gecko/browser/devtools/shared/widgets/Tooltip.js

742 lines
23 KiB
JavaScript
Raw Normal View History

/* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
"use strict";
const {Cc, Cu, Ci} = require("chrome");
const promise = require("sdk/core/promise");
const IOService = Cc["@mozilla.org/network/io-service;1"]
.getService(Ci.nsIIOService);
const {Spectrum} = require("devtools/shared/widgets/Spectrum");
const EventEmitter = require("devtools/shared/event-emitter");
const {colorUtils} = require("devtools/css-color");
const Heritage = require("sdk/core/heritage");
Cu.import("resource://gre/modules/Services.jsm");
Cu.import("resource:///modules/devtools/ViewHelpers.jsm");
const GRADIENT_RE = /\b(repeating-)?(linear|radial)-gradient\(((rgb|hsl)a?\(.+?\)|[^\)])+\)/gi;
const BORDERCOLOR_RE = /^border-[-a-z]*color$/ig;
const BORDER_RE = /^border(-(top|bottom|left|right))?$/ig;
const BACKGROUND_IMAGE_RE = /url\([\'\"]?(.*?)[\'\"]?\)/;
const XHTML_NS = "http://www.w3.org/1999/xhtml";
const SPECTRUM_FRAME = "chrome://browser/content/devtools/spectrum-frame.xhtml";
const ESCAPE_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_ESCAPE;
const ENTER_KEYCODE = Ci.nsIDOMKeyEvent.DOM_VK_RETURN;
/**
* Tooltip widget.
*
* This widget is intended at any tool that may need to show rich content in the
* form of floating panels.
* A common use case is image previewing in the CSS rule view, but more complex
* use cases may include color pickers, object inspection, etc...
*
* Tooltips are based on XUL (namely XUL arrow-type <panel>s), and therefore
* need a XUL Document to live in.
* This is pretty much the only requirement they have on their environment.
*
* The way to use a tooltip is simply by instantiating a tooltip yourself and
* attaching some content in it, or using one of the ready-made content types.
*
* A convenient `startTogglingOnHover` method may avoid having to register event
* handlers yourself if the tooltip has to be shown when hovering over a
* specific element or group of elements (which is usually the most common case)
*/
/**
* Container used for dealing with optional parameters.
*
* @param {Object} defaults
* An object with all default options {p1: v1, p2: v2, ...}
* @param {Object} options
* The actual values.
*/
function OptionsStore(defaults, options) {
this.defaults = defaults || {};
this.options = options || {};
}
OptionsStore.prototype = {
/**
* Get the value for a given option name.
* @return {Object} Returns the value for that option, coming either for the
* actual values that have been set in the constructor, or from the
* defaults if that options was not specified.
*/
get: function(name) {
if (typeof this.options[name] !== "undefined") {
return this.options[name];
} else {
return this.defaults[name];
}
}
};
/**
* The low level structure of a tooltip is a XUL element (a <panel>).
*/
let PanelFactory = {
/**
* Get a new XUL panel instance.
* @param {XULDocument} doc
* The XUL document to put that panel into
* @param {OptionsStore} options
* An options store to get some configuration from
*/
get: function(doc, options) {
// Create the tooltip
let panel = doc.createElement("panel");
panel.setAttribute("hidden", true);
panel.setAttribute("ignorekeys", true);
// Prevent the click used to close the panel from being consumed
panel.setAttribute("consumeoutsideclicks", options.get("consumeOutsideClick"));
panel.setAttribute("noautofocus", options.get("noAutoFocus"));
panel.setAttribute("type", "arrow");
panel.setAttribute("level", "top");
panel.setAttribute("class", "devtools-tooltip theme-tooltip-panel");
doc.querySelector("window").appendChild(panel);
return panel;
}
};
/**
* Tooltip class.
*
* Basic usage:
* let t = new Tooltip(xulDoc);
* t.content = someXulContent;
* t.show();
* t.hide();
* t.destroy();
*
* Better usage:
* let t = new Tooltip(xulDoc);
* t.startTogglingOnHover(container, target => {
* if (<condition based on target>) {
* t.setImageContent("http://image.png");
* return true;
* }
* });
* t.destroy();
*
* @param {XULDocument} doc
* The XUL document hosting this tooltip
* @param {Object} options
* Optional options that give options to consumers
* - consumeOutsideClick {Boolean} Wether the first click outside of the
* tooltip should close the tooltip and be consumed or not.
* Defaults to false
* - closeOnKeys {Array} An array of key codes that should close the
* tooltip. Defaults to [27] (escape key)
* - noAutoFocus {Boolean} Should the focus automatically go to the panel
* when it opens. Defaults to true
*
* Fires these events:
* - showing : just before the tooltip shows
* - shown : when the tooltip is shown
* - hiding : just before the tooltip closes
* - hidden : when the tooltip gets hidden
* - keypress : when any key gets pressed, with keyCode
*/
function Tooltip(doc, options) {
EventEmitter.decorate(this);
this.doc = doc;
this.options = new OptionsStore({
consumeOutsideClick: false,
closeOnKeys: [ESCAPE_KEYCODE],
noAutoFocus: true
}, options);
this.panel = PanelFactory.get(doc, this.options);
// Used for namedTimeouts in the mouseover handling
this.uid = "tooltip-" + Date.now();
// Emit show/hide events
for (let event of ["shown", "hidden", "showing", "hiding"]) {
this["_onPopup" + event] = ((e) => {
return () => this.emit(e);
})(event);
this.panel.addEventListener("popup" + event,
this["_onPopup" + event], false);
}
// Listen to keypress events to close the tooltip if configured to do so
let win = this.doc.querySelector("window");
this._onKeyPress = event => {
this.emit("keypress", event.keyCode);
if (this.options.get("closeOnKeys").indexOf(event.keyCode) !== -1) {
this.hide();
}
};
win.addEventListener("keypress", this._onKeyPress, false);
}
module.exports.Tooltip = Tooltip;
Tooltip.prototype = {
defaultPosition: "before_start",
defaultOffsetX: 0,
defaultOffsetY: 0,
/**
* Show the tooltip. It might be wise to append some content first if you
* don't want the tooltip to be empty. You may access the content of the
* tooltip by setting a XUL node to t.content.
* @param {node} anchor
* Which node should the tooltip be shown on
* @param {string} position
* https://developer.mozilla.org/en-US/docs/XUL/PopupGuide/Positioning
* Defaults to before_start
*/
show: function(anchor,
position = this.defaultPosition,
x = this.defaultOffsetX,
y = this.defaultOffsetY) {
this.panel.hidden = false;
this.panel.openPopup(anchor, position, x, y);
},
/**
* Hide the tooltip
*/
hide: function() {
this.panel.hidden = true;
this.panel.hidePopup();
},
isShown: function() {
return this.panel.state !== "closed" && this.panel.state !== "hiding";
},
/**
* Empty the tooltip's content
*/
empty: function() {
while (this.panel.hasChildNodes()) {
this.panel.removeChild(this.panel.firstChild);
}
},
/**
* Get rid of references and event listeners
*/
destroy: function () {
this.hide();
for (let event of ["shown", "hidden", "showing", "hiding"]) {
this.panel.removeEventListener("popup" + event,
this["_onPopup" + event], false);
}
let win = this.doc.querySelector("window");
win.removeEventListener("keypress", this._onKeyPress, false);
this.content = null;
this.doc = null;
this.panel.parentNode.removeChild(this.panel);
this.panel = null;
if (this._basedNode) {
this.stopTogglingOnHover();
}
},
/**
* Show/hide the tooltip when the mouse hovers over particular nodes.
*
* 2 Ways to make this work:
* - Provide a single node to attach the tooltip to, as the baseNode, and
* omit the second targetNodeCb argument
* - Provide a baseNode that is the container of possibly numerous children
* elements that may receive a tooltip. In this case, provide the second
* targetNodeCb argument to decide wether or not a child should receive
* a tooltip.
*
* This works by tracking mouse movements on a base container node (baseNode)
* and showing the tooltip when the mouse stops moving. The targetNodeCb
* callback is used to know whether or not the particular element being
* hovered over should indeed receive the tooltip. If you don't provide it
* it's equivalent to a function that always returns true.
*
* Note that if you call this function a second time, it will itself call
* stopTogglingOnHover before adding mouse tracking listeners again.
*
* @param {node} baseNode
* The container for all target nodes
* @param {Function} targetNodeCb
* A function that accepts a node argument and returns true or false
* to signify if the tooltip should be shown on that node or not.
* Additionally, the function receives a second argument which is the
* tooltip instance itself, to be used to add/modify the content of the
* tooltip if needed. If omitted, the tooltip will be shown everytime.
* @param {Number} showDelay
* An optional delay that will be observed before showing the tooltip.
* Defaults to 750ms
*/
startTogglingOnHover: function(baseNode, targetNodeCb, showDelay = 750) {
if (this._basedNode) {
this.stopTogglingOnHover();
}
// If no targetNodeCb callback is provided, then we need to hide the tooltip
// on mouseleave since baseNode is the target node itself
this._hideOnMouseLeave = !targetNodeCb;
this._basedNode = baseNode;
this._showDelay = showDelay;
this._targetNodeCb = targetNodeCb || (() => true);
this._onBaseNodeMouseMove = this._onBaseNodeMouseMove.bind(this);
this._onBaseNodeMouseLeave = this._onBaseNodeMouseLeave.bind(this);
baseNode.addEventListener("mousemove", this._onBaseNodeMouseMove, false);
baseNode.addEventListener("mouseleave", this._onBaseNodeMouseLeave, false);
},
/**
* If the startTogglingOnHover function has been used previously, and you want
* to get rid of this behavior, then call this function to remove the mouse
* movement tracking
*/
stopTogglingOnHover: function() {
clearNamedTimeout(this.uid);
this._basedNode.removeEventListener("mousemove",
this._onBaseNodeMouseMove, false);
this._basedNode.removeEventListener("mouseleave",
this._onBaseNodeMouseLeave, false);
this._basedNode = null;
this._targetNodeCb = null;
this._lastHovered = null;
},
_onBaseNodeMouseMove: function(event) {
if (event.target !== this._lastHovered) {
this.hide();
this._lastHovered = null;
setNamedTimeout(this.uid, this._showDelay, () => {
this._showOnHover(event.target);
});
}
},
_showOnHover: function(target) {
if (this._targetNodeCb(target, this)) {
this.show(target);
this._lastHovered = target;
}
},
_onBaseNodeMouseLeave: function() {
clearNamedTimeout(this.uid);
this._lastHovered = null;
if (this._hideOnMouseLeave) {
this.hide();
}
},
/**
* Set the content of this tooltip. Will first empty the tooltip and then
* append the new content element.
* Consider using one of the set<type>Content() functions instead.
* @param {node} content
* A node that can be appended in the tooltip XUL element
*/
set content(content) {
this.empty();
if (content) {
this.panel.appendChild(content);
}
},
get content() {
return this.panel.firstChild;
},
/**
* Sets some text as the content of this tooltip.
*
* @param string[] messages
* A list of text messages.
*/
setTextContent: function(...messages) {
let vbox = this.doc.createElement("vbox");
vbox.className = "devtools-tooltip-simple-text-container";
vbox.setAttribute("flex", "1");
for (let text of messages) {
let description = this.doc.createElement("description");
description.setAttribute("flex", "1");
description.className = "devtools-tooltip-simple-text";
description.textContent = text;
vbox.appendChild(description);
}
this.content = vbox;
},
/**
* Fill the tooltip with an image, displayed over a tiled background useful
* for transparent images. Also adds the image dimension as a label at the
* bottom.
* @param {string} imageUrl
* The url to load the image from
* @param {Object} options
* The following options are supported:
* - resized : whether or not the image identified by imageUrl has been
* resized before this function was called.
* - naturalWidth/naturalHeight : the original size of the image before
* it was resized, if if was resized before this function was called.
* If not provided, will be measured on the loaded image.
* - maxDim : if the image should be resized before being shown, pass
* a number here
*/
setImageContent: function(imageUrl, options={}) {
// Main container
let vbox = this.doc.createElement("vbox");
vbox.setAttribute("align", "center")
// Display the image
let image = this.doc.createElement("image");
image.setAttribute("src", imageUrl);
if (options.maxDim) {
image.style.maxWidth = options.maxDim + "px";
image.style.maxHeight = options.maxDim + "px";
}
vbox.appendChild(image);
// Temporary label during image load
let label = this.doc.createElement("label");
label.classList.add("devtools-tooltip-caption");
label.classList.add("theme-comment");
label.textContent = l10n.strings.GetStringFromName("previewTooltip.image.brokenImage");
vbox.appendChild(label);
this.content = vbox;
// Load the image to get dimensions and display it when done
let imgObj = new this.doc.defaultView.Image();
imgObj.src = imageUrl;
imgObj.onload = () => {
imgObj.onload = null;
// Display dimensions
let w = options.naturalWidth || imgObj.naturalWidth;
let h = options.naturalHeight || imgObj.naturalHeight;
label.textContent = w + " x " + h;
}
},
/**
* Exactly the same as the `image` function but takes a css background image
* value instead : url(....)
*/
setCssBackgroundImageContent: function(cssBackground, sheetHref, maxDim=400) {
let uri = getBackgroundImageUri(cssBackground, sheetHref);
if (uri) {
this.setImageContent(uri, {
maxDim: maxDim
});
}
},
/**
* Fill the tooltip with a new instance of the spectrum color picker widget
* initialized with the given color, and return a promise that resolves to
* the instance of spectrum
*/
setColorPickerContent: function(color) {
let def = promise.defer();
// Create an iframe to contain spectrum
let iframe = this.doc.createElementNS(XHTML_NS, "iframe");
iframe.setAttribute("transparent", true);
iframe.setAttribute("width", "210");
iframe.setAttribute("height", "195");
iframe.setAttribute("flex", "1");
iframe.setAttribute("class", "devtools-tooltip-iframe");
let panel = this.panel;
let xulWin = this.doc.ownerGlobal;
// Wait for the load to initialize spectrum
function onLoad() {
iframe.removeEventListener("load", onLoad, true);
let win = iframe.contentWindow.wrappedJSObject;
let container = win.document.getElementById("spectrum");
let spectrum = new Spectrum(container, color);
// Finalize spectrum's init when the tooltip becomes visible
panel.addEventListener("popupshown", function shown() {
panel.removeEventListener("popupshown", shown, true);
spectrum.show();
def.resolve(spectrum);
}, true);
}
iframe.addEventListener("load", onLoad, true);
iframe.setAttribute("src", SPECTRUM_FRAME);
// Put the iframe in the tooltip
this.content = iframe;
return def.promise;
}
};
/**
* Base class for all (color, gradient, ...)-swatch based value editors inside
* tooltips
*
* @param {XULDocument} doc
*/
function SwatchBasedEditorTooltip(doc) {
// Creating a tooltip instance
// This one will consume outside clicks as it makes more sense to let the user
// close the tooltip by clicking out
// It will also close on <escape> and <enter>
this.tooltip = new Tooltip(doc, {
consumeOutsideClick: true,
closeOnKeys: [ESCAPE_KEYCODE, ENTER_KEYCODE],
noAutoFocus: false
});
// By default, swatch-based editor tooltips revert value change on <esc> and
// commit value change on <enter>
this._onTooltipKeypress = (event, code) => {
if (code === ESCAPE_KEYCODE) {
this.revert();
} else if (code === ENTER_KEYCODE) {
this.commit();
}
};
this.tooltip.on("keypress", this._onTooltipKeypress);
// All target swatches are kept in a map, indexed by swatch DOM elements
this.swatches = new Map();
// When a swatch is clicked, and for as long as the tooltip is shown, the
// activeSwatch property will hold the reference to the swatch DOM element
// that was clicked
this.activeSwatch = null;
this._onSwatchClick = this._onSwatchClick.bind(this);
}
SwatchBasedEditorTooltip.prototype = {
show: function() {
if (this.activeSwatch) {
this.tooltip.show(this.activeSwatch, "topcenter bottomleft");
}
},
hide: function() {
this.tooltip.hide();
},
/**
* Add a new swatch DOM element to the list of swatch elements this editor
* tooltip knows about. That means from now on, clicking on that swatch will
* toggle the editor.
*
* @param {node} swatchEl
* The element to add
* @param {object} callbacks
* Callbacks that will be executed when the editor wants to preview a
* value change, or revert a change, or commit a change.
* @param {object} originalValue
* The original value before the editor in the tooltip makes changes
* This can be of any type, and will be passed, as is, in the revert
* callback
*/
addSwatch: function(swatchEl, callbacks={}, originalValue) {
if (!callbacks.onPreview) callbacks.onPreview = function() {};
if (!callbacks.onRevert) callbacks.onRevert = function() {};
if (!callbacks.onCommit) callbacks.onCommit = function() {};
this.swatches.set(swatchEl, {
callbacks: callbacks,
originalValue: originalValue
});
swatchEl.addEventListener("click", this._onSwatchClick, false);
},
removeSwatch: function(swatchEl) {
if (this.swatches.has(swatchEl)) {
if (this.activeSwatch === swatchEl) {
this.hide();
this.activeSwatch = null;
}
swatchEl.removeEventListener("click", this._onSwatchClick, false);
this.swatches.delete(swatchEl);
}
},
_onSwatchClick: function(event) {
let swatch = this.swatches.get(event.target);
if (swatch) {
this.activeSwatch = event.target;
this.show();
event.stopPropagation();
}
},
/**
* Not called by this parent class, needs to be taken care of by sub-classes
*/
preview: function(value) {
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
swatch.callbacks.onPreview(value);
}
},
/**
* This parent class only calls this on <esc> keypress
*/
revert: function() {
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
swatch.callbacks.onRevert(swatch.originalValue);
}
},
/**
* This parent class only calls this on <enter> keypress
*/
commit: function() {
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
swatch.callbacks.onCommit();
}
},
destroy: function() {
this.swatches.clear();
this.activeSwatch = null;
this.tooltip.off("keypress", this._onTooltipKeypress);
this.tooltip.destroy();
}
};
/**
* The swatch color picker tooltip class is a specific class meant to be used
* along with output-parser's generated color swatches.
* It extends the parent SwatchBasedEditorTooltip class.
* It just wraps a standard Tooltip and sets its content with an instance of a
* color picker.
*
* @param {XULDocument} doc
*/
function SwatchColorPickerTooltip(doc) {
SwatchBasedEditorTooltip.call(this, doc);
// Creating a spectrum instance. this.spectrum will always be a promise that
// resolves to the spectrum instance
this.spectrum = this.tooltip.setColorPickerContent([0, 0, 0, 1]);
this._onSpectrumColorChange = this._onSpectrumColorChange.bind(this);
}
module.exports.SwatchColorPickerTooltip = SwatchColorPickerTooltip;
SwatchColorPickerTooltip.prototype = Heritage.extend(SwatchBasedEditorTooltip.prototype, {
/**
* Overriding the SwatchBasedEditorTooltip.show function to set spectrum's
* color.
*/
show: function() {
// Call then parent class' show function
SwatchBasedEditorTooltip.prototype.show.call(this);
// Then set spectrum's color and listen to color changes to preview them
if (this.activeSwatch) {
let swatch = this.swatches.get(this.activeSwatch);
let color = this.activeSwatch.style.backgroundColor;
this.spectrum.then(spectrum => {
spectrum.off("changed", this._onSpectrumColorChange);
spectrum.rgb = this._colorToRgba(color);
spectrum.on("changed", this._onSpectrumColorChange);
spectrum.updateUI();
});
}
},
_onSpectrumColorChange: function(event, rgba, cssColor) {
if (this.activeSwatch) {
this.activeSwatch.style.backgroundColor = cssColor;
this.activeSwatch.nextSibling.textContent = cssColor;
this.preview(cssColor);
}
},
_colorToRgba: function(color) {
color = new colorUtils.CssColor(color);
let rgba = color._getRGBATuple();
return [rgba.r, rgba.g, rgba.b, rgba.a];
},
destroy: function() {
SwatchBasedEditorTooltip.prototype.destroy.call(this);
this.spectrum.then(spectrum => {
spectrum.off("changed", this._onSpectrumColorChange);
spectrum.destroy();
});
}
});
/**
* Internal util, checks whether a css declaration is a gradient
*/
function isGradientRule(property, value) {
return (property === "background" || property === "background-image") &&
value.match(GRADIENT_RE);
}
/**
* Internal util, checks whether a css declaration is a color
*/
function isColorOnly(property, value) {
return property === "background-color" ||
property === "color" ||
property.match(BORDERCOLOR_RE);
}
/**
* Internal util, returns the background image uri if any
*/
function getBackgroundImageUri(value, sheetHref) {
let uriMatch = BACKGROUND_IMAGE_RE.exec(value);
let uri = null;
if (uriMatch && uriMatch[1]) {
uri = uriMatch[1];
if (sheetHref) {
let sheetUri = IOService.newURI(sheetHref, null, null);
uri = sheetUri.resolve(uri);
}
}
return uri;
}
/**
* L10N utility class
*/
function L10N() {}
L10N.prototype = {};
let l10n = new L10N();
loader.lazyGetter(L10N.prototype, "strings", () => {
return Services.strings.createBundle(
"chrome://browser/locale/devtools/inspector.properties");
});