// Copyright 1998-2015 Epic Games, Inc. All Rights Reserved. using System; using System.Collections; using System.Collections.Generic; using System.Diagnostics; using System.IO; using System.IO.Compression; using System.Runtime.InteropServices; using System.Runtime.Remoting; using System.Runtime.Remoting.Channels; using System.Runtime.Remoting.Channels.Tcp; using System.Runtime.Remoting.Messaging; using System.Threading; using AgentInterface; using System.Reflection; namespace NSwarm { internal static class DebugLog { [Conditional("DEBUG")] internal static void Write (string msg) { Console.WriteLine(msg); } } /* * PerfTiming * * An instance of a timing object. It tracks a single timing; the total time and the number of calls */ public class PerfTiming { public String Name; public Stopwatch StopWatchTimer; public Int32 Count; public bool Accumulate; public Int64 Counter; public PerfTiming(String InName, bool InAccumulate) { Name = InName; StopWatchTimer = new Stopwatch(); Count = 0; Accumulate = InAccumulate; Counter = 0; } public void Start() { StopWatchTimer.Start(); } public void Stop() { Count++; StopWatchTimer.Stop(); } public void IncrementCounter(Int64 Adder) { Counter += Adder; } } /* * PerfTimer * * Tracks a dictionary of PerfTimings */ public class PerfTimer { public Stack LastTimers; ReaderWriterDictionary Timings; public PerfTimer() { Timings = new ReaderWriterDictionary(); LastTimers = new Stack(); } public void Start(String Name, bool Accum, Int64 Adder) { Monitor.Enter(LastTimers); PerfTiming Timing = null; if (!Timings.TryGetValue(Name, out Timing)) { Timing = new PerfTiming(Name, Accum); Timings.Add(Name, Timing); } LastTimers.Push(Timing); Timing.IncrementCounter(Adder); Timing.Start(); Monitor.Exit(LastTimers); } public void Stop() { Monitor.Enter(LastTimers); PerfTiming Timing = LastTimers.Pop(); Timing.Stop(); Monitor.Exit(LastTimers); } public String DumpTimings() { String Output = ""; double TotalTime = 0.0; foreach (PerfTiming Timing in Timings.Values) { if (Timing.Count > 0) { double Elapsed = Timing.StopWatchTimer.Elapsed.TotalSeconds; double Average = (Elapsed * 1000000.0) / Timing.Count; Output += Timing.Name.PadLeft(30) + " : " + Elapsed.ToString("F3") + "s in " + Timing.Count + " calls (" + Average.ToString("F0") + "us per call)"; if (Timing.Counter > 0) { Output += " (" + (Timing.Counter / 1024) + "k)"; } Output += "\n"; if (Timing.Accumulate) { TotalTime += Elapsed; } } } Output += "\nTotal time inside Swarm: " + TotalTime.ToString("F3") + "s\n"; return Output; } } /////////////////////////////////////////////////////////////////////////////// /** * Connection configuration parameters, filled in by OpenConnection */ public class AgentConfiguration { public AgentConfiguration() { AgentProcessID = -1; AgentCachePath = null; AgentJobGuid = null; IsPureLocalConnection = false; } // Process ID of the owning process for the agent, which can be used to // monitor it for crashes or hangs public Int32 AgentProcessID; // The full path of the cache directory this agent is using public String AgentCachePath; // The GUID of the job the agent has associated this connection with, if any public AgentGuid AgentJobGuid; // An indication of whether we're considered a "pure" local connection by the // Agent, potentially relieving us from Agent coordination when using Channels public bool IsPureLocalConnection; } /////////////////////////////////////////////////////////////////////////////// /** * A wrapper to abstract away the complexity of asynchronous calls for the * Agent API and the monitoring of the connection */ public class IAgentInterfaceWrapper { public IAgentInterfaceWrapper() { // TODO: Make URL configurable Connection = (IAgentInterface)Activator.GetObject(typeof(IAgentInterface), "tcp://127.0.0.1:8008/SwarmAgent"); ConnectionDroppedEvent = new ManualResetEvent(false); } public void SignalConnectionDropped() { ConnectionDroppedEvent.Set(); } /////////////////////////////////////////////////////////////////////////// // A duplication of the IAgentInterface API which this class wraps public Int32 OpenConnection(Process AgentProcess, bool AgentProcessOwner, Int32 LocalProcessID, ELogFlags LoggingFlags, out AgentConfiguration NewConfiguration) { OpenConnectionDelegate DOpenConnection = Connection.OpenConnection; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["ProcessID"] = LocalProcessID; InParameters["ProcessIsOwner"] = (AgentProcessOwner == true ? true : false); InParameters["LoggingFlags"] = LoggingFlags; Hashtable OutParameters = null; IAsyncResult Result = DOpenConnection.BeginInvoke(InParameters, ref OutParameters, null, null); // This will wait with an occasional wake up to check to see if the // agent process is still alive and kicking (avoids infinite wait, // allows for very long start up times while debugging) Int32 StartupSleep = 1000; while ((Result.AsyncWaitHandle.WaitOne(StartupSleep) == false) && (AgentProcess.HasExited == false) && (AgentProcess.Responding == true)) { // While the application is alive and responding, wait DebugLog.Write("[OpenConnection] Waiting for agent to respond ..."); } if (Result.IsCompleted) { // If the invocation didn't fail, end to get the result Int32 ReturnValue = DOpenConnection.EndInvoke(ref OutParameters, Result); if (OutParameters != null) { if ((ESwarmVersionValue)OutParameters["Version"] == ESwarmVersionValue.VER_1_0) { NewConfiguration = new AgentConfiguration(); NewConfiguration.AgentProcessID = (Int32 )OutParameters["AgentProcessID"]; NewConfiguration.AgentCachePath = (String )OutParameters["AgentCachePath"]; NewConfiguration.AgentJobGuid = (AgentGuid )OutParameters["AgentJobGuid"]; if (OutParameters.ContainsKey("IsPureLocalConnection")) { NewConfiguration.IsPureLocalConnection = (bool)OutParameters["IsPureLocalConnection"]; } // Complete and successful return ReturnValue; } } } // Otherwise, error NewConfiguration = null; return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 CloseConnection(Int32 ConnectionHandle) { CloseConnectionDelegate DCloseConnection = Connection.CloseConnection; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable InParameters = null; Hashtable OutParameters = null; IAsyncResult Result = DCloseConnection.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DCloseConnection.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 SendMessage(Int32 ConnectionHandle, AgentMessage NewMessage) { SendMessageDelegate DSendMessage = Connection.SendMessage; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["Message"] = NewMessage; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DSendMessage.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DSendMessage.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 GetMessage(Int32 ConnectionHandle, out AgentMessage NextMessage, Int32 Timeout) { GetMessageDelegate DGetMessage = Connection.GetMessage; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["Timeout"] = (Int32)Timeout; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DGetMessage.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation didn't fail, end to get the result Int32 ReturnValue = DGetMessage.EndInvoke(ref OutParameters, Result); if (OutParameters != null) { if((ESwarmVersionValue)OutParameters["Version"] == ESwarmVersionValue.VER_1_0) { NextMessage = (AgentMessage )OutParameters["Message"]; // Complete and successful return ReturnValue; } } } // Otherwise, error NextMessage = null; return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 AddChannel(Int32 ConnectionHandle, String FullPath, String ChannelName) { AddChannelDelegate DAddChannel = Connection.AddChannel; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["FullPath"] = FullPath; InParameters["ChannelName"] = ChannelName; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DAddChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DAddChannel.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 TestChannel(Int32 ConnectionHandle, String ChannelName) { TestChannelDelegate DTestChannel = Connection.TestChannel; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["ChannelName"] = ChannelName; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DTestChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DTestChannel.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 OpenChannel(Int32 ConnectionHandle, String ChannelName, EChannelFlags ChannelFlags) { OpenChannelDelegate DOpenChannel = Connection.OpenChannel; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["ChannelName"] = ChannelName; InParameters["ChannelFlags"] = ChannelFlags; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DOpenChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DOpenChannel.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 CloseChannel(Int32 ConnectionHandle, Int32 ChannelHandle) { CloseChannelDelegate DCloseChannel = Connection.CloseChannel; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["ChannelHandle"] = ChannelHandle; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DCloseChannel.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DCloseChannel.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 OpenJob(Int32 ConnectionHandle, AgentGuid JobGuid ) { OpenJobDelegate DOpenJob = Connection.OpenJob; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["JobGuid"] = JobGuid; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DOpenJob.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DOpenJob.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 BeginJobSpecification(Int32 ConnectionHandle, AgentJobSpecification Specification32, Hashtable Description32, AgentJobSpecification Specification64, Hashtable Description64) { BeginJobSpecificationDelegate DBeginJobSpecification = Connection.BeginJobSpecification; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["Specification32"] = Specification32; InParameters["Specification64"] = Specification64; InParameters["Description32"] = Description32; InParameters["Description64"] = Description64; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DBeginJobSpecification.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DBeginJobSpecification.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 AddTask(Int32 ConnectionHandle, List Specifications) { AddTaskDelegate DAddTask = Connection.AddTask; // Set up the versioned hashtable input parameters Hashtable InParameters = new Hashtable(); InParameters["Version"] = ESwarmVersionValue.VER_1_0; InParameters["Specifications"] = Specifications; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable OutParameters = null; IAsyncResult Result = DAddTask.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DAddTask.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 EndJobSpecification(Int32 ConnectionHandle) { EndJobSpecificationDelegate DEndJobSpecification = Connection.EndJobSpecification; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable InParameters = null; Hashtable OutParameters = null; IAsyncResult Result = DEndJobSpecification.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DEndJobSpecification.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 CloseJob(Int32 ConnectionHandle) { CloseJobDelegate DCloseJob = Connection.CloseJob; // Invoke the method, then wait for it to finish or to be notified that the connection dropped Hashtable InParameters = null; Hashtable OutParameters = null; IAsyncResult Result = DCloseJob.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DCloseJob.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 Method(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters) { MethodDelegate DMethod = Connection.Method; // Invoke the method, then wait for it to finish or to be notified that the connection dropped IAsyncResult Result = DMethod.BeginInvoke(ConnectionHandle, InParameters, ref OutParameters, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DMethod.EndInvoke(ref OutParameters, Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// public Int32 Log(EVerbosityLevel Verbosity, ELogColour TextColour, String Line) { LogDelegate DLog = Connection.Log; // Invoke the method, then wait for it to finish or to be notified that the connection dropped IAsyncResult Result = DLog.BeginInvoke(Verbosity, TextColour, Line, null, null); WaitHandle.WaitAny(new WaitHandle[]{ Result.AsyncWaitHandle, ConnectionDroppedEvent }); // If the method completed normally, return the result if (Result.IsCompleted) { // If the invocation completed, success return DLog.EndInvoke(Result); } // Otherwise, error return Constants.ERROR_CONNECTION_DISCONNECTED; } /////////////////////////////////////////////////////////////////////////// // The wrapped connection IAgentInterface Connection; ManualResetEvent ConnectionDroppedEvent; // Delegate type declarations delegate Int32 OpenConnectionDelegate(Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 CloseConnectionDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 SendMessageDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 GetMessageDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 AddChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 TestChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 OpenChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 CloseChannelDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 OpenJobDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 BeginJobSpecificationDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 AddTaskDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 EndJobSpecificationDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 CloseJobDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 MethodDelegate(Int32 ConnectionHandle, Hashtable InParameters, ref Hashtable OutParameters); delegate Int32 LogDelegate(EVerbosityLevel Verbosity, ELogColour TextColour, String Line); } /////////////////////////////////////////////////////////////////////////////// public delegate void FConnectionCallback(IntPtr CallbackMessage, IntPtr CallbackData); /** * Helper struct for getting the message processing thread started */ public struct MessageThreadData { public FSwarmInterface Owner; public IAgentInterfaceWrapper Connection; public Int32 ConnectionHandle; public FConnectionCallback ConnectionCallback; public IntPtr ConnectionCallbackData; public AgentConfiguration ConnectionConfiguration; } /** * The C#implementation of FSwarmInterface */ public class FSwarmInterface { FSwarmInterface() { AgentProcess = null; AgentProcessOwner = false; Connection = null; ConnectionHandle = Constants.INVALID; ConnectionMessageThread = null; ConnectionMonitorThread = null; ConnectionConfiguration = null; ConnectionCallback = null; BaseChannelHandle = 0; PendingTasks = null; NetworkChannel = null; PerfTimerInstance = null; OpenChannels = new ReaderWriterDictionary(); FreeChannelWriteBuffers = new Stack(); CleanupClosedConnectionLock = new Object(); // TODO: Delete old files } delegate int SwarmOpenConnectionProc(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, IntPtr OptionsFolder); delegate int SwarmCloseConnectionProc(); delegate int SwarmSendMessageProc(IntPtr Message); delegate int SwarmAddChannelProc(IntPtr FullPath, IntPtr ChannelName); delegate int SwarmTestChannelProc(IntPtr ChannelName); delegate int SwarmOpenChannelProc(IntPtr ChannelName, EChannelFlags ChannelFlags); delegate int SwarmCloseChannelProc(int Channel); delegate int SwarmWriteChannelProc(int Channel, IntPtr Data, int DataSize); delegate int SwarmReadChannelProc(int Channel, IntPtr Data, int DataSize); delegate int SwarmOpenJobProc(IntPtr JobGuid); delegate int SwarmBeginJobSpecificationProc(IntPtr Specification32, IntPtr Specification64); delegate int SwarmAddTaskProc(IntPtr Specification); delegate int SwarmEndJobSpecificationProc(); delegate int SwarmCloseJobProc(); delegate int SwarmLogProc(EVerbosityLevel Verbosity, ELogColour TextColour, IntPtr Message); private delegate void RegisterSwarmOpenConnectionProc(SwarmOpenConnectionProc Proc); private delegate void RegisterSwarmCloseConnectionProc(SwarmCloseConnectionProc Proc); private delegate void RegisterSwarmSendMessageProc(SwarmSendMessageProc Proc); private delegate void RegisterSwarmAddChannelProc(SwarmAddChannelProc Proc); private delegate void RegisterSwarmTestChannelProc(SwarmTestChannelProc Proc); private delegate void RegisterSwarmOpenChannelProc(SwarmOpenChannelProc Proc); private delegate void RegisterSwarmCloseChannelProc(SwarmCloseChannelProc Proc); private delegate void RegisterSwarmWriteChannelProc(SwarmWriteChannelProc Proc); private delegate void RegisterSwarmReadChannelProc(SwarmReadChannelProc Proc); private delegate void RegisterSwarmOpenJobProc(SwarmOpenJobProc Proc); private delegate void RegisterSwarmBeginJobSpecificationProc(SwarmBeginJobSpecificationProc Proc); private delegate void RegisterSwarmAddTaskProc(SwarmAddTaskProc Proc); private delegate void RegisterSwarmEndJobSpecificationProc(SwarmEndJobSpecificationProc Proc); private delegate void RegisterSwarmCloseJobProc(SwarmCloseJobProc Proc); private delegate void RegisterSwarmLogProc(SwarmLogProc Proc); static int SwarmOpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, IntPtr OptionsFolder) { try { return GInstance.OpenConnection(CallbackFunc, CallbackData, (ELogFlags)LoggingFlags, FStringMarshaler.MarshalNativeToManaged(OptionsFolder)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmCloseConnection() { try { return GInstance.CloseConnection(); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmSendMessage(IntPtr Message) { try { return GInstance.SendMessage(Message); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmAddChannel(IntPtr FullPath, IntPtr ChannelName) { try { return GInstance.AddChannel(FStringMarshaler.MarshalNativeToManaged(FullPath), FStringMarshaler.MarshalNativeToManaged(ChannelName)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmTestChannel(IntPtr ChannelName) { try { return GInstance.TestChannel(FStringMarshaler.MarshalNativeToManaged(ChannelName)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmOpenChannel(IntPtr ChannelName, EChannelFlags ChannelFlags) { try { return GInstance.OpenChannel(FStringMarshaler.MarshalNativeToManaged(ChannelName), ChannelFlags); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmCloseChannel(int Channel) { try { return GInstance.CloseChannel(Channel); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmWriteChannel(int Channel, IntPtr Data, int DataSize) { try { return GInstance.WriteChannel(Channel, Data, DataSize); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmReadChannel(int Channel, IntPtr Data, int DataSize) { try { return GInstance.ReadChannel(Channel, Data, DataSize); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmOpenJob(IntPtr JobGuid) { try { return GInstance.OpenJob((FGuid)Marshal.PtrToStructure(JobGuid, typeof(FGuid))); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static FJobSpecification MarshalJobSpecification(IntPtr SpecificationPtr) { FJobSpecificationMarshalHelper Helper = (FJobSpecificationMarshalHelper)Marshal.PtrToStructure(SpecificationPtr, typeof(FJobSpecificationMarshalHelper)); FJobSpecification Specification = new FJobSpecification(); Specification.ExecutableName = FStringMarshaler.MarshalNativeToManaged(Helper.ExecutableName); Specification.Parameters = FStringMarshaler.MarshalNativeToManaged(Helper.Parameters); Specification.Flags = Helper.Flags; Specification.RequiredDependencyCount = Helper.RequiredDependencyCount; Specification.RequiredDependencies = new String[Specification.RequiredDependencyCount]; for (UInt32 Index = 0; Index < Specification.RequiredDependencyCount; Index++) { Specification.RequiredDependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.RequiredDependencies, (Int32)Index * 8)); } Specification.OptionalDependencyCount = Helper.OptionalDependencyCount; Specification.OptionalDependencies = new String[Specification.OptionalDependencyCount]; for (UInt32 Index = 0; Index < Specification.OptionalDependencyCount; Index++) { Specification.OptionalDependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.OptionalDependencies, (Int32)Index * 8)); } Specification.DescriptionCount = Helper.DescriptionCount; Specification.DescriptionKeys = new String[Specification.DescriptionCount]; Specification.DescriptionValues = new String[Specification.DescriptionCount]; for (UInt32 Index = 0; Index < Specification.DescriptionCount; Index++) { Specification.DescriptionKeys[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.DescriptionKeys, (Int32)Index * 8)); Specification.DescriptionValues[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.DescriptionValues, (Int32)Index * 8)); } return Specification; } static int SwarmBeginJobSpecification(IntPtr Specification32, IntPtr Specification64) { try { return GInstance.BeginJobSpecification(MarshalJobSpecification(Specification32), MarshalJobSpecification(Specification64)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static FTaskSpecification MarshalTaskSpecification(IntPtr SpecificationPtr) { FTaskSpecificationMarshalHelper Helper = (FTaskSpecificationMarshalHelper)Marshal.PtrToStructure(SpecificationPtr, typeof(FTaskSpecificationMarshalHelper)); FTaskSpecification Specification = new FTaskSpecification(Helper.TaskGuid, FStringMarshaler.MarshalNativeToManaged(Helper.Parameters), Helper.Flags); Specification.Cost = Helper.Cost; Specification.DependencyCount = Helper.DependencyCount; Specification.Dependencies = new String[Specification.DependencyCount]; for (UInt32 Index = 0; Index < Specification.DependencyCount; Index++) { Specification.Dependencies[Index] = FStringMarshaler.MarshalNativeToManaged(Marshal.ReadIntPtr(Helper.Dependencies, (Int32)Index * 8)); } return Specification; } static int SwarmAddTask(IntPtr Specification) { try { return GInstance.AddTask(MarshalTaskSpecification(Specification)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmEndJobSpecification() { try { return GInstance.EndJobSpecification(); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmCloseJob() { try { return GInstance.CloseJob(); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static int SwarmLog(EVerbosityLevel Verbosity, ELogColour TextColour, IntPtr Message) { try { return GInstance.Log((EVerbosityLevel)Verbosity, (ELogColour)TextColour, FStringMarshaler.MarshalNativeToManaged(Message)); } catch(Exception Ex) { DebugLog.Write(Ex.Message + "\n" + Ex.ToString()); return 0; } } static FSwarmInterface GInstance = new FSwarmInterface(); static SwarmOpenConnectionProc OpenConnectionProc = new SwarmOpenConnectionProc(SwarmOpenConnection); static SwarmCloseConnectionProc CloseConnectionProc = new SwarmCloseConnectionProc(SwarmCloseConnection); static SwarmSendMessageProc SendMessageProc = new SwarmSendMessageProc(SwarmSendMessage); static SwarmAddChannelProc AddChannelProc = new SwarmAddChannelProc(SwarmAddChannel); static SwarmTestChannelProc TestChannelProc = new SwarmTestChannelProc(SwarmTestChannel); static SwarmOpenChannelProc OpenChannelProc = new SwarmOpenChannelProc(SwarmOpenChannel); static SwarmCloseChannelProc CloseChannelProc = new SwarmCloseChannelProc(SwarmCloseChannel); static SwarmWriteChannelProc WriteChannelProc = new SwarmWriteChannelProc(SwarmWriteChannel); static SwarmReadChannelProc ReadChannelProc = new SwarmReadChannelProc(SwarmReadChannel); static SwarmOpenJobProc OpenJobProc = new SwarmOpenJobProc(SwarmOpenJob); static SwarmBeginJobSpecificationProc BeginJobSpecificationProc = new SwarmBeginJobSpecificationProc(SwarmBeginJobSpecification); static SwarmAddTaskProc AddTaskProc = new SwarmAddTaskProc(SwarmAddTask); static SwarmEndJobSpecificationProc EndJobSpecificationProc = new SwarmEndJobSpecificationProc(SwarmEndJobSpecification); static SwarmCloseJobProc CloseJobProc = new SwarmCloseJobProc(SwarmCloseJob); static SwarmLogProc LogProc = new SwarmLogProc(SwarmLog); static bool KillMonitorThread = false; #if !__MonoCS__ [DllImport("kernel32.dll", CharSet = CharSet.Auto, SetLastError = true)] private static extern IntPtr LoadLibrary(string name); [DllImport("kernel32.dll", CharSet = CharSet.Ansi, SetLastError = true)] private static extern IntPtr GetProcAddress(IntPtr hModule, string name); #else [DllImport("dl", CharSet = CharSet.Auto, SetLastError = true)] private static extern IntPtr dlopen(string name, int flag); [DllImport("dl", CharSet = CharSet.Ansi, SetLastError = true)] private static extern IntPtr dlsym(int handle, string name); #endif /** */ public static int InitCppBridgeCallbacks(String SwarmInterfaceDllName) { #if !__MonoCS__ IntPtr DllHandle = LoadLibrary(SwarmInterfaceDllName); if (DllHandle == IntPtr.Zero) { return Constants.ERROR_FILE_FOUND_NOT; } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenConnectionProc"); var Proc = (RegisterSwarmOpenConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenConnectionProc)); Proc(OpenConnectionProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseConnectionProc"); var Proc = (RegisterSwarmCloseConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseConnectionProc)); Proc(CloseConnectionProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmSendMessageProc"); var Proc = (RegisterSwarmSendMessageProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmSendMessageProc)); Proc(SendMessageProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmAddChannelProc"); var Proc = (RegisterSwarmAddChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddChannelProc)); Proc(AddChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmTestChannelProc"); var Proc = (RegisterSwarmTestChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmTestChannelProc)); Proc(TestChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenChannelProc"); var Proc = (RegisterSwarmOpenChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenChannelProc)); Proc(OpenChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseChannelProc"); var Proc = (RegisterSwarmCloseChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseChannelProc)); Proc(CloseChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmWriteChannelProc"); var Proc = (RegisterSwarmWriteChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmWriteChannelProc)); Proc(WriteChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmReadChannelProc"); var Proc = (RegisterSwarmReadChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmReadChannelProc)); Proc(ReadChannelProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmOpenJobProc"); var Proc = (RegisterSwarmOpenJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenJobProc)); Proc(OpenJobProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmBeginJobSpecificationProc"); var Proc = (RegisterSwarmBeginJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmBeginJobSpecificationProc)); Proc(BeginJobSpecificationProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmAddTaskProc"); var Proc = (RegisterSwarmAddTaskProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddTaskProc)); Proc(AddTaskProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmEndJobSpecificationProc"); var Proc = (RegisterSwarmEndJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmEndJobSpecificationProc)); Proc(EndJobSpecificationProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmCloseJobProc"); var Proc = (RegisterSwarmCloseJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseJobProc)); Proc(CloseJobProc); } { IntPtr ProcAddress = GetProcAddress(DllHandle, "RegisterSwarmLogProc"); var Proc = (RegisterSwarmLogProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmLogProc)); Proc(LogProc); } #else IntPtr DllHandle = dlopen(SwarmInterfaceDllName, 9 /* RTLD_LAZY | RTLD_GLOBAL */); if (DllHandle == IntPtr.Zero) { return Constants.ERROR_FILE_FOUND_NOT; } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenConnectionProc"); var Proc = (RegisterSwarmOpenConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenConnectionProc)); Proc(SwarmOpenConnection); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseConnectionProc"); var Proc = (RegisterSwarmCloseConnectionProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseConnectionProc)); Proc(SwarmCloseConnection); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmSendMessageProc"); var Proc = (RegisterSwarmSendMessageProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmSendMessageProc)); Proc(SwarmSendMessage); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmAddChannelProc"); var Proc = (RegisterSwarmAddChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddChannelProc)); Proc(SwarmAddChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmTestChannelProc"); var Proc = (RegisterSwarmTestChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmTestChannelProc)); Proc(SwarmTestChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenChannelProc"); var Proc = (RegisterSwarmOpenChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenChannelProc)); Proc(SwarmOpenChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseChannelProc"); var Proc = (RegisterSwarmCloseChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseChannelProc)); Proc(SwarmCloseChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmWriteChannelProc"); var Proc = (RegisterSwarmWriteChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmWriteChannelProc)); Proc(SwarmWriteChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmReadChannelProc"); var Proc = (RegisterSwarmReadChannelProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmReadChannelProc)); Proc(SwarmReadChannel); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmOpenJobProc"); var Proc = (RegisterSwarmOpenJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmOpenJobProc)); Proc(SwarmOpenJob); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmBeginJobSpecificationProc"); var Proc = (RegisterSwarmBeginJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmBeginJobSpecificationProc)); Proc(SwarmBeginJobSpecification); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmAddTaskProc"); var Proc = (RegisterSwarmAddTaskProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmAddTaskProc)); Proc(SwarmAddTask); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmEndJobSpecificationProc"); var Proc = (RegisterSwarmEndJobSpecificationProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmEndJobSpecificationProc)); Proc(SwarmEndJobSpecification); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmCloseJobProc"); var Proc = (RegisterSwarmCloseJobProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmCloseJobProc)); Proc(SwarmCloseJob); } { IntPtr ProcAddress = dlsym(-2 /* RTLD_DEFAULT */, "RegisterSwarmLogProc"); var Proc = (RegisterSwarmLogProc)Marshal.GetDelegateForFunctionPointer(ProcAddress, typeof(RegisterSwarmLogProc)); Proc(SwarmLog); } #endif return Constants.SUCCESS; } /** * Opens a new connection to the Swarm * * @param CallbackFunc The callback function Swarm will use to communicate back to the Instigator * * @return An INT containing the error code (if < 0) or the handle (>= 0) which is useful for debugging only */ public virtual Int32 OpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags, string OptionsFolder) { // Checked here so we can time OpenConnection if ((LoggingFlags & ELogFlags.LOG_TIMINGS) == ELogFlags.LOG_TIMINGS) { PerfTimerInstance = new PerfTimer(); } StartTiming("OpenConnection-Managed", true); // Establish a connection to the local Agent server object ConnectionHandle = Constants.INVALID; Int32 ReturnValue = Constants.INVALID; try { DebugLog.Write("[OpenConnection] Registering TCP channel ..."); // Start up network services, by opening a network communication channel NetworkChannel = new TcpClientChannel(); ChannelServices.RegisterChannel(NetworkChannel, false); // See if an agent is already running, and if not, launch one EnsureAgentIsRunning(OptionsFolder); if (AgentProcess != null) { DebugLog.Write("[OpenConnection] Connecting to agent ..."); ReturnValue = TryOpenConnection(CallbackFunc, CallbackData, LoggingFlags); if (ReturnValue >= 0) { AgentCacheFolder = ConnectionConfiguration.AgentCachePath; if (AgentCacheFolder.Length == 0) { CloseConnection(); ReturnValue = Constants.ERROR_FILE_FOUND_NOT; } } } else { DebugLog.Write("[OpenConnection] Failed to find Swarm Agent"); ReturnValue = Constants.ERROR_FILE_FOUND_NOT; } } catch (Exception Ex) { DebugLog.Write("[OpenConnection] Error: " + Ex.Message); ReturnValue = Constants.ERROR_EXCEPTION; } // Finally, if there have been no errors, assign the connection handle if (ReturnValue >= 0) { ConnectionHandle = ReturnValue; } else { // If we've failed for any reason, call the clean up routine CleanupClosedConnection(); } StopTiming(); return ReturnValue; } /** * Closes an existing connection to the Swarm * * @return Int32 error code (< 0 is error) */ public virtual Int32 CloseConnection() { // Dump any collected timing info DumpTimings(); // Close the connection StartTiming("CloseConnection-Managed", true); Int32 ConnectionState = Constants.INVALID; if (Connection != null) { try { StartTiming("CloseConnection-Remote", false); Connection.CloseConnection(ConnectionHandle); StopTiming(); ConnectionState = Constants.SUCCESS; } catch (Exception Ex) { ConnectionState = Constants.ERROR_EXCEPTION; DebugLog.Write("[CloseConnection] Error: " + Ex.Message); } // Clean up the state of the object with the connection now closed CleanupClosedConnection(); // With the connecton completely closed, clean up our threads if (ConnectionMessageThread.Join(1000) == false) { // After calling CloseConnection, this thread is fair game to kill at any time Debug.WriteLineIf( Debugger.IsAttached, "[CloseConnection] Error: Message queue thread failed to quit before timeout, killing."); ConnectionMessageThread.Abort(); } ConnectionMessageThread = null; KillMonitorThread = true; if (ConnectionMonitorThread.Join(1000) == false) { // We expect to abort this thread, no message necessary ConnectionMonitorThread.Abort(); } ConnectionMonitorThread = null; } else { ConnectionState = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return( ConnectionState ); } /** * Sends a message to an Agent (return messages are sent via the FConnectionCallback) * * @param Message The message being sent * * @return Int32 error code (< 0 is error) */ public virtual Int32 SendMessage(IntPtr NativeMessagePtr) { StartTiming("SendMessage-Managed", true); FMessage NativeMessage = (FMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FMessage)); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { AgentMessage ManagedMessage = null; // TODO: As we add additional versions, convert to a switch rather than if-else. // For now, just use a simple if since we only have one version and a switch is // overkill. if (NativeMessage.Version == ESwarmVersionValue.VER_1_0) { switch (NativeMessage.Type) { case EMessageType.TASK_REQUEST_RESPONSE: // Swallow this message, since it should not be sent along to a local connection // since all Job and Task information is contained within the Agent itself break; case EMessageType.TASK_STATE: { FTaskState NativeTaskStateMessage = (FTaskState)Marshal.PtrToStructure(NativeMessagePtr, typeof(FTaskState)); AgentGuid ManagedTaskGuid = new AgentGuid(NativeTaskStateMessage.TaskGuid.A, NativeTaskStateMessage.TaskGuid.B, NativeTaskStateMessage.TaskGuid.C, NativeTaskStateMessage.TaskGuid.D); EJobTaskState TaskState = (EJobTaskState)NativeTaskStateMessage.TaskState; AgentTaskState ManagedTaskStateMessage = new AgentTaskState(null, ManagedTaskGuid, TaskState); ManagedTaskStateMessage.TaskExitCode = NativeTaskStateMessage.TaskExitCode; ManagedTaskStateMessage.TaskRunningTime = NativeTaskStateMessage.TaskRunningTime; // If there is a message, be sure copy and pass it on if (NativeTaskStateMessage.TaskMessage != IntPtr.Zero) { ManagedTaskStateMessage.TaskMessage = FStringMarshaler.MarshalNativeToManaged(NativeTaskStateMessage.TaskMessage); } ManagedMessage = ManagedTaskStateMessage; } break; case EMessageType.INFO: { // Create the managed version of the info message FInfoMessage NativeInfoMessage = (FInfoMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FInfoMessage)); AgentInfoMessage ManagedInfoMessage = new AgentInfoMessage(); if (NativeInfoMessage.TextMessage != IntPtr.Zero) { ManagedInfoMessage.TextMessage = FStringMarshaler.MarshalNativeToManaged(NativeInfoMessage.TextMessage); } ManagedMessage = ManagedInfoMessage; } break; case EMessageType.ALERT: { // Create the managed version of the alert message FAlertMessage NativeAlertMessage = (FAlertMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FAlertMessage)); AgentGuid JobGuid = new AgentGuid(NativeAlertMessage.JobGuid.A, NativeAlertMessage.JobGuid.B, NativeAlertMessage.JobGuid.C, NativeAlertMessage.JobGuid.D); AgentAlertMessage ManagedAlertMessage = new AgentAlertMessage(JobGuid); ManagedAlertMessage.AlertLevel = (EAlertLevel)(NativeAlertMessage.AlertLevel); AgentGuid ObjectGuid = new AgentGuid(NativeAlertMessage.ObjectGuid.A, NativeAlertMessage.ObjectGuid.B, NativeAlertMessage.ObjectGuid.C, NativeAlertMessage.ObjectGuid.D); ManagedAlertMessage.ObjectGuid = ObjectGuid; ManagedAlertMessage.TypeId = NativeAlertMessage.TypeId; if (NativeAlertMessage.TextMessage != IntPtr.Zero) { ManagedAlertMessage.TextMessage = FStringMarshaler.MarshalNativeToManaged(NativeAlertMessage.TextMessage); } ManagedMessage = ManagedAlertMessage; } break; case EMessageType.TIMING: { // Create the managed version of the info message FTimingMessage NativeTimingMessage = (FTimingMessage)Marshal.PtrToStructure(NativeMessagePtr, typeof(FTimingMessage)); AgentTimingMessage ManagedTimingMessage = new AgentTimingMessage((EProgressionState)NativeTimingMessage.State, NativeTimingMessage.ThreadNum); ManagedMessage = ManagedTimingMessage; } break; default: // By default, just pass the message version and type through, but // any additional payload of a specialized type will be lost ManagedMessage = new AgentMessage((EMessageType)NativeMessage.Type); break; } } if (ManagedMessage != null) { try { // Finally, send the message to the Agent StartTiming("SendMessage-Remote", false); Connection.SendMessage(ConnectionHandle, ManagedMessage); StopTiming(); ReturnValue = Constants.SUCCESS; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:SendMessage] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return( ReturnValue ); } /** * Adds an existing file to the cache. Note, any existing channel with the same * name will be overwritten. * * @param FullPath The full path name to the file that should be copied into the cache * @param ChannelName The name of the channel once it's in the cache * * @return Int32 error code (< 0 is error) */ public virtual Int32 AddChannel(String FullPath, String ChannelName) { StartTiming("AddChannel-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { try { StartTiming("AddChannel-Remote", false); ReturnValue = Connection.AddChannel(ConnectionHandle, FullPath, ChannelName); StopTiming(); } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:AddChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return( ReturnValue ); } /** * Determines if the named channel is in the cache * * @param ChannelName The name of the channel to look for * * @return Int32 error code (< 0 is error) */ public virtual Int32 TestChannel(String ChannelName) { StartTiming("TestChannel-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { try { if (!ConnectionConfiguration.IsPureLocalConnection) { StartTiming("TestChannel-Remote", false); ReturnValue = Connection.TestChannel(ConnectionHandle, ChannelName); StopTiming(); } else { // Testing a channel only tests the main, persistent cache for files to read EChannelFlags ChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_READ); String FullManagedName = GenerateFullChannelName(ChannelName, ChannelFlags); if (File.Exists(FullManagedName)) { ReturnValue = Constants.SUCCESS; } else { ReturnValue = Constants.ERROR_FILE_FOUND_NOT; } } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:TestChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return( ReturnValue ); } /** * Opens a data channel for streaming data into the cache associated with an Agent * * @param ChannelName The name of the channel being opened * @param ChannelFlags The mode, access, and other attributes of the channel being opened * * @return A handle to the opened channel (< 0 is error) */ public virtual Int32 OpenChannel(String ChannelName, EChannelFlags ChannelFlags) { StartTiming("OpenChannel-Managed", true); Int32 ChannelHandle = Constants.INVALID; bool NewChannelSuccessfullyCreated = false; if (Connection != null) { try { // Ask the Agent if the file is safe to open, if required if (!ConnectionConfiguration.IsPureLocalConnection) { StartTiming("OpenChannel-Remote", false); ChannelHandle = Connection.OpenChannel(ConnectionHandle, ChannelName, (EChannelFlags)ChannelFlags); StopTiming(); } else { // If this is a pure local connection, then all we need to assure // if that the handle we generate here is unique to the connection ChannelHandle = Interlocked.Increment(ref BaseChannelHandle); } // If the channel is safe to open, open it up if (ChannelHandle >= 0) { // Track the newly created temp file ChannelInfo NewChannelInfo = new ChannelInfo(); NewChannelInfo.ChannelName = ChannelName; NewChannelInfo.ChannelFlags = ChannelFlags; NewChannelInfo.ChannelHandle = ChannelHandle; NewChannelInfo.ChannelFileStream = null; NewChannelInfo.ChannelData = null; NewChannelInfo.ChannelOffset = 0; // Determine the proper path name for the file String FullManagedName = GenerateFullChannelName(ChannelName, ChannelFlags); // Try to open the file if ((ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0) { // Open the file stream NewChannelInfo.ChannelFileStream = new FileStream(FullManagedName, FileMode.Create, FileAccess.Write, FileShare.None); // Slightly different path for compressed files if ((ChannelFlags & EChannelFlags.MISC_ENABLE_COMPRESSION) != 0) { Stream NewChannelStream = NewChannelInfo.ChannelFileStream; NewChannelInfo.ChannelFileStream = new GZipStream(NewChannelStream, CompressionMode.Compress, false); } // If we were able to open the file, add it to the active channel list Monitor.Enter(FreeChannelWriteBuffers); try { // If available, take the next free write buffer from the list if (FreeChannelWriteBuffers.Count > 0) { NewChannelInfo.ChannelData = FreeChannelWriteBuffers.Pop(); } else { // Otherwise, allocate a new write buffer for this channel (default to 1MB) NewChannelInfo.ChannelData = new byte[1024 * 1024]; } } finally { Monitor.Exit( FreeChannelWriteBuffers ); } // Track the newly created file OpenChannels.Add(ChannelHandle, NewChannelInfo); NewChannelSuccessfullyCreated = true; } else if ((ChannelFlags & EChannelFlags.ACCESS_READ) != 0) { if (File.Exists(FullManagedName)) { // Slightly different paths for compressed and non-compressed files if ((ChannelFlags & EChannelFlags.MISC_ENABLE_COMPRESSION) != 0) { // Open the input stream, loading it entirely into memory byte[] RawCompressedData = File.ReadAllBytes(FullManagedName); // Allocate the destination buffer // The size of the uncompressed data is contained in the last four bytes of the file // http://www.ietf.org/rfc/rfc1952.txt?number=1952 Int32 UncompressedSize = BitConverter.ToInt32(RawCompressedData, RawCompressedData.Length - 4); NewChannelInfo.ChannelData = new byte[UncompressedSize]; // Open the decompression stream and decompress directly into the destination Stream DecompressionChannelStream = new GZipStream(new MemoryStream(RawCompressedData), CompressionMode.Decompress, false); DecompressionChannelStream.Read(NewChannelInfo.ChannelData, 0, UncompressedSize); DecompressionChannelStream.Close(); } else { // Simply read in the entire file in one go NewChannelInfo.ChannelData = File.ReadAllBytes(FullManagedName); } // Track the newly created channel OpenChannels.Add(ChannelHandle, NewChannelInfo); NewChannelSuccessfullyCreated = true; } else { // Failed to find the channel to read, return an error ChannelHandle = Constants.ERROR_CHANNEL_NOT_FOUND; } } } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenChannel] Error: " + Ex.ToString()); ChannelHandle = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } // If we opened the channel on the agent, but failed to create // the file, close it on the agent if ((ChannelHandle >= 0) && (NewChannelSuccessfullyCreated == false)) { if (!ConnectionConfiguration.IsPureLocalConnection) { StartTiming("CloseChannel-Remote", false); try { Connection.CloseChannel(ConnectionHandle, ChannelHandle); } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenChannel] Cleanup error: " + Ex.Message); CleanupClosedConnection(); } StopTiming(); } ChannelHandle = Constants.ERROR_CHANNEL_IO_FAILED; } } else { ChannelHandle = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ChannelHandle; } /** * Closes an open channel * * @param Channel An open channel handle, returned by OpenChannel * * @return Int32 error code (< 0 is error) */ public virtual Int32 CloseChannel(Int32 Channel) { StartTiming("CloseChannel-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { // Get the channel info, so we can close the connection on the Agent ChannelInfo ChannelToClose = null; if (OpenChannels.TryGetValue(Channel, out ChannelToClose)) { try { // If the channel was open for WRITE, make sure any buffers are flushed if ((ChannelToClose.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0) { FlushChannel(ChannelToClose); // Now that we're done with the write buffer, add it to the free stack // for another channel to use (only for WRITE) Monitor.Enter(FreeChannelWriteBuffers); try { FreeChannelWriteBuffers.Push(ChannelToClose.ChannelData); } finally { Monitor.Exit(FreeChannelWriteBuffers); } } // Remove the channel from the collection of open channels for this connection OpenChannels.Remove(Channel); // Close the file handle if (ChannelToClose.ChannelFileStream != null) { ChannelToClose.ChannelFileStream.Close(); ChannelToClose.ChannelFileStream = null; } // Notify the Agent that the channel is closed, if required if (!ConnectionConfiguration.IsPureLocalConnection) { StartTiming("CloseChannel-Remote", false); Connection.CloseChannel(ConnectionHandle, ChannelToClose.ChannelHandle); StopTiming(); } else { // Since this is a pure local connection, all we need to do is make // sure the now-closed channel is moved from the staging area into // the main cache, but only if the channel is PERSISTENT and WRITE if ((ChannelToClose.ChannelFlags & EChannelFlags.TYPE_PERSISTENT) != 0) { if ((ChannelToClose.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0) { // Get the final location path EChannelFlags WriteChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_WRITE); String SrcChannelName = GenerateFullChannelName(ChannelToClose.ChannelName, WriteChannelFlags); EChannelFlags ReadChannelFlags = (EChannelFlags)(EChannelFlags.TYPE_PERSISTENT | EChannelFlags.ACCESS_READ); String DstChannelName = GenerateFullChannelName(ChannelToClose.ChannelName, ReadChannelFlags); // Always remove the destination file if it already exists FileInfo DstChannel = new FileInfo(DstChannelName); if (DstChannel.Exists) { DstChannel.IsReadOnly = false; DstChannel.Delete(); } // Copy if the paper trail is enabled; Move otherwise if ((ChannelToClose.ChannelFlags & EChannelFlags.MISC_ENABLE_PAPER_TRAIL) != 0) { File.Copy(SrcChannelName, DstChannelName); } else { File.Move(SrcChannelName, DstChannelName); } } } } ReturnValue = Constants.SUCCESS; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CloseChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } } else { ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Writes the provided data to the open channel opened for WRITE * * @param Channel An open channel handle, returned by OpenChannel * @param Data Source buffer for the write * @param Data Size of the source buffer * * @return The number of bytes written (< 0 is error) */ public virtual Int32 WriteChannel(Int32 Channel, IntPtr Data, Int32 DataSize) { StartTiming("WriteChannel-Managed", true, DataSize); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { ChannelInfo ChannelToWrite = null; if ((OpenChannels.TryGetValue(Channel, out ChannelToWrite)) && (ChannelToWrite.ChannelFileStream != null)) { try { bool WriteBuffered = false; if (ChannelToWrite.ChannelData != null) { // See if the new data will fit into the write buffer if ((ChannelToWrite.ChannelOffset + DataSize) <= ChannelToWrite.ChannelData.Length) { Marshal.Copy(Data, ChannelToWrite.ChannelData, ChannelToWrite.ChannelOffset, DataSize); ChannelToWrite.ChannelOffset += DataSize; ReturnValue = DataSize; WriteBuffered = true; } else { // Otherwise, flush any pending writes and try again with the reset buffer FlushChannel(ChannelToWrite); if (DataSize <= ChannelToWrite.ChannelData.Length) { Marshal.Copy(Data, ChannelToWrite.ChannelData, 0, DataSize); ChannelToWrite.ChannelOffset = DataSize; ReturnValue = DataSize; WriteBuffered = true; } } } // Write was not buffered, just write it directly out if (!WriteBuffered) { try { // Allocate a temporary buffer and copy the data in byte[] TempChannelData = new byte[DataSize]; Marshal.Copy(Data, TempChannelData, 0, DataSize); ChannelToWrite.ChannelFileStream.Write(TempChannelData, 0, DataSize); ReturnValue = DataSize; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED; } } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } // If this was not a successful IO operation, remove the channel // from the set of active channels if (ReturnValue < 0) { OpenChannels.Remove(Channel); try { ChannelToWrite.ChannelFileStream.Close(); ChannelToWrite.ChannelFileStream = null; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:WriteChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } } } else { ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Reads data from a channel opened for READ into the provided buffer * * @param Channel An open channel handle, returned by OpenChannel * @param Data Destination buffer for the read * @param Data Size of the destination buffer * * @return The number of bytes read (< 0 is error) */ public virtual Int32 ReadChannel(Int32 Channel, IntPtr Data, Int32 DataSize) { StartTiming("ReadChannel-Managed", true, DataSize); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { ChannelInfo ChannelToRead = null; if ((OpenChannels.TryGetValue(Channel, out ChannelToRead)) && (ChannelToRead.ChannelData != null)) { try { // Read the data directly from our buffered copy of the file Int32 DataRemaining = ChannelToRead.ChannelData.Length - ChannelToRead.ChannelOffset; if (DataRemaining >= 0) { Int32 SizeToRead = DataRemaining < DataSize ? DataRemaining : DataSize; if (SizeToRead > 0) { Marshal.Copy(ChannelToRead.ChannelData, ChannelToRead.ChannelOffset, Data, SizeToRead); ChannelToRead.ChannelOffset += SizeToRead; } ReturnValue = SizeToRead; } else { ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED; } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:ReadChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } // If this was not a successful IO operation, remove the channel // from the set of active channels if (ReturnValue < 0) { OpenChannels.Remove(Channel); } } else { ReturnValue = Constants.ERROR_CHANNEL_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Opens a Job session, which allows a Job to be specified, Tasks added, Job * channels opened and used, etc. When the Job is complete and no more Job * related data is needed from the Swarm, call CloseJob. * * @param JobGuid A GUID that uniquely identifies this Job, generated by the caller * * @return Int32 Error code (< 0 is an error) */ public virtual Int32 OpenJob(FGuid JobGuid) { StartTiming("OpenJob-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { StartTiming("OpenJob-Remote", false); try { AgentGuid ManagedJobGuid = new AgentGuid(JobGuid.A, JobGuid.B, JobGuid.C, JobGuid.D); ReturnValue = Connection.OpenJob(ConnectionHandle, ManagedJobGuid); if (ReturnValue >= 0) { // If the call was successful, assign the Job Guid as the active one ConnectionConfiguration.AgentJobGuid = ManagedJobGuid; // Allocate a new list to collect tasks until the specification is complete PendingTasks = new List(); } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:OpenJob] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } StopTiming(); } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Begins a Job specification, which allows a series of Tasks to be specified * via AddTask. When Tasks are done being specified, call EndJobSpecification. * * The default behavior will be to execute the Job executable with the * specified parameters. If Tasks are added for the Job, they are expected * to be requested by the executable run for the Job. If no Tasks are added * for the Job, it is expected that the Job executable will perform its * operations without additional Task input from Swarm. * * @param Specification32 A structure describing a new 32-bit Job (can be an empty specification) * @param Specification64 A structure describing a new 64-bit Job (can be an empty specification) * * @return Int32 Error code (< 0 is an error) */ public virtual Int32 BeginJobSpecification(FJobSpecification Specification32, FJobSpecification Specification64) { StartTiming("BeginJobSpecification-Managed", true ); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { if (ConnectionConfiguration.AgentJobGuid != null) { // Convert the specifications from native to managed AgentJobSpecification NewSpecification32 = ConvertJobSpecification(ref Specification32, false); AgentJobSpecification NewSpecification64 = ConvertJobSpecification(ref Specification64, true); // Ensure all the files are in the cache with the right cache compatible name if (NewSpecification32 != null) { ReturnValue = CacheAllFiles(NewSpecification32); } if (NewSpecification64 != null && (NewSpecification32 == null || ReturnValue < 0)) { ReturnValue = CacheAllFiles(NewSpecification64); } if (ReturnValue >= 0) { // Pack up the optional descriptions into Hashtables and pass them along UInt32 DescriptionIndex; Hashtable NewDescription32 = null; Hashtable NewDescription64 = null; // 32-bit specification description if (Specification32.DescriptionCount > 0) { try { NewDescription32 = new Hashtable(); NewDescription32["Version"] = ESwarmVersionValue.VER_1_0; for (DescriptionIndex = 0; DescriptionIndex < Specification32.DescriptionCount; DescriptionIndex++) { String NewKey = Specification32.DescriptionKeys[DescriptionIndex]; String NewValue = Specification32.DescriptionValues[DescriptionIndex]; NewDescription32[NewKey] = NewValue; } } catch (Exception Ex) { // Failed to transfer optional description, log and continue Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error with Specification32 Description: " + Ex.Message); NewDescription32 = null; } } // 64-bit specification description if (Specification64.DescriptionCount > 0) { try { NewDescription64 = new Hashtable(); NewDescription64["Version"] = ESwarmVersionValue.VER_1_0; for (DescriptionIndex = 0; DescriptionIndex < Specification64.DescriptionCount; DescriptionIndex++) { String NewKey = Specification64.DescriptionKeys[DescriptionIndex]; String NewValue = Specification64.DescriptionValues[DescriptionIndex]; NewDescription64[NewKey] = NewValue; } } catch (Exception Ex) { // Failed to transfer optional description, log and continue Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error with Specification64 Description: " + Ex.Message); NewDescription64 = null; } } StartTiming("BeginJobSpecification-Remote", false); try { ReturnValue = Connection.BeginJobSpecification(ConnectionHandle, NewSpecification32, NewDescription32, NewSpecification64, NewDescription64); } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:BeginJobSpecification] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } StopTiming(); } } else { ReturnValue = Constants.ERROR_JOB_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Adds a Task to the current Job * * @param Specification A structure describing the new Task * * @return Int32 Error code (< 0 is an error) */ public virtual Int32 AddTask(FTaskSpecification Specification) { StartTiming("AddTask-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { if (ConnectionConfiguration.AgentJobGuid != null) { // Convert the parameters from native to managed AgentGuid TaskGuid = new AgentGuid(Specification.TaskGuid.A, Specification.TaskGuid.B, Specification.TaskGuid.C, Specification.TaskGuid.D); String Parameters = Specification.Parameters; List Dependencies = null; if (Specification.DependencyCount > 0) { Dependencies = new List(); for (UInt32 i = 0; i < Specification.DependencyCount; i++) { Dependencies.Add(Specification.Dependencies[i]); } } AgentTaskSpecification NewSpecification = new AgentTaskSpecification(ConnectionConfiguration.AgentJobGuid, TaskGuid, (Int32)Specification.Flags, Parameters, (Int32)Specification.Cost, Dependencies); // Ensure all the files are in the cache with the right cache compatible name ReturnValue = CacheAllFiles(NewSpecification); if (ReturnValue >= 0) { // Queue up all tasks until the specification is complete and submit them all at once PendingTasks.Add(NewSpecification); } } else { ReturnValue = Constants.ERROR_JOB_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Ends the Job specification, after which no additional Tasks may be defined. Also, * this is generally the point when the Agent will validate and launch the Job executable, * potentially distributing the Job to other Agents. * * @return Int32 Error code (< 0 is an error) */ public virtual Int32 EndJobSpecification() { StartTiming("EndJobSpecification-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { if (ConnectionConfiguration.AgentJobGuid != null) { StartTiming("EndJobSpecification-Remote", false); try { // Add all queued up and pending tasks now, all at once ReturnValue = Connection.AddTask(ConnectionHandle, PendingTasks); if( ReturnValue >= 0 ) { // Finally, end the specification ReturnValue = Connection.EndJobSpecification(ConnectionHandle); } } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:EndJobSpecification] Error: " + Ex.Message + " " + Ex.ToString()); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } PendingTasks = null; StopTiming(); } else { ReturnValue = Constants.ERROR_JOB_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Ends the Job, after which all Job-related API usage (except OpenJob) will be rejected * * @return Int32 Error code (< 0 is an error) */ public virtual Int32 CloseJob() { StartTiming("CloseJob-Managed", true); Int32 ReturnValue = Constants.INVALID; if (Connection != null) { if (ConnectionConfiguration.AgentJobGuid != null) { StartTiming("CloseJob-Remote", false); try { ReturnValue = Connection.CloseJob(ConnectionHandle); } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CloseJob] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } StopTiming(); // Reset the active Job Guid value try { ConnectionConfiguration.AgentJobGuid = null; } catch (Exception) { // The ConnectionConfiguration can be set to null // asynchronously, so we'll need to try/catch here } } else { ReturnValue = Constants.ERROR_JOB_NOT_FOUND; } } else { ReturnValue = Constants.ERROR_CONNECTION_NOT_FOUND; } StopTiming(); return ReturnValue; } /** * Adds a line of text to the Agent log window * * @param Verbosity the importance of this message * @param TextColour the colour of the text * @param Message the line of text to add */ public virtual Int32 Log(EVerbosityLevel Verbosity, ELogColour TextColour, String Message) { try { Connection.Log(Verbosity, TextColour, Message); } catch (Exception) { } return Constants.SUCCESS; } /** * The function for the message queue monitoring thread used for * calling the callback from the remote Agent */ static void MessageThreadProc(Object ThreadParameters) { MessageThreadData ThreadData = (MessageThreadData)ThreadParameters; IAgentInterfaceWrapper Connection = ThreadData.Connection; try { // Because the way we use the GetMessage call is blocking, if we ever break out, quit AgentMessage ManagedMessage = null; while (Connection.GetMessage(ThreadData.ConnectionHandle, out ManagedMessage, -1) >= 0) { // TODO: As we add additional versions, convert to a switch rather than if-else. // For now, just use a simple if since we only have one version and a switch is // overkill. if (ManagedMessage.Version == ESwarmVersionValue.VER_1_0) { IntPtr NativeMessage = IntPtr.Zero; String PinnedStringData = null; switch (ManagedMessage.Type) { case EMessageType.JOB_STATE: { AgentJobState JobStateMessage = (AgentJobState)ManagedMessage; FGuid JobGuid = new FGuid(JobStateMessage.JobGuid.A, JobStateMessage.JobGuid.B, JobStateMessage.JobGuid.C, JobStateMessage.JobGuid.D); FJobState NativeJobStateMessage = new FJobState(JobGuid, (EJobTaskState)JobStateMessage.JobState); NativeJobStateMessage.JobExitCode = JobStateMessage.JobExitCode; NativeJobStateMessage.JobRunningTime = JobStateMessage.JobRunningTime; // If there is a message, be sure to pin and pass it on if (JobStateMessage.JobMessage != null) { Char[] RawJobMessageData = JobStateMessage.JobMessage.ToCharArray(); if (RawJobMessageData.Length > 0) { // Pin the string data for the message PinnedStringData = new String(RawJobMessageData); NativeJobStateMessage.JobMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData); } } NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FJobState))); Marshal.StructureToPtr(NativeJobStateMessage, NativeMessage, false); } break; case EMessageType.TASK_REQUEST: // Swallow this message, since it should not be sent along to a local connection // since all Job and Task information is contained within the Agent itself break; case EMessageType.TASK_REQUEST_RESPONSE: { AgentTaskRequestResponse TaskRequestResponseMessage = (AgentTaskRequestResponse)ManagedMessage; // Switch again on the response type ETaskRequestResponseType ResponseType = (ETaskRequestResponseType)TaskRequestResponseMessage.ResponseType; switch (ResponseType) { case ETaskRequestResponseType.RELEASE: case ETaskRequestResponseType.RESERVATION: { NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskRequestResponse))); Marshal.StructureToPtr(new FTaskRequestResponse((ETaskRequestResponseType)ResponseType), NativeMessage, false); } break; case ETaskRequestResponseType.SPECIFICATION: { AgentTaskSpecification TaskSpecificationMessage = (AgentTaskSpecification)TaskRequestResponseMessage; FGuid TaskGuid = new FGuid(TaskSpecificationMessage.TaskGuid.A, TaskSpecificationMessage.TaskGuid.B, TaskSpecificationMessage.TaskGuid.C, TaskSpecificationMessage.TaskGuid.D); EJobTaskFlags TaskFlags = (EJobTaskFlags)TaskSpecificationMessage.TaskFlags; Char[] RawParametersData = TaskSpecificationMessage.Parameters.ToCharArray(); if (RawParametersData.Length > 0) { // Pin the string data for the message PinnedStringData = new String(RawParametersData); } FTaskSpecificationMarshalHelper MarshalHelper = new FTaskSpecificationMarshalHelper(); MarshalHelper.TaskGuid = TaskGuid; MarshalHelper.Parameters = FStringMarshaler.MarshalManagedToNative(PinnedStringData); MarshalHelper.Flags = TaskFlags; MarshalHelper.Cost = 0; MarshalHelper.DependencyCount = 0; MarshalHelper.Dependencies = IntPtr.Zero; NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskSpecificationMarshalHelper))); Marshal.StructureToPtr(MarshalHelper, NativeMessage, false); } break; } } break; case EMessageType.TASK_STATE: { AgentTaskState TaskStateMessage = (AgentTaskState)ManagedMessage; // TODO: Assert that we have a valid Job GUID, since this must be the Instigator // TODO: Assert that the Job GUID of the message matches the ConnectionConfiguration.AgentJobGuid FGuid TaskGuid = new FGuid(TaskStateMessage.TaskGuid.A, TaskStateMessage.TaskGuid.B, TaskStateMessage.TaskGuid.C, TaskStateMessage.TaskGuid.D); FTaskState NativeTaskStateMessage = new FTaskState(TaskGuid, (EJobTaskState)TaskStateMessage.TaskState); // If there is a message, be sure to pin and pass it if (TaskStateMessage.TaskMessage != null) { Char[] RawTaskMessageData = TaskStateMessage.TaskMessage.ToCharArray(); if (RawTaskMessageData.Length > 0) { // Pin the string data for the message PinnedStringData = new String(RawTaskMessageData); NativeTaskStateMessage.TaskMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData); } } NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FTaskState))); Marshal.StructureToPtr(NativeTaskStateMessage, NativeMessage, false); } break; case EMessageType.INFO: { // Create the managed version of the info message AgentInfoMessage ManagedInfoMessage = (AgentInfoMessage)ManagedMessage; FInfoMessage NativeInfoMessage = new FInfoMessage(""); if (ManagedInfoMessage.TextMessage != null) { Char[] RawTaskMessageData = ManagedInfoMessage.TextMessage.ToCharArray(); if (RawTaskMessageData.Length > 0) { // Pin the string data for the message PinnedStringData = new String(RawTaskMessageData); NativeInfoMessage.TextMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData); } } NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FInfoMessage))); Marshal.StructureToPtr(NativeInfoMessage, NativeMessage, false); } break; case EMessageType.ALERT: { // Create the managed version of the info message AgentAlertMessage ManagedAlertMessage = (AgentAlertMessage)ManagedMessage; FGuid JobGuid = new FGuid(ManagedAlertMessage.JobGuid.A, ManagedAlertMessage.JobGuid.B, ManagedAlertMessage.JobGuid.C, ManagedAlertMessage.JobGuid.D); FGuid ObjectGuid = new FGuid(ManagedAlertMessage.ObjectGuid.A, ManagedAlertMessage.ObjectGuid.B, ManagedAlertMessage.ObjectGuid.C, ManagedAlertMessage.ObjectGuid.D); FAlertMessage NativeAlertMessage = new FAlertMessage( JobGuid, ManagedAlertMessage.AlertLevel, ObjectGuid, ManagedAlertMessage.TypeId); if (ManagedAlertMessage.TextMessage != null) { Char[] RawTaskMessageData = ManagedAlertMessage.TextMessage.ToCharArray(); if (RawTaskMessageData.Length > 0) { // Pin the string data for the message PinnedStringData = new String(RawTaskMessageData); NativeAlertMessage.TextMessage = FStringMarshaler.MarshalManagedToNative(PinnedStringData); } } NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FAlertMessage))); Marshal.StructureToPtr(NativeAlertMessage, NativeMessage, false); } break; default: // By default, just pass the message version and type through, but // any additional payload of a specialized type will be lost NativeMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FMessage))); Marshal.StructureToPtr(new FMessage(ESwarmVersionValue.VER_1_0, (EMessageType)ManagedMessage.Type), NativeMessage, false); break; } // If a message was created to pass on to the user's callback, send it on if (NativeMessage != IntPtr.Zero) { // Call the user's callback function ThreadData.ConnectionCallback(NativeMessage, ThreadData.ConnectionCallbackData); // All finished with the message, free and set to null NativeMessage = IntPtr.Zero; } if (ManagedMessage.Type == EMessageType.QUIT) { // Return from this function, which will exit this message processing thread DebugLog.Write("Message queue thread shutting down from a QUIT message"); return; } } // Reset the message handle ManagedMessage = null; } } catch (ThreadAbortException) { // An expected exception when closing the connection DebugLog.Write("Message queue thread shutting down normally after being closed by CloseConnection"); } catch (Exception Ex) { DebugLog.Write("Error: Exception in the message queue thread: " + Ex.Message); // If the connection has thrown us an exception, close the connection DebugLog.Write("MessageThreadProc calling CleanupClosedConnection"); ThreadData.Owner.CleanupClosedConnection(); } // Only write out in debug DebugLog.Write("Message queue thread shutting down normally"); } /** * The function for the agent monitoring thread used to watch * for potential crashed or hung agents */ static void MonitorThreadProc(Object ThreadParameters) { MessageThreadData ThreadData = (MessageThreadData)ThreadParameters; AgentConfiguration ConnectionConfiguration = ThreadData.ConnectionConfiguration; IAgentInterfaceWrapper Connection = ThreadData.Connection; bool NeedToCleanupClosedConnection = false; try { if (Connection != null) { // We'll just monitor the process itself to see if it exits Int32 ConnectionProcessID = ConnectionConfiguration.AgentProcessID; Process AgentProcess = Process.GetProcessById(ConnectionProcessID); if (AgentProcess != null) { // As long as the process is still running, yield bool KeepRunning = true; while (KeepRunning && !KillMonitorThread) { // Sleep for a little bit at the beginning of each iteration Thread.Sleep(1000); if (AgentProcess.HasExited == true) { // If the Agent process has exited, game over NeedToCleanupClosedConnection = true; KeepRunning = false; } } KillMonitorThread = false; } } } catch (ThreadAbortException) { // An expected exception when closing the connection DebugLog.Write("Agent monitor thread shutting down normally after being closed by CloseConnection"); } catch (Exception Ex) { DebugLog.Write("Exception in the agent monitor thread: " + Ex.Message); // If the connection has thrown us an exception, close the connection NeedToCleanupClosedConnection = true; } // If needed, clean up the connection if (NeedToCleanupClosedConnection) { DebugLog.Write("MonitorThreadProc calling CleanupClosedConnection"); ThreadData.Owner.CleanupClosedConnection(); } DebugLog.Write("Agent monitor thread shutting down normally"); } /* * Start a timer going */ void StartTiming(String Name, bool Accum, Int64 Adder) { if (PerfTimerInstance != null) { PerfTimerInstance.Start(Name, Accum, Adder); } } void StartTiming(String Name, bool Accum) { StartTiming(Name, Accum, 0); } /* * Stop a timer */ void StopTiming() { if (PerfTimerInstance != null) { PerfTimerInstance.Stop(); } } /* * Print out all the timing info */ void DumpTimings() { if (PerfTimerInstance != null) { String PerfMessage = PerfTimerInstance.DumpTimings(); IntPtr PerfMessagePtr = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FInfoMessage))); Marshal.StructureToPtr(new FInfoMessage(PerfMessage), PerfMessagePtr, true); SendMessage(PerfMessagePtr); PerfTimerInstance = null; } } /* * Clean up all of the remainders from a closed connection, including the network channels, etc. */ Int32 CleanupClosedConnection() { Monitor.Enter(CleanupClosedConnectionLock); // NOTE: Do not make any calls to the real Connection in here! // If, for any reason, the connection has died, calling into it from here will // end up causing this thread to hang, waiting for the dead connection to respond. DebugLog.Write("[Interface:CleanupClosedConnection] Closing all connections to the Agent"); // Reset all necessary assigned variables AgentProcess = null; AgentProcessOwner = false; if (Connection != null) { // Notify the connection wrapper that the connection is gone Connection.SignalConnectionDropped(); Connection = null; } ConnectionHandle = Constants.INVALID; ConnectionConfiguration = null; // Clean up and close up the connection callback if (ConnectionCallback != null) { IntPtr QuitMessage = Marshal.AllocHGlobal(Marshal.SizeOf(typeof(FMessage))); Marshal.StructureToPtr(new FMessage(ESwarmVersionValue.VER_1_0, EMessageType.QUIT), QuitMessage, false); ConnectionCallback(QuitMessage, ConnectionCallbackData); } ConnectionCallback = null; ConnectionCallbackData = IntPtr.Zero; // Close all associated channels if (OpenChannels.Count > 0) { foreach (ChannelInfo NextChannel in OpenChannels.Values) { // Just close the handle and we'll clear the entire list later if (NextChannel.ChannelFileStream != null) { NextChannel.ChannelFileStream.Close(); NextChannel.ChannelFileStream = null; } } OpenChannels.Clear(); } // Unregister the primary network communication channel if (NetworkChannel != null) { ChannelServices.UnregisterChannel(NetworkChannel); NetworkChannel = null; } Monitor.Exit(CleanupClosedConnectionLock); return Constants.SUCCESS; } /** All agent/swarm-specific variables */ Process AgentProcess; bool AgentProcessOwner; /** All connection-specific variables */ IAgentInterfaceWrapper Connection; Int32 ConnectionHandle; Thread ConnectionMessageThread; Thread ConnectionMonitorThread; FConnectionCallback ConnectionCallback; IntPtr ConnectionCallbackData; ELogFlags ConnectionLoggingFlags; AgentConfiguration ConnectionConfiguration; Object CleanupClosedConnectionLock; /** A convenience class for packing a few managed types together */ class ChannelInfo { public String ChannelName; public EChannelFlags ChannelFlags; public Int32 ChannelHandle; public Stream ChannelFileStream; // For buffered reads and writes public byte[] ChannelData; public Int32 ChannelOffset; }; ReaderWriterDictionary OpenChannels; Stack FreeChannelWriteBuffers; Int32 BaseChannelHandle; /** While a job is being specified, collect the task specifications until it's done, then submit all at once */ List PendingTasks; /** A pair of locations needed for using channels */ String AgentCacheFolder; /** The network channel used to communicate with the Agent */ TcpClientChannel NetworkChannel; /** A helper class for timing info */ PerfTimer PerfTimerInstance; Int32 TryOpenConnection(FConnectionCallback CallbackFunc, IntPtr CallbackData, ELogFlags LoggingFlags) { try { // Allocate our new connection wrapper object Connection = new IAgentInterfaceWrapper(); // Make sure the agent is alive and responsive before continuing DebugLog.Write("[TryOpenConnection] Testing the Agent"); Hashtable InParameters = null; Hashtable OutParameters = null; bool AgentIsReady = false; while (!AgentIsReady) { try { // Simply try to call the method and if it doesn't throw // an exception, consider it a success Connection.Method(0, InParameters, ref OutParameters); AgentIsReady = true; } catch (Exception ex) { // Wait a little longer DebugLog.Write("[TryOpenConnection] Waiting for the agent to start up ..."); DebugLog.Write(ex.ToString()); Thread.Sleep(5000); } } // Request an official connection to the Agent DebugLog.Write("[TryOpenConnection] Opening Connection to Agent"); DebugLog.Write("[TryOpenConnection] Local Process ID is " + Process.GetCurrentProcess().Id.ToString()); StartTiming("OpenConnection-Remote", false); ConnectionHandle = Connection.OpenConnection(AgentProcess, AgentProcessOwner, Process.GetCurrentProcess().Id, LoggingFlags, out ConnectionConfiguration); StopTiming(); if (ConnectionHandle >= 0) { Log(EVerbosityLevel.Informative, ELogColour.Green, "[Interface:TryOpenConnection] Local connection established"); // Spawn a thread to monitor the message queue MessageThreadData ThreadData = new MessageThreadData(); ThreadData.Owner = this; ThreadData.Connection = Connection; ThreadData.ConnectionHandle = ConnectionHandle; ThreadData.ConnectionCallback = CallbackFunc; ThreadData.ConnectionCallbackData = CallbackData; ThreadData.ConnectionConfiguration = ConnectionConfiguration; // Launch the message queue thread ConnectionMessageThread = new Thread(new ParameterizedThreadStart(MessageThreadProc)); ConnectionMessageThread.Name = "ConnectionMessageThread"; ConnectionMessageThread.Start( ThreadData ); // Launch the agent monitor thread ConnectionMonitorThread = new Thread(new ParameterizedThreadStart(MonitorThreadProc)); ConnectionMonitorThread.Name = "ConnectionMonitorThread"; ConnectionMonitorThread.Start(ThreadData); // Save the user's callback routine ConnectionCallback = CallbackFunc; ConnectionCallbackData = CallbackData; ConnectionLoggingFlags = LoggingFlags; } } catch (Exception Ex) { DebugLog.Write("[TryOpenConnection] Error: " + Ex.Message); ConnectionHandle = Constants.INVALID; Connection = null; } return ConnectionHandle; } void EnsureAgentIsRunning(string OptionsFolder) { // See if an agent is already running, and if not, launch one AgentProcess = null; AgentProcessOwner = false; #if !__MonoCS__ Process[] RunningSwarmAgents = Process.GetProcessesByName("SwarmAgent"); if (RunningSwarmAgents.Length > 0) { // If any are running, just grab the first one AgentProcess = RunningSwarmAgents[0]; } #else Process[] RunningSwarmAgents = Process.GetProcessesByName("mono"); if (RunningSwarmAgents.Length == 0) { RunningSwarmAgents = Process.GetProcessesByName("mono-sgen"); } foreach (Process Iter in RunningSwarmAgents) { foreach(ProcessModule m in Iter.Modules) { if(m.ModuleName.Contains("SwarmAgent")) { AgentProcess = Iter; break; } } if(AgentProcess != null) break; } if (RunningSwarmAgents.Length > 0) { // If any are running, just grab the first one AgentProcess = RunningSwarmAgents[0]; } #endif if (AgentProcess == null) { String StartupPath = Path.GetDirectoryName(Assembly.GetExecutingAssembly().Location); #if !__MonoCS__ StartupPath += "/../DotNET/SwarmAgent.exe"; #else StartupPath += "/../Mac/SwarmAgent.exe"; #endif // If none, launch the Agent binary DebugLog.Write("[OpenConnection] Spawning agent: " + StartupPath); if (File.Exists(StartupPath)) { String Arguments = "IAmSwarmAgent"; if ( OptionsFolder.Length > 0 ) { Arguments += " -OptionsFolder=\"" + OptionsFolder + "\""; } AgentProcess = Process.Start(StartupPath, Arguments); if (AgentProcess == null) { DebugLog.Write("[OpenConnection] Failed to start the Agent executable: " + StartupPath); } else { // If we started the process, we own it and control its lifetime AgentProcessOwner = true; } } else { DebugLog.Write("[OpenConnection] Failed to find the Agent executable: " + StartupPath); } } } /** * Converts an native job specification to a managed version. * * @param Specification Native job specification (may be empty) * @param bIs64bit Whether the job specification is 64-bit or not * @return Newly created managed job specification, or null if the specification was empty */ AgentJobSpecification ConvertJobSpecification(ref FJobSpecification Specification, bool bIs64bit) { if (Specification.ExecutableName == null) { return null; } else { // Convert the parameters from native to managed String ExecutableName = Specification.ExecutableName; String Parameters = Specification.Parameters; EJobTaskFlags Flags = (EJobTaskFlags)((Specification.Flags & ~EJobTaskFlags.FLAG_64BIT) | (bIs64bit ? EJobTaskFlags.FLAG_64BIT : 0)); List RequiredDependencies = null; if (Specification.RequiredDependencyCount > 0) { RequiredDependencies = new List(); for (UInt32 i = 0; i < Specification.RequiredDependencyCount; i++) { RequiredDependencies.Add(Specification.RequiredDependencies[i]); } } List OptionalDependencies = null; if (Specification.OptionalDependencyCount > 0) { OptionalDependencies = new List(); for (UInt32 i = 0; i < Specification.OptionalDependencyCount; i++) { OptionalDependencies.Add(Specification.OptionalDependencies[i]); } } return new AgentJobSpecification(ConnectionConfiguration.AgentJobGuid, (EJobTaskFlags)Flags, ExecutableName, Parameters, RequiredDependencies, OptionalDependencies); } } /* * Generates the full channel name, including Job path and staging area path if necessary */ String GenerateFullChannelName(String ManagedChannelName, EChannelFlags ChannelFlags) { if ((ChannelFlags & EChannelFlags.TYPE_PERSISTENT) != 0) { if ((ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0) { // A persistent cache channel open for writing opens in the staging area String StagingAreaName = Path.Combine(AgentCacheFolder, "AgentStagingArea"); return Path.Combine(StagingAreaName, ManagedChannelName); } else if ((ChannelFlags & EChannelFlags.ACCESS_READ) != 0) { // A persistent cache channel open for reading opens directly in the cache return Path.Combine(AgentCacheFolder, ManagedChannelName); } } else if ((ChannelFlags & EChannelFlags.TYPE_JOB_ONLY) != 0) { AgentGuid JobGuid = ConnectionConfiguration.AgentJobGuid; if (JobGuid == null) { // If there's no Job associated with this connection at this point, provide // a default GUID for one for debugging access to the agent cache JobGuid = new AgentGuid(0x00000123, 0x00004567, 0x000089ab, 0x0000cdef); } // A Job Channel opens directly in the Job-specific directory String JobsFolder = Path.Combine(AgentCacheFolder, "Jobs"); String JobFolderName = Path.Combine(JobsFolder, "Job-" + JobGuid.ToString()); return Path.Combine(JobFolderName, ManagedChannelName); } return ""; } /* * CacheFileAndConvertName * * Checks to see if the file with the correct timestamp and size exists in the cache * If it does not, add it to the cache */ Int32 CacheFileAndConvertName(String FullPathName, out String CachedFileName, bool bUse64bitNamingConvention) { Int32 ReturnValue = Constants.INVALID; CachedFileName = ""; // First, check that the original file exists if (File.Exists(FullPathName)) { // The full cache name is based on the file name, the last modified timestamp on the file, and the file size FileInfo FullPathFileInfo = new FileInfo(FullPathName); // The last modified timestamp String LastModifiedTimeUTCString = FullPathFileInfo.LastWriteTimeUtc.ToString("yyyy-MM-dd_HH-mm-ss"); // The file size, which we get by opening the file String FileSizeInBytesString = FullPathFileInfo.Length.ToString(); String Suffix64bit = bUse64bitNamingConvention ? "-64bit" : ""; // Compose the full cache name CachedFileName = String.Format("{0}_{1}_{2}{3}{4}", Path.GetFileNameWithoutExtension(FullPathName), LastModifiedTimeUTCString, FileSizeInBytesString, Suffix64bit, FullPathFileInfo.Extension); // Test the cache with the cached file name if (Connection.TestChannel(ConnectionHandle, CachedFileName) < 0) { // If not already in the cache, attempt to add it now ReturnValue = Connection.AddChannel(ConnectionHandle, FullPathName, CachedFileName); } else { ReturnValue = Constants.SUCCESS; } } else { ReturnValue = Constants.ERROR_FILE_FOUND_NOT; } // Didn't find the file, return failure return ReturnValue; } /* * CacheAllFiles * * Ensures all executables and dependencies are correctly placed in the cache */ Int32 CacheAllFiles(AgentJobSpecification JobSpecification) { Int32 ReturnValue = Constants.INVALID; try { // Allocate the dictionary we'll use for the name mapping Dictionary DependenciesOriginalNames = new Dictionary(); bool bUse64bitNamingConvention = (JobSpecification.JobFlags & EJobTaskFlags.FLAG_64BIT) != 0; // Check for and possibly cache the executable String OriginalExecutableFullPath = Path.GetFullPath(JobSpecification.ExecutableName); String CachedExecutableName; ReturnValue = CacheFileAndConvertName(OriginalExecutableFullPath, out CachedExecutableName, bUse64bitNamingConvention); if (ReturnValue < 0) { // Failed to cache the executable, return failure Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the executable: " + OriginalExecutableFullPath); return ReturnValue; } JobSpecification.ExecutableName = CachedExecutableName; String OriginalExecutableName = Path.GetFileName(OriginalExecutableFullPath); DependenciesOriginalNames.Add(CachedExecutableName, OriginalExecutableName); // Check and cache all the required dependencies if ((JobSpecification.RequiredDependencies != null) && (JobSpecification.RequiredDependencies.Count > 0)) { for (Int32 i = 0; i < JobSpecification.RequiredDependencies.Count; i++) { String OriginalDependencyFullPath = Path.GetFullPath(JobSpecification.RequiredDependencies[i]); String CachedDependencyName; ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, bUse64bitNamingConvention); if (ReturnValue < 0) { // Failed to cache the dependency, return failure Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the required dependency: " + OriginalDependencyFullPath); return ReturnValue; } JobSpecification.RequiredDependencies[i] = CachedDependencyName; String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath); DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName); } } // Check and cache any optional dependencies if ((JobSpecification.OptionalDependencies != null) && (JobSpecification.OptionalDependencies.Count > 0)) { for (Int32 i = 0; i < JobSpecification.OptionalDependencies.Count; i++) { String OriginalDependencyFullPath = JobSpecification.OptionalDependencies[i]; String CachedDependencyName; ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, bUse64bitNamingConvention); if (ReturnValue < 0) { // Failed to cache the dependency, log a warning Log(EVerbosityLevel.Verbose, ELogColour.Orange, "[Interface:CacheAllFiles] Failed to cache an optional dependency: " + OriginalDependencyFullPath); } else { JobSpecification.OptionalDependencies[i] = CachedDependencyName; String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath); DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName); } } } // Set the newly created name mapping dictionary JobSpecification.DependenciesOriginalNames = DependenciesOriginalNames; ReturnValue = Constants.SUCCESS; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } return ReturnValue; } Int32 CacheAllFiles(AgentTaskSpecification TaskSpecification) { Int32 ReturnValue = Constants.INVALID; try { TaskSpecification.DependenciesOriginalNames = null; if ((TaskSpecification.Dependencies != null) && (TaskSpecification.Dependencies.Count > 0)) { // Allocate the dictionary we'll use for the name mapping Dictionary DependenciesOriginalNames = new Dictionary(); // Check and cache all the dependencies for (Int32 i = 0; i < TaskSpecification.Dependencies.Count; i++) { String OriginalDependencyFullPath = TaskSpecification.Dependencies[i]; String CachedDependencyName; ReturnValue = CacheFileAndConvertName(OriginalDependencyFullPath, out CachedDependencyName, false); if (ReturnValue < 0) { // Failed to cache the dependency, return failure Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Failed to cache the dependency: " + OriginalDependencyFullPath); return ReturnValue; } TaskSpecification.Dependencies[i] = CachedDependencyName; String OriginalDependencyName = Path.GetFileName(OriginalDependencyFullPath); DependenciesOriginalNames.Add(CachedDependencyName, OriginalDependencyName); } // Set the newly created name mapping dictionary TaskSpecification.DependenciesOriginalNames = DependenciesOriginalNames; } ReturnValue = Constants.SUCCESS; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:CacheAllFiles] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CONNECTION_DISCONNECTED; CleanupClosedConnection(); } return ReturnValue; } /* * Flushes any buffered writes to the channel */ Int32 FlushChannel(ChannelInfo ChannelToFlush) { Int32 ReturnValue = Constants.INVALID; if ((ChannelToFlush.ChannelFlags & EChannelFlags.ACCESS_WRITE) != 0 && (ChannelToFlush.ChannelOffset > 0) && (ChannelToFlush.ChannelData != null) && (ChannelToFlush.ChannelFileStream != null)) { try { ChannelToFlush.ChannelFileStream.Write(ChannelToFlush.ChannelData, 0, ChannelToFlush.ChannelOffset); ReturnValue = ChannelToFlush.ChannelOffset; } catch (Exception Ex) { Log(EVerbosityLevel.Critical, ELogColour.Red, "[Interface:FlushChannel] Error: " + Ex.Message); ReturnValue = Constants.ERROR_CHANNEL_IO_FAILED; } ChannelToFlush.ChannelOffset = 0; } return ReturnValue; } } }