | URL Tag | 1 | * | 2 ~ (Y+1) | Length(X) | Y | * | (Y+2) ~ | URL | X | * | (Y+1+X) | | | */ retrieveUrl: function retrieveUrl(length) { let s = ""; for (let i = 0; i < length; i++) { s += String.fromCharCode(GsmPDUHelper.readHexOctet()); } return {url: s}; }, searchForTag: function searchForTag(tag, ctlvs) { for (let i = 0; i < ctlvs.length; i++) { let ctlv = ctlvs[i]; if ((ctlv.tag & ~COMPREHENSIONTLV_FLAG_CR) == tag) { return ctlv; } } return null; }, }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_COMMAND_DETAILS] = function COMPREHENSIONTLV_TAG_COMMAND_DETAILS(length) { return this.retrieveCommandDetails(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_DEVICE_ID] = function COMPREHENSIONTLV_TAG_DEVICE_ID(length) { return this.retrieveDeviceId(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_ALPHA_ID] = function COMPREHENSIONTLV_TAG_ALPHA_ID(length) { return this.retrieveAlphaId(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_DURATION] = function COMPREHENSIONTLV_TAG_DURATION(length) { return this.retrieveDuration(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_ADDRESS] = function COMPREHENSIONTLV_TAG_ADDRESS(length) { return this.retrieveAddress(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_TEXT_STRING] = function COMPREHENSIONTLV_TAG_TEXT_STRING(length) { return this.retrieveTextString(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_TONE] = function COMPREHENSIONTLV_TAG_TONE(length) { return this.retrieveTone(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_ITEM] = function COMPREHENSIONTLV_TAG_ITEM(length) { return this.retrieveItem(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_ITEM_ID] = function COMPREHENSIONTLV_TAG_ITEM_ID(length) { return this.retrieveItemId(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_RESPONSE_LENGTH] = function COMPREHENSIONTLV_TAG_RESPONSE_LENGTH(length) { return this.retrieveResponseLength(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_FILE_LIST] = function COMPREHENSIONTLV_TAG_FILE_LIST(length) { return this.retrieveFileList(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_DEFAULT_TEXT] = function COMPREHENSIONTLV_TAG_DEFAULT_TEXT(length) { return this.retrieveDefaultText(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_EVENT_LIST] = function COMPREHENSIONTLV_TAG_EVENT_LIST(length) { return this.retrieveEventList(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_TIMER_IDENTIFIER] = function COMPREHENSIONTLV_TAG_TIMER_IDENTIFIER(length) { return this.retrieveTimerId(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_TIMER_VALUE] = function COMPREHENSIONTLV_TAG_TIMER_VALUE(length) { return this.retrieveTimerValue(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_IMMEDIATE_RESPONSE] = function COMPREHENSIONTLV_TAG_IMMEDIATE_RESPONSE(length) { return this.retrieveImmediaResponse(length); }; StkProactiveCmdHelper[COMPREHENSIONTLV_TAG_URL] = function COMPREHENSIONTLV_TAG_URL(length) { return this.retrieveUrl(length); }; let ComprehensionTlvHelper = { /** * Decode raw data to a Comprehension-TLV. */ decode: function decode() { let hlen = 0; // For header(tag field + length field) length. let temp = GsmPDUHelper.readHexOctet(); hlen++; // TS 101.220, clause 7.1.1 let tag, cr; switch (temp) { // TS 101.220, clause 7.1.1 case 0x0: // Not used. case 0xff: // Not used. case 0x80: // Reserved for future use. RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid octet when parsing Comprehension TLV :" + temp); case 0x7f: // Tag is three byte format. // TS 101.220 clause 7.1.1.2. // | Byte 1 | Byte 2 | Byte 3 | // | | 8 | 7 | 6 | 5 | 4 | 3 | 2 | 1 | | // | 0x7f |CR | Tag Value | tag = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); hlen += 2; cr = (tag & 0x8000) !== 0; tag &= ~0x8000; break; default: // Tag is single byte format. tag = temp; // TS 101.220 clause 7.1.1.1. // | 8 | 7 | 6 | 5 | 4 | 3 | 2 | 1 | // |CR | Tag Value | cr = (tag & 0x80) !== 0; tag &= ~0x80; } // TS 101.220 clause 7.1.2, Length Encoding. // Length | Byte 1 | Byte 2 | Byte 3 | Byte 4 | // 0 - 127 | 00 - 7f | N/A | N/A | N/A | // 128-255 | 81 | 80 - ff| N/A | N/A | // 256-65535| 82 | 0100 - ffff | N/A | // 65536- | 83 | 010000 - ffffff | // 16777215 // // Length errors: TS 11.14, clause 6.10.6 let length; // Data length. temp = GsmPDUHelper.readHexOctet(); hlen++; if (temp < 0x80) { length = temp; } else if (temp == 0x81) { length = GsmPDUHelper.readHexOctet(); hlen++; if (length < 0x80) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid length in Comprehension TLV :" + length); } } else if (temp == 0x82) { length = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); hlen += 2; if (lenth < 0x0100) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid length in 3-byte Comprehension TLV :" + length); } } else if (temp == 0x83) { length = (GsmPDUHelper.readHexOctet() << 16) | (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); hlen += 3; if (length < 0x010000) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid length in 4-byte Comprehension TLV :" + length); } } else { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid octet in Comprehension TLV :" + length); } let ctlv = { tag: tag, length: length, value: StkProactiveCmdHelper.retrieve(tag, length), cr: cr, hlen: hlen }; return ctlv; }, decodeChunks: function decodeChunks(length) { let chunks = []; let index = 0; while (index < length) { let tlv = this.decode(); chunks.push(tlv); index += tlv.length; index += tlv.hlen; } return chunks; }, /** * Write Location Info Comprehension TLV. * * @param loc location Information. */ writeLocationInfoTlv: function writeLocationInfoTlv(loc) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_LOCATION_INFO | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(loc.gsmCellId > 0xffff ? 9 : 7); // From TS 11.14, clause 12.19 // "The mobile country code (MCC), the mobile network code (MNC), // the location area code (LAC) and the cell ID are // coded as in TS 04.08." // And from TS 04.08 and TS 24.008, // the format is as follows: // // MCC = MCC_digit_1 + MCC_digit_2 + MCC_digit_3 // // 8 7 6 5 4 3 2 1 // +-------------+-------------+ // | MCC digit 2 | MCC digit 1 | octet 2 // | MNC digit 3 | MCC digit 3 | octet 3 // | MNC digit 2 | MNC digit 1 | octet 4 // +-------------+-------------+ // // Also in TS 24.008 // "However a network operator may decide to // use only two digits in the MNC in the LAI over the // radio interface. In this case, bits 5 to 8 of octet 3 // shall be coded as '1111'". // MCC & MNC, 3 octets let mcc = loc.mcc, mnc; if (loc.mnc.length == 2) { mnc = "F" + loc.mnc; } else { mnc = loc.mnc[2] + loc.mnc[0] + loc.mnc[1]; } GsmPDUHelper.writeSwappedNibbleBCD(mcc + mnc); // LAC, 2 octets GsmPDUHelper.writeHexOctet((loc.gsmLocationAreaCode >> 8) & 0xff); GsmPDUHelper.writeHexOctet(loc.gsmLocationAreaCode & 0xff); // Cell Id if (loc.gsmCellId > 0xffff) { // UMTS/WCDMA, gsmCellId is 28 bits. GsmPDUHelper.writeHexOctet((loc.gsmCellId >> 24) & 0xff); GsmPDUHelper.writeHexOctet((loc.gsmCellId >> 16) & 0xff); GsmPDUHelper.writeHexOctet((loc.gsmCellId >> 8) & 0xff); GsmPDUHelper.writeHexOctet(loc.gsmCellId & 0xff); } else { // GSM, gsmCellId is 16 bits. GsmPDUHelper.writeHexOctet((loc.gsmCellId >> 8) & 0xff); GsmPDUHelper.writeHexOctet(loc.gsmCellId & 0xff); } }, /** * Given a geckoError string, this function translates it into cause value * and write the value into buffer. * * @param geckoError Error string that is passed to gecko. */ writeCauseTlv: function writeCauseTlv(geckoError) { let cause = -1; for (let errorNo in RIL_ERROR_TO_GECKO_ERROR) { if (geckoError == RIL_ERROR_TO_GECKO_ERROR[errorNo]) { cause = errorNo; break; } } cause = (cause == -1) ? ERROR_SUCCESS : cause; GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_CAUSE | COMPREHENSIONTLV_FLAG_CR); GsmPDUHelper.writeHexOctet(2); // For single cause value. // TS 04.08, clause 10.5.4.11: National standard code + user location. GsmPDUHelper.writeHexOctet(0x60); // TS 04.08, clause 10.5.4.11: ext bit = 1 + 7 bits for cause. // +-----------------+----------------------------------+ // | Ext = 1 (1 bit) | Cause (7 bits) | // +-----------------+----------------------------------+ GsmPDUHelper.writeHexOctet(0x80 | cause); }, writeDateTimeZoneTlv: function writeDataTimeZoneTlv(date) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_DATE_TIME_ZONE); GsmPDUHelper.writeHexOctet(7); GsmPDUHelper.writeTimestamp(date); }, writeLanguageTlv: function writeLanguageTlv(language) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_LANGUAGE); GsmPDUHelper.writeHexOctet(2); // ISO 639-1, Alpha-2 code // TS 123.038, clause 6.2.1, GSM 7 bit Default Alphabet GsmPDUHelper.writeHexOctet( PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT].indexOf(language[0])); GsmPDUHelper.writeHexOctet( PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT].indexOf(language[1])); }, /** * Write Timer Value Comprehension TLV. * * @param seconds length of time during of the timer. * @param cr Comprehension Required or not */ writeTimerValueTlv: function writeTimerValueTlv(seconds, cr) { GsmPDUHelper.writeHexOctet(COMPREHENSIONTLV_TAG_TIMER_VALUE | (cr ? COMPREHENSIONTLV_FLAG_CR : 0)); GsmPDUHelper.writeHexOctet(3); // TS 102.223, clause 8.38 // +----------------+------------------+-------------------+ // | hours (1 byte) | minutes (1 btye) | secounds (1 byte) | // +----------------+------------------+-------------------+ GsmPDUHelper.writeSwappedNibbleBCDNum(Math.floor(seconds / 60 / 60)); GsmPDUHelper.writeSwappedNibbleBCDNum(Math.floor(seconds / 60) % 60); GsmPDUHelper.writeSwappedNibbleBCDNum(seconds % 60); }, getSizeOfLengthOctets: function getSizeOfLengthOctets(length) { if (length >= 0x10000) { return 4; // 0x83, len_1, len_2, len_3 } else if (length >= 0x100) { return 3; // 0x82, len_1, len_2 } else if (length >= 0x80) { return 2; // 0x81, len } else { return 1; // len } }, writeLength: function writeLength(length) { // TS 101.220 clause 7.1.2, Length Encoding. // Length | Byte 1 | Byte 2 | Byte 3 | Byte 4 | // 0 - 127 | 00 - 7f | N/A | N/A | N/A | // 128-255 | 81 | 80 - ff| N/A | N/A | // 256-65535| 82 | 0100 - ffff | N/A | // 65536- | 83 | 010000 - ffffff | // 16777215 if (length < 0x80) { GsmPDUHelper.writeHexOctet(length); } else if (0x80 <= length && length < 0x100) { GsmPDUHelper.writeHexOctet(0x81); GsmPDUHelper.writeHexOctet(length); } else if (0x100 <= length && length < 0x10000) { GsmPDUHelper.writeHexOctet(0x82); GsmPDUHelper.writeHexOctet((length >> 8) & 0xff); GsmPDUHelper.writeHexOctet(length & 0xff); } else if (0x10000 <= length && length < 0x1000000) { GsmPDUHelper.writeHexOctet(0x83); GsmPDUHelper.writeHexOctet((length >> 16) & 0xff); GsmPDUHelper.writeHexOctet((length >> 8) & 0xff); GsmPDUHelper.writeHexOctet(length & 0xff); } else { throw new Error("Invalid length value :" + length); } }, }; let BerTlvHelper = { /** * Decode Ber TLV. * * @param dataLen * The length of data in bytes. */ decode: function decode(dataLen) { // See TS 11.14, Annex D for BerTlv. let hlen = 0; let tag = GsmPDUHelper.readHexOctet(); hlen++; // Length | Byte 1 | Byte 2 // 0 - 127 | length ('00' to '7f') | N/A // 128 - 255 | '81' | length ('80' to 'ff') let length; if (tag == BER_PROACTIVE_COMMAND_TAG) { let temp = GsmPDUHelper.readHexOctet(); hlen++; if (temp < 0x80) { length = temp; } else if(temp == 0x81) { length = GsmPDUHelper.readHexOctet(); if (length < 0x80) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid length " + length); } } else { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Invalid length octet " + temp); } } else { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("Unknown BER tag"); } // If the value length of the BerTlv is larger than remaining value on Parcel. if (dataLen - hlen < length) { RIL.sendStkTerminalResponse({ resultCode: STK_RESULT_CMD_DATA_NOT_UNDERSTOOD}); throw new Error("BerTlvHelper value length too long!!"); } let ctlvs = ComprehensionTlvHelper.decodeChunks(length); let berTlv = { tag: tag, length: length, value: ctlvs }; return berTlv; } }; /** * ICC Helper for getting EF path. */ let ICCFileHelper = { /** * This function handles only EFs that are common to RUIM, SIM, USIM * and other types of ICC cards. */ getCommonEFPath: function getCommonEFPath(fileId) { switch (fileId) { case ICC_EF_ICCID: return EF_PATH_MF_SIM; case ICC_EF_ADN: return EF_PATH_MF_SIM + EF_PATH_DF_TELECOM; case ICC_EF_PBR: return EF_PATH_MF_SIM + EF_PATH_DF_TELECOM + EF_PATH_DF_PHONEBOOK; } return null; }, /** * This function handles EFs for SIM. */ getSimEFPath: function getSimEFPath(fileId) { switch (fileId) { case ICC_EF_FDN: case ICC_EF_MSISDN: return EF_PATH_MF_SIM + EF_PATH_DF_TELECOM; case ICC_EF_AD: case ICC_EF_MBDN: case ICC_EF_PLMNsel: case ICC_EF_SPN: case ICC_EF_SPDI: case ICC_EF_SST: case ICC_EF_PHASE: case ICC_EF_CBMI: case ICC_EF_CBMID: case ICC_EF_CBMIR: case ICC_EF_OPL: case ICC_EF_PNN: return EF_PATH_MF_SIM + EF_PATH_DF_GSM; default: return null; } }, /** * This function handles EFs for USIM. */ getUSimEFPath: function getUSimEFPath(fileId) { switch (fileId) { case ICC_EF_AD: case ICC_EF_FDN: case ICC_EF_MBDN: case ICC_EF_UST: case ICC_EF_MSISDN: case ICC_EF_SPN: case ICC_EF_SPDI: case ICC_EF_CBMI: case ICC_EF_CBMID: case ICC_EF_CBMIR: case ICC_EF_OPL: case ICC_EF_PNN: return EF_PATH_MF_SIM + EF_PATH_ADF_USIM; default: // The file ids in USIM phone book entries are decided by the // card manufacturer. So if we don't match any of the cases // above and if its a USIM return the phone book path. return EF_PATH_MF_SIM + EF_PATH_DF_TELECOM + EF_PATH_DF_PHONEBOOK; } }, /** * This function handles EFs for RUIM */ getRuimEFPath: function getRuimEFPath(fileId) { switch(fileId) { case ICC_EF_CSIM_CDMAHOME: case ICC_EF_CSIM_CST: case ICC_EF_CSIM_SPN: return EF_PATH_MF_SIM + EF_PATH_DF_CDMA; case ICC_EF_FDN: return EF_PATH_MF_SIM + EF_PATH_DF_TELECOM; default: return null; } }, /** * Helper function for getting the pathId for the specific ICC record * depeding on which type of ICC card we are using. * * @param fileId * File id. * @return The pathId or null in case of an error or invalid input. */ getEFPath: function getEFPath(fileId) { if (RIL.appType == null) { return null; } let path = this.getCommonEFPath(fileId); if (path) { return path; } switch (RIL.appType) { case CARD_APPTYPE_SIM: return this.getSimEFPath(fileId); case CARD_APPTYPE_USIM: return this.getUSimEFPath(fileId); case CARD_APPTYPE_RUIM: return this.getRuimEFPath(fileId); default: return null; } } }; /** * Helper for ICC IO functionalities. */ let ICCIOHelper = { /** * Load EF with type 'Linear Fixed'. * * @param fileId * The file to operate on, one of the ICC_EF_* constants. * @param recordNumber [optional] * The number of the record shall be loaded. * @param recordSize [optional] * The size of the record. * @param callback [optional] * The callback function shall be called when the record(s) is read. * @param onerror [optional] * The callback function shall be called when failure. */ loadLinearFixedEF: function loadLinearFixedEF(options) { let cb; function readRecord(options) { options.command = ICC_COMMAND_READ_RECORD; options.p1 = options.recordNumber || 1; // Record number options.p2 = READ_RECORD_ABSOLUTE_MODE; options.p3 = options.recordSize; options.callback = cb || options.callback; RIL.iccIO(options); } options.type = EF_TYPE_LINEAR_FIXED; options.pathId = ICCFileHelper.getEFPath(options.fileId); if (options.recordSize) { readRecord(options); return; } cb = options.callback; options.callback = readRecord.bind(this); this.getResponse(options); }, /** * Load next record from current record Id. */ loadNextRecord: function loadNextRecord(options) { options.p1++; RIL.iccIO(options); }, /** * Update EF with type 'Linear Fixed'. * * @param fileId * The file to operate on, one of the ICC_EF_* constants. * @param recordNumber * The number of the record shall be updated. * @param dataWriter [optional] * The function for writing string parameter for the ICC_COMMAND_UPDATE_RECORD. * @param pin2 [optional] * PIN2 is required when updating ICC_EF_FDN. * @param callback [optional] * The callback function shall be called when the record is updated. * @param onerror [optional] * The callback function shall be called when failure. */ updateLinearFixedEF: function updateLinearFixedEF(options) { if (!options.fileId || !options.recordNumber) { throw new Error("Unexpected fileId " + options.fileId + " or recordNumber " + options.recordNumber); } options.type = EF_TYPE_LINEAR_FIXED; options.pathId = ICCFileHelper.getEFPath(options.fileId); let cb = options.callback; options.callback = function callback(options) { options.callback = cb; options.command = ICC_COMMAND_UPDATE_RECORD; options.p1 = options.recordNumber; options.p2 = READ_RECORD_ABSOLUTE_MODE; options.p3 = options.recordSize; RIL.iccIO(options); }.bind(this); this.getResponse(options); }, /** * Load EF with type 'Transparent'. * * @param fileId * The file to operate on, one of the ICC_EF_* constants. * @param callback [optional] * The callback function shall be called when the record(s) is read. * @param onerror [optional] * The callback function shall be called when failure. */ loadTransparentEF: function loadTransparentEF(options) { options.type = EF_TYPE_TRANSPARENT; let cb = options.callback; options.callback = function callback(options) { options.callback = cb; options.command = ICC_COMMAND_READ_BINARY; options.p3 = options.fileSize; RIL.iccIO(options); }.bind(this); this.getResponse(options); }, /** * Use ICC_COMMAND_GET_RESPONSE to query the EF. * * @param fileId * The file to operate on, one of the ICC_EF_* constants. */ getResponse: function getResponse(options) { options.command = ICC_COMMAND_GET_RESPONSE; options.pathId = options.pathId || ICCFileHelper.getEFPath(options.fileId); if (!options.pathId) { throw new Error("Unknown pathId for " + options.fileId.toString(16)); } options.p1 = 0; // For GET_RESPONSE, p1 = 0 options.p2 = 0; // For GET_RESPONSE, p2 = 0 options.p3 = GET_RESPONSE_EF_SIZE_BYTES; RIL.iccIO(options); }, /** * Process ICC I/O response. */ processICCIO: function processICCIO(options) { let func = this[options.command]; func.call(this, options); }, /** * Process a ICC_COMMAND_GET_RESPONSE type command for REQUEST_SIM_IO. */ processICCIOGetResponse: function processICCIOGetResponse(options) { let strLen = Buf.readUint32(); // The format is from TS 51.011, clause 9.2.1 // Skip RFU, data[0] data[1] Buf.seekIncoming(2 * Buf.PDU_HEX_OCTET_SIZE); // File size, data[2], data[3] options.fileSize = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); // 2 bytes File id. data[4], data[5] let fileId = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); if (fileId != options.fileId) { throw new Error("Expected file ID " + options.fileId.toString(16) + " but read " + fileId.toString(16)); } // Type of file, data[6] let fileType = GsmPDUHelper.readHexOctet(); if (fileType != TYPE_EF) { throw new Error("Unexpected file type " + fileType); } // Skip 1 byte RFU, data[7], // 3 bytes Access conditions, data[8] data[9] data[10], // 1 byte File status, data[11], // 1 byte Length of the following data, data[12]. Buf.seekIncoming(((RESPONSE_DATA_STRUCTURE - RESPONSE_DATA_FILE_TYPE - 1) * Buf.PDU_HEX_OCTET_SIZE)); // Read Structure of EF, data[13] let efType = GsmPDUHelper.readHexOctet(); if (efType != options.type) { throw new Error("Expected EF type " + options.type + " but read " + efType); } // Length of a record, data[14]. // Only available for LINEAR_FIXED and CYCLIC. if (efType == EF_TYPE_LINEAR_FIXED || efType == EF_TYPE_CYCLIC) { options.recordSize = GsmPDUHelper.readHexOctet(); options.totalRecords = options.fileSize / options.recordSize; } else { Buf.seekIncoming(1 * Buf.PDU_HEX_OCTET_SIZE); } Buf.readStringDelimiter(strLen); if (options.callback) { options.callback(options); } }, /** * Process a ICC_COMMAND_READ_RECORD type command for REQUEST_SIM_IO. */ processICCIOReadRecord: function processICCIOReadRecord(options) { if (options.callback) { options.callback(options); } }, /** * Process a ICC_COMMAND_READ_BINARY type command for REQUEST_SIM_IO. */ processICCIOReadBinary: function processICCIOReadBinary(options) { if (options.callback) { options.callback(options); } }, /** * Process a ICC_COMMAND_UPDATE_RECORD type command for REQUEST_SIM_IO. */ processICCIOUpdateRecord: function processICCIOUpdateRecord(options) { if (options.callback) { options.callback(options); } }, /** * Process ICC IO error. */ processICCIOError: function processICCIOError(options) { let error = options.onerror || debug; // See GSM11.11, TS 51.011 clause 9.4, and ISO 7816-4 for the error // description. let errorMsg = "ICC I/O Error code " + RIL_ERROR_TO_GECKO_ERROR[options.rilRequestError] + " EF id = " + options.fileId.toString(16) + " command = " + options.command.toString(16); if (options.sw1 && options.sw2) { errorMsg += "(" + options.sw1.toString(16) + "/" + options.sw2.toString(16) + ")"; } error(errorMsg); }, }; ICCIOHelper[ICC_COMMAND_SEEK] = null; ICCIOHelper[ICC_COMMAND_READ_BINARY] = function ICC_COMMAND_READ_BINARY(options) { this.processICCIOReadBinary(options); }; ICCIOHelper[ICC_COMMAND_READ_RECORD] = function ICC_COMMAND_READ_RECORD(options) { this.processICCIOReadRecord(options); }; ICCIOHelper[ICC_COMMAND_GET_RESPONSE] = function ICC_COMMAND_GET_RESPONSE(options) { this.processICCIOGetResponse(options); }; ICCIOHelper[ICC_COMMAND_UPDATE_BINARY] = null; ICCIOHelper[ICC_COMMAND_UPDATE_RECORD] = function ICC_COMMAND_UPDATE_RECORD(options) { this.processICCIOUpdateRecord(options); }; /** * Helper for ICC records. */ let ICCRecordHelper = { /** * Fetch ICC records. */ fetchICCRecords: function fetchICCRecords() { this.readICCID(); RIL.getIMSI(); this.readMSISDN(); this.readAD(); this.readSST(); this.readMBDN(); }, /** * Read EF_phase. * This EF is only available in SIM. */ readICCPhase: function readICCPhase() { function callback() { let strLen = Buf.readUint32(); let phase = GsmPDUHelper.readHexOctet(); // If EF_phase is coded '03' or greater, an ME supporting STK shall // perform the PROFILE DOWNLOAD procedure. if (phase >= ICC_PHASE_2_PROFILE_DOWNLOAD_REQUIRED) { RIL.sendStkTerminalProfile(STK_SUPPORTED_TERMINAL_PROFILE); } Buf.readStringDelimiter(strLen); } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_PHASE, callback: callback.bind(this)}); }, /** * Read the ICCID. */ readICCID: function readICCID() { function callback() { let strLen = Buf.readUint32(); let octetLen = strLen / 2; RIL.iccInfo.iccid = GsmPDUHelper.readSwappedNibbleBcdString(octetLen); Buf.readStringDelimiter(strLen); if (DEBUG) debug("ICCID: " + RIL.iccInfo.iccid); if (RIL.iccInfo.iccid) { ICCUtilsHelper.handleICCInfoChange(); } } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_ICCID, callback: callback.bind(this)}); }, /** * Read the MSISDN from the ICC. */ readMSISDN: function readMSISDN() { function callback(options) { let contact = GsmPDUHelper.readAlphaIdDiallingNumber(options.recordSize); if (!contact || (RIL.iccInfo.msisdn !== undefined && RIL.iccInfo.msisdn === contact.number)) { return; } RIL.iccInfo.msisdn = contact.number; if (DEBUG) debug("MSISDN: " + RIL.iccInfo.msisdn); ICCUtilsHelper.handleICCInfoChange(); } ICCIOHelper.loadLinearFixedEF({fileId: ICC_EF_MSISDN, callback: callback.bind(this)}); }, /** * Read the AD (Administrative Data) from the ICC. */ readAD: function readAD() { function callback() { let strLen = Buf.readUint32(); // Each octet is encoded into two chars. let octetLen = strLen / 2; let ad = GsmPDUHelper.readHexOctetArray(octetLen); Buf.readStringDelimiter(strLen); if (DEBUG) { let str = ""; for (let i = 0; i < ad.length; i++) { str += ad[i] + ", "; } debug("AD: " + str); } // The 4th byte of the response is the length of MNC. let mccMnc = ICCUtilsHelper.parseMccMncFromImsi(RIL.iccInfoPrivate.imsi, ad && ad[3]); if (mccMnc) { RIL.iccInfo.mcc = mccMnc.mcc; RIL.iccInfo.mnc = mccMnc.mnc; ICCUtilsHelper.handleICCInfoChange(); } } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_AD, callback: callback.bind(this)}); }, /** * Read the SPN (Service Provider Name) from the ICC. */ readSPN: function readSPN() { function callback() { let strLen = Buf.readUint32(); // Each octet is encoded into two chars. let octetLen = strLen / 2; let spnDisplayCondition = GsmPDUHelper.readHexOctet(); // Minus 1 because the first octet is used to store display condition. let spn = GsmPDUHelper.readAlphaIdentifier(octetLen - 1); Buf.readStringDelimiter(strLen); if (DEBUG) { debug("SPN: spn = " + spn + ", spnDisplayCondition = " + spnDisplayCondition); } RIL.iccInfoPrivate.spnDisplayCondition = spnDisplayCondition; RIL.iccInfo.spn = spn; ICCUtilsHelper.updateDisplayCondition(); ICCUtilsHelper.handleICCInfoChange(); } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_SPN, callback: callback.bind(this)}); }, /** * Read the (U)SIM Service Table from the ICC. */ readSST: function readSST() { function callback() { let strLen = Buf.readUint32(); // Each octet is encoded into two chars. let octetLen = strLen / 2; let sst = GsmPDUHelper.readHexOctetArray(octetLen); Buf.readStringDelimiter(strLen); RIL.iccInfoPrivate.sst = sst; if (DEBUG) { let str = ""; for (let i = 0; i < sst.length; i++) { str += sst[i] + ", "; } debug("SST: " + str); } // Fetch SPN and PLMN list, if some of them are available. if (ICCUtilsHelper.isICCServiceAvailable("SPN")) { if (DEBUG) debug("SPN: SPN is available"); this.readSPN(); } else { if (DEBUG) debug("SPN: SPN service is not available"); } if (ICCUtilsHelper.isICCServiceAvailable("SPDI")) { if (DEBUG) debug("SPDI: SPDI available."); this.readSPDI(); } else { if (DEBUG) debug("SPDI: SPDI service is not available"); } if (ICCUtilsHelper.isICCServiceAvailable("PNN")) { if (DEBUG) debug("PNN: PNN is available"); this.readPNN(); } else { if (DEBUG) debug("PNN: PNN is not available"); } if (ICCUtilsHelper.isICCServiceAvailable("OPL")) { if (DEBUG) debug("OPL: OPL is available"); this.readOPL(); } else { if (DEBUG) debug("OPL: OPL is not available"); } if (ICCUtilsHelper.isICCServiceAvailable("CBMI")) { this.readCBMI(); } else { RIL.cellBroadcastConfigs.CBMI = null; } if (ICCUtilsHelper.isICCServiceAvailable("DATA_DOWNLOAD_SMS_CB")) { this.readCBMID(); } else { RIL.cellBroadcastConfigs.CBMID = null; } if (ICCUtilsHelper.isICCServiceAvailable("CBMIR")) { this.readCBMIR(); } else { RIL.cellBroadcastConfigs.CBMIR = null; } RIL._mergeAllCellBroadcastConfigs(); } // ICC_EF_UST has the same value with ICC_EF_SST. ICCIOHelper.loadTransparentEF({fileId: ICC_EF_SST, callback: callback.bind(this)}); }, /** * Read ICC ADN like EF, i.e. EF_ADN, EF_FDN. * * @param fileId EF id of the ADN or FDN. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readADNLike: function readADNLike(fileId, onsuccess, onerror) { function callback(options) { let contact = GsmPDUHelper.readAlphaIdDiallingNumber(options.recordSize); if (contact) { contact.recordId = options.p1; contacts.push(contact); } if (options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { if (DEBUG) { for (let i = 0; i < contacts.length; i++) { debug("contact [" + i + "] " + JSON.stringify(contacts[i])); } } if (onsuccess) { onsuccess(contacts); } } } let contacts = []; ICCIOHelper.loadLinearFixedEF({fileId: fileId, callback: callback.bind(this), onerror: onerror}); }, /** * Update ICC ADN like EFs, like EF_ADN, EF_FDN. * * @param fileId EF id of the ADN or FDN. * @param contact The contact will be updated. (Shall have recordId property) * @param pin2 PIN2 is required when updating ICC_EF_FDN. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateADNLike: function updateADNLike(fileId, contact, pin2, onsuccess, onerror) { function dataWriter(recordSize) { GsmPDUHelper.writeAlphaIdDiallingNumber(recordSize, contact.alphaId, contact.number); } function callback(options) { if (onsuccess) { onsuccess(); } } if (!contact || !contact.recordId) { let error = onerror || debug; error(GECKO_ERROR_INVALID_PARAMETER); return; } ICCIOHelper.updateLinearFixedEF({fileId: fileId, recordNumber: contact.recordId, dataWriter: dataWriter.bind(this), pin2: pin2, callback: callback.bind(this), onerror: onerror}); }, /** * Read ICC MBDN. (Mailbox Dialling Number) * * @see TS 131.102, clause 4.2.60 */ readMBDN: function readMBDN() { function callback(options) { let contact = GsmPDUHelper.readAlphaIdDiallingNumber(options.recordSize); if (!contact || (RIL.iccInfoPrivate.mbdn !== undefined && RIL.iccInfoPrivate.mbdn === contact.number)) { return; } RIL.iccInfoPrivate.mbdn = contact.number; if (DEBUG) { debug("MBDN, alphaId="+contact.alphaId+" number="+contact.number); } contact.rilMessageType = "iccmbdn"; RIL.sendChromeMessage(contact); } ICCIOHelper.loadLinearFixedEF({fileId: ICC_EF_MBDN, callback: callback.bind(this)}); }, /** * Read USIM Phonebook. * * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readPBR: function readPBR(onsuccess, onerror) { function callback(options) { let strLen = Buf.readUint32(); let octetLen = strLen / 2, readLen = 0; let pbrTlvs = []; while (readLen < octetLen) { let tag = GsmPDUHelper.readHexOctet(); if (tag == 0xff) { readLen++; Buf.seekIncoming((octetLen - readLen) * Buf.PDU_HEX_OCTET_SIZE); break; } let tlvLen = GsmPDUHelper.readHexOctet(); let tlvs = ICCUtilsHelper.decodeSimTlvs(tlvLen); pbrTlvs.push({tag: tag, length: tlvLen, value: tlvs}); readLen += tlvLen + 2; // +2 for tag and tlvLen } Buf.readStringDelimiter(strLen); if (pbrTlvs.length > 0) { let pbr = ICCUtilsHelper.parsePbrTlvs(pbrTlvs); // EF_ADN is mandatory if and only if DF_PHONEBOOK is present. if (!pbr.adn) { let error = onerror || debug; error("Cannot access ADN."); return; } pbrs.push(pbr); } if (options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { if (onsuccess) { onsuccess(pbrs); } } } let pbrs = []; ICCIOHelper.loadLinearFixedEF({fileId : ICC_EF_PBR, callback: callback.bind(this), onerror: onerror}); }, /** * Cache EF_IAP record size. */ _iapRecordSize: null, /** * Read ICC EF_IAP. (Index Administration Phonebook) * * @see TS 131.102, clause 4.4.2.2 * * @param fileId EF id of the IAP. * @param recordNumber The number of the record shall be loaded. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readIAP: function readIAP(fileId, recordNumber, onsuccess, onerror) { function callback(options) { let strLen = Buf.readUint32(); let octetLen = strLen / 2; this._iapRecordSize = options.recordSize; let iap = GsmPDUHelper.readHexOctetArray(octetLen); Buf.readStringDelimiter(strLen); if (onsuccess) { onsuccess(iap); } } ICCIOHelper.loadLinearFixedEF({fileId: fileId, recordNumber: recordNumber, recordSize: this._iapRecordSize, callback: callback.bind(this), onerror: onerror}); }, /** * Update USIM Phonebook EF_IAP. * * @see TS 131.102, clause 4.4.2.13 * * @param fileId EF id of the IAP. * @param recordNumber The identifier of the record shall be updated. * @param iap The IAP value to be written. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateIAP: function updateIAP(fileId, recordNumber, iap, onsuccess, onerror) { let dataWriter = function dataWriter(recordSize) { // Write String length let strLen = recordSize * 2; Buf.writeUint32(strLen); for (let i = 0; i < iap.length; i++) { GsmPDUHelper.writeHexOctet(iap[i]); } Buf.writeStringDelimiter(strLen); }.bind(this); ICCIOHelper.updateLinearFixedEF({fileId: fileId, recordNumber: recordNumber, dataWriter: dataWriter, callback: onsuccess, onerror: onerror}); }, /** * Cache EF_Email record size. */ _emailRecordSize: null, /** * Read USIM Phonebook EF_EMAIL. * * @see TS 131.102, clause 4.4.2.13 * * @param fileId EF id of the EMAIL. * @param fileType The type of the EMAIL, one of the ICC_USIM_TYPE* constants. * @param recordNumber The number of the record shall be loaded. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readEmail: function readEmail(fileId, fileType, recordNumber, onsuccess, onerror) { function callback(options) { let strLen = Buf.readUint32(); let octetLen = strLen / 2; let email = null; this._emailRecordSize = options.recordSize; // Read contact's email // // | Byte | Description | Length | M/O // | 1 ~ X | E-mail Address | X | M // | X+1 | ADN file SFI | 1 | C // | X+2 | ADN file Record Identifier | 1 | C // Note: The fields marked as C above are mandatort if the file // is not type 1 (as specified in EF_PBR) if (fileType == ICC_USIM_TYPE1_TAG) { email = GsmPDUHelper.read8BitUnpackedToString(octetLen); } else { email = GsmPDUHelper.read8BitUnpackedToString(octetLen - 2); // Consumes the remaining buffer Buf.seekIncoming(2 * Buf.PDU_HEX_OCTET_SIZE); // For ADN SFI and Record Identifier } Buf.readStringDelimiter(strLen); if (onsuccess) { onsuccess(email); } } ICCIOHelper.loadLinearFixedEF({fileId: fileId, recordNumber: recordNumber, recordSize: this._emailRecordSize, callback: callback.bind(this), onerror: onerror}); }, /** * Update USIM Phonebook EF_EMAIL. * * @see TS 131.102, clause 4.4.2.13 * * @param pbr Phonebook Reference File. * @param recordNumber The identifier of the record shall be updated. * @param email The value to be written. * @param adnRecordId The record Id of ADN, only needed if the fileType of Email is TYPE2. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateEmail: function updateEmail(pbr, recordNumber, email, adnRecordId, onsuccess, onerror) { let fileId = pbr[USIM_PBR_EMAIL].fileId; let fileType = pbr[USIM_PBR_EMAIL].fileType; let dataWriter = function dataWriter(recordSize) { // Write String length let strLen = recordSize * 2; Buf.writeUint32(strLen); if (fileType == ICC_USIM_TYPE1_TAG) { GsmPDUHelper.writeStringTo8BitUnpacked(recordSize, email); } else { GsmPDUHelper.writeStringTo8BitUnpacked(recordSize - 2, email); GsmPDUHelper.writeHexOctet(pbr.adn.sfi || 0xff); GsmPDUHelper.writeHexOctet(adnRecordId); } Buf.writeStringDelimiter(strLen); }.bind(this); ICCIOHelper.updateLinearFixedEF({fileId: fileId, recordNumber: recordNumber, dataWriter: dataWriter, callback: onsuccess, onerror: onerror}); }, /** * Cache EF_ANR record size. */ _anrRecordSize: null, /** * Read USIM Phonebook EF_ANR. * * @see TS 131.102, clause 4.4.2.9 * * @param fileId EF id of the ANR. * @param fileType One of the ICC_USIM_TYPE* constants. * @param recordNumber The number of the record shall be loaded. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readANR: function readANR(fileId, fileType, recordNumber, onsuccess, onerror) { function callback(options) { let strLen = Buf.readUint32(); let number = null; this._anrRecordSize = options.recordSize; // Skip EF_AAS Record ID. Buf.seekIncoming(1 * Buf.PDU_HEX_OCTET_SIZE); number = GsmPDUHelper.readNumberWithLength(); // Skip 2 unused octets, CCP and EXT1. Buf.seekIncoming(2 * Buf.PDU_HEX_OCTET_SIZE); // For Type 2 there are two extra octets. if (fileType == ICC_USIM_TYPE2_TAG) { // Skip 2 unused octets, ADN SFI and Record Identifier. Buf.seekIncoming(2 * Buf.PDU_HEX_OCTET_SIZE); } Buf.readStringDelimiter(strLen); if (onsuccess) { onsuccess(number); } } ICCIOHelper.loadLinearFixedEF({fileId: fileId, recordNumber: recordNumber, recordSize: this._anrRecordSize, callback: callback.bind(this), onerror: onerror}); }, /** * Update USIM Phonebook EF_ANR. * * @see TS 131.102, clause 4.4.2.9 * * @param pbr Phonebook Reference File. * @param recordNumber The identifier of the record shall be updated. * @param number The value to be written. * @param adnRecordId The record Id of ADN, only needed if the fileType of Email is TYPE2. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateANR: function updateANR(pbr, recordNumber, number, adnRecordId, onsuccess, onerror) { let fileId = pbr[USIM_PBR_ANR0].fileId; let fileType = pbr[USIM_PBR_ANR0].fileType; let dataWriter = function dataWriter(recordSize) { // Write String length let strLen = recordSize * 2; Buf.writeUint32(strLen); // EF_AAS record Id. Unused for now. GsmPDUHelper.writeHexOctet(0xff); GsmPDUHelper.writeNumberWithLength(number); // Write unused octets 0xff, CCP and EXT1. GsmPDUHelper.writeHexOctet(0xff); GsmPDUHelper.writeHexOctet(0xff); // For Type 2 there are two extra octets. if (fileType == ICC_USIM_TYPE2_TAG) { GsmPDUHelper.writeHexOctet(pbr.adn.sfi || 0xff); GsmPDUHelper.writeHexOctet(adnRecordId); } Buf.writeStringDelimiter(strLen); }.bind(this); ICCIOHelper.updateLinearFixedEF({fileId: fileId, recordNumber: recordNumber, dataWriter: dataWriter, callback: onsuccess, onerror: onerror}); }, /** * Read the SPDI (Service Provider Display Information) from the ICC. * * See TS 131.102 section 4.2.66 for USIM and TS 51.011 section 10.3.50 * for SIM. */ readSPDI: function readSPDI() { function callback() { let strLen = Buf.readUint32(); let octetLen = strLen / 2; let readLen = 0; let endLoop = false; RIL.iccInfoPrivate.SPDI = null; while ((readLen < octetLen) && !endLoop) { let tlvTag = GsmPDUHelper.readHexOctet(); let tlvLen = GsmPDUHelper.readHexOctet(); readLen += 2; // For tag and length fields. switch (tlvTag) { case SPDI_TAG_SPDI: // The value part itself is a TLV. continue; case SPDI_TAG_PLMN_LIST: // This PLMN list is what we want. RIL.iccInfoPrivate.SPDI = this.readPLMNEntries(tlvLen / 3); readLen += tlvLen; endLoop = true; break; default: // We don't care about its content if its tag is not SPDI nor // PLMN_LIST. endLoop = true; break; } } // Consume unread octets. Buf.seekIncoming((octetLen - readLen) * Buf.PDU_HEX_OCTET_SIZE); Buf.readStringDelimiter(strLen); if (DEBUG) debug("SPDI: " + JSON.stringify(RIL.iccInfoPrivate.SPDI)); if (ICCUtilsHelper.updateDisplayCondition()) { ICCUtilsHelper.handleICCInfoChange(); } } // PLMN List is Servive 51 in USIM, EF_SPDI ICCIOHelper.loadTransparentEF({fileId: ICC_EF_SPDI, callback: callback.bind(this)}); }, _readCbmiHelper: function _readCbmiHelper(which) { function callback() { let strLength = Buf.readUint32(); // Each Message Identifier takes two octets and each octet is encoded // into two chars. let numIds = strLength / 4, list = null; if (numIds) { list = []; for (let i = 0, id; i < numIds; i++) { id = GsmPDUHelper.readHexOctet() << 8 | GsmPDUHelper.readHexOctet(); // `Unused entries shall be set to 'FF FF'.` if (id != 0xFFFF) { list.push(id); list.push(id + 1); } } } if (DEBUG) { debug(which + ": " + JSON.stringify(list)); } Buf.readStringDelimiter(strLength); RIL.cellBroadcastConfigs[which] = list; RIL._mergeAllCellBroadcastConfigs(); } function onerror() { RIL.cellBroadcastConfigs[which] = null; RIL._mergeAllCellBroadcastConfigs(); } let fileId = GLOBAL["ICC_EF_" + which]; ICCIOHelper.loadTransparentEF({fileId: fileId, callback: callback.bind(this), onerror: onerror.bind(this)}); }, /** * Read EFcbmi (Cell Broadcast Message Identifier selection) * * @see 3GPP TS 31.102 v110.02.0 section 4.2.14 EFcbmi * @see 3GPP TS 51.011 v5.0.0 section 10.3.13 EFcbmi */ readCBMI: function readCBMI() { this._readCbmiHelper("CBMI"); }, /** * Read EFcbmid (Cell Broadcast Message Identifier for Data Download) * * @see 3GPP TS 31.102 v110.02.0 section 4.2.20 EFcbmid * @see 3GPP TS 51.011 v5.0.0 section 10.3.26 EFcbmid */ readCBMID: function readCBMID() { this._readCbmiHelper("CBMID"); }, /** * Read EFcbmir (Cell Broadcast Message Identifier Range selection) * * @see 3GPP TS 31.102 v110.02.0 section 4.2.22 EFcbmir * @see 3GPP TS 51.011 v5.0.0 section 10.3.28 EFcbmir */ readCBMIR: function readCBMIR() { function callback() { let strLength = Buf.readUint32(); // Each Message Identifier range takes four octets and each octet is // encoded into two chars. let numIds = strLength / 8, list = null; if (numIds) { list = []; for (let i = 0, from, to; i < numIds; i++) { // `Bytes one and two of each range identifier equal the lower value // of a cell broadcast range, bytes three and four equal the upper // value of a cell broadcast range.` from = GsmPDUHelper.readHexOctet() << 8 | GsmPDUHelper.readHexOctet(); to = GsmPDUHelper.readHexOctet() << 8 | GsmPDUHelper.readHexOctet(); // `Unused entries shall be set to 'FF FF'.` if ((from != 0xFFFF) && (to != 0xFFFF)) { list.push(from); list.push(to + 1); } } } if (DEBUG) { debug("CBMIR: " + JSON.stringify(list)); } Buf.readStringDelimiter(strLength); RIL.cellBroadcastConfigs.CBMIR = list; RIL._mergeAllCellBroadcastConfigs(); } function onerror() { RIL.cellBroadcastConfigs.CBMIR = null; RIL._mergeAllCellBroadcastConfigs(); } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_CBMIR, callback: callback.bind(this), onerror: onerror.bind(this)}); }, /** * Read OPL (Operator PLMN List) from USIM. * * See 3GPP TS 31.102 Sec. 4.2.59 for USIM * 3GPP TS 51.011 Sec. 10.3.42 for SIM. */ readOPL: function readOPL() { let opl = []; function callback(options) { let strLen = Buf.readUint32(); // The first 7 bytes are LAI (for UMTS) and the format of LAI is defined // in 3GPP TS 23.003, Sec 4.1 // +-------------+---------+ // | Octet 1 - 3 | MCC/MNC | // +-------------+---------+ // | Octet 4 - 7 | LAC | // +-------------+---------+ let mccMnc = [GsmPDUHelper.readHexOctet(), GsmPDUHelper.readHexOctet(), GsmPDUHelper.readHexOctet()]; if (mccMnc[0] != 0xFF || mccMnc[1] != 0xFF || mccMnc[2] != 0xFF) { let oplElement = {}; let semiOctets = []; for (let i = 0; i < mccMnc.length; i++) { semiOctets.push((mccMnc[i] & 0xf0) >> 4); semiOctets.push(mccMnc[i] & 0x0f); } let reformat = [semiOctets[1], semiOctets[0], semiOctets[3], semiOctets[5], semiOctets[4], semiOctets[2]]; let buf = ""; for (let i = 0; i < reformat.length; i++) { if (reformat[i] != 0xF) { buf += GsmPDUHelper.semiOctetToBcdChar(reformat[i]); } if (i === 2) { // 0-2: MCC oplElement.mcc = buf; buf = ""; } else if (i === 5) { // 3-5: MNC oplElement.mnc = buf; } } // LAC/TAC oplElement.lacTacStart = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); oplElement.lacTacEnd = (GsmPDUHelper.readHexOctet() << 8) | GsmPDUHelper.readHexOctet(); // PLMN Network Name Record Identifier oplElement.pnnRecordId = GsmPDUHelper.readHexOctet(); if (DEBUG) { debug("OPL: [" + (opl.length + 1) + "]: " + JSON.stringify(oplElement)); } opl.push(oplElement); } else { Buf.seekIncoming(5 * Buf.PDU_HEX_OCTET_SIZE); } Buf.readStringDelimiter(strLen); if (options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { RIL.iccInfoPrivate.OPL = opl; } } ICCIOHelper.loadLinearFixedEF({fileId: ICC_EF_OPL, callback: callback.bind(this)}); }, /** * Read PNN (PLMN Network Name) from USIM. * * See 3GPP TS 31.102 Sec. 4.2.58 for USIM * 3GPP TS 51.011 Sec. 10.3.41 for SIM. */ readPNN: function readPNN() { function callback(options) { let pnnElement; let strLen = Buf.readUint32(); let octetLen = strLen / 2; let readLen = 0; while (readLen < octetLen) { let tlvTag = GsmPDUHelper.readHexOctet(); if (tlvTag == 0xFF) { // Unused byte readLen++; Buf.seekIncoming((octetLen - readLen) * Buf.PDU_HEX_OCTET_SIZE); break; } // Needs this check to avoid initializing twice. pnnElement = pnnElement || {}; let tlvLen = GsmPDUHelper.readHexOctet(); switch (tlvTag) { case PNN_IEI_FULL_NETWORK_NAME: pnnElement.fullName = GsmPDUHelper.readNetworkName(tlvLen); break; case PNN_IEI_SHORT_NETWORK_NAME: pnnElement.shortName = GsmPDUHelper.readNetworkName(tlvLen); break; default: Buf.seekIncoming(tlvLen * Buf.PDU_HEX_OCTET_SIZE); break; } readLen += (tlvLen + 2); // +2 for tlvTag and tlvLen } Buf.readStringDelimiter(strLen); if (pnnElement) { pnn.push(pnnElement); } // Will ignore remaining records when got the contents of a record are all 0xff. if (pnnElement && options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { if (DEBUG) { for (let i = 0; i < pnn.length; i++) { debug("PNN: [" + i + "]: " + JSON.stringify(pnn[i])); } } RIL.iccInfoPrivate.PNN = pnn; } } let pnn = []; ICCIOHelper.loadLinearFixedEF({fileId: ICC_EF_PNN, callback: callback.bind(this)}); }, /** * Find free record id. * * @param fileId EF id. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ findFreeRecordId: function findFreeRecordId(fileId, onsuccess, onerror) { function callback(options) { let strLen = Buf.readUint32(); let octetLen = strLen / 2; let readLen = 0; while (readLen < octetLen) { let octet = GsmPDUHelper.readHexOctet(); readLen++; if (octet != 0xff) { break; } } if (readLen == octetLen) { // Find free record. if (onsuccess) { onsuccess(options.p1); } return; } else { Buf.seekIncoming((octetLen - readLen) * Buf.PDU_HEX_OCTET_SIZE); } Buf.readStringDelimiter(strLen); if (options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { // No free record found. let error = onerror || debug; error("No free record found."); } } ICCIOHelper.loadLinearFixedEF({fileId: fileId, callback: callback.bind(this), onerror: onerror}); }, /** * Read the list of PLMN (Public Land Mobile Network) entries * We cannot directly rely on readSwappedNibbleBcdToString(), * since it will no correctly handle some corner-cases that are * not a problem in our case (0xFF 0xFF 0xFF). * * @param length The number of PLMN records. * @return An array of string corresponding to the PLMNs. */ readPLMNEntries: function readPLMNEntries(length) { let plmnList = []; // Each PLMN entry has 3 bytes. if (DEBUG) debug("readPLMNEntries: PLMN entries length = " + length); let index = 0; while (index < length) { // Unused entries will be 0xFFFFFF, according to EF_SPDI // specs (TS 131 102, section 4.2.66) try { let plmn = [GsmPDUHelper.readHexOctet(), GsmPDUHelper.readHexOctet(), GsmPDUHelper.readHexOctet()]; if (DEBUG) debug("readPLMNEntries: Reading PLMN entry: [" + index + "]: '" + plmn + "'"); if (plmn[0] != 0xFF && plmn[1] != 0xFF && plmn[2] != 0xFF) { let semiOctets = []; for (let idx = 0; idx < plmn.length; idx++) { semiOctets.push((plmn[idx] & 0xF0) >> 4); semiOctets.push(plmn[idx] & 0x0F); } // According to TS 24.301, 9.9.3.12, the semi octets is arranged // in format: // Byte 1: MCC[2] | MCC[1] // Byte 2: MNC[3] | MCC[3] // Byte 3: MNC[2] | MNC[1] // Therefore, we need to rearrange them. let reformat = [semiOctets[1], semiOctets[0], semiOctets[3], semiOctets[5], semiOctets[4], semiOctets[2]]; let buf = ""; let plmnEntry = {}; for (let i = 0; i < reformat.length; i++) { if (reformat[i] != 0xF) { buf += GsmPDUHelper.semiOctetToBcdChar(reformat[i]); } if (i === 2) { // 0-2: MCC plmnEntry.mcc = buf; buf = ""; } else if (i === 5) { // 3-5: MNC plmnEntry.mnc = buf; } } if (DEBUG) debug("readPLMNEntries: PLMN = " + plmnEntry.mcc + ", " + plmnEntry.mnc); plmnList.push(plmnEntry); } } catch (e) { if (DEBUG) debug("readPLMNEntries: PLMN entry " + index + " is invalid."); break; } index ++; } return plmnList; }, }; /** * Helper functions for ICC utilities. */ let ICCUtilsHelper = { /** * Get network names by using EF_OPL and EF_PNN * * @See 3GPP TS 31.102 sec. 4.2.58 and sec. 4.2.59 for USIM, * 3GPP TS 51.011 sec. 10.3.41 and sec. 10.3.42 for SIM. * * @param mcc The mobile country code of the network. * @param mnc The mobile network code of the network. * @param lac The location area code of the network. */ getNetworkNameFromICC: function getNetworkNameFromICC(mcc, mnc, lac) { let iccInfoPriv = RIL.iccInfoPrivate; let iccInfo = RIL.iccInfo; let pnnEntry; if (!mcc || !mnc || !lac) { return null; } // We won't get network name if there is no PNN file. if (!iccInfoPriv.PNN) { return null; } if (!iccInfoPriv.OPL) { // When OPL is not present: // According to 3GPP TS 31.102 Sec. 4.2.58 and 3GPP TS 51.011 Sec. 10.3.41, // If EF_OPL is not present, the first record in this EF is used for the // default network name when registered to the HPLMN. // If we haven't get pnnEntry assigned, we should try to assign default // value to it. if (mcc == iccInfo.mcc && mnc == iccInfo.mnc) { pnnEntry = iccInfoPriv.PNN[0]; } } else { // According to 3GPP TS 31.102 Sec. 4.2.59 and 3GPP TS 51.011 Sec. 10.3.42, // the ME shall use this EF_OPL in association with the EF_PNN in place // of any network name stored within the ME's internal list and any network // name received when registered to the PLMN. let length = iccInfoPriv.OPL ? iccInfoPriv.OPL.length : 0; for (let i = 0; i < length; i++) { let opl = iccInfoPriv.OPL[i]; // Try to match the MCC/MNC. if (mcc != opl.mcc || mnc != opl.mnc) { continue; } // Try to match the location area code. If current local area code is // covered by lac range that specified in the OPL entry, use the PNN // that specified in the OPL entry. if ((opl.lacTacStart === 0x0 && opl.lacTacEnd == 0xFFFE) || (opl.lacTacStart <= lac && opl.lacTacEnd >= lac)) { if (opl.pnnRecordId === 0) { // See 3GPP TS 31.102 Sec. 4.2.59 and 3GPP TS 51.011 Sec. 10.3.42, // A value of '00' indicates that the name is to be taken from other // sources. return null; } pnnEntry = iccInfoPriv.PNN[opl.pnnRecordId - 1]; break; } } } if (!pnnEntry) { return null; } // Return a new object to avoid global variable, PNN, be modified by accident. return { fullName: pnnEntry.fullName || "", shortName: pnnEntry.shortName || "" }; }, /** * This will compute the spnDisplay field of the network. * See TS 22.101 Annex A and TS 51.011 10.3.11 for details. * * @return True if some of iccInfo is changed in by this function. */ updateDisplayCondition: function updateDisplayCondition() { // If EFspn isn't existed in SIM or it haven't been read yet, we should // just set isDisplayNetworkNameRequired = true and // isDisplaySpnRequired = false let iccInfo = RIL.iccInfo; let iccInfoPriv = RIL.iccInfoPrivate; let displayCondition = iccInfoPriv.spnDisplayCondition; let origIsDisplayNetworkNameRequired = iccInfo.isDisplayNetworkNameRequired; let origIsDisplaySPNRequired = iccInfo.isDisplaySpnRequired; if (displayCondition === undefined) { iccInfo.isDisplayNetworkNameRequired = true; iccInfo.isDisplaySpnRequired = false; } else if (RIL._isCdma) { // CDMA family display rule. let cdmaHome = RIL.cdmaHome; let cell = RIL.voiceRegistrationState.cell; let sid = cell && cell.cdmaSystemId; let nid = cell && cell.cdmaNetworkId; iccInfo.isDisplayNetworkNameRequired = false; // If display condition is 0x0, we don't even need to check network id // or system id. if (displayCondition === 0x0) { iccInfo.isDisplaySpnRequired = false; } else { // CDMA SPN Display condition dosen't specify whenever network name is // reqired. if (!cdmaHome || !cdmaHome.systemId || cdmaHome.systemId.length === 0 || cdmaHome.systemId.length != cdmaHome.networkId.length || !sid || !nid) { // CDMA Home haven't been ready, or we haven't got the system id and // network id of the network we register to, assuming we are in home // network. iccInfo.isDisplaySpnRequired = true; } else { // Determine if we are registered in the home service area. // System ID and Network ID are described in 3GPP2 C.S0005 Sec. 2.6.5.2. let inHomeArea = false; for (let i = 0; i < cdmaHome.systemId.length; i++) { let homeSid = cdmaHome.systemId[i], homeNid = cdmaHome.networkId[i]; if (homeSid === 0 || homeNid === 0 // Reserved system id/network id || homeSid != sid) { continue; } // According to 3GPP2 C.S0005 Sec. 2.6.5.2, NID number 65535 means // all networks in the system should be considered as home. if (homeNid == 65535 || homeNid == nid) { inHomeArea = true; break; } } iccInfo.isDisplaySpnRequired = inHomeArea; } } } else { // GSM family display rule. let operatorMnc = RIL.operator.mnc; let operatorMcc = RIL.operator.mcc; // First detect if we are on HPLMN or one of the PLMN // specified by the SIM card. let isOnMatchingPlmn = false; // If the current network is the one defined as mcc/mnc // in SIM card, it's okay. if (iccInfo.mcc == operatorMcc && iccInfo.mnc == operatorMnc) { isOnMatchingPlmn = true; } // Test to see if operator's mcc/mnc match mcc/mnc of PLMN. if (!isOnMatchingPlmn && iccInfoPriv.SPDI) { let iccSpdi = iccInfoPriv.SPDI; // PLMN list for (let plmn in iccSpdi) { let plmnMcc = iccSpdi[plmn].mcc; let plmnMnc = iccSpdi[plmn].mnc; isOnMatchingPlmn = (plmnMcc == operatorMcc) && (plmnMnc == operatorMnc); if (isOnMatchingPlmn) { break; } } } if (isOnMatchingPlmn) { // The first bit of display condition tells us if we should display // registered PLMN. if (DEBUG) debug("updateDisplayCondition: PLMN is HPLMN or PLMN is in PLMN list"); // TS 31.102 Sec. 4.2.66 and TS 51.011 Sec. 10.3.50 // EF_SPDI contains a list of PLMNs in which the Service Provider Name // shall be displayed. iccInfo.isDisplaySpnRequired = true; iccInfo.isDisplayNetworkNameRequired = (displayCondition & 0x01) !== 0; } else { // The second bit of display condition tells us if we should display // registered PLMN. if (DEBUG) debug("updateICCDisplayName: PLMN isn't HPLMN and PLMN isn't in PLMN list"); // We didn't found the requirement of displaying network name if // current PLMN isn't HPLMN nor one of PLMN in SPDI. So we keep // isDisplayNetworkNameRequired false. iccInfo.isDisplayNetworkNameRequired = false; iccInfo.isDisplaySpnRequired = (displayCondition & 0x02) === 0; } } if (DEBUG) { debug("updateDisplayCondition: isDisplayNetworkNameRequired = " + iccInfo.isDisplayNetworkNameRequired); debug("updateDisplayCondition: isDisplaySpnRequired = " + iccInfo.isDisplaySpnRequired); } return ((origIsDisplayNetworkNameRequired !== iccInfo.isDisplayNetworkNameRequired) || (origIsDisplaySPNRequired !== iccInfo.isDisplaySpnRequired)); }, decodeSimTlvs: function decodeSimTlvs(tlvsLen) { let index = 0; let tlvs = []; while (index < tlvsLen) { let simTlv = { tag : GsmPDUHelper.readHexOctet(), length : GsmPDUHelper.readHexOctet(), }; simTlv.value = GsmPDUHelper.readHexOctetArray(simTlv.length); tlvs.push(simTlv); index += simTlv.length + 2; // The length of 'tag' and 'length' field. } return tlvs; }, /** * Parse those TLVs and convert it to an object. */ parsePbrTlvs: function parsePbrTlvs(pbrTlvs) { let pbr = {}; for (let i = 0; i < pbrTlvs.length; i++) { let pbrTlv = pbrTlvs[i]; let anrIndex = 0; for (let j = 0; j < pbrTlv.value.length; j++) { let tlv = pbrTlv.value[j]; let tagName = USIM_TAG_NAME[tlv.tag]; // ANR could have multiple files. We save it as anr0, anr1,...etc. if (tlv.tag == ICC_USIM_EFANR_TAG) { tagName += anrIndex; anrIndex++; } pbr[tagName] = tlv; pbr[tagName].fileType = pbrTlv.tag; pbr[tagName].fileId = (tlv.value[0] << 8) | tlv.value[1]; pbr[tagName].sfi = tlv.value[2]; // For Type 2, the order of files is in the same order in IAP. if (pbrTlv.tag == ICC_USIM_TYPE2_TAG) { pbr[tagName].indexInIAP = j; } } } return pbr; }, /** * Update the ICC information to RadioInterfaceLayer. */ handleICCInfoChange: function handleICCInfoChange() { RIL.iccInfo.rilMessageType = "iccinfochange"; RIL.sendChromeMessage(RIL.iccInfo); }, /** * Get whether specificed (U)SIM service is available. * * @param geckoService * Service name like "ADN", "BDN", etc. * * @return true if the service is enabled, false otherwise. */ isICCServiceAvailable: function isICCServiceAvailable(geckoService) { let serviceTable = RIL._isCdma ? RIL.iccInfoPrivate.cst: RIL.iccInfoPrivate.sst; let index, bitmask; if (RIL.appType == CARD_APPTYPE_SIM || RIL.appType == CARD_APPTYPE_RUIM) { /** * Service id is valid in 1..N, and 2 bits are used to code each service. * * +----+-- --+----+----+ * | b8 | ... | b2 | b1 | * +----+-- --+----+----+ * * b1 = 0, service not allocated. * 1, service allocated. * b2 = 0, service not activatd. * 1, service allocated. * * @see 3GPP TS 51.011 10.3.7. */ let simService; if (RIL.appType == CARD_APPTYPE_SIM) { simService = GECKO_ICC_SERVICES.sim[geckoService]; } else { simService = GECKO_ICC_SERVICES.ruim[geckoService]; } if (!simService) { return false; } simService -= 1; index = Math.floor(simService / 4); bitmask = 2 << ((simService % 4) << 1); } else if (RIL.appType == CARD_APPTYPE_USIM) { /** * Service id is valid in 1..N, and 1 bit is used to code each service. * * +----+-- --+----+----+ * | b8 | ... | b2 | b1 | * +----+-- --+----+----+ * * b1 = 0, service not avaiable. * 1, service available. * b2 = 0, service not avaiable. * 1, service available. * * @see 3GPP TS 31.102 4.2.8. */ let usimService = GECKO_ICC_SERVICES.usim[geckoService]; if (!usimService) { return false; } usimService -= 1; index = Math.floor(usimService / 8); bitmask = 1 << ((usimService % 8) << 0); } return (serviceTable !== null) && (index < serviceTable.length) && ((serviceTable[index] & bitmask) !== 0); }, /** * Check if the string is of GSM default 7-bit coded alphabets with bit 8 * set to 0. * * @param str String to be checked. */ isGsm8BitAlphabet: function isGsm8BitAlphabet(str) { if (!str) { return false; } const langTable = PDU_NL_LOCKING_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; const langShiftTable = PDU_NL_SINGLE_SHIFT_TABLES[PDU_NL_IDENTIFIER_DEFAULT]; for (let i = 0; i < str.length; i++) { let c = str.charAt(i); let octet = langTable.indexOf(c); if (octet == -1) { octet = langShiftTable.indexOf(c); if (octet == -1) { return false; } } } return true; }, /** * Parse MCC/MNC from IMSI. If there is no available value for the length of * mnc, it will use the data in MCC table to parse. * * @param imsi * The imsi of icc. * @param mncLength [optional] * The length of mnc. * * @return An object contains the parsing result of mcc and mnc. * Or null if any error occurred. */ parseMccMncFromImsi: function parseMccMncFromImsi(imsi, mncLength) { if (!imsi) { return null; } // MCC is the first 3 digits of IMSI. let mcc = imsi.substr(0,3); if (!mncLength) { // Check the MCC table to decide the length of MNC. let index = MCC_TABLE_FOR_MNC_LENGTH_IS_3.indexOf(mcc); mncLength = (index !== -1) ? 3 : 2; } let mnc = imsi.substr(3, mncLength); if (DEBUG) debug("IMSI: " + imsi + " MCC: " + mcc + " MNC: " + mnc); return { mcc: mcc, mnc: mnc}; }, }; /** * Helper for ICC Contacts. */ let ICCContactHelper = { /** * Helper function to check DF_PHONEBOOK. */ hasDfPhoneBook: function hasDfPhoneBook(appType) { switch (appType) { case CARD_APPTYPE_SIM: return false; case CARD_APPTYPE_USIM: return true; case CARD_APPTYPE_RUIM: return ICCUtilsHelper.isICCServiceAvailable("ENHANCED_PHONEBOOK"); default: return false; } }, /** * Helper function to read ICC contacts. * * @param appType One of CARD_APPTYPE_*. * @param contactType "adn" or "fdn". * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readICCContacts: function readICCContacts(appType, contactType, onsuccess, onerror) { switch (contactType) { case "adn": if (!this.hasDfPhoneBook(appType)) { ICCRecordHelper.readADNLike(ICC_EF_ADN, onsuccess, onerror); } else { this.readUSimContacts(onsuccess, onerror); } break; case "fdn": ICCRecordHelper.readADNLike(ICC_EF_FDN, onsuccess, onerror); break; default: let error = onerror || debug; error(GECKO_ERROR_REQUEST_NOT_SUPPORTED); break; } }, /** * Helper function to find free contact record. * * @param appType One of CARD_APPTYPE_*. * @param contactType "adn" or "fdn". * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ findFreeICCContact: function findFreeICCContact(appType, contactType, onsuccess, onerror) { switch (contactType) { case "adn": if (!this.hasDfPhoneBook(appType)) { ICCRecordHelper.findFreeRecordId(ICC_EF_ADN, onsuccess, onerror); } else { let gotPbrCb = function gotPbrCb(pbrs) { this.findUSimFreeADNRecordId(pbrs, onsuccess, onerror); }.bind(this); ICCRecordHelper.readPBR(gotPbrCb, onerror); } break; case "fdn": ICCRecordHelper.findFreeRecordId(ICC_EF_FDN, onsuccess, onerror); break; default: let error = onerror || debug; error(GECKO_ERROR_REQUEST_NOT_SUPPORTED); break; } }, /** * Find free ADN record id in USIM. * * @param pbrs All Phonebook Reference Files read. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ findUSimFreeADNRecordId: function findUSimFreeADNRecordId(pbrs, onsuccess, onerror) { (function findFreeRecordId(pbrIndex) { if (pbrIndex >= pbrs.length) { let error = onerror || debug; error("No free record found."); return; } let pbr = pbrs[pbrIndex]; ICCRecordHelper.findFreeRecordId( pbr.adn.fileId, onsuccess, function (errorMsg) { findFreeRecordId.bind(this, pbrIndex + 1); }.bind(this)); })(0); }, /** * Helper function to add a new ICC contact. * * @param appType One of CARD_APPTYPE_*. * @param contactType "adn" or "fdn". * @param contact The contact will be added. * @param pin2 PIN2 is required for FDN. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ addICCContact: function addICCContact(appType, contactType, contact, pin2, onsuccess, onerror) { let foundFreeCb = function foundFreeCb(recordId) { contact.recordId = recordId; ICCContactHelper.updateICCContact(appType, contactType, contact, pin2, onsuccess, onerror); }.bind(this); // Find free record first. ICCContactHelper.findFreeICCContact(appType, contactType, foundFreeCb, onerror); }, /** * Helper function to update ICC contact. * * @param appType One of CARD_APPTYPE_*. * @param contactType "adn" or "fdn". * @param contact The contact will be updated. * @param pin2 PIN2 is required for FDN. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateICCContact: function updateICCContact(appType, contactType, contact, pin2, onsuccess, onerror) { let error = onerror || debug; switch (contactType) { case "adn": if (!this.hasDfPhoneBook(appType)) { ICCRecordHelper.updateADNLike(ICC_EF_ADN, contact, null, onsuccess, onerror); } else { this.updateUSimContact(contact, onsuccess, onerror); } break; case "fdn": if (!pin2) { error("pin2 is empty"); return; } ICCRecordHelper.updateADNLike(ICC_EF_FDN, contact, pin2, onsuccess, onerror); break; default: error(GECKO_ERROR_REQUEST_NOT_SUPPORTED); break; } }, /** * Read contacts from USIM. * * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readUSimContacts: function readUSimContacts(onsuccess, onerror) { let gotPbrCb = function gotPbrCb(pbrs) { this.readAllPhonebookSets(pbrs, onsuccess, onerror); }.bind(this); ICCRecordHelper.readPBR(gotPbrCb, onerror); }, /** * Read all Phonebook sets. * * @param pbrs All Phonebook Reference Files read. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readAllPhonebookSets: function readAllPhonebookSets(pbrs, onsuccess, onerror) { let allContacts = [], pbrIndex = 0; let readPhonebook = function readPhonebook(contacts) { if (contacts) { allContacts = allContacts.concat(contacts); } let cLen = contacts ? contacts.length : 0; for (let i = 0; i < cLen; i++) { contacts[i].recordId += pbrIndex * ICC_MAX_LINEAR_FIXED_RECORDS; } pbrIndex++; if (pbrIndex >= pbrs.length) { if (onsuccess) { onsuccess(allContacts); } return; } this.readPhonebookSet(pbrs[pbrIndex], readPhonebook, onerror); }.bind(this); this.readPhonebookSet(pbrs[pbrIndex], readPhonebook, onerror); }, /** * Read from Phonebook Reference File. * * @param pbr Phonebook Reference File to be read. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readPhonebookSet: function readPhonebookSet(pbr, onsuccess, onerror) { let gotAdnCb = function gotAdnCb(contacts) { this.readSupportedPBRFields(pbr, contacts, onsuccess, onerror); }.bind(this); ICCRecordHelper.readADNLike(pbr.adn.fileId, gotAdnCb, onerror); }, /** * Read supported Phonebook fields. * * @param pbr Phone Book Reference file. * @param contacts Contacts stored on ICC. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readSupportedPBRFields: function readSupportedPBRFields(pbr, contacts, onsuccess, onerror) { let fieldIndex = 0; (function readField() { let field = USIM_PBR_FIELDS[fieldIndex]; fieldIndex += 1; if (!field) { if (onsuccess) { onsuccess(contacts); } return; } ICCContactHelper.readPhonebookField(pbr, contacts, field, readField, onerror); })(); }, /** * Read Phonebook field. * * @param pbr The phonebook reference file. * @param contacts Contacts stored on ICC. * @param field Phonebook field to be retrieved. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readPhonebookField: function readPhonebookField(pbr, contacts, field, onsuccess, onerror) { if (!pbr[field]) { if (onsuccess) { onsuccess(contacts); } return; } (function doReadContactField(n) { if (n >= contacts.length) { // All contact's fields are read. if (onsuccess) { onsuccess(contacts); } return; } // get n-th contact's field. ICCContactHelper.readContactField( pbr, contacts[n], field, doReadContactField.bind(this, n + 1), onerror); })(0); }, /** * Read contact's field from USIM. * * @param pbr The phonebook reference file. * @param contact The contact needs to get field. * @param field Phonebook field to be retrieved. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ readContactField: function readContactField(pbr, contact, field, onsuccess, onerror) { let gotRecordIdCb = function gotRecordIdCb(recordId) { if (recordId == 0xff) { if (onsuccess) { onsuccess(); } return; } let fileId = pbr[field].fileId; let fileType = pbr[field].fileType; let gotFieldCb = function gotFieldCb(value) { if (value) { // Move anr0 anr1,.. into anr[]. if (field.startsWith(USIM_PBR_ANR)) { if (!contact[USIM_PBR_ANR]) { contact[USIM_PBR_ANR] = []; } contact[USIM_PBR_ANR].push(value); } else { contact[field] = value; } } if (onsuccess) { onsuccess(); } }.bind(this); // Detect EF to be read, for anr, it could have anr0, anr1,... let ef = field.startsWith(USIM_PBR_ANR) ? USIM_PBR_ANR : field; switch (ef) { case USIM_PBR_EMAIL: ICCRecordHelper.readEmail(fileId, fileType, recordId, gotFieldCb, onerror); break; case USIM_PBR_ANR: ICCRecordHelper.readANR(fileId, fileType, recordId, gotFieldCb, onerror); break; default: let error = onerror || debug; error("Unknown field " + field); break; } }.bind(this); this.getContactFieldRecordId(pbr, contact, field, gotRecordIdCb, onerror); }, /** * Get the recordId. * * If the fileType of field is ICC_USIM_TYPE1_TAG, use corresponding ADN recordId. * otherwise get the recordId from IAP. * * @see TS 131.102, clause 4.4.2.2 * * @param pbr The phonebook reference file. * @param contact The contact will be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ getContactFieldRecordId: function getContactFieldRecordId(pbr, contact, field, onsuccess, onerror) { if (pbr[field].fileType == ICC_USIM_TYPE1_TAG) { // If the file type is ICC_USIM_TYPE1_TAG, use corresponding ADN recordId. if (onsuccess) { onsuccess(contact.recordId); } } else if (pbr[field].fileType == ICC_USIM_TYPE2_TAG) { // If the file type is ICC_USIM_TYPE2_TAG, the recordId shall be got from IAP. let gotIapCb = function gotIapCb(iap) { let indexInIAP = pbr[field].indexInIAP; let recordId = iap[indexInIAP]; if (onsuccess) { onsuccess(recordId); } }.bind(this); ICCRecordHelper.readIAP(pbr.iap.fileId, contact.recordId, gotIapCb, onerror); } else { let error = onerror | debug; error("USIM PBR files in Type 3 format are not supported."); } }, /** * Update USIM contact. * * @param contact The contact will be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateUSimContact: function updateUSimContact(contact, onsuccess, onerror) { let gotPbrCb = function gotPbrCb(pbrs) { let pbrIndex = Math.floor(contact.recordId / ICC_MAX_LINEAR_FIXED_RECORDS); let pbr = pbrs[pbrIndex]; if (!pbr) { let error = onerror || debug; error("Cannot access Phonebook."); return; } contact.recordId %= ICC_MAX_LINEAR_FIXED_RECORDS; this.updatePhonebookSet(pbr, contact, onsuccess, onerror); }.bind(this); ICCRecordHelper.readPBR(gotPbrCb, onerror); }, /** * Update fields in Phonebook Reference File. * * @param pbr Phonebook Reference File to be read. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updatePhonebookSet: function updatePhonebookSet(pbr, contact, onsuccess, onerror) { let updateAdnCb = function () { this.updateSupportedPBRFields(pbr, contact, onsuccess, onerror); }.bind(this); ICCRecordHelper.updateADNLike(pbr.adn.fileId, contact, null, updateAdnCb, onerror); }, /** * Update supported Phonebook fields. * * @param pbr Phone Book Reference file. * @param contact Contact to be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateSupportedPBRFields: function updateSupportedPBRFields(pbr, contact, onsuccess, onerror) { let fieldIndex = 0; (function updateField() { let field = USIM_PBR_FIELDS[fieldIndex]; fieldIndex += 1; if (!field) { if (onsuccess) { onsuccess(); } return; } // Check if PBR has this field. if (!pbr[field]) { updateField(); return; } // Check if contact has additional properties (email, anr, ...etc) that // need to be updated as well. if ((field === USIM_PBR_EMAIL && !contact.email) || (field === USIM_PBR_ANR0 && (!Array.isArray(contact.anr) || !contact.anr[0]))) { updateField(); return; } ICCContactHelper.updateContactField(pbr, contact, field, updateField, onerror); })(); }, /** * Update contact's field from USIM. * * @param pbr The phonebook reference file. * @param contact The contact needs to be updated. * @param field Phonebook field to be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateContactField: function updateContactField(pbr, contact, field, onsuccess, onerror) { if (pbr[field].fileType === ICC_USIM_TYPE1_TAG) { this.updateContactFieldType1(pbr, contact, field, onsuccess, onerror); } else if (pbr[field].fileType === ICC_USIM_TYPE2_TAG) { this.updateContactFieldType2(pbr, contact, field, onsuccess, onerror); } }, /** * Update Type 1 USIM contact fields. * * @param pbr The phonebook reference file. * @param contact The contact needs to be updated. * @param field Phonebook field to be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateContactFieldType1: function updateContactFieldType1(pbr, contact, field, onsuccess, onerror) { if (field === USIM_PBR_EMAIL) { ICCRecordHelper.updateEmail(pbr, contact.recordId, contact.email, null, onsuccess, onerror); } else if (field === USIM_PBR_ANR0) { ICCRecordHelper.updateANR(pbr, contact.recordId, contact.anr[0], null, onsuccess, onerror); } }, /** * Update Type 2 USIM contact fields. * * @param pbr The phonebook reference file. * @param contact The contact needs to be updated. * @param field Phonebook field to be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ updateContactFieldType2: function updateContactFieldType2(pbr, contact, field, onsuccess, onerror) { // Case 1 : EF_IAP[adnRecordId] doesn't have a value(0xff) // Find a free recordId for EF_field // Update field with that free recordId. // Update IAP. // // Case 2: EF_IAP[adnRecordId] has a value // update EF_field[iap[field.indexInIAP]] let gotIapCb = function gotIapCb(iap) { let recordId = iap[pbr[field].indexInIAP]; if (recordId === 0xff) { // Case 1. this.addContactFieldType2(pbr, contact, field, onsuccess, onerror); return; } // Case 2. if (field === USIM_PBR_EMAIL) { ICCRecordHelper.updateEmail(pbr, recordId, contact.email, contact.recordId, onsuccess, onerror); } else if (field === USIM_PBR_ANR0) { ICCRecordHelper.updateANR(pbr, recordId, contact.anr[0], contact.recordId, onsuccess, onerror); } }.bind(this); ICCRecordHelper.readIAP(pbr.iap.fileId, contact.recordId, gotIapCb, onerror); }, /** * Add Type 2 USIM contact fields. * * @param pbr The phonebook reference file. * @param contact The contact needs to be updated. * @param field Phonebook field to be updated. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. */ addContactFieldType2: function addContactFieldType2(pbr, contact, field, onsuccess, onerror) { let successCb = function successCb(recordId) { let updateCb = function updateCb() { this.updateContactFieldIndexInIAP(pbr, contact.recordId, field, recordId, onsuccess, onerror); }.bind(this); if (field === USIM_PBR_EMAIL) { ICCRecordHelper.updateEmail(pbr, recordId, contact.email, contact.recordId, updateCb, onerror); } else if (field === USIM_PBR_ANR0) { ICCRecordHelper.updateANR(pbr, recordId, contact.anr[0], contact.recordId, updateCb, onerror); } }.bind(this); let errorCb = function errorCb(errorMsg) { let error = onerror || debug; error(errorMsg + " USIM field " + field); }.bind(this); ICCRecordHelper.findFreeRecordId(pbr[field].fileId, successCb, errorCb); }, /** * Update IAP value. * * @param pbr The phonebook reference file. * @param recordNumber The record identifier of EF_IAP. * @param field Phonebook field. * @param value The value of 'field' in IAP. * @param onsuccess Callback to be called when success. * @param onerror Callback to be called when error. * */ updateContactFieldIndexInIAP: function updateContactFieldIndexInIAP(pbr, recordNumber, field, value, onsuccess, onerror) { let gotIAPCb = function gotIAPCb(iap) { iap[pbr[field].indexInIAP] = value; ICCRecordHelper.updateIAP(pbr.iap.fileId, recordNumber, iap, onsuccess, onerror); }.bind(this); ICCRecordHelper.readIAP(pbr.iap.fileId, recordNumber, gotIAPCb, onerror); }, }; let RuimRecordHelper = { fetchRuimRecords: function fetchRuimRecords() { ICCRecordHelper.readICCID(); RIL.getIMSI(); this.readCST(); this.readCDMAHome(); RIL.getCdmaSubscription(); }, /** * Read CDMAHOME for CSIM. * See 3GPP2 C.S0023 Sec. 3.4.8. */ readCDMAHome: function readCDMAHome() { function callback(options) { let strLen = Buf.readUint32(); let tempOctet = GsmPDUHelper.readHexOctet(); cdmaHomeSystemId.push(((GsmPDUHelper.readHexOctet() & 0x7f) << 8) | tempOctet); tempOctet = GsmPDUHelper.readHexOctet(); cdmaHomeNetworkId.push(((GsmPDUHelper.readHexOctet() & 0xff) << 8) | tempOctet); // Consuming the last octet: band class. Buf.seekIncoming(Buf.PDU_HEX_OCTET_SIZE); Buf.readStringDelimiter(strLen); if (options.p1 < options.totalRecords) { ICCIOHelper.loadNextRecord(options); } else { if (DEBUG) { debug("CDMAHome system id: " + JSON.stringify(cdmaHomeSystemId)); debug("CDMAHome network id: " + JSON.stringify(cdmaHomeNetworkId)); } RIL.cdmaHome = { systemId: cdmaHomeSystemId, networkId: cdmaHomeNetworkId }; } } let cdmaHomeSystemId = [], cdmaHomeNetworkId = []; ICCIOHelper.loadLinearFixedEF({fileId: ICC_EF_CSIM_CDMAHOME, callback: callback.bind(this)}); }, /** * Read CDMA Service Table. * See 3GPP2 C.S0023 Sec. 3.4.18 */ readCST: function readCST() { function callback() { let strLen = Buf.readUint32(); // Each octet is encoded into two chars. RIL.iccInfoPrivate.cst = GsmPDUHelper.readHexOctetArray(strLen / 2); Buf.readStringDelimiter(strLen); if (DEBUG) { let str = ""; for (let i = 0; i < RIL.iccInfoPrivate.cst.length; i++) { str += RIL.iccInfoPrivate.cst[i] + ", "; } debug("CST: " + str); } if (ICCUtilsHelper.isICCServiceAvailable("SPN")) { if (DEBUG) debug("SPN: SPN is available"); this.readSPN(); } } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_CSIM_CST, callback: callback.bind(this)}); }, readSPN: function readSPN() { function callback() { let strLen = Buf.readUint32(); let octetLen = strLen / 2; let displayCondition = GsmPDUHelper.readHexOctet(); let codingScheme = GsmPDUHelper.readHexOctet(); // Skip one octet: language indicator. Buf.seekIncoming(Buf.PDU_HEX_OCTET_SIZE); let readLen = 3; // SPN String ends up with 0xff. let userDataBuffer = []; while (readLen < octetLen) { let octet = GsmPDUHelper.readHexOctet(); readLen++; if (octet == 0xff) { break; } userDataBuffer.push(octet); } BitBufferHelper.startRead(userDataBuffer); let msgLen; switch (CdmaPDUHelper.getCdmaMsgEncoding(codingScheme)) { case PDU_DCS_MSG_CODING_7BITS_ALPHABET: msgLen = Math.floor(userDataBuffer.length * 8 / 7); break; case PDU_DCS_MSG_CODING_8BITS_ALPHABET: msgLen = userDataBuffer.length; break; case PDU_DCS_MSG_CODING_16BITS_ALPHABET: msgLen = Math.floor(userDataBuffer.length / 2); break; } RIL.iccInfo.spn = CdmaPDUHelper.decodeCdmaPDUMsg(codingScheme, null, msgLen); if (DEBUG) { debug("CDMA SPN: " + RIL.iccInfo.spn + ", Display condition: " + displayCondition); } RIL.iccInfoPrivate.spnDisplayCondition = displayCondition; Buf.seekIncoming((octetLen - readLen) * Buf.PDU_HEX_OCTET_SIZE); Buf.readStringDelimiter(strLen); } ICCIOHelper.loadTransparentEF({fileId: ICC_EF_CSIM_SPN, callback: callback.bind(this)}); } }; /** * Global stuff. */ // Initialize buffers. This is a separate function so that unit tests can // re-initialize the buffers at will. Buf.init(); function onRILMessage(data) { Buf.processIncoming(data); } onmessage = function onmessage(event) { RIL.handleChromeMessage(event.data); }; onerror = function onerror(event) { debug("RIL Worker error" + event.message + "\n"); };