You've already forked UnrealEngineUWP
mirror of
https://github.com/izzy2lost/UnrealEngineUWP.git
synced 2026-03-26 18:15:20 -07:00
#rnx #rb none #ROBOMERGE-SOURCE: CL 10869241 via CL 10869527 via CL 10869904 #ROBOMERGE-BOT: (v613-10869866) [CL 10870586 by ryan durand in Main branch]
3255 lines
111 KiB
C#
3255 lines
111 KiB
C#
// Copyright Epic Games, Inc. All Rights Reserved.
|
|
|
|
using System;
|
|
using System.Collections;
|
|
using System.Collections.Generic;
|
|
using System.Diagnostics;
|
|
using System.IO;
|
|
using System.IO.Compression;
|
|
using System.Runtime.InteropServices;
|
|
using System.Runtime.Remoting;
|
|
using System.Runtime.Remoting.Channels;
|
|
using System.Runtime.Remoting.Channels.Tcp;
|
|
using System.Runtime.Remoting.Messaging;
|
|
using System.Threading;
|
|
|
|
using AgentInterface;
|
|
using System.Reflection;
|
|
|
|
namespace NSwarm
|
|
{
|
|
internal static class DebugLog
|
|
{
|
|
[Conditional("DEBUG")]
|
|
internal static void Write (string msg)
|
|
{
|
|
Console.WriteLine(msg);
|
|
}
|
|
}
|
|
|
|
/*
|
|
* PerfTiming
|
|
*
|
|
* An instance of a timing object. It tracks a single timing; the total time and the number of calls
|
|
*/
|
|
public class PerfTiming
|
|
{
|
|
public String Name;
|
|
public Stopwatch StopWatchTimer;
|
|
public Int32 Count;
|
|
public bool Accumulate;
|
|
public Int64 Counter;
|
|
|
|
public PerfTiming(String InName, bool InAccumulate)
|
|
{
|
|
Name = InName;
|
|
StopWatchTimer = new Stopwatch();
|
|
Count = 0;
|
|
Accumulate = InAccumulate;
|
|
Counter = 0;
|
|
}
|
|
|
|
public void Start()
|
|
{
|
|
StopWatchTimer.Start();
|
|
}
|
|
|
|
public void Stop()
|
|
{
|
|
Count++;
|
|
StopWatchTimer.Stop();
|
|
}
|
|
|
|
public void IncrementCounter(Int64 Adder)
|
|
{
|
|
Counter += Adder;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* PerfTimer
|
|
*
|
|
* Tracks a dictionary of PerfTimings
|
|
*/
|
|
public class PerfTimer
|
|
{
|
|
public Stack<PerfTiming> LastTimers;
|
|
ReaderWriterDictionary<String, PerfTiming> Timings;
|
|
|
|
public PerfTimer()
|
|
{
|
|
Timings = new ReaderWriterDictionary<String, PerfTiming>();
|
|
LastTimers = new Stack<PerfTiming>();
|
|
}
|
|
|
|
public void Start(String Name, bool Accum, Int64 Adder)
|
|
{
|
|
Monitor.Enter(LastTimers);
|
|
|
|
PerfTiming Timing = null;
|
|
if (!Timings.TryGetValue(Name, out Timing))
|
|
{
|
|
Timing = new PerfTiming(Name, Accum);
|
|
Timings.Add(Name, Timing);
|
|
}
|
|
|
|
LastTimers.Push(Timing);
|
|
|
|
Timing.IncrementCounter(Adder);
|
|
Timing.Start();
|
|
|
|
Monitor.Exit(LastTimers);
|
|
}
|
|
|
|
public void Stop()
|
|
{
|
|
Monitor.Enter(LastTimers);
|
|
|
|
PerfTiming Timing = LastTimers.Pop();
|
|
Timing.Stop();
|
|
|
|
Monitor.Exit(LastTimers);
|
|
}
|
|
|
|
public String DumpTimings()
|
|
{
|
|
String Output = "";
|
|
|
|
double TotalTime = 0.0;
|
|
foreach (PerfTiming Timing in Timings.Values)
|
|
{
|
|
if (Timing.Count > 0)
|
|
{
|
|
double Elapsed = Timing.StopWatchTimer.Elapsed.TotalSeconds;
|
|
double Average = (Elapsed * 1000000.0) / Timing.Count;
|
|
Output += Timing.Name.PadLeft(30) + " : " + Elapsed.ToString("F3") + "s in " + Timing.Count + " calls (" + Average.ToString("F0") + "us per call)";
|
|
|
|
if (Timing.Counter > 0)
|
|
{
|
|
Output += " (" + (Timing.Counter / 1024) + "k)";
|
|
}
|
|
|
|
Output += "\n";
|
|
if (Timing.Accumulate)
|
|
{
|
|
TotalTime += Elapsed;
|
|
}
|
|
}
|
|
}
|
|
|
|
Output += "\nTotal time inside Swarm: " + TotalTime.ToString("F3") + "s\n";
|
|
|
|
return Output;
|
|
}
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
/**
|
|
* Connection configuration parameters, filled in by OpenConnection
|
|
*/
|
|
public class AgentConfiguration
|
|
{
|
|
public AgentConfiguration()
|
|
{
|
|
AgentProcessID = -1;
|
|
AgentCachePath = null;
|
|
AgentJobGuid = null;
|
|
IsPureLocalConnection = false;
|
|
}
|
|
|
|
// Process ID of the owning process for the agent, which can be used to
|
|
// monitor it for crashes or hangs
|
|
public Int32 AgentProcessID;
|
|
|
|
// The full path of the cache directory this agent is using
|
|
public String AgentCachePath;
|
|
|
|
// The GUID of the job the agent has associated this connection with, if any
|
|
public AgentGuid AgentJobGuid;
|
|
|
|
// An indication of whether we're considered a "pure" local connection by the
|
|
// Agent, potentially relieving us from Agent coordination when using Channels
|
|
public bool IsPureLocalConnection;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
/**
|
|
* A wrapper to abstract away the complexity of asynchronous calls for the
|
|
* Agent API and the monitoring of the connection
|
|
*/
|
|
public class IAgentInterfaceWrapper
|
|
{
|
|
public IAgentInterfaceWrapper()
|
|
{
|
|
// TODO: Make URL configurable
|
|
Connection = (IAgentInterface)Activator.GetObject(typeof(IAgentInterface), "tcp://127.0.0.1:8008/SwarmAgent");
|
|
ConnectionDroppedEvent = new ManualResetEvent(false);
|
|
}
|
|
|
|
public void SignalConnectionDropped()
|
|
{
|
|
ConnectionDroppedEvent.Set();
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
// A duplication of the IAgentInterface API which this class wraps
|
|
public Int32 OpenConnection(Process AgentProcess, bool AgentProcessOwner, Int32 LocalProcessID, ELogFlags LoggingFlags, out AgentConfiguration NewConfiguration)
|
|
{
|
|
OpenConnectionDelegate DOpenConnection = Connection.OpenConnection;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["ProcessID"] = LocalProcessID;
|
|
InParameters["ProcessIsOwner"] = (AgentProcessOwner == true ? true : false);
|
|
InParameters["LoggingFlags"] = LoggingFlags;
|
|
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DOpenConnection.BeginInvoke(InParameters, ref OutParameters, null, null);
|
|
|
|
// This will wait with an occasional wake up to check to see if the
|
|
// agent process is still alive and kicking (avoids infinite wait,
|
|
// allows for very long start up times while debugging)
|
|
Int32 StartupSleep = 1000;
|
|
while ((Result.AsyncWaitHandle.WaitOne(StartupSleep) == false) &&
|
|
(AgentProcess.HasExited == false) &&
|
|
(AgentProcess.Responding == true))
|
|
{
|
|
// While the application is alive and responding, wait
|
|
DebugLog.Write("[OpenConnection] Waiting for agent to respond ...");
|
|
}
|
|
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation didn't fail, end to get the result
|
|
Int32 ReturnValue = DOpenConnection.EndInvoke(ref OutParameters, Result);
|
|
if (OutParameters != null)
|
|
{
|
|
if ((ESwarmVersionValue)OutParameters["Version"] == ESwarmVersionValue.VER_1_0)
|
|
{
|
|
NewConfiguration = new AgentConfiguration();
|
|
NewConfiguration.AgentProcessID = (Int32 )OutParameters["AgentProcessID"];
|
|
NewConfiguration.AgentCachePath = (String )OutParameters["AgentCachePath"];
|
|
NewConfiguration.AgentJobGuid = (AgentGuid )OutParameters["AgentJobGuid"];
|
|
|
|
if (OutParameters.ContainsKey("IsPureLocalConnection"))
|
|
{
|
|
NewConfiguration.IsPureLocalConnection = (bool)OutParameters["IsPureLocalConnection"];
|
|
}
|
|
|
|
// Complete and successful
|
|
return ReturnValue;
|
|
}
|
|
}
|
|
}
|
|
// Otherwise, error
|
|
NewConfiguration = null;
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 CloseConnection(Int32 ConnectionHandle)
|
|
{
|
|
CloseConnectionDelegate DCloseConnection = Connection.CloseConnection;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable InParameters = null;
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DCloseConnection.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DCloseConnection.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 SendMessage(Int32 ConnectionHandle, AgentMessage NewMessage)
|
|
{
|
|
SendMessageDelegate DSendMessage = Connection.SendMessage;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["Message"] = NewMessage;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DSendMessage.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DSendMessage.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 GetMessage(Int32 ConnectionHandle, out AgentMessage NextMessage, Int32 Timeout)
|
|
{
|
|
GetMessageDelegate DGetMessage = Connection.GetMessage;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["Timeout"] = (Int32)Timeout;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DGetMessage.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation didn't fail, end to get the result
|
|
Int32 ReturnValue = DGetMessage.EndInvoke(ref OutParameters, Result);
|
|
if (OutParameters != null)
|
|
{
|
|
if((ESwarmVersionValue)OutParameters["Version"] == ESwarmVersionValue.VER_1_0)
|
|
{
|
|
NextMessage = (AgentMessage )OutParameters["Message"];
|
|
|
|
// Complete and successful
|
|
return ReturnValue;
|
|
}
|
|
}
|
|
}
|
|
// Otherwise, error
|
|
NextMessage = null;
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 AddChannel(Int32 ConnectionHandle, String FullPath, String ChannelName)
|
|
{
|
|
AddChannelDelegate DAddChannel = Connection.AddChannel;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["FullPath"] = FullPath;
|
|
InParameters["ChannelName"] = ChannelName;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DAddChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DAddChannel.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 TestChannel(Int32 ConnectionHandle, String ChannelName)
|
|
{
|
|
TestChannelDelegate DTestChannel = Connection.TestChannel;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["ChannelName"] = ChannelName;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DTestChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DTestChannel.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 OpenChannel(Int32 ConnectionHandle, String ChannelName, EChannelFlags ChannelFlags)
|
|
{
|
|
OpenChannelDelegate DOpenChannel = Connection.OpenChannel;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["ChannelName"] = ChannelName;
|
|
InParameters["ChannelFlags"] = ChannelFlags;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DOpenChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DOpenChannel.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 CloseChannel(Int32 ConnectionHandle, Int32 ChannelHandle)
|
|
{
|
|
CloseChannelDelegate DCloseChannel = Connection.CloseChannel;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["ChannelHandle"] = ChannelHandle;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DCloseChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DCloseChannel.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 OpenJob(Int32 ConnectionHandle, AgentGuid JobGuid )
|
|
{
|
|
OpenJobDelegate DOpenJob = Connection.OpenJob;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["JobGuid"] = JobGuid;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DOpenJob.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DOpenJob.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 BeginJobSpecification(Int32 ConnectionHandle, AgentJobSpecification Specification32, Hashtable Description32, AgentJobSpecification Specification64, Hashtable Description64)
|
|
{
|
|
BeginJobSpecificationDelegate DBeginJobSpecification = Connection.BeginJobSpecification;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["Specification32"] = Specification32;
|
|
InParameters["Specification64"] = Specification64;
|
|
InParameters["Description32"] = Description32;
|
|
InParameters["Description64"] = Description64;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DBeginJobSpecification.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DBeginJobSpecification.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 AddTask(Int32 ConnectionHandle, List<AgentTaskSpecification> Specifications)
|
|
{
|
|
AddTaskDelegate DAddTask = Connection.AddTask;
|
|
|
|
// Set up the versioned hashtable input parameters
|
|
Hashtable InParameters = new Hashtable();
|
|
InParameters["Version"] = ESwarmVersionValue.VER_1_0;
|
|
InParameters["Specifications"] = Specifications;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DAddTask.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DAddTask.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 EndJobSpecification(Int32 ConnectionHandle)
|
|
{
|
|
EndJobSpecificationDelegate DEndJobSpecification = Connection.EndJobSpecification;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable InParameters = null;
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DEndJobSpecification.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DEndJobSpecification.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 CloseJob(Int32 ConnectionHandle)
|
|
{
|
|
CloseJobDelegate DCloseJob = Connection.CloseJob;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
Hashtable InParameters = null;
|
|
Hashtable OutParameters = null;
|
|
IAsyncResult Result = DCloseJob.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DCloseJob.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 Method(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters)
|
|
{
|
|
MethodDelegate DMethod = Connection.Method;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
IAsyncResult Result = DMethod.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DMethod.EndInvoke(ref OutParameters, Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
public Int32 Log(EVerbosityLevel Verbosity, ELogColour TextColour, String Line)
|
|
{
|
|
LogDelegate DLog = Connection.Log;
|
|
|
|
// Invoke the method, then wait for it to finish or to be notified that the connection dropped
|
|
IAsyncResult Result = DLog.BeginInvoke(Verbosity, TextColour, Line, null, null);
|
|
WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent });
|
|
|
|
// If the method completed normally, return the result
|
|
if (Result.IsCompleted)
|
|
{
|
|
// If the invocation completed, success
|
|
return DLog.EndInvoke(Result);
|
|
}
|
|
// Otherwise, error
|
|
return Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////
|
|
|
|
// The wrapped connection
|
|
IAgentInterface Connection;
|
|
ManualResetEvent ConnectionDroppedEvent;
|
|
|
|
// Delegate type declarations
|
|
delegate Int32 OpenConnectionDelegate(Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 CloseConnectionDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 SendMessageDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 GetMessageDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 AddChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 TestChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 OpenChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 CloseChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 OpenJobDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 BeginJobSpecificationDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 AddTaskDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 EndJobSpecificationDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 CloseJobDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 MethodDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters);
|
|
delegate Int32 LogDelegate(EVerbosityLevel Verbosity, ELogColour TextColour, String Line);
|
|
}
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
public delegate void FConnectionCallback(IntPtr CallbackMessage, IntPtr CallbackData);
|
|
|
|
/**
|
|
* Helper struct for getting the message processing thread started
|
|
*/
|
|
public struct MessageThreadData
|
|
{
|
|
public FSwarmInterface Owner;
|
|
public IAgentInterfaceWrapper Connection;
|
|
public Int32 ConnectionHandle;
|
|
public FConnectionCallback ConnectionCallback;
|
|
public IntPtr ConnectionCallbackData;
|
|
public AgentConfiguration ConnectionConfiguration;
|
|
}
|
|
|
|
/**
|
|
* The C#implementation of FSwarmInterface
|
|
*/
|
|
public class FSwarmInterface
|
|
{
|
|
FSwarmInterface()
|
|
{
|
|
AgentProcess = null;
|
|
AgentProcessOwner = false;
|
|
Connection = null;
|
|
ConnectionHandle = Constants.INVALID;
|
|
ConnectionMessageThread = null;
|
|
ConnectionMonitorThread = null;
|
|
ConnectionConfiguration = null;
|
|
ConnectionCallback = null;
|
|
BaseChannelHandle = 0;
|
|
PendingTasks = null;
|
|
NetworkChannel = null;
|
|
PerfTimerInstance = null;
|
|
|
|
OpenChannels = new ReaderWriterDictionary<Int32, ChannelInfo>();
|
|
FreeChannelWriteBuffers = new Stack<byte[]>();
|
|
CleanupClosedConnectionLock = new Object();
|
|
|
|
// TODO: Delete old files
|
|
}
|
|
|
|
delegate int SwarmOpenConnectionProc(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, IntPtr OptionsFolder);
|
|
delegate int SwarmCloseConnectionProc();
|
|
delegate int SwarmSendMessageProc(IntPtr Message);
|
|
delegate int SwarmAddChannelProc(IntPtr FullPath, IntPtr ChannelName);
|
|
delegate int SwarmTestChannelProc(IntPtr ChannelName);
|
|
delegate int SwarmOpenChannelProc(IntPtr ChannelName, EChannelFlags ChannelFlags);
|
|
delegate int SwarmCloseChannelProc(int Channel);
|
|
delegate int SwarmWriteChannelProc(int Channel, IntPtr Data, int DataSize);
|
|
delegate int SwarmReadChannelProc(int Channel, IntPtr Data, int DataSize);
|
|
delegate int SwarmOpenJobProc(IntPtr JobGuid);
|
|
delegate int SwarmBeginJobSpecificationProc(IntPtr Specification32, IntPtr Specification64);
|
|
delegate int SwarmAddTaskProc(IntPtr Specification);
|
|
delegate int SwarmEndJobSpecificationProc();
|
|
delegate int SwarmCloseJobProc();
|
|
delegate int SwarmLogProc(EVerbosityLevel Verbosity, ELogColour TextColour, IntPtr Message);
|
|
delegate int SwarmInterfaceLogDelegate(EVerbosityLevel Verbosity, IntPtr Message);
|
|
|
|
static SwarmInterfaceLogDelegate SwarmInterfaceLogCppProc;
|
|
|
|
private delegate void RegisterSwarmOpenConnectionProc(SwarmOpenConnectionProc Proc);
|
|
private delegate void RegisterSwarmCloseConnectionProc(SwarmCloseConnectionProc Proc);
|
|
private delegate void RegisterSwarmSendMessageProc(SwarmSendMessageProc Proc);
|
|
private delegate void RegisterSwarmAddChannelProc(SwarmAddChannelProc Proc);
|
|
private delegate void RegisterSwarmTestChannelProc(SwarmTestChannelProc Proc);
|
|
private delegate void RegisterSwarmOpenChannelProc(SwarmOpenChannelProc Proc);
|
|
private delegate void RegisterSwarmCloseChannelProc(SwarmCloseChannelProc Proc);
|
|
private delegate void RegisterSwarmWriteChannelProc(SwarmWriteChannelProc Proc);
|
|
private delegate void RegisterSwarmReadChannelProc(SwarmReadChannelProc Proc);
|
|
private delegate void RegisterSwarmOpenJobProc(SwarmOpenJobProc Proc);
|
|
private delegate void RegisterSwarmBeginJobSpecificationProc(SwarmBeginJobSpecificationProc Proc);
|
|
private delegate void RegisterSwarmAddTaskProc(SwarmAddTaskProc Proc);
|
|
private delegate void RegisterSwarmEndJobSpecificationProc(SwarmEndJobSpecificationProc Proc);
|
|
private delegate void RegisterSwarmCloseJobProc(SwarmCloseJobProc Proc);
|
|
private delegate void RegisterSwarmLogProc(SwarmLogProc Proc);
|
|
|
|
static int SwarmOpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, IntPtr OptionsFolder)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.OpenConnection(CallbackFunc, CallbackData, (ELogFlags)LoggingFlags, FStringMarshaler.MarshalNativeToManaged(OptionsFolder));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmCloseConnection()
|
|
{
|
|
try
|
|
{
|
|
return GInstance.CloseConnection();
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmSendMessage(IntPtr Message)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.SendMessage(Message);
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmAddChannel(IntPtr FullPath, IntPtr ChannelName)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.AddChannel(FStringMarshaler.MarshalNativeToManaged(FullPath), FStringMarshaler.MarshalNativeToManaged(ChannelName));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmTestChannel(IntPtr ChannelName)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.TestChannel(FStringMarshaler.MarshalNativeToManaged(ChannelName));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmOpenChannel(IntPtr ChannelName, EChannelFlags ChannelFlags)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.OpenChannel(FStringMarshaler.MarshalNativeToManaged(ChannelName), ChannelFlags);
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmCloseChannel(int Channel)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.CloseChannel(Channel);
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmWriteChannel(int Channel, IntPtr Data, int DataSize)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.WriteChannel(Channel, Data, DataSize);
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmReadChannel(int Channel, IntPtr Data, int DataSize)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.ReadChannel(Channel, Data, DataSize);
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmOpenJob(IntPtr JobGuid)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.OpenJob((FGuid)Marshal.PtrToStructure(JobGuid, typeof(FGuid)));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static FJobSpecification MarshalJobSpecification(IntPtr SpecificationPtr)
|
|
{
|
|
FJobSpecificationMarshalHelper Helper = (FJobSpecificationMarshalHelper)Marshal.PtrToStructure(SpecificationPtr, typeof(FJobSpecificationMarshalHelper));
|
|
|
|
FJobSpecification Specification = new FJobSpecification();
|
|
Specification.ExecutableName = FStringMarshaler.MarshalNativeToManaged(Helper.ExecutableName);
|
|
Specification.Parameters = FStringMarshaler.MarshalNativeToManaged(Helper.Parameters);
|
|
Specification.Flags = Helper.Flags;
|
|
|
|
Specification.RequiredDependencyCount = Helper.RequiredDependencyCount;
|
|
Specification.RequiredDependencies = new String[Specification.RequiredDependencyCount];
|
|
for (UInt32 Index = 0; Index < Specification.RequiredDependencyCount; Index++)
|
|
{
|
|
Specification.RequiredDependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.RequiredDependencies, (Int32)Index * 8));
|
|
}
|
|
|
|
Specification.OptionalDependencyCount = Helper.OptionalDependencyCount;
|
|
Specification.OptionalDependencies = new String[Specification.OptionalDependencyCount];
|
|
for (UInt32 Index = 0; Index < Specification.OptionalDependencyCount; Index++)
|
|
{
|
|
Specification.OptionalDependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.OptionalDependencies, (Int32)Index * 8));
|
|
}
|
|
|
|
Specification.DescriptionCount = Helper.DescriptionCount;
|
|
Specification.DescriptionKeys = new String[Specification.DescriptionCount];
|
|
Specification.DescriptionValues = new String[Specification.DescriptionCount];
|
|
for (UInt32 Index = 0; Index < Specification.DescriptionCount; Index++)
|
|
{
|
|
Specification.DescriptionKeys[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.DescriptionKeys, (Int32)Index * 8));
|
|
Specification.DescriptionValues[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.DescriptionValues, (Int32)Index * 8));
|
|
}
|
|
|
|
return Specification;
|
|
}
|
|
|
|
static int SwarmBeginJobSpecification(IntPtr Specification32, IntPtr Specification64)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.BeginJobSpecification(MarshalJobSpecification(Specification32), MarshalJobSpecification(Specification64));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static FTaskSpecification MarshalTaskSpecification(IntPtr SpecificationPtr)
|
|
{
|
|
FTaskSpecificationMarshalHelper Helper = (FTaskSpecificationMarshalHelper)Marshal.PtrToStructure(SpecificationPtr, typeof(FTaskSpecificationMarshalHelper));
|
|
FTaskSpecification Specification = new FTaskSpecification(Helper.TaskGuid, FStringMarshaler.MarshalNativeToManaged(Helper.Parameters), Helper.Flags);
|
|
Specification.Cost = Helper.Cost;
|
|
Specification.DependencyCount = Helper.DependencyCount;
|
|
Specification.Dependencies = new String[Specification.DependencyCount];
|
|
for (UInt32 Index = 0; Index < Specification.DependencyCount; Index++)
|
|
{
|
|
Specification.Dependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.Dependencies, (Int32)Index * 8));
|
|
}
|
|
return Specification;
|
|
}
|
|
|
|
static int SwarmAddTask(IntPtr Specification)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.AddTask(MarshalTaskSpecification(Specification));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmEndJobSpecification()
|
|
{
|
|
try
|
|
{
|
|
return GInstance.EndJobSpecification();
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmCloseJob()
|
|
{
|
|
try
|
|
{
|
|
return GInstance.CloseJob();
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static int SwarmLog(EVerbosityLevel Verbosity, ELogColour TextColour, IntPtr Message)
|
|
{
|
|
try
|
|
{
|
|
return GInstance.Log((EVerbosityLevel)Verbosity, (ELogColour)TextColour, FStringMarshaler.MarshalNativeToManaged(Message));
|
|
}
|
|
catch(Exception Ex)
|
|
{
|
|
DebugLog.Write(Ex.Message + "\n" + Ex.ToString());
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
static FSwarmInterface GInstance = new FSwarmInterface();
|
|
static SwarmOpenConnectionProc OpenConnectionProc = new SwarmOpenConnectionProc(SwarmOpenConnection);
|
|
static SwarmCloseConnectionProc CloseConnectionProc = new SwarmCloseConnectionProc(SwarmCloseConnection);
|
|
static SwarmSendMessageProc SendMessageProc = new SwarmSendMessageProc(SwarmSendMessage);
|
|
static SwarmAddChannelProc AddChannelProc = new SwarmAddChannelProc(SwarmAddChannel);
|
|
static SwarmTestChannelProc TestChannelProc = new SwarmTestChannelProc(SwarmTestChannel);
|
|
static SwarmOpenChannelProc OpenChannelProc = new SwarmOpenChannelProc(SwarmOpenChannel);
|
|
static SwarmCloseChannelProc CloseChannelProc = new SwarmCloseChannelProc(SwarmCloseChannel);
|
|
static SwarmWriteChannelProc WriteChannelProc = new SwarmWriteChannelProc(SwarmWriteChannel);
|
|
static SwarmReadChannelProc ReadChannelProc = new SwarmReadChannelProc(SwarmReadChannel);
|
|
static SwarmOpenJobProc OpenJobProc = new SwarmOpenJobProc(SwarmOpenJob);
|
|
static SwarmBeginJobSpecificationProc BeginJobSpecificationProc = new SwarmBeginJobSpecificationProc(SwarmBeginJobSpecification);
|
|
static SwarmAddTaskProc AddTaskProc = new SwarmAddTaskProc(SwarmAddTask);
|
|
static SwarmEndJobSpecificationProc EndJobSpecificationProc = new SwarmEndJobSpecificationProc(SwarmEndJobSpecification);
|
|
static SwarmCloseJobProc CloseJobProc = new SwarmCloseJobProc(SwarmCloseJob);
|
|
static SwarmLogProc LogProc = new SwarmLogProc(SwarmLog);
|
|
static bool KillMonitorThread = false;
|
|
|
|
#if !__MonoCS__
|
|
[DllImport("kernel32.dll", CharSet = CharSet.Auto, SetLastError = true)]
|
|
private static extern IntPtr LoadLibrary(string name);
|
|
[DllImport("kernel32.dll", CharSet = CharSet.Ansi, SetLastError = true)]
|
|
private static extern IntPtr GetProcAddress(IntPtr hModule, string name);
|
|
#else
|
|
[DllImport("dl", CharSet = CharSet.Auto, SetLastError = true)]
|
|
private static extern IntPtr dlopen(string name, int flag);
|
|
[DllImport("dl", CharSet = CharSet.Ansi, SetLastError = true)]
|
|
private static extern IntPtr dlsym(int handle, string name);
|
|
#endif
|
|
|
|
/**
|
|
*/
|
|
public static int InitCppBridgeCallbacks(String SwarmInterfaceDllName)
|
|
{
|
|
#if !__MonoCS__
|
|
IntPtr DllHandle = LoadLibrary(SwarmInterfaceDllName);
|
|
if (DllHandle == IntPtr.Zero)
|
|
{
|
|
return Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenConnectionProc");
|
|
var Proc = (RegisterSwarmOpenConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenConnectionProc));
|
|
Proc(OpenConnectionProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseConnectionProc");
|
|
var Proc = (RegisterSwarmCloseConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseConnectionProc));
|
|
Proc(CloseConnectionProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmSendMessageProc");
|
|
var Proc = (RegisterSwarmSendMessageProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmSendMessageProc));
|
|
Proc(SendMessageProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmAddChannelProc");
|
|
var Proc = (RegisterSwarmAddChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddChannelProc));
|
|
Proc(AddChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmTestChannelProc");
|
|
var Proc = (RegisterSwarmTestChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmTestChannelProc));
|
|
Proc(TestChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenChannelProc");
|
|
var Proc = (RegisterSwarmOpenChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenChannelProc));
|
|
Proc(OpenChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseChannelProc");
|
|
var Proc = (RegisterSwarmCloseChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseChannelProc));
|
|
Proc(CloseChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmWriteChannelProc");
|
|
var Proc = (RegisterSwarmWriteChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmWriteChannelProc));
|
|
Proc(WriteChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmReadChannelProc");
|
|
var Proc = (RegisterSwarmReadChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmReadChannelProc));
|
|
Proc(ReadChannelProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenJobProc");
|
|
var Proc = (RegisterSwarmOpenJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenJobProc));
|
|
Proc(OpenJobProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmBeginJobSpecificationProc");
|
|
var Proc = (RegisterSwarmBeginJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmBeginJobSpecificationProc));
|
|
Proc(BeginJobSpecificationProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmAddTaskProc");
|
|
var Proc = (RegisterSwarmAddTaskProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddTaskProc));
|
|
Proc(AddTaskProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmEndJobSpecificationProc");
|
|
var Proc = (RegisterSwarmEndJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmEndJobSpecificationProc));
|
|
Proc(EndJobSpecificationProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseJobProc");
|
|
var Proc = (RegisterSwarmCloseJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseJobProc));
|
|
Proc(CloseJobProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmLogProc");
|
|
var Proc = (RegisterSwarmLogProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmLogProc));
|
|
Proc(LogProc);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = GetProcAddress(DllHandle, "SwarmInterfaceLog");
|
|
SwarmInterfaceLogCppProc = (SwarmInterfaceLogDelegate)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(SwarmInterfaceLogDelegate));
|
|
}
|
|
#else
|
|
IntPtr DllHandle = dlopen(SwarmInterfaceDllName, 9 /* RTLD_LAZY | RTLD_GLOBAL */);
|
|
if (DllHandle == IntPtr.Zero)
|
|
{
|
|
return Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenConnectionProc");
|
|
var Proc = (RegisterSwarmOpenConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenConnectionProc));
|
|
Proc(SwarmOpenConnection);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseConnectionProc");
|
|
var Proc = (RegisterSwarmCloseConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseConnectionProc));
|
|
Proc(SwarmCloseConnection);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmSendMessageProc");
|
|
var Proc = (RegisterSwarmSendMessageProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmSendMessageProc));
|
|
Proc(SwarmSendMessage);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmAddChannelProc");
|
|
var Proc = (RegisterSwarmAddChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddChannelProc));
|
|
Proc(SwarmAddChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmTestChannelProc");
|
|
var Proc = (RegisterSwarmTestChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmTestChannelProc));
|
|
Proc(SwarmTestChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenChannelProc");
|
|
var Proc = (RegisterSwarmOpenChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenChannelProc));
|
|
Proc(SwarmOpenChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseChannelProc");
|
|
var Proc = (RegisterSwarmCloseChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseChannelProc));
|
|
Proc(SwarmCloseChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmWriteChannelProc");
|
|
var Proc = (RegisterSwarmWriteChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmWriteChannelProc));
|
|
Proc(SwarmWriteChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmReadChannelProc");
|
|
var Proc = (RegisterSwarmReadChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmReadChannelProc));
|
|
Proc(SwarmReadChannel);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenJobProc");
|
|
var Proc = (RegisterSwarmOpenJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenJobProc));
|
|
Proc(SwarmOpenJob);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmBeginJobSpecificationProc");
|
|
var Proc = (RegisterSwarmBeginJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmBeginJobSpecificationProc));
|
|
Proc(SwarmBeginJobSpecification);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmAddTaskProc");
|
|
var Proc = (RegisterSwarmAddTaskProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddTaskProc));
|
|
Proc(SwarmAddTask);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmEndJobSpecificationProc");
|
|
var Proc = (RegisterSwarmEndJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmEndJobSpecificationProc));
|
|
Proc(SwarmEndJobSpecification);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseJobProc");
|
|
var Proc = (RegisterSwarmCloseJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseJobProc));
|
|
Proc(SwarmCloseJob);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmLogProc");
|
|
var Proc = (RegisterSwarmLogProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmLogProc));
|
|
Proc(SwarmLog);
|
|
}
|
|
|
|
{
|
|
IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "SwarmInterfaceLog");
|
|
SwarmInterfaceLogCppProc = (SwarmInterfaceLogDelegate)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(SwarmInterfaceLogDelegate));
|
|
}
|
|
#endif
|
|
|
|
return Constants.SUCCESS;
|
|
}
|
|
|
|
/**
|
|
* Opens a new connection to the Swarm
|
|
*
|
|
* @param CallbackFunc The callback function Swarm will use to communicate back to the Instigator
|
|
*
|
|
* @return An INT containing the error code (if < 0) or the handle (>= 0) which is useful for debugging only
|
|
*/
|
|
public virtual Int32 OpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, string OptionsFolder)
|
|
{
|
|
// Checked here so we can time OpenConnection
|
|
if ((LoggingFlags & ELogFlags.LOG_TIMINGS) == ELogFlags.LOG_TIMINGS)
|
|
{
|
|
PerfTimerInstance = new PerfTimer();
|
|
}
|
|
|
|
StartTiming("OpenConnection-Managed", true);
|
|
|
|
// Establish a connection to the local Agent server object
|
|
ConnectionHandle = Constants.INVALID;
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
try
|
|
{
|
|
EditorLog(EVerbosityLevel.Informative, "[OpenConnection] Registering TCP channel ...");
|
|
|
|
// Start up network services, by opening a network communication channel
|
|
NetworkChannel = new TcpClientChannel();
|
|
ChannelServices.RegisterChannel(NetworkChannel, false);
|
|
|
|
// See if an agent is already running, and if not, launch one
|
|
EnsureAgentIsRunning(OptionsFolder);
|
|
if (AgentProcess != null)
|
|
{
|
|
EditorLog(EVerbosityLevel.Informative, "[OpenConnection] Connecting to agent ...");
|
|
ReturnValue = TryOpenConnection(CallbackFunc, CallbackData, LoggingFlags);
|
|
if (ReturnValue >= 0)
|
|
{
|
|
AgentCacheFolder = ConnectionConfiguration.AgentCachePath;
|
|
if (AgentCacheFolder.Length == 0)
|
|
{
|
|
EditorLog(EVerbosityLevel.Critical, "[OpenConnection] Agent cache folder with 0 length.");
|
|
CloseConnection();
|
|
ReturnValue = Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
}
|
|
}
|
|
else
|
|
{
|
|
EditorLog(EVerbosityLevel.Critical, "[OpenConnection] Failed to find Swarm Agent");
|
|
ReturnValue = Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
EditorLog(EVerbosityLevel.Critical, "[OpenConnection] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_EXCEPTION;
|
|
}
|
|
|
|
// Finally, if there have been no errors, assign the connection handle
|
|
if (ReturnValue >= 0)
|
|
{
|
|
ConnectionHandle = ReturnValue;
|
|
}
|
|
else
|
|
{
|
|
// If we've failed for any reason, call the clean up routine
|
|
CleanupClosedConnection();
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Closes an existing connection to the Swarm
|
|
*
|
|
* @return Int32 error code (< 0 is error)
|
|
*/
|
|
public virtual Int32 CloseConnection()
|
|
{
|
|
// Dump any collected timing info
|
|
DumpTimings();
|
|
|
|
// Close the connection
|
|
StartTiming("CloseConnection-Managed", true);
|
|
|
|
Int32 ConnectionState = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
try
|
|
{
|
|
StartTiming("CloseConnection-Remote", false);
|
|
Connection.CloseConnection(ConnectionHandle);
|
|
StopTiming();
|
|
|
|
ConnectionState = Constants.SUCCESS;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
ConnectionState = Constants.ERROR_EXCEPTION;
|
|
DebugLog.Write("[CloseConnection] Error: " + Ex.Message);
|
|
}
|
|
|
|
// Clean up the state of the object with the connection now closed
|
|
CleanupClosedConnection();
|
|
|
|
// With the connecton completely closed, clean up our threads
|
|
if (ConnectionMessageThread.Join(1000) == false)
|
|
{
|
|
// After calling CloseConnection, this thread is fair game to kill at any time
|
|
Debug.WriteLineIf( Debugger.IsAttached, "[CloseConnection] Error: Message queue thread failed to quit before timeout, killing.");
|
|
ConnectionMessageThread.Abort();
|
|
}
|
|
ConnectionMessageThread = null;
|
|
KillMonitorThread = true;
|
|
if (ConnectionMonitorThread.Join(1000) == false)
|
|
{
|
|
// We expect to abort this thread, no message necessary
|
|
ConnectionMonitorThread.Abort();
|
|
}
|
|
ConnectionMonitorThread = null;
|
|
}
|
|
else
|
|
{
|
|
ConnectionState = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return( ConnectionState );
|
|
}
|
|
|
|
/**
|
|
* Sends a message to an Agent (return messages are sent via the FConnectionCallback)
|
|
*
|
|
* @param Message The message being sent
|
|
*
|
|
* @return Int32 error code (< 0 is error)
|
|
*/
|
|
public virtual Int32 SendMessage(IntPtr NativeMessagePtr)
|
|
{
|
|
StartTiming("SendMessage-Managed", true);
|
|
|
|
FMessage NativeMessage = (FMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FMessage));
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
AgentMessage ManagedMessage = null;
|
|
|
|
// TODO: As we add additional versions, convert to a switch rather than if-else.
|
|
// For now, just use a simple if since we only have one version and a switch is
|
|
// overkill.
|
|
if (NativeMessage.Version == ESwarmVersionValue.VER_1_0)
|
|
{
|
|
switch (NativeMessage.Type)
|
|
{
|
|
case EMessageType.TASK_REQUEST_RESPONSE:
|
|
// Swallow this message, since it should not be sent along to a local connection
|
|
// since all Job and Task information is contained within the Agent itself
|
|
break;
|
|
|
|
case EMessageType.TASK_STATE:
|
|
{
|
|
FTaskState NativeTaskStateMessage = (FTaskState)Marshal.PtrToStructure(NativeMessagePtr, typeof(FTaskState));
|
|
AgentGuid ManagedTaskGuid = new AgentGuid(NativeTaskStateMessage.TaskGuid.A,
|
|
NativeTaskStateMessage.TaskGuid.B,
|
|
NativeTaskStateMessage.TaskGuid.C,
|
|
NativeTaskStateMessage.TaskGuid.D);
|
|
EJobTaskState TaskState = (EJobTaskState)NativeTaskStateMessage.TaskState;
|
|
AgentTaskState ManagedTaskStateMessage = new AgentTaskState(null, ManagedTaskGuid, TaskState);
|
|
|
|
ManagedTaskStateMessage.TaskExitCode = NativeTaskStateMessage.TaskExitCode;
|
|
ManagedTaskStateMessage.TaskRunningTime = NativeTaskStateMessage.TaskRunningTime;
|
|
|
|
// If there is a message, be sure copy and pass it on
|
|
if (NativeTaskStateMessage.TaskMessage != IntPtr.Zero)
|
|
{
|
|
ManagedTaskStateMessage.TaskMessage = FStringMarshaler.MarshalNativeToManaged(NativeTaskStateMessage.TaskMessage);
|
|
}
|
|
|
|
ManagedMessage = ManagedTaskStateMessage;
|
|
}
|
|
break;
|
|
|
|
case EMessageType.INFO:
|
|
{
|
|
// Create the managed version of the info message
|
|
FInfoMessage NativeInfoMessage = (FInfoMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FInfoMessage));
|
|
AgentInfoMessage ManagedInfoMessage = new AgentInfoMessage();
|
|
if (NativeInfoMessage.TextMessage != IntPtr.Zero)
|
|
{
|
|
ManagedInfoMessage.TextMessage = FStringMarshaler.MarshalNativeToManaged(NativeInfoMessage.TextMessage);
|
|
}
|
|
ManagedMessage = ManagedInfoMessage;
|
|
}
|
|
break;
|
|
|
|
case EMessageType.ALERT:
|
|
{
|
|
// Create the managed version of the alert message
|
|
FAlertMessage NativeAlertMessage = (FAlertMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FAlertMessage));
|
|
AgentGuid JobGuid = new AgentGuid(NativeAlertMessage.JobGuid.A,
|
|
NativeAlertMessage.JobGuid.B,
|
|
NativeAlertMessage.JobGuid.C,
|
|
NativeAlertMessage.JobGuid.D);
|
|
AgentAlertMessage ManagedAlertMessage = new AgentAlertMessage(JobGuid);
|
|
ManagedAlertMessage.AlertLevel = (EAlertLevel)(NativeAlertMessage.AlertLevel);
|
|
AgentGuid ObjectGuid = new AgentGuid(NativeAlertMessage.ObjectGuid.A,
|
|
NativeAlertMessage.ObjectGuid.B,
|
|
NativeAlertMessage.ObjectGuid.C,
|
|
NativeAlertMessage.ObjectGuid.D);
|
|
ManagedAlertMessage.ObjectGuid = ObjectGuid;
|
|
ManagedAlertMessage.TypeId = NativeAlertMessage.TypeId;
|
|
if (NativeAlertMessage.TextMessage != IntPtr.Zero)
|
|
{
|
|
ManagedAlertMessage.TextMessage = FStringMarshaler.MarshalNativeToManaged(NativeAlertMessage.TextMessage);
|
|
}
|
|
ManagedMessage = ManagedAlertMessage;
|
|
}
|
|
break;
|
|
|
|
case EMessageType.TIMING:
|
|
{
|
|
// Create the managed version of the info message
|
|
FTimingMessage NativeTimingMessage = (FTimingMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FTimingMessage));
|
|
AgentTimingMessage ManagedTimingMessage = new AgentTimingMessage((EProgressionState)NativeTimingMessage.State, NativeTimingMessage.ThreadNum);
|
|
ManagedMessage = ManagedTimingMessage;
|
|
}
|
|
break;
|
|
|
|
default:
|
|
// By default, just pass the message version and type through, but
|
|
// any additional payload of a specialized type will be lost
|
|
ManagedMessage = new AgentMessage((EMessageType)NativeMessage.Type);
|
|
break;
|
|
}
|
|
}
|
|
|
|
if (ManagedMessage != null)
|
|
{
|
|
try
|
|
{
|
|
// Finally, send the message to the Agent
|
|
StartTiming("SendMessage-Remote", false);
|
|
Connection.SendMessage(ConnectionHandle, ManagedMessage);
|
|
StopTiming();
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:SendMessage] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return( ReturnValue );
|
|
}
|
|
|
|
/**
|
|
* Adds an existing file to the cache. Note, any existing channel with the same
|
|
* name will be overwritten.
|
|
*
|
|
* @param FullPath The full path name to the file that should be copied into the cache
|
|
* @param ChannelName The name of the channel once it's in the cache
|
|
*
|
|
* @return Int32 error code (< 0 is error)
|
|
*/
|
|
public virtual Int32 AddChannel(String FullPath, String ChannelName)
|
|
{
|
|
StartTiming("AddChannel-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
try
|
|
{
|
|
StartTiming("AddChannel-Remote", false);
|
|
ReturnValue = Connection.AddChannel(ConnectionHandle, FullPath, ChannelName);
|
|
StopTiming();
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:AddChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return( ReturnValue );
|
|
}
|
|
|
|
/**
|
|
* Determines if the named channel is in the cache
|
|
*
|
|
* @param ChannelName The name of the channel to look for
|
|
*
|
|
* @return Int32 error code (< 0 is error)
|
|
*/
|
|
public virtual Int32 TestChannel(String ChannelName)
|
|
{
|
|
StartTiming("TestChannel-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
try
|
|
{
|
|
if (!ConnectionConfiguration.IsPureLocalConnection)
|
|
{
|
|
StartTiming("TestChannel-Remote", false);
|
|
ReturnValue = Connection.TestChannel(ConnectionHandle, ChannelName);
|
|
StopTiming();
|
|
}
|
|
else
|
|
{
|
|
// Testing a channel only tests the main, persistent cache for files to read
|
|
EChannelFlags ChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_READ);
|
|
String FullManagedName = GenerateFullChannelName(ChannelName, ChannelFlags);
|
|
|
|
if (File.Exists(FullManagedName))
|
|
{
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:TestChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return( ReturnValue );
|
|
}
|
|
|
|
/**
|
|
* Opens a data channel for streaming data into the cache associated with an Agent
|
|
*
|
|
* @param ChannelName The name of the channel being opened
|
|
* @param ChannelFlags The mode, access, and other attributes of the channel being opened
|
|
*
|
|
* @return A handle to the opened channel (< 0 is error)
|
|
*/
|
|
public virtual Int32 OpenChannel(String ChannelName, EChannelFlags ChannelFlags)
|
|
{
|
|
StartTiming("OpenChannel-Managed", true);
|
|
|
|
Int32 ChannelHandle = Constants.INVALID;
|
|
bool NewChannelSuccessfullyCreated = false;
|
|
if (Connection != null)
|
|
{
|
|
try
|
|
{
|
|
// Ask the Agent if the file is safe to open, if required
|
|
if (!ConnectionConfiguration.IsPureLocalConnection)
|
|
{
|
|
StartTiming("OpenChannel-Remote", false);
|
|
ChannelHandle = Connection.OpenChannel(ConnectionHandle, ChannelName, (EChannelFlags)ChannelFlags);
|
|
StopTiming();
|
|
}
|
|
else
|
|
{
|
|
// If this is a pure local connection, then all we need to assure
|
|
// if that the handle we generate here is unique to the connection
|
|
ChannelHandle = Interlocked.Increment(ref BaseChannelHandle);
|
|
}
|
|
|
|
// If the channel is safe to open, open it up
|
|
if (ChannelHandle >= 0)
|
|
{
|
|
// Track the newly created temp file
|
|
ChannelInfo NewChannelInfo = new ChannelInfo();
|
|
NewChannelInfo.ChannelName = ChannelName;
|
|
NewChannelInfo.ChannelFlags = ChannelFlags;
|
|
NewChannelInfo.ChannelHandle = ChannelHandle;
|
|
NewChannelInfo.ChannelFileStream = null;
|
|
NewChannelInfo.ChannelData = null;
|
|
NewChannelInfo.ChannelOffset = 0;
|
|
|
|
// Determine the proper path name for the file
|
|
String FullManagedName = GenerateFullChannelName(ChannelName, ChannelFlags);
|
|
|
|
// Try to open the file
|
|
if ((ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0)
|
|
{
|
|
// Open the file stream
|
|
NewChannelInfo.ChannelFileStream = new FileStream(FullManagedName, FileMode.Create, FileAccess.Write, FileShare.None);
|
|
|
|
// Slightly different path for compressed files
|
|
if ((ChannelFlags & EChannelFlags.MISC_ENABLE_COMPRESSION) != 0)
|
|
{
|
|
Stream NewChannelStream = NewChannelInfo.ChannelFileStream;
|
|
NewChannelInfo.ChannelFileStream = new GZipStream(NewChannelStream, CompressionMode.Compress, false);
|
|
}
|
|
|
|
// If we were able to open the file, add it to the active channel list
|
|
Monitor.Enter(FreeChannelWriteBuffers);
|
|
try
|
|
{
|
|
// If available, take the next free write buffer from the list
|
|
if (FreeChannelWriteBuffers.Count > 0)
|
|
{
|
|
NewChannelInfo.ChannelData = FreeChannelWriteBuffers.Pop();
|
|
}
|
|
else
|
|
{
|
|
// Otherwise, allocate a new write buffer for this channel (default to 1MB)
|
|
NewChannelInfo.ChannelData = new byte[1024 * 1024];
|
|
}
|
|
}
|
|
finally
|
|
{
|
|
Monitor.Exit( FreeChannelWriteBuffers );
|
|
}
|
|
|
|
// Track the newly created file
|
|
OpenChannels.Add(ChannelHandle, NewChannelInfo);
|
|
NewChannelSuccessfullyCreated = true;
|
|
}
|
|
else if ((ChannelFlags & EChannelFlags.ACCESS_READ) != 0)
|
|
{
|
|
if (File.Exists(FullManagedName))
|
|
{
|
|
// Slightly different paths for compressed and non-compressed files
|
|
if ((ChannelFlags & EChannelFlags.MISC_ENABLE_COMPRESSION) != 0)
|
|
{
|
|
// Open the input stream, loading it entirely into memory
|
|
byte[] RawCompressedData = File.ReadAllBytes(FullManagedName);
|
|
|
|
// Allocate the destination buffer
|
|
// The size of the uncompressed data is contained in the last four bytes of the file
|
|
// http://www.ietf.org/rfc/rfc1952.txt?number=1952
|
|
Int32 UncompressedSize = BitConverter.ToInt32(RawCompressedData, RawCompressedData.Length - 4);
|
|
NewChannelInfo.ChannelData = new byte[UncompressedSize];
|
|
|
|
// Open the decompression stream and decompress directly into the destination
|
|
Stream DecompressionChannelStream = new GZipStream(new MemoryStream(RawCompressedData), CompressionMode.Decompress, false);
|
|
DecompressionChannelStream.Read(NewChannelInfo.ChannelData, 0, UncompressedSize);
|
|
DecompressionChannelStream.Close();
|
|
}
|
|
else
|
|
{
|
|
// Simply read in the entire file in one go
|
|
NewChannelInfo.ChannelData = File.ReadAllBytes(FullManagedName);
|
|
}
|
|
|
|
// Track the newly created channel
|
|
OpenChannels.Add(ChannelHandle, NewChannelInfo);
|
|
NewChannelSuccessfullyCreated = true;
|
|
}
|
|
else
|
|
{
|
|
// Failed to find the channel to read, return an error
|
|
ChannelHandle = Constants.ERROR_CHANNEL_NOT_FOUND;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenChannel] Error: " + Ex.ToString());
|
|
ChannelHandle = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
|
|
// If we opened the channel on the agent, but failed to create
|
|
// the file, close it on the agent
|
|
if ((ChannelHandle >= 0) &&
|
|
(NewChannelSuccessfullyCreated == false))
|
|
{
|
|
if (!ConnectionConfiguration.IsPureLocalConnection)
|
|
{
|
|
StartTiming("CloseChannel-Remote", false);
|
|
try
|
|
{
|
|
Connection.CloseChannel(ConnectionHandle, ChannelHandle);
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenChannel] Cleanup error: " + Ex.Message);
|
|
CleanupClosedConnection();
|
|
}
|
|
StopTiming();
|
|
}
|
|
ChannelHandle = Constants.ERROR_CHANNEL_IO_FAILED;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ChannelHandle = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ChannelHandle;
|
|
}
|
|
|
|
/**
|
|
* Closes an open channel
|
|
*
|
|
* @param Channel An open channel handle, returned by OpenChannel
|
|
*
|
|
* @return Int32 error code (< 0 is error)
|
|
*/
|
|
public virtual Int32 CloseChannel(Int32 Channel)
|
|
{
|
|
StartTiming("CloseChannel-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
// Get the channel info, so we can close the connection on the Agent
|
|
ChannelInfo ChannelToClose = null;
|
|
if (OpenChannels.TryGetValue(Channel, out ChannelToClose))
|
|
{
|
|
try
|
|
{
|
|
// If the channel was open for WRITE, make sure any buffers are flushed
|
|
if ((ChannelToClose.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0)
|
|
{
|
|
FlushChannel(ChannelToClose);
|
|
|
|
// Now that we're done with the write buffer, add it to the free stack
|
|
// for another channel to use (only for WRITE)
|
|
Monitor.Enter(FreeChannelWriteBuffers);
|
|
try
|
|
{
|
|
FreeChannelWriteBuffers.Push(ChannelToClose.ChannelData);
|
|
}
|
|
finally
|
|
{
|
|
Monitor.Exit(FreeChannelWriteBuffers);
|
|
}
|
|
}
|
|
|
|
// Remove the channel from the collection of open channels for this connection
|
|
OpenChannels.Remove(Channel);
|
|
|
|
// Close the file handle
|
|
if (ChannelToClose.ChannelFileStream != null)
|
|
{
|
|
ChannelToClose.ChannelFileStream.Close();
|
|
ChannelToClose.ChannelFileStream = null;
|
|
}
|
|
|
|
// Notify the Agent that the channel is closed, if required
|
|
if (!ConnectionConfiguration.IsPureLocalConnection)
|
|
{
|
|
StartTiming("CloseChannel-Remote", false);
|
|
Connection.CloseChannel(ConnectionHandle, ChannelToClose.ChannelHandle);
|
|
StopTiming();
|
|
}
|
|
else
|
|
{
|
|
// Since this is a pure local connection, all we need to do is make
|
|
// sure the now-closed channel is moved from the staging area into
|
|
// the main cache, but only if the channel is PERSISTENT and WRITE
|
|
if ((ChannelToClose.ChannelFlags & EChannelFlags.TYPE_PERSISTENT) != 0)
|
|
{
|
|
if ((ChannelToClose.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0)
|
|
{
|
|
// Get the final location path
|
|
EChannelFlags WriteChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_WRITE);
|
|
String SrcChannelName = GenerateFullChannelName(ChannelToClose.ChannelName, WriteChannelFlags);
|
|
EChannelFlags ReadChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_READ);
|
|
String DstChannelName = GenerateFullChannelName(ChannelToClose.ChannelName, ReadChannelFlags);
|
|
|
|
// Always remove the destination file if it already exists
|
|
FileInfo DstChannel = new FileInfo(DstChannelName);
|
|
if (DstChannel.Exists)
|
|
{
|
|
DstChannel.IsReadOnly = false;
|
|
DstChannel.Delete();
|
|
}
|
|
|
|
// Copy if the paper trail is enabled; Move otherwise
|
|
if ((ChannelToClose.ChannelFlags & EChannelFlags.MISC_ENABLE_PAPER_TRAIL) != 0)
|
|
{
|
|
File.Copy(SrcChannelName, DstChannelName);
|
|
}
|
|
else
|
|
{
|
|
File.Move(SrcChannelName, DstChannelName);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CloseChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Writes the provided data to the open channel opened for WRITE
|
|
*
|
|
* @param Channel An open channel handle, returned by OpenChannel
|
|
* @param Data Source buffer for the write
|
|
* @param Data Size of the source buffer
|
|
*
|
|
* @return The number of bytes written (< 0 is error)
|
|
*/
|
|
public virtual Int32 WriteChannel(Int32 Channel, IntPtr Data, Int32 DataSize)
|
|
{
|
|
StartTiming("WriteChannel-Managed", true, DataSize);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
ChannelInfo ChannelToWrite = null;
|
|
if ((OpenChannels.TryGetValue(Channel, out ChannelToWrite)) &&
|
|
(ChannelToWrite.ChannelFileStream != null))
|
|
{
|
|
try
|
|
{
|
|
bool WriteBuffered = false;
|
|
if (ChannelToWrite.ChannelData != null)
|
|
{
|
|
// See if the new data will fit into the write buffer
|
|
if ((ChannelToWrite.ChannelOffset + DataSize) <= ChannelToWrite.ChannelData.Length)
|
|
{
|
|
Marshal.Copy(Data, ChannelToWrite.ChannelData, ChannelToWrite.ChannelOffset, DataSize);
|
|
ChannelToWrite.ChannelOffset += DataSize;
|
|
ReturnValue = DataSize;
|
|
WriteBuffered = true;
|
|
}
|
|
else
|
|
{
|
|
// Otherwise, flush any pending writes and try again with the reset buffer
|
|
FlushChannel(ChannelToWrite);
|
|
if (DataSize <= ChannelToWrite.ChannelData.Length)
|
|
{
|
|
Marshal.Copy(Data, ChannelToWrite.ChannelData, 0, DataSize);
|
|
ChannelToWrite.ChannelOffset = DataSize;
|
|
ReturnValue = DataSize;
|
|
WriteBuffered = true;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Write was not buffered, just write it directly out
|
|
if (!WriteBuffered)
|
|
{
|
|
try
|
|
{
|
|
// Allocate a temporary buffer and copy the data in
|
|
byte[] TempChannelData = new byte[DataSize];
|
|
Marshal.Copy(Data, TempChannelData, 0, DataSize);
|
|
ChannelToWrite.ChannelFileStream.Write(TempChannelData, 0, DataSize);
|
|
ReturnValue = DataSize;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED;
|
|
}
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
|
|
// If this was not a successful IO operation, remove the channel
|
|
// from the set of active channels
|
|
if (ReturnValue < 0)
|
|
{
|
|
OpenChannels.Remove(Channel);
|
|
|
|
try
|
|
{
|
|
ChannelToWrite.ChannelFileStream.Close();
|
|
ChannelToWrite.ChannelFileStream = null;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Reads data from a channel opened for READ into the provided buffer
|
|
*
|
|
* @param Channel An open channel handle, returned by OpenChannel
|
|
* @param Data Destination buffer for the read
|
|
* @param Data Size of the destination buffer
|
|
*
|
|
* @return The number of bytes read (< 0 is error)
|
|
*/
|
|
public virtual Int32 ReadChannel(Int32 Channel, IntPtr Data, Int32 DataSize)
|
|
{
|
|
StartTiming("ReadChannel-Managed", true, DataSize);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
ChannelInfo ChannelToRead = null;
|
|
if ((OpenChannels.TryGetValue(Channel, out ChannelToRead)) &&
|
|
(ChannelToRead.ChannelData != null))
|
|
{
|
|
try
|
|
{
|
|
// Read the data directly from our buffered copy of the file
|
|
Int32 DataRemaining = ChannelToRead.ChannelData.Length - ChannelToRead.ChannelOffset;
|
|
if (DataRemaining >= 0)
|
|
{
|
|
Int32 SizeToRead = DataRemaining < DataSize ? DataRemaining : DataSize;
|
|
if (SizeToRead > 0)
|
|
{
|
|
Marshal.Copy(ChannelToRead.ChannelData, ChannelToRead.ChannelOffset, Data, SizeToRead);
|
|
ChannelToRead.ChannelOffset += SizeToRead;
|
|
}
|
|
ReturnValue = SizeToRead;
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED;
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:ReadChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
|
|
// If this was not a successful IO operation, remove the channel
|
|
// from the set of active channels
|
|
if (ReturnValue < 0)
|
|
{
|
|
OpenChannels.Remove(Channel);
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Opens a Job session, which allows a Job to be specified, Tasks added, Job
|
|
* channels opened and used, etc. When the Job is complete and no more Job
|
|
* related data is needed from the Swarm, call CloseJob.
|
|
*
|
|
* @param JobGuid A GUID that uniquely identifies this Job, generated by the caller
|
|
*
|
|
* @return Int32 Error code (< 0 is an error)
|
|
*/
|
|
public virtual Int32 OpenJob(FGuid JobGuid)
|
|
{
|
|
StartTiming("OpenJob-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
StartTiming("OpenJob-Remote", false);
|
|
try
|
|
{
|
|
AgentGuid ManagedJobGuid = new AgentGuid(JobGuid.A, JobGuid.B, JobGuid.C, JobGuid.D);
|
|
ReturnValue = Connection.OpenJob(ConnectionHandle, ManagedJobGuid);
|
|
if (ReturnValue >= 0)
|
|
{
|
|
// If the call was successful, assign the Job Guid as the active one
|
|
ConnectionConfiguration.AgentJobGuid = ManagedJobGuid;
|
|
|
|
// Allocate a new list to collect tasks until the specification is complete
|
|
PendingTasks = new List<AgentTaskSpecification>();
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenJob] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
StopTiming();
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Begins a Job specification, which allows a series of Tasks to be specified
|
|
* via AddTask. When Tasks are done being specified, call EndJobSpecification.
|
|
*
|
|
* The default behavior will be to execute the Job executable with the
|
|
* specified parameters. If Tasks are added for the Job, they are expected
|
|
* to be requested by the executable run for the Job. If no Tasks are added
|
|
* for the Job, it is expected that the Job executable will perform its
|
|
* operations without additional Task input from Swarm.
|
|
*
|
|
* @param Specification32 A structure describing a new 32-bit Job (can be an empty specification)
|
|
* @param Specification64 A structure describing a new 64-bit Job (can be an empty specification)
|
|
*
|
|
* @return Int32 Error code (< 0 is an error)
|
|
*/
|
|
public virtual Int32 BeginJobSpecification(FJobSpecification Specification32, FJobSpecification Specification64)
|
|
{
|
|
StartTiming("BeginJobSpecification-Managed", true );
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
if (ConnectionConfiguration.AgentJobGuid != null)
|
|
{
|
|
// Convert the specifications from native to managed
|
|
AgentJobSpecification NewSpecification32 = ConvertJobSpecification(ref Specification32, false);
|
|
AgentJobSpecification NewSpecification64 = ConvertJobSpecification(ref Specification64, true);
|
|
|
|
// Ensure all the files are in the cache with the right cache compatible name
|
|
if (NewSpecification32 != null)
|
|
{
|
|
ReturnValue = CacheAllFiles(NewSpecification32);
|
|
}
|
|
if (NewSpecification64 != null && (NewSpecification32 == null || ReturnValue < 0))
|
|
{
|
|
ReturnValue = CacheAllFiles(NewSpecification64);
|
|
}
|
|
|
|
if (ReturnValue >= 0)
|
|
{
|
|
// Pack up the optional descriptions into Hashtables and pass them along
|
|
UInt32 DescriptionIndex;
|
|
Hashtable NewDescription32 = null;
|
|
Hashtable NewDescription64 = null;
|
|
// 32-bit specification description
|
|
if (Specification32.DescriptionCount > 0)
|
|
{
|
|
try
|
|
{
|
|
NewDescription32 = new Hashtable();
|
|
NewDescription32["Version"] = ESwarmVersionValue.VER_1_0;
|
|
for (DescriptionIndex = 0; DescriptionIndex < Specification32.DescriptionCount; DescriptionIndex++)
|
|
{
|
|
String NewKey = Specification32.DescriptionKeys[DescriptionIndex];
|
|
String NewValue = Specification32.DescriptionValues[DescriptionIndex];
|
|
NewDescription32[NewKey] = NewValue;
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
// Failed to transfer optional description, log and continue
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error with Specification32 Description: " + Ex.Message);
|
|
NewDescription32 = null;
|
|
}
|
|
}
|
|
// 64-bit specification description
|
|
if (Specification64.DescriptionCount > 0)
|
|
{
|
|
try
|
|
{
|
|
NewDescription64 = new Hashtable();
|
|
NewDescription64["Version"] = ESwarmVersionValue.VER_1_0;
|
|
for (DescriptionIndex = 0; DescriptionIndex < Specification64.DescriptionCount; DescriptionIndex++)
|
|
{
|
|
String NewKey = Specification64.DescriptionKeys[DescriptionIndex];
|
|
String NewValue = Specification64.DescriptionValues[DescriptionIndex];
|
|
NewDescription64[NewKey] = NewValue;
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
// Failed to transfer optional description, log and continue
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error with Specification64 Description: " + Ex.Message);
|
|
NewDescription64 = null;
|
|
}
|
|
}
|
|
|
|
StartTiming("BeginJobSpecification-Remote", false);
|
|
try
|
|
{
|
|
ReturnValue = Connection.BeginJobSpecification(ConnectionHandle, NewSpecification32, NewDescription32, NewSpecification64, NewDescription64);
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
StopTiming();
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_JOB_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Adds a Task to the current Job
|
|
*
|
|
* @param Specification A structure describing the new Task
|
|
*
|
|
* @return Int32 Error code (< 0 is an error)
|
|
*/
|
|
public virtual Int32 AddTask(FTaskSpecification Specification)
|
|
{
|
|
StartTiming("AddTask-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
if (ConnectionConfiguration.AgentJobGuid != null)
|
|
{
|
|
// Convert the parameters from native to managed
|
|
AgentGuid TaskGuid = new AgentGuid(Specification.TaskGuid.A,
|
|
Specification.TaskGuid.B,
|
|
Specification.TaskGuid.C,
|
|
Specification.TaskGuid.D);
|
|
|
|
String Parameters = Specification.Parameters;
|
|
|
|
List<String> Dependencies = null;
|
|
if (Specification.DependencyCount > 0)
|
|
{
|
|
Dependencies = new List<String>();
|
|
for (UInt32 i = 0; i < Specification.DependencyCount; i++)
|
|
{
|
|
Dependencies.Add(Specification.Dependencies[i]);
|
|
}
|
|
}
|
|
|
|
AgentTaskSpecification NewSpecification =
|
|
new AgentTaskSpecification(ConnectionConfiguration.AgentJobGuid, TaskGuid, (Int32)Specification.Flags, Parameters, (Int32)Specification.Cost, Dependencies);
|
|
|
|
// Ensure all the files are in the cache with the right cache compatible name
|
|
ReturnValue = CacheAllFiles(NewSpecification);
|
|
if (ReturnValue >= 0)
|
|
{
|
|
// Queue up all tasks until the specification is complete and submit them all at once
|
|
PendingTasks.Add(NewSpecification);
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_JOB_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Ends the Job specification, after which no additional Tasks may be defined. Also,
|
|
* this is generally the point when the Agent will validate and launch the Job executable,
|
|
* potentially distributing the Job to other Agents.
|
|
*
|
|
* @return Int32 Error code (< 0 is an error)
|
|
*/
|
|
public virtual Int32 EndJobSpecification()
|
|
{
|
|
StartTiming("EndJobSpecification-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
if (ConnectionConfiguration.AgentJobGuid != null)
|
|
{
|
|
StartTiming("EndJobSpecification-Remote", false);
|
|
try
|
|
{
|
|
// Add all queued up and pending tasks now, all at once
|
|
ReturnValue = Connection.AddTask(ConnectionHandle, PendingTasks);
|
|
if( ReturnValue >= 0 )
|
|
{
|
|
// Finally, end the specification
|
|
ReturnValue = Connection.EndJobSpecification(ConnectionHandle);
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:EndJobSpecification] Error: " + Ex.Message + " " + Ex.ToString());
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
PendingTasks = null;
|
|
StopTiming();
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_JOB_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Ends the Job, after which all Job-related API usage (except OpenJob) will be rejected
|
|
*
|
|
* @return Int32 Error code (< 0 is an error)
|
|
*/
|
|
public virtual Int32 CloseJob()
|
|
{
|
|
StartTiming("CloseJob-Managed", true);
|
|
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if (Connection != null)
|
|
{
|
|
if (ConnectionConfiguration.AgentJobGuid != null)
|
|
{
|
|
StartTiming("CloseJob-Remote", false);
|
|
try
|
|
{
|
|
ReturnValue = Connection.CloseJob(ConnectionHandle);
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CloseJob] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
StopTiming();
|
|
|
|
// Reset the active Job Guid value
|
|
try
|
|
{
|
|
ConnectionConfiguration.AgentJobGuid = null;
|
|
}
|
|
catch (Exception)
|
|
{
|
|
// The ConnectionConfiguration can be set to null
|
|
// asynchronously, so we'll need to try/catch here
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_JOB_NOT_FOUND;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND;
|
|
}
|
|
|
|
StopTiming();
|
|
return ReturnValue;
|
|
}
|
|
|
|
/**
|
|
* Adds a line of text to the Agent log window
|
|
*
|
|
* @param Verbosity the importance of this message
|
|
* @param TextColour the colour of the text
|
|
* @param Message the line of text to add
|
|
*/
|
|
public virtual Int32 Log(EVerbosityLevel Verbosity, ELogColour TextColour, String Message)
|
|
{
|
|
try
|
|
{
|
|
Connection.Log(Verbosity, TextColour, Message);
|
|
}
|
|
catch (Exception)
|
|
{
|
|
}
|
|
|
|
return Constants.SUCCESS;
|
|
}
|
|
|
|
/**
|
|
* The function for the message queue monitoring thread used for
|
|
* calling the callback from the remote Agent
|
|
*/
|
|
static void MessageThreadProc(Object ThreadParameters)
|
|
{
|
|
MessageThreadData ThreadData = (MessageThreadData)ThreadParameters;
|
|
IAgentInterfaceWrapper Connection = ThreadData.Connection;
|
|
|
|
try
|
|
{
|
|
// Because the way we use the GetMessage call is blocking, if we ever break out, quit
|
|
AgentMessage ManagedMessage = null;
|
|
while (Connection.GetMessage(ThreadData.ConnectionHandle, out ManagedMessage, -1) >= 0)
|
|
{
|
|
// TODO: As we add additional versions, convert to a switch rather than if-else.
|
|
// For now, just use a simple if since we only have one version and a switch is
|
|
// overkill.
|
|
if (ManagedMessage.Version == ESwarmVersionValue.VER_1_0)
|
|
{
|
|
IntPtr NativeMessage = IntPtr.Zero;
|
|
String PinnedStringData = null;
|
|
|
|
switch (ManagedMessage.Type)
|
|
{
|
|
case EMessageType.JOB_STATE:
|
|
{
|
|
AgentJobState JobStateMessage = (AgentJobState)ManagedMessage;
|
|
FGuid JobGuid = new FGuid(JobStateMessage.JobGuid.A,
|
|
JobStateMessage.JobGuid.B,
|
|
JobStateMessage.JobGuid.C,
|
|
JobStateMessage.JobGuid.D);
|
|
|
|
FJobState NativeJobStateMessage = new FJobState(JobGuid, (EJobTaskState)JobStateMessage.JobState);
|
|
NativeJobStateMessage.JobExitCode = JobStateMessage.JobExitCode;
|
|
NativeJobStateMessage.JobRunningTime = JobStateMessage.JobRunningTime;
|
|
|
|
// If there is a message, be sure to pin and pass it on
|
|
if (JobStateMessage.JobMessage != null)
|
|
{
|
|
Char[] RawJobMessageData = JobStateMessage.JobMessage.ToCharArray();
|
|
if (RawJobMessageData.Length > 0)
|
|
{
|
|
// Pin the string data for the message
|
|
PinnedStringData = new String(RawJobMessageData);
|
|
NativeJobStateMessage.JobMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData);
|
|
}
|
|
}
|
|
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FJobState)));
|
|
Marshal.StructureToPtr(NativeJobStateMessage, NativeMessage, false);
|
|
}
|
|
break;
|
|
|
|
case EMessageType.TASK_REQUEST:
|
|
// Swallow this message, since it should not be sent along to a local connection
|
|
// since all Job and Task information is contained within the Agent itself
|
|
break;
|
|
|
|
case EMessageType.TASK_REQUEST_RESPONSE:
|
|
{
|
|
AgentTaskRequestResponse TaskRequestResponseMessage = (AgentTaskRequestResponse)ManagedMessage;
|
|
|
|
// Switch again on the response type
|
|
ETaskRequestResponseType ResponseType = (ETaskRequestResponseType)TaskRequestResponseMessage.ResponseType;
|
|
switch (ResponseType)
|
|
{
|
|
case ETaskRequestResponseType.RELEASE:
|
|
case ETaskRequestResponseType.RESERVATION:
|
|
{
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskRequestResponse)));
|
|
Marshal.StructureToPtr(new FTaskRequestResponse((ETaskRequestResponseType)ResponseType), NativeMessage, false);
|
|
}
|
|
break;
|
|
|
|
case ETaskRequestResponseType.SPECIFICATION:
|
|
{
|
|
AgentTaskSpecification TaskSpecificationMessage = (AgentTaskSpecification)TaskRequestResponseMessage;
|
|
FGuid TaskGuid = new FGuid(TaskSpecificationMessage.TaskGuid.A,
|
|
TaskSpecificationMessage.TaskGuid.B,
|
|
TaskSpecificationMessage.TaskGuid.C,
|
|
TaskSpecificationMessage.TaskGuid.D);
|
|
EJobTaskFlags TaskFlags = (EJobTaskFlags)TaskSpecificationMessage.TaskFlags;
|
|
|
|
Char[] RawParametersData = TaskSpecificationMessage.Parameters.ToCharArray();
|
|
if (RawParametersData.Length > 0)
|
|
{
|
|
// Pin the string data for the message
|
|
PinnedStringData = new String(RawParametersData);
|
|
}
|
|
|
|
FTaskSpecificationMarshalHelper MarshalHelper = new FTaskSpecificationMarshalHelper();
|
|
MarshalHelper.TaskGuid = TaskGuid;
|
|
MarshalHelper.Parameters = FStringMarshaler.MarshalManagedToNative(PinnedStringData);
|
|
MarshalHelper.Flags = TaskFlags;
|
|
MarshalHelper.Cost = 0;
|
|
MarshalHelper.DependencyCount = 0;
|
|
MarshalHelper.Dependencies = IntPtr.Zero;
|
|
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskSpecificationMarshalHelper)));
|
|
Marshal.StructureToPtr(MarshalHelper, NativeMessage, false);
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
break;
|
|
|
|
case EMessageType.TASK_STATE:
|
|
{
|
|
AgentTaskState TaskStateMessage = (AgentTaskState)ManagedMessage;
|
|
|
|
// TODO: Assert that we have a valid Job GUID, since this must be the Instigator
|
|
// TODO: Assert that the Job GUID of the message matches the ConnectionConfiguration.AgentJobGuid
|
|
|
|
FGuid TaskGuid = new FGuid(TaskStateMessage.TaskGuid.A,
|
|
TaskStateMessage.TaskGuid.B,
|
|
TaskStateMessage.TaskGuid.C,
|
|
TaskStateMessage.TaskGuid.D);
|
|
|
|
FTaskState NativeTaskStateMessage = new FTaskState(TaskGuid, (EJobTaskState)TaskStateMessage.TaskState);
|
|
|
|
// If there is a message, be sure to pin and pass it
|
|
if (TaskStateMessage.TaskMessage != null)
|
|
{
|
|
Char[] RawTaskMessageData = TaskStateMessage.TaskMessage.ToCharArray();
|
|
if (RawTaskMessageData.Length > 0)
|
|
{
|
|
// Pin the string data for the message
|
|
PinnedStringData = new String(RawTaskMessageData);
|
|
NativeTaskStateMessage.TaskMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData);
|
|
}
|
|
}
|
|
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskState)));
|
|
Marshal.StructureToPtr(NativeTaskStateMessage, NativeMessage, false);
|
|
}
|
|
break;
|
|
|
|
case EMessageType.INFO:
|
|
{
|
|
// Create the managed version of the info message
|
|
AgentInfoMessage ManagedInfoMessage = (AgentInfoMessage)ManagedMessage;
|
|
FInfoMessage NativeInfoMessage = new FInfoMessage("");
|
|
if (ManagedInfoMessage.TextMessage != null)
|
|
{
|
|
Char[] RawTaskMessageData = ManagedInfoMessage.TextMessage.ToCharArray();
|
|
if (RawTaskMessageData.Length > 0)
|
|
{
|
|
// Pin the string data for the message
|
|
PinnedStringData = new String(RawTaskMessageData);
|
|
NativeInfoMessage.TextMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData);
|
|
}
|
|
}
|
|
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FInfoMessage)));
|
|
Marshal.StructureToPtr(NativeInfoMessage, NativeMessage, false);
|
|
}
|
|
break;
|
|
|
|
case EMessageType.ALERT:
|
|
{
|
|
// Create the managed version of the info message
|
|
AgentAlertMessage ManagedAlertMessage = (AgentAlertMessage)ManagedMessage;
|
|
FGuid JobGuid = new FGuid(ManagedAlertMessage.JobGuid.A,
|
|
ManagedAlertMessage.JobGuid.B,
|
|
ManagedAlertMessage.JobGuid.C,
|
|
ManagedAlertMessage.JobGuid.D);
|
|
FGuid ObjectGuid = new FGuid(ManagedAlertMessage.ObjectGuid.A,
|
|
ManagedAlertMessage.ObjectGuid.B,
|
|
ManagedAlertMessage.ObjectGuid.C,
|
|
ManagedAlertMessage.ObjectGuid.D);
|
|
FAlertMessage NativeAlertMessage = new FAlertMessage(
|
|
JobGuid,
|
|
ManagedAlertMessage.AlertLevel,
|
|
ObjectGuid,
|
|
ManagedAlertMessage.TypeId);
|
|
if (ManagedAlertMessage.TextMessage != null)
|
|
{
|
|
Char[] RawTaskMessageData = ManagedAlertMessage.TextMessage.ToCharArray();
|
|
if (RawTaskMessageData.Length > 0)
|
|
{
|
|
// Pin the string data for the message
|
|
PinnedStringData = new String(RawTaskMessageData);
|
|
NativeAlertMessage.TextMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData);
|
|
}
|
|
}
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FAlertMessage)));
|
|
Marshal.StructureToPtr(NativeAlertMessage, NativeMessage, false);
|
|
}
|
|
break;
|
|
|
|
default:
|
|
// By default, just pass the message version and type through, but
|
|
// any additional payload of a specialized type will be lost
|
|
NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FMessage)));
|
|
Marshal.StructureToPtr(new FMessage(ESwarmVersionValue.VER_1_0, (EMessageType)ManagedMessage.Type), NativeMessage, false);
|
|
break;
|
|
}
|
|
|
|
// If a message was created to pass on to the user's callback, send it on
|
|
if (NativeMessage != IntPtr.Zero)
|
|
{
|
|
// Call the user's callback function
|
|
ThreadData.ConnectionCallback(NativeMessage, ThreadData.ConnectionCallbackData);
|
|
|
|
// All finished with the message, free and set to null
|
|
NativeMessage = IntPtr.Zero;
|
|
}
|
|
|
|
if (ManagedMessage.Type == EMessageType.QUIT)
|
|
{
|
|
// Return from this function, which will exit this message processing thread
|
|
DebugLog.Write("Message queue thread shutting down from a QUIT message");
|
|
return;
|
|
}
|
|
}
|
|
|
|
// Reset the message handle
|
|
ManagedMessage = null;
|
|
}
|
|
}
|
|
catch (ThreadAbortException)
|
|
{
|
|
// An expected exception when closing the connection
|
|
DebugLog.Write("Message queue thread shutting down normally after being closed by CloseConnection");
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
DebugLog.Write("Error: Exception in the message queue thread: " + Ex.Message);
|
|
|
|
// If the connection has thrown us an exception, close the connection
|
|
DebugLog.Write("MessageThreadProc calling CleanupClosedConnection");
|
|
ThreadData.Owner.CleanupClosedConnection();
|
|
}
|
|
|
|
// Only write out in debug
|
|
DebugLog.Write("Message queue thread shutting down normally");
|
|
}
|
|
|
|
/**
|
|
* The function for the agent monitoring thread used to watch
|
|
* for potential crashed or hung agents
|
|
*/
|
|
static void MonitorThreadProc(Object ThreadParameters)
|
|
{
|
|
MessageThreadData ThreadData = (MessageThreadData)ThreadParameters;
|
|
AgentConfiguration ConnectionConfiguration = ThreadData.ConnectionConfiguration;
|
|
IAgentInterfaceWrapper Connection = ThreadData.Connection;
|
|
|
|
bool NeedToCleanupClosedConnection = false;
|
|
try
|
|
{
|
|
if (Connection != null)
|
|
{
|
|
// We'll just monitor the process itself to see if it exits
|
|
Int32 ConnectionProcessID = ConnectionConfiguration.AgentProcessID;
|
|
|
|
Process AgentProcess = Process.GetProcessById(ConnectionProcessID);
|
|
if (AgentProcess != null)
|
|
{
|
|
// As long as the process is still running, yield
|
|
bool KeepRunning = true;
|
|
while (KeepRunning && !KillMonitorThread)
|
|
{
|
|
// Sleep for a little bit at the beginning of each iteration
|
|
Thread.Sleep(1000);
|
|
|
|
if (AgentProcess.HasExited == true)
|
|
{
|
|
// If the Agent process has exited, game over
|
|
NeedToCleanupClosedConnection = true;
|
|
KeepRunning = false;
|
|
}
|
|
}
|
|
KillMonitorThread = false;
|
|
}
|
|
}
|
|
}
|
|
catch (ThreadAbortException)
|
|
{
|
|
// An expected exception when closing the connection
|
|
DebugLog.Write("Agent monitor thread shutting down normally after being closed by CloseConnection");
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
DebugLog.Write("Exception in the agent monitor thread: " + Ex.Message);
|
|
|
|
// If the connection has thrown us an exception, close the connection
|
|
NeedToCleanupClosedConnection = true;
|
|
}
|
|
|
|
// If needed, clean up the connection
|
|
if (NeedToCleanupClosedConnection)
|
|
{
|
|
DebugLog.Write("MonitorThreadProc calling CleanupClosedConnection");
|
|
ThreadData.Owner.CleanupClosedConnection();
|
|
}
|
|
|
|
DebugLog.Write("Agent monitor thread shutting down normally");
|
|
}
|
|
|
|
/*
|
|
* Start a timer going
|
|
*/
|
|
void StartTiming(String Name, bool Accum, Int64 Adder)
|
|
{
|
|
if (PerfTimerInstance != null)
|
|
{
|
|
PerfTimerInstance.Start(Name, Accum, Adder);
|
|
}
|
|
}
|
|
|
|
void StartTiming(String Name, bool Accum)
|
|
{
|
|
StartTiming(Name, Accum, 0);
|
|
}
|
|
|
|
/*
|
|
* Stop a timer
|
|
*/
|
|
void StopTiming()
|
|
{
|
|
if (PerfTimerInstance != null)
|
|
{
|
|
PerfTimerInstance.Stop();
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Print out all the timing info
|
|
*/
|
|
void DumpTimings()
|
|
{
|
|
if (PerfTimerInstance != null)
|
|
{
|
|
String PerfMessage = PerfTimerInstance.DumpTimings();
|
|
IntPtr PerfMessagePtr = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FInfoMessage)));
|
|
Marshal.StructureToPtr(new FInfoMessage(PerfMessage), PerfMessagePtr, true);
|
|
SendMessage(PerfMessagePtr);
|
|
PerfTimerInstance = null;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Clean up all of the remainders from a closed connection, including the network channels, etc.
|
|
*/
|
|
Int32 CleanupClosedConnection()
|
|
{
|
|
Monitor.Enter(CleanupClosedConnectionLock);
|
|
|
|
// NOTE: Do not make any calls to the real Connection in here!
|
|
// If, for any reason, the connection has died, calling into it from here will
|
|
// end up causing this thread to hang, waiting for the dead connection to respond.
|
|
DebugLog.Write("[Interface:CleanupClosedConnection] Closing all connections to the Agent");
|
|
|
|
// Reset all necessary assigned variables
|
|
AgentProcess = null;
|
|
AgentProcessOwner = false;
|
|
|
|
if (Connection != null)
|
|
{
|
|
// Notify the connection wrapper that the connection is gone
|
|
Connection.SignalConnectionDropped();
|
|
Connection = null;
|
|
}
|
|
ConnectionHandle = Constants.INVALID;
|
|
ConnectionConfiguration = null;
|
|
|
|
// Clean up and close up the connection callback
|
|
if (ConnectionCallback != null)
|
|
{
|
|
IntPtr QuitMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FMessage)));
|
|
Marshal.StructureToPtr(new FMessage(ESwarmVersionValue.VER_1_0, EMessageType.QUIT), QuitMessage, false);
|
|
ConnectionCallback(QuitMessage, ConnectionCallbackData);
|
|
}
|
|
ConnectionCallback = null;
|
|
ConnectionCallbackData = IntPtr.Zero;
|
|
|
|
// Close all associated channels
|
|
if (OpenChannels.Count > 0)
|
|
{
|
|
foreach (ChannelInfo NextChannel in OpenChannels.Values)
|
|
{
|
|
// Just close the handle and we'll clear the entire list later
|
|
if (NextChannel.ChannelFileStream != null)
|
|
{
|
|
NextChannel.ChannelFileStream.Close();
|
|
NextChannel.ChannelFileStream = null;
|
|
}
|
|
}
|
|
OpenChannels.Clear();
|
|
}
|
|
|
|
// Unregister the primary network communication channel
|
|
if (NetworkChannel != null)
|
|
{
|
|
ChannelServices.UnregisterChannel(NetworkChannel);
|
|
NetworkChannel = null;
|
|
}
|
|
|
|
Monitor.Exit(CleanupClosedConnectionLock);
|
|
|
|
return Constants.SUCCESS;
|
|
}
|
|
|
|
/** All agent/swarm-specific variables */
|
|
Process AgentProcess;
|
|
bool AgentProcessOwner;
|
|
|
|
/** All connection-specific variables */
|
|
IAgentInterfaceWrapper Connection;
|
|
Int32 ConnectionHandle;
|
|
Thread ConnectionMessageThread;
|
|
Thread ConnectionMonitorThread;
|
|
FConnectionCallback ConnectionCallback;
|
|
IntPtr ConnectionCallbackData;
|
|
ELogFlags ConnectionLoggingFlags;
|
|
AgentConfiguration ConnectionConfiguration;
|
|
Object CleanupClosedConnectionLock;
|
|
|
|
/** A convenience class for packing a few managed types together */
|
|
class ChannelInfo
|
|
{
|
|
public String ChannelName;
|
|
public EChannelFlags ChannelFlags;
|
|
public Int32 ChannelHandle;
|
|
public Stream ChannelFileStream;
|
|
|
|
// For buffered reads and writes
|
|
public byte[] ChannelData;
|
|
public Int32 ChannelOffset;
|
|
};
|
|
|
|
ReaderWriterDictionary<Int32, ChannelInfo> OpenChannels;
|
|
Stack<byte[]> FreeChannelWriteBuffers;
|
|
Int32 BaseChannelHandle;
|
|
|
|
/** While a job is being specified, collect the task specifications until it's done, then submit all at once */
|
|
List<AgentTaskSpecification> PendingTasks;
|
|
|
|
/** A pair of locations needed for using channels */
|
|
String AgentCacheFolder;
|
|
|
|
/** The network channel used to communicate with the Agent */
|
|
TcpClientChannel NetworkChannel;
|
|
|
|
/** A helper class for timing info */
|
|
PerfTimer PerfTimerInstance;
|
|
|
|
Int32 TryOpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags)
|
|
{
|
|
try
|
|
{
|
|
// Allocate our new connection wrapper object
|
|
Connection = new IAgentInterfaceWrapper();
|
|
|
|
// Make sure the agent is alive and responsive before continuing
|
|
EditorLog(EVerbosityLevel.Informative, "[TryOpenConnection] Testing the Agent");
|
|
Hashtable InParameters = null;
|
|
Hashtable OutParameters = null;
|
|
bool AgentIsReady = false;
|
|
while (!AgentIsReady)
|
|
{
|
|
try
|
|
{
|
|
// Simply try to call the method and if it doesn't throw
|
|
// an exception, consider it a success
|
|
Connection.Method(0, InParameters, ref OutParameters);
|
|
AgentIsReady = true;
|
|
}
|
|
catch (Exception ex)
|
|
{
|
|
// Wait a little longer
|
|
EditorLog(EVerbosityLevel.Critical, "[TryOpenConnection] Waiting for the agent to start up ...");
|
|
EditorLog(EVerbosityLevel.Critical, ex.ToString());
|
|
Thread.Sleep(5000);
|
|
}
|
|
}
|
|
|
|
// Request an official connection to the Agent
|
|
EditorLog(EVerbosityLevel.Informative, "[TryOpenConnection] Opening Connection to Agent");
|
|
EditorLog(EVerbosityLevel.Informative, "[TryOpenConnection] Local Process ID is " + Process.GetCurrentProcess().Id.ToString());
|
|
|
|
StartTiming("OpenConnection-Remote", false);
|
|
ConnectionHandle = Connection.OpenConnection(AgentProcess, AgentProcessOwner, Process.GetCurrentProcess().Id, LoggingFlags, out ConnectionConfiguration);
|
|
StopTiming();
|
|
|
|
if (ConnectionHandle >= 0)
|
|
{
|
|
Log(EVerbosityLevel.Informative, ELogColour.Green, "[Interface:TryOpenConnection] Local connection established");
|
|
|
|
// Spawn a thread to monitor the message queue
|
|
MessageThreadData ThreadData = new MessageThreadData();
|
|
ThreadData.Owner = this;
|
|
ThreadData.Connection = Connection;
|
|
ThreadData.ConnectionHandle = ConnectionHandle;
|
|
ThreadData.ConnectionCallback = CallbackFunc;
|
|
ThreadData.ConnectionCallbackData = CallbackData;
|
|
ThreadData.ConnectionConfiguration = ConnectionConfiguration;
|
|
|
|
// Launch the message queue thread
|
|
ConnectionMessageThread = new Thread(new ParameterizedThreadStart(MessageThreadProc));
|
|
ConnectionMessageThread.Name = "ConnectionMessageThread";
|
|
ConnectionMessageThread.Start( ThreadData );
|
|
|
|
// Launch the agent monitor thread
|
|
ConnectionMonitorThread = new Thread(new ParameterizedThreadStart(MonitorThreadProc));
|
|
ConnectionMonitorThread.Name = "ConnectionMonitorThread";
|
|
ConnectionMonitorThread.Start(ThreadData);
|
|
|
|
// Save the user's callback routine
|
|
ConnectionCallback = CallbackFunc;
|
|
ConnectionCallbackData = CallbackData;
|
|
ConnectionLoggingFlags = LoggingFlags;
|
|
}
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
EditorLog(EVerbosityLevel.Critical, "[TryOpenConnection] Error: " + Ex.Message);
|
|
EditorLog(EVerbosityLevel.Critical, Ex.ToString());
|
|
ConnectionHandle = Constants.INVALID;
|
|
Connection = null;
|
|
}
|
|
|
|
return ConnectionHandle;
|
|
}
|
|
|
|
void EnsureAgentIsRunning(string OptionsFolder)
|
|
{
|
|
// See if an agent is already running, and if not, launch one
|
|
AgentProcess = null;
|
|
AgentProcessOwner = false;
|
|
|
|
#if !__MonoCS__
|
|
Process[] RunningSwarmAgents = Process.GetProcessesByName("SwarmAgent");
|
|
if (RunningSwarmAgents.Length > 0)
|
|
{
|
|
// If any are running, just grab the first one
|
|
AgentProcess = RunningSwarmAgents[0];
|
|
}
|
|
#else
|
|
Process[] RunningSwarmAgents = Process.GetProcessesByName("mono");
|
|
if (RunningSwarmAgents.Length == 0)
|
|
{
|
|
RunningSwarmAgents = Process.GetProcessesByName("mono-sgen");
|
|
}
|
|
foreach (Process Iter in RunningSwarmAgents)
|
|
{
|
|
foreach(ProcessModule m in Iter.Modules)
|
|
{
|
|
if(m.ModuleName.Contains("SwarmAgent"))
|
|
{
|
|
AgentProcess = Iter;
|
|
break;
|
|
}
|
|
}
|
|
if(AgentProcess != null)
|
|
break;
|
|
}
|
|
if (RunningSwarmAgents.Length > 0)
|
|
{
|
|
// If any are running, just grab the first one
|
|
AgentProcess = RunningSwarmAgents[0];
|
|
}
|
|
#endif
|
|
|
|
if (AgentProcess == null)
|
|
{
|
|
String StartupPath = Path.GetDirectoryName(Assembly.GetExecutingAssembly().Location);
|
|
#if !__MonoCS__
|
|
StartupPath += "/../DotNET/SwarmAgent.exe";
|
|
#else
|
|
StartupPath += "/../Mac/SwarmAgent.exe";
|
|
#endif
|
|
|
|
// If none, launch the Agent binary
|
|
DebugLog.Write("[OpenConnection] Spawning agent: " + StartupPath);
|
|
if (File.Exists(StartupPath))
|
|
{
|
|
String Arguments = "IAmSwarmAgent";
|
|
if ( OptionsFolder.Length > 0 )
|
|
{
|
|
Arguments += " -OptionsFolder=\"" + OptionsFolder + "\"";
|
|
}
|
|
AgentProcess = Process.Start(StartupPath, Arguments);
|
|
if (AgentProcess == null)
|
|
{
|
|
DebugLog.Write("[OpenConnection] Failed to start the Agent executable: " + StartupPath);
|
|
}
|
|
else
|
|
{
|
|
// If we started the process, we own it and control its lifetime
|
|
AgentProcessOwner = true;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
DebugLog.Write("[OpenConnection] Failed to find the Agent executable: " + StartupPath);
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Converts an native job specification to a managed version.
|
|
*
|
|
* @param Specification Native job specification (may be empty)
|
|
* @param bIs64bit Whether the job specification is 64-bit or not
|
|
* @return Newly created managed job specification, or null if the specification was empty
|
|
*/
|
|
AgentJobSpecification ConvertJobSpecification(ref FJobSpecification Specification, bool bIs64bit)
|
|
{
|
|
if (Specification.ExecutableName == null)
|
|
{
|
|
return null;
|
|
}
|
|
else
|
|
{
|
|
// Convert the parameters from native to managed
|
|
String ExecutableName = Specification.ExecutableName;
|
|
String Parameters = Specification.Parameters;
|
|
EJobTaskFlags Flags = (EJobTaskFlags)((Specification.Flags & ~EJobTaskFlags.FLAG_64BIT) | (bIs64bit ? EJobTaskFlags.FLAG_64BIT : 0));
|
|
|
|
List<String> RequiredDependencies = null;
|
|
if (Specification.RequiredDependencyCount > 0)
|
|
{
|
|
RequiredDependencies = new List<String>();
|
|
for (UInt32 i = 0; i < Specification.RequiredDependencyCount; i++)
|
|
{
|
|
RequiredDependencies.Add(Specification.RequiredDependencies[i]);
|
|
}
|
|
}
|
|
List<String> OptionalDependencies = null;
|
|
if (Specification.OptionalDependencyCount > 0)
|
|
{
|
|
OptionalDependencies = new List<String>();
|
|
for (UInt32 i = 0; i < Specification.OptionalDependencyCount; i++)
|
|
{
|
|
OptionalDependencies.Add(Specification.OptionalDependencies[i]);
|
|
}
|
|
}
|
|
|
|
return new AgentJobSpecification(ConnectionConfiguration.AgentJobGuid, (EJobTaskFlags)Flags, ExecutableName, Parameters, RequiredDependencies, OptionalDependencies);
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Generates the full channel name, including Job path and staging area path if necessary
|
|
*/
|
|
String GenerateFullChannelName(String ManagedChannelName, EChannelFlags ChannelFlags)
|
|
{
|
|
if ((ChannelFlags & EChannelFlags.TYPE_PERSISTENT) != 0)
|
|
{
|
|
if ((ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0)
|
|
{
|
|
// A persistent cache channel open for writing opens in the staging area
|
|
String StagingAreaName = Path.Combine(AgentCacheFolder, "AgentStagingArea");
|
|
return Path.Combine(StagingAreaName, ManagedChannelName);
|
|
}
|
|
else if ((ChannelFlags & EChannelFlags.ACCESS_READ) != 0)
|
|
{
|
|
// A persistent cache channel open for reading opens directly in the cache
|
|
return Path.Combine(AgentCacheFolder, ManagedChannelName);
|
|
}
|
|
}
|
|
else if ((ChannelFlags & EChannelFlags.TYPE_JOB_ONLY) != 0)
|
|
{
|
|
AgentGuid JobGuid = ConnectionConfiguration.AgentJobGuid;
|
|
if (JobGuid == null)
|
|
{
|
|
// If there's no Job associated with this connection at this point, provide
|
|
// a default GUID for one for debugging access to the agent cache
|
|
JobGuid = new AgentGuid(0x00000123, 0x00004567, 0x000089ab, 0x0000cdef);
|
|
}
|
|
|
|
// A Job Channel opens directly in the Job-specific directory
|
|
String JobsFolder = Path.Combine(AgentCacheFolder, "Jobs");
|
|
String JobFolderName = Path.Combine(JobsFolder, "Job-" + JobGuid.ToString());
|
|
return Path.Combine(JobFolderName, ManagedChannelName);
|
|
}
|
|
|
|
return "";
|
|
}
|
|
|
|
/*
|
|
* CacheFileAndConvertName
|
|
*
|
|
* Checks to see if the file with the correct timestamp and size exists in the cache
|
|
* If it does not, add it to the cache
|
|
*/
|
|
Int32 CacheFileAndConvertName(String FullPathName, out String CachedFileName, bool bUse64bitNamingConvention)
|
|
{
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
CachedFileName = "";
|
|
|
|
// First, check that the original file exists
|
|
if (File.Exists(FullPathName))
|
|
{
|
|
// The full cache name is based on the file name, the last modified timestamp on the file, and the file size
|
|
FileInfo FullPathFileInfo = new FileInfo(FullPathName);
|
|
|
|
// The last modified timestamp
|
|
String LastModifiedTimeUTCString = FullPathFileInfo.LastWriteTimeUtc.ToString("yyyy-MM-dd_HH-mm-ss");
|
|
|
|
// The file size, which we get by opening the file
|
|
String FileSizeInBytesString = FullPathFileInfo.Length.ToString();
|
|
|
|
String Suffix64bit = bUse64bitNamingConvention ? "-64bit" : "";
|
|
|
|
// Compose the full cache name
|
|
CachedFileName = String.Format("{0}_{1}_{2}{3}{4}",
|
|
Path.GetFileNameWithoutExtension(FullPathName),
|
|
LastModifiedTimeUTCString,
|
|
FileSizeInBytesString,
|
|
Suffix64bit,
|
|
FullPathFileInfo.Extension);
|
|
|
|
// Test the cache with the cached file name
|
|
if (Connection.TestChannel(ConnectionHandle, CachedFileName) < 0)
|
|
{
|
|
// If not already in the cache, attempt to add it now
|
|
ReturnValue = Connection.AddChannel(ConnectionHandle, FullPathName, CachedFileName);
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
ReturnValue = Constants.ERROR_FILE_FOUND_NOT;
|
|
}
|
|
|
|
// Didn't find the file, return failure
|
|
return ReturnValue;
|
|
}
|
|
|
|
/*
|
|
* CacheAllFiles
|
|
*
|
|
* Ensures all executables and dependencies are correctly placed in the cache
|
|
*/
|
|
Int32 CacheAllFiles(AgentJobSpecification JobSpecification)
|
|
{
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
try
|
|
{
|
|
// Allocate the dictionary we'll use for the name mapping
|
|
Dictionary<String, String> DependenciesOriginalNames = new Dictionary<String, String>();
|
|
|
|
bool bUse64bitNamingConvention = (JobSpecification.JobFlags & EJobTaskFlags.FLAG_64BIT) != 0;
|
|
|
|
// Check for and possibly cache the executable
|
|
String OriginalExecutableFullPath = Path.GetFullPath(JobSpecification.ExecutableName);
|
|
String CachedExecutableName;
|
|
ReturnValue = CacheFileAndConvertName(OriginalExecutableFullPath, out CachedExecutableName, bUse64bitNamingConvention);
|
|
if (ReturnValue < 0)
|
|
{
|
|
// Failed to cache the executable, return failure
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the executable: " + OriginalExecutableFullPath);
|
|
return ReturnValue;
|
|
}
|
|
|
|
JobSpecification.ExecutableName = CachedExecutableName;
|
|
|
|
String OriginalExecutableName = Path.GetFileName(OriginalExecutableFullPath);
|
|
DependenciesOriginalNames.Add(CachedExecutableName, OriginalExecutableName);
|
|
|
|
// Check and cache all the required dependencies
|
|
if ((JobSpecification.RequiredDependencies != null) &&
|
|
(JobSpecification.RequiredDependencies.Count > 0))
|
|
{
|
|
for (Int32 i = 0; i < JobSpecification.RequiredDependencies.Count; i++)
|
|
{
|
|
String OriginalDependencyFullPath = Path.GetFullPath(JobSpecification.RequiredDependencies[i]);
|
|
String CachedDependencyName;
|
|
ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, bUse64bitNamingConvention);
|
|
if (ReturnValue < 0)
|
|
{
|
|
// Failed to cache the dependency, return failure
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the required dependency: " + OriginalDependencyFullPath);
|
|
return ReturnValue;
|
|
}
|
|
|
|
JobSpecification.RequiredDependencies[i] = CachedDependencyName;
|
|
|
|
String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath);
|
|
DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName);
|
|
}
|
|
}
|
|
// Check and cache any optional dependencies
|
|
if ((JobSpecification.OptionalDependencies != null) &&
|
|
(JobSpecification.OptionalDependencies.Count > 0))
|
|
{
|
|
for (Int32 i = 0; i < JobSpecification.OptionalDependencies.Count; i++)
|
|
{
|
|
String OriginalDependencyFullPath = JobSpecification.OptionalDependencies[i];
|
|
String CachedDependencyName;
|
|
ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, bUse64bitNamingConvention);
|
|
if (ReturnValue < 0)
|
|
{
|
|
// Failed to cache the dependency, log a warning
|
|
Log(EVerbosityLevel.Verbose, ELogColour.Orange, "[Interface:CacheAllFiles] Failed to cache an optional dependency: " + OriginalDependencyFullPath);
|
|
}
|
|
else
|
|
{
|
|
JobSpecification.OptionalDependencies[i] = CachedDependencyName;
|
|
|
|
String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath);
|
|
DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName);
|
|
}
|
|
}
|
|
}
|
|
|
|
// Set the newly created name mapping dictionary
|
|
JobSpecification.DependenciesOriginalNames = DependenciesOriginalNames;
|
|
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
return ReturnValue;
|
|
}
|
|
|
|
Int32 CacheAllFiles(AgentTaskSpecification TaskSpecification)
|
|
{
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
try
|
|
{
|
|
TaskSpecification.DependenciesOriginalNames = null;
|
|
if ((TaskSpecification.Dependencies != null) &&
|
|
(TaskSpecification.Dependencies.Count > 0))
|
|
{
|
|
// Allocate the dictionary we'll use for the name mapping
|
|
Dictionary<String, String> DependenciesOriginalNames = new Dictionary<String, String>();
|
|
|
|
// Check and cache all the dependencies
|
|
for (Int32 i = 0; i < TaskSpecification.Dependencies.Count; i++)
|
|
{
|
|
String OriginalDependencyFullPath = TaskSpecification.Dependencies[i];
|
|
String CachedDependencyName;
|
|
ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, false);
|
|
if (ReturnValue < 0)
|
|
{
|
|
// Failed to cache the dependency, return failure
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the dependency: " + OriginalDependencyFullPath);
|
|
return ReturnValue;
|
|
}
|
|
|
|
TaskSpecification.Dependencies[i] = CachedDependencyName;
|
|
|
|
String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath);
|
|
DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName);
|
|
}
|
|
|
|
// Set the newly created name mapping dictionary
|
|
TaskSpecification.DependenciesOriginalNames = DependenciesOriginalNames;
|
|
}
|
|
ReturnValue = Constants.SUCCESS;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED;
|
|
CleanupClosedConnection();
|
|
}
|
|
return ReturnValue;
|
|
}
|
|
|
|
/*
|
|
* Flushes any buffered writes to the channel
|
|
*/
|
|
Int32 FlushChannel(ChannelInfo ChannelToFlush)
|
|
{
|
|
Int32 ReturnValue = Constants.INVALID;
|
|
if ((ChannelToFlush.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0 &&
|
|
(ChannelToFlush.ChannelOffset > 0) &&
|
|
(ChannelToFlush.ChannelData != null) &&
|
|
(ChannelToFlush.ChannelFileStream != null))
|
|
{
|
|
try
|
|
{
|
|
ChannelToFlush.ChannelFileStream.Write(ChannelToFlush.ChannelData, 0, ChannelToFlush.ChannelOffset);
|
|
ReturnValue = ChannelToFlush.ChannelOffset;
|
|
}
|
|
catch (Exception Ex)
|
|
{
|
|
Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:FlushChannel] Error: " + Ex.Message);
|
|
ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED;
|
|
}
|
|
ChannelToFlush.ChannelOffset = 0;
|
|
}
|
|
return ReturnValue;
|
|
}
|
|
|
|
private void EditorLog(EVerbosityLevel Verbosity, string Message)
|
|
{
|
|
if(SwarmInterfaceLogCppProc != null)
|
|
{
|
|
SwarmInterfaceLogCppProc(Verbosity, FStringMarshaler.MarshalManagedToNative(Message));
|
|
}
|
|
else
|
|
{
|
|
DebugLog.Write(Message);
|
|
}
|
|
}
|
|
|
|
}
|
|
}
|